! function (t) {
    function e(i) {
        if (n[i]) return n[i].exports;
        var o = n[i] = {
            i: i,
            l: false,
            exports: {}
        };
        return t[i].call(o.exports, o, o.exports, e), o.l = true, o.exports
    }
    var n = {};
    return e.m = t, e.c = n, e.d = function (t, n, getter) {
        if (!e.o(t, n)) Object.defineProperty(t, n, {
            configurable: false,
            enumerable: true,
            get: getter
        })
    }, e.n = function (t) {
        var getter = t && t.__esModule ? function e() {
            return t["default"]
        } : function e() {
            return t
        };
        return e.d(getter, "a", getter), getter
    }, e.o = function (t, e) {
        return Object.prototype.hasOwnProperty.call(t, e)
    }, e.p = "/Content/BundledScripts/", e(e.s = 12036)
}({
    112: function (t, e, n) {
        "use strict";

        function i() {
            throw new Error("setTimeout has not been defined")
        }

        function o() {
            throw new Error("clearTimeout has not been defined")
        }

        function a(t) {
            if (p === setTimeout) return setTimeout(t, 0);
            if ((p === i || !p) && setTimeout) return p = setTimeout, setTimeout(t, 0);
            try {
                return p(t, 0)
            } catch (e) {
                try {
                    return p.call(null, t, 0)
                } catch (e) {
                    return p.call(this, t, 0)
                }
            }
        }

        function s(t) {
            if (m === clearTimeout) return clearTimeout(t);
            if ((m === o || !m) && clearTimeout) return m = clearTimeout, clearTimeout(t);
            try {
                return m(t)
            } catch (e) {
                try {
                    return m.call(null, t)
                } catch (e) {
                    return m.call(this, t)
                }
            }
        }

        function u() {
            if (v && y) {
                if (v = false, y.length) g = y.concat(g);
                else w = -1;
                if (g.length) l()
            }
        }

        function l() {
            if (!v) {
                var t = a(u);
                v = true;
                for (var e = g.length; e;) {
                    for (y = g, g = []; ++w < e;)
                        if (y) y[w].run();
                    w = -1, e = g.length
                }
                y = null, v = false, s(t)
            }
        }

        function c(t, e) {
            this.fun = t, this.array = e
        }

        function f() {}
        var h = t.exports = {},
            p, m;
        ! function () {
            try {
                if ("function" == typeof setTimeout) p = setTimeout;
                else p = i
            } catch (t) {
                p = i
            }
            try {
                if ("function" == typeof clearTimeout) m = clearTimeout;
                else m = o
            } catch (t) {
                m = o
            }
        }();
        var g = [],
            v = false,
            y, w = -1;
        h.nextTick = function (t) {
            var e = new Array(arguments.length - 1);
            if (arguments.length > 1)
                for (var n = 1; n < arguments.length; n++) e[n - 1] = arguments[n];
            if (g.push(new c(t, e)), 1 === g.length && !v) a(l)
        }, c.prototype.run = function () {
            this.fun.apply(null, this.array)
        }, h.title = "browser", h.browser = true, h.env = {}, h.argv = [], h.version = "", h.versions = {}, h.on = f, h.addListener = f, h.once = f, h.off = f, h.removeListener = f, h.removeAllListeners = f, h.emit = f, h.prependListener = f, h.prependOnceListener = f, h.listeners = function (t) {
            return []
        }, h.binding = function (t) {
            throw new Error("process.binding is not supported")
        }, h.cwd = function () {
            return "/"
        }, h.chdir = function (t) {
            throw new Error("process.chdir is not supported")
        }, h.umask = function () {
            return 0
        }
    },
    12036: function (t, e, n) {
        "use strict";
        n(12037), n(12125)
    },
    12037: function (t, e, n) {
        "use strict";
        n(12038)
    },
    12038: function (t, e, n) {
        "use strict";
        n(12039), n(12040), n(507), n(12041), n(12042), n(12044), n(12045), n(12046), n(12047), n(903), n(921), n(12048), n(12056), n(12057), n(12059), n(12061), n(12062), n(12063), n(12064), n(282), n(12065), n(12073), n(12074), n(12076), n(12077), n(12079), n(12083), n(12084), n(12086), n(12087), n(12088), n(12089), n(943), n(12090), n(12091), n(12092), n(12093), n(12094), n(12095), n(12096), n(12098), n(12099), n(12102), n(12103), n(12104), n(12106), n(12108), n(12109), n(12118), n(12119), n(12120)
    },
    12039: function (t, e, n) {
        "use strict";

        function i() {
            if (window && document && "complete" !== document.readyState) {
                var t = document.body;
                if (t && t.classList && "function" == typeof t.classList.add && "function" == typeof t.classList.remove && "function" == typeof t.appendChild && "function" == typeof document.createElement && "function" == typeof window.addEventListener) {
                    var e = "u-disable-duration";
                    t.classList.add(e);
                    var styleNode = document.createElement("style");
                    styleNode.innerHTML = ".u-disable-duration * {transition-duration: 0s !important;}", t.appendChild(styleNode), window.addEventListener("load", (function () {
                        t.classList.remove(e)
                    }))
                }
            }
        }
        i()
    },
    12040: function (t, e, n) {
        "use strict";
        if (!("CSS" in window)) window.CSS = {};
        if (!("supports" in window.CSS)) "use strict", window.CSS._cacheSupports = {}, window.CSS.supports = function (t, e) {
            function n(t, e) {
                var style = document.createElement("div").style;
                if (void 0 === e) {
                    var n = function (t, e) {
                            var n = t.split(e);
                            if (n.length > 1) return n.map((function (t, index, e) {
                                return index % 2 == 0 ? t + e[index + 1] : ""
                            })).filter(Boolean)
                        },
                        i = n(t, /([)])\s*or\s*([(])/gi);
                    if (i) return i.some((function (t) {
                        return window.CSS.supports(t)
                    }));
                    var o = n(t, /([)])\s*and\s*([(])/gi);
                    if (o) return o.every((function (t) {
                        return window.CSS.supports(t)
                    }));
                    style.cssText = t.replace("(", "").replace(/[)]$/, "")
                } else style.cssText = t + ":" + e;
                return !!style.length
            }
            var i = [t, e].toString();
            if (i in window.CSS._cacheSupports) return window.CSS._cacheSupports[i];
            else return window.CSS._cacheSupports[i] = n(t, e)
        }
    },
    12041: function (t, e, n) {
        "use strict";

        function i(t) {
            if (this.prevMode = "", this.resizeTimeout = 50, this.sheet = {
                    XS: 340,
                    SM: 540,
                    MD: 720,
                    LG: 940,
                    XL: 1140,
                    XXL: 1320
                }, this.mediaMax = {
                    XS: 575,
                    SM: 767,
                    MD: 991,
                    LG: 1199
                }, this.modes = ["XL", "LG", "MD", "SM", "XS"], this.defaultMode = "XL", document.body.classList.contains("u-xxl-mode")) this.mediaMax.XXL = 1399, this.defaultMode = "XXL", this.modes.splice(0, 0, "XXL");
            this._handlers = [], this.modes.forEach((function (t) {
                var e = document.body.style.getPropertyValue("--theme-sheet-width-" + t.toLowerCase());
                if (e = parseFloat(e), Number.isFinite(e)) this.sheet[t] = e
            }), this), this.init(t || [])
        }
        var ResponsiveMenu = n(922),
            o = n(15);
        Object.defineProperty(i.prototype, "mode", {
            get: function () {
                var t = (document.documentElement || document.body).clientWidth || window.innerWidth;
                if (this.scrolbar) document.documentElement.setAttribute("style", "overflow-y:hidden"), t = (document.documentElement || document.body).clientWidth || window.innerWidth, document.documentElement.removeAttribute("style");
                for (var e in this.mediaMax)
                    if (this.mediaMax.hasOwnProperty(e))
                        if (t <= this.mediaMax[e]) return e;
                return this.defaultMode
            }
        }), i.prototype.init = function init(t) {
            o(function () {
                this.update(true), this.scrolbar = !!(document.body && document.body.clientWidth !== document.body.scrollWidth)
            }.bind(this)), o(window).on("resize", function () {
                this.update(true)
            }.bind(this)), t.forEach((function (t) {
                this._handlers.push(new t(this))
            }), this);
            var e = new CustomEvent("np.responsive.init", {
                detail: {
                    prevMode: this.prevMode,
                    mode: this.mode
                }
            });
            document.dispatchEvent(e), this.update()
        }, i.prototype.update = function update(t) {
            var e = function () {
                var t = this.mode;
                if (t !== this.prevMode || this.getContentWidth() < this.sheet[t]) {
                    this._handlers.forEach((function (t) {
                        if ("function" == typeof t.onResponsiveBefore) t.onResponsiveBefore()
                    })), this.responsiveClass(o("html")), this._handlers.forEach((function (t) {
                        if ("function" == typeof t.onResponsiveAfter) t.onResponsiveAfter()
                    }));
                    var e = new CustomEvent("np.responsive.changed", {
                        detail: {
                            prevMode: this.prevMode,
                            mode: t
                        }
                    });
                    document.dispatchEvent(e), this.prevMode = t
                }
                this._handlers.forEach((function (t) {
                    if ("function" == typeof t.onResponsiveResize) t.onResponsiveResize()
                }))
            }.bind(this);
            if (t) clearTimeout(this._timeoutId), this._timeoutId = setTimeout(e, this.resizeTimeout);
            else e()
        }, i.prototype.responsiveClass = function t(e) {
            var removeList = Object.keys(this.sheet).map((function (t) {
                return "u-responsive-" + t.toLowerCase()
            })).join(" ");
            e.removeClass(removeList), e.addClass("u-responsive-" + this.mode.toLowerCase())
        }, i.prototype.getContentWidth = function () {
            return o(".u-body section:first").parent().width()
        }, o((function () {
            window._responsive = new i([ResponsiveMenu]), o(document).on("click", "[data-href]:not(.u-back-to-top), [data-post-link]", (function (t) {
                if (!t.isDefaultPrevented()) {
                    var e = o(this),
                        url = e.attr("data-href") || e.attr("data-post-link"),
                        n = e.attr("data-target") || "",
                        i = o(e).parents("body").find("header") && o(e).parents("body").find("header").hasClass("u-sticky"),
                        a = url && (url.startsWith("#") || url.indexOf("#") > -1 && url.indexOf(window.location.href.split("#")[0]) > -1);
                    if (i && a && window._npScrollAnchor) {
                        var s = url.split("#")[1] || "",
                            u = o("#" + s);
                        if (u.length) window._npScrollAnchor.scroll(u)
                    } else if (n) window.open(url, n);
                    else try {
                        window.location.href = url
                    } catch (t) {
                        console.warn("Incorrect url: " + url)
                    }
                }
            }))
        }))
    },
    12042: function (t, e, n) {
        "use strict";

        function i() {
            return {
                submit: function (t) {
                    t.preventDefault();
                    t.stopPropagation();
                    var form = m(this);
                    form.find('input[type="submit"]').prop("disabled", true); // Desabilita do botão de submit
                    var url = form.attr("action");
                    var e = form.attr("source");
                    var n = form.attr("method") || "POST";
                    var i = "";
                    if (h(form), ("email" === e || "customphp" === e) && "true" === form.attr("redirect"))
                        i = form.attr("redirect-url") && !m.isNumeric(form.attr("redirect-url")) ? form.attr("redirect-url") : form.attr("redirect-address");
                    if ("email" === e && !m(form).find('input[name="npspec-referer"]').length) 
                        m(form).append('<input type="hidden" name="npspec-referer" value="' + window.location.href + '">');
                    var o = document.location && document.location.protocol;
                    var u;
                    if (navigator.userAgent && navigator.userAgent.match(/firefox|fxios/i) && "file:" === o) 
                        FormMessage.showError(form, "The page is opened as a file on disk and sending emails is not supported.\n" + "Sending emails works only for pages opened from the domain.");
                    else {
                        var services = form.find('input[name="formServices"]');
                        var l = Const.formActionUrl + "v2/form/process";
                        var c = url === l;

                        let sendFrom = 'contato@ameris.com.br';
                        
                        let nomeContato = form.find("input[name=name]").val();
                        let sendTo = form.find("input[name=email]").val();                        
                        let sendSubject = 'Formulário de Contato : [' + nomeContato + ']';
                        let sendText = 'Corpo de email:' + "\n" + "Mensagem enviada por:" + nomeContato + "\n" + "Email de Contato:" + sendTo;
                        let textArea = form.find("textarea").val();
                        let sendHtml = '<strong>' + textArea + '</strong>';
                        let sendUrl = 'https://lwf715duuc.execute-api.sa-east-1.amazonaws.com/default/ameris_sendmail';

                        var data = JSON.stringify({
                                to: sendFrom,
                                from: sendFrom,
                                subject: sendSubject, 
                                text: sendText, 
                                html: sendHtml
                            });

                        if (services.length) {
                            s(form, {
                                url: sendUrl,
                                method: "POST",
                                redirectAddress: i,                          
                                data: data,
                                showSuccess: c,
                                success: function () {
                                    if (!c) {
                                        a(form, {
                                            url: url,
                                            method: n,
                                            redirectAddress: i
                                        })
                                    }
                                },
                                error: function(xhr, ajaxOptions, thrownError) {
                                    alert("xhr " + xhr.status);
                                    alert("error " + thrownError);
                                }
                            });
                        }
                        else {
                            a(form, {
                                url: url,
                                method: n,
                                redirectAddress: i
                            })
                        }
                    }
                },
                click: function (t) {
                    t.preventDefault();
                    t.stopPropagation();
                    m(this).find(".u-form-send-success").hide();
                    m(this).find(".u-form-send-error").hide();
                    var form = m(this).closest("form");
                    if (o(form), !g.signatureValidation(form)) {
                        return FormMessage.showError(form, "The Signature field is required"), void 0;
                    }
                    if (!c(form)) {
                        return FormMessage.showError(form, "The File field is required"), void 0;
                    }
                    if (!f(form)) {
                        return FormMessage.showError(form, "Unable to submit the contact form. Please accept the cookie consent for the correct recaptcha functioning."), void 0;
                    }
                    else {
                        return g.addSignatureFiles(form), form.find('input[type="submit"]').click(), void 0;
                    }
                }
            }
        }

        function o(form) {
            form.find(".u-form-checkbox-group").each((function () {
                var t = m(this),
                    e = t.find("input"),
                    n = e.length,
                    i = n > 0 ? e[0] : null,
                    o;
                if (e.attr("required") || t.attr("data-required")) {
                    e.removeAttr("required"), t.attr("data-required", "required");
                    for (var a = false, s = 0; s < n; s++)
                        if (e[s].checked) {
                            a = true;
                            break
                        } var u = !a ? "At least one checkbox must be selected." : "";
                    i.setCustomValidity(u)
                }
            }))
        }

        function a(form, t) {
            if (/list-manage[1-9]?.com/i.test(t.url)) return u(form, t.url), void 0;
            s(form, {
                url: t.url,
                method: t.method,
                redirectAddress: t.redirectAddress,
                success: l,
                showSuccess: true
            })
        }

        function s(form, t) {
            var e = function () {
                m.ajax({
                    type: t.method,
                    url: t.url,
                    data: t.data,
                    dataType: "json",   
                    processData: false,
                    contentType: false, 
                })
                .done((function (data, e) {
                    if (data && (data.success || data.ok || "success" === e) || !data && "success" === e) {
                        if (t.showSuccess) {
                            FormMessage.showSuccess(form);
                        }
                        if (t.redirectAddress) {
                            setTimeout((function () {
                                window.location.replace(t.redirectAddress);
                            }), 2e3);
                        }
                        else {
                            t.success(form);
                        }
                    } 
                    else {
                        data = data || {};
                        FormMessage.showError(form, data.error, data.errorId, data.email);
                    }
                }))
                .fail((function (jqXHR, textStatus, errorThrown) {
                    console.log(jqXHR.responseText);
                    console.log('Error occurred: '+ jqXHR.statusText + ' ' + jqXHR.status);
                    
                    FormMessage.showError(form);
                }))
            };
            if (void 0 !== window.recaptchaObject) {
                window.recaptchaObject.executeContact(e);
            }
            else {
                e();
            }
        }

        function u(form, url) {
            var t = form.find("input[name=name]").val(),
                email = form.find("input[name=email]").val(),
                data = {
                    Email: email,
                    EMAIL: email
                };
            if (t) data.Name = t, data.FNAME = t;
            var e = form.find("input, textarea");
            m.each(e, (function (index, t) {
                var e = m(t).attr("name"),
                    n = m(t).val();
                if (e && n) data[e.toUpperCase()] = n
            }));
            var n = (url = url.replace("/post?", "/post-json?") + "&c=?").indexOf("u=") + 2;
            n = url.substring(n, url.indexOf("&", n));
            var i = url.indexOf("id=") + 3;
            i = url.substring(i, url.indexOf("&", i)), data["b_" + n + "_" + i] = "", m.ajax({
                url: url,
                data: data,
                dataType: "jsonp"
            }).done((function (t) {
                var e;
                if ("success" === t.result || /already/.test(t.msg)) FormMessage.showSuccess(form), l(form);
                else FormMessage.showError(form, t.msg)
            })).fail((function () {
                FormMessage.showError(form)
            }))
        }

        function l(form) {
            var dialog = new Dialog(form);
            setTimeout((function () {
                dialog.close()
            }), 2e3)
        }

        function c(form) {
            var t = form.find('input[type="file"][required]');
            if (!t.length) return true;
            else return t.toArray().every((function (input) {
                return input.files.length
            }))
        }

        function f(form) {
            var t = form.hasClass("u-form-custom-backend"),
                e = form.find('input[name="recaptchaResponse"]'),
                n = form.parents("body").find(".u-cookies-consent"),
                i = document.cookie && document.cookie.indexOf("u-gdpr-cookie=true") > -1;
            if (t) return true;
            if (n.length && e.length && !i) return false;
            else return true
        }

        function h(form) {
            var t;
            form.find("input[type=tel]").each((function () {
                var t = m(this),
                    e = t.parents(".iti").find(".iti__selected-flag").attr("title") || "";
                t.val(e + " " + t.val())
            }))
        }

        function p(form) {
            var services;
            if (form.find('input[name="formServices"]').length) {
                var t = Const.formActionUrl + "v2/form/process",
                    e = form.attr("action") === t;
                s(form, {
                    url: t,
                    method: "POST",
                    redirectAddress: "",
                    showSuccess: e,
                    success: function () {}
                })
            }
        }
        var m = n(15),
            Dialog = n(279),
            g = n(12043),
            FormMessage = n(3436),
            Const = n(3437);
        m((function () {
            var form = new i;
            window.serviceRequest = p, m("form.u-form-vertical:not(.u-form-custom-backend), form.u-form-horizontal:not(.u-form-custom-backend)").submit(form.submit), m(".u-form .u-btn-submit").click(form.click)
        })), window.MailChimpForm = i
    },
    12043: function (t, e, n) {
        "use strict";

        function i(t) {
            var e = JSON.parse(t.getAttribute("data-canvas-default-options") || "{}");
            a(t, e)
        }

        function o(t) {
            var e, n = t.clone().get(0),
                i = JSON.parse(n.getAttribute("data-canvas-default-options") || "{}");
            return a(n, i), n.toDataURL()
        }

        function a(t, e) {
            var n = t.getContext("2d");
            n.clearRect(0, 0, e.width, e.height), n.lineWidth = e.lineWidth, n.strokeStyle = e.strokeStyle, n.fillStyle = e.fillStyle, n.fillRect(0, 0, e.width, e.height), n.beginPath(), n.moveTo(e.signatureLine.startX, e.signatureLine.startY), n.lineTo(e.signatureLine.endX, e.signatureLine.endY), n.stroke()
        }

        function s(t, fileName) {
            for (var e = t.split(","), n = e[0].match(/:(.*?);/)[1], i = atob(e[1]), o = i.length, a = new Uint8Array(o); o--;) a[o] = i.charCodeAt(o);
            var s = new Blob([a], {
                type: n
            });
            return new File([s], fileName)
        }
        var u = t.exports = {};
        u.signatureValidation = function t(form) {
            var e = form.find("canvas"),
                n, data;
            if (!e.length) return true;
            if (!e.attr("data-required")) return true;
            else return o(e) !== e.get(0).toDataURL()
        }, u.addSignatureFiles = function t(form) {
            form.find(".u-form-signature canvas").each((function () {
                var t = $(this).get(0),
                    e, n = s(t.toDataURL(), "signature.png"),
                    o = form.find(".u-form-signature-file");
                if (o.length) o.remove();
                var file = $('<input class="u-form-signature-file" style="display:none" type="file" name="file">');
                form.append(file);
                var a = new DataTransfer;
                a.items.add(n), file[0].files = a.files, i(t)
            }))
        }
    },
    12044: function (t, e, n) {
        "use strict";
        var i = n(654).evaluate,
            o = n(655);
        $((function () {
            function t(t) {
                var form;
                $(t && t.target).closest("form").each((function (index, form) {
                    var t = new o(form).getScope();
                    $(form).find("[data-expression]").each((function () {
                        var e = $(this),
                            n = e.closest(".u-form-calc").find(".u-calc-input");
                        try {
                            var o = e.attr("data-expression"),
                                a = i(o, t);
                            e.text(a), n.val(a)
                        } catch (t) {
                            e.text(0), n.val(0)
                        }
                    }))
                }))
            }
            $("body").on("input", "input[type=number][name]", t), $("body").on("change", "input[type=range][name], input[type=radio][name], input[type=checkbox][name], select[name]", t)
        }))
    },
    12045: function (t, e, n) {
        "use strict";

        function i() {
            $(".u-form input[type=file]").change((function () {
                var form = $(this).closest(".u-form");
                l(form), c(form)
            }))
        }

        function o() {
            $(".u-form .u-upload-button").click((function (t) {
                t.stopPropagation(), t.preventDefault(), $(this).closest(".u-form").find('input[type="file"]').click()
            }))
        }

        function a() {
            $(".u-form").on("click", ".u-file-remove", (function (t) {
                t.stopPropagation(), t.preventDefault();
                var e = $(this),
                    form = e.closest(".u-form"),
                    n = e.closest(".u-file-item"),
                    i = parseFloat(n.attr("data-i"));
                if (Number.isFinite(i)) f(form, i), c(form)
            }))
        }

        function s() {
            $(".u-form").on("reset", (function () {
                var form = $(this).closest(".u-form"),
                    input = form.find('input[type="file"]').get(0);
                if (input) input.files = (new DataTransfer).files, c(form)
            }))
        }

        function u() {
            $('.u-form input[type="file"]').each((function () {
                var t = $(this),
                    e = t.attr("accept");
                if (e in FormFileAccept) e = FormFileAccept[e];
                t.attr("accept", e)
            }))
        }

        function l(form) {
            var input = form.find('input[type="file"]').get(0),
                t = [];
            if (input)
                if (Array.from(input.files).forEach((function (file, e) {
                        if (file.size > h || e >= p) t.push({
                            i: e,
                            name: file.name
                        })
                    })), t.length) {
                    f(form, t.map((function (t) {
                        return t.i
                    })));
                    var e = '"{files}" file(s) size exceeds maximum limit.',
                        n = t.map((function (t) {
                            return t.name
                        })).join(", ");
                    FormMessage.showError(form, e.replace(/\{files\}/, n))
                }
        }

        function c(form) {
            form.find(".u-file-list .u-file-item:not(.u-file-template)").remove();
            var input = form.find('input[type="file"]').get(0),
                t = form.find(".u-file-template");
            if (input) Array.from(input.files).forEach((function (file, e) {
                var n = t.clone();
                n.removeClass("u-file-template"), n.find(".u-file-name").text(file.name), n.attr("data-i", e), form.find(".u-file-list").append(n)
            }))
        }

        function f(form, index) {
            var input = form.find('input[type="file"]').get(0),
                t = new DataTransfer;
            if (input) {
                if (!Array.isArray(index)) index = [index];
                Array.from(input.files).forEach((function (file, e) {
                    if (!index.includes(e)) t.items.add(file)
                })), input.files = t.files
            }
        }
        var FormFileAccept = n(659),
            FormMessage = n(3436),
            h = 10 * 1024 * 1024,
            p = 10;
        $((function () {
            i(), o(), a(), s(), u()
        }))
    },
    12046: function (t, e, n) {
        "use strict";

        function i(el) {
            var video;
            el.find(".u-video .embed-responsive-item").each((function () {
                if (this.matches("video")) this.pause();
                else if (this.matches("iframe")) {
                    var t = this.getAttribute("src") || this.getAttribute("data-src");
                    this.setAttribute("src", t.replace(/autoplay=1?/gi, ""))
                }
            }))
        }

        function o(t) {
            var video;
            (t.hasClass("u-video") ? t : t.find(".u-video")).find(".embed-responsive-item[data-autoplay]").each((function () {
                a(s(this).closest(".u-video"))
            }))
        }

        function a(video) {
            if (!video.closest(".u-dialog-block:not(.u-dialog-open)").length) {
                var t = video.find("iframe"),
                    e = t.attr("data-src") || t.attr("src"),
                    n = video.find("video");
                if (e) video.addClass("active"), e += (-1 === e.indexOf("?") ? "?" : "&") + "autoplay=1", t.attr("src", e);
                else if (n.length) {
                    video.addClass("active");
                    var i = n[0];
                    if (i.paused) i.play();
                    else i.pause()
                }
            }
        }
        var s = n(15);
        s(document).on("click", ".u-video-poster, .u-video video", (function (t) {
            var e, video;
            t.preventDefault(), a(s(this).closest(".u-video"))
        })), s((function () {
            s(".u-video-background .u-video-poster, .u-video-background .u-video video").each((function () {
                a(s(this).closest(".u-video"))
            })), s(".u-video .embed-responsive-item:not(.lazyloading, .lazyloaded) + .u-video-poster").each((function () {
                var t = this.getAttribute("data-src");
                if (t) this.style.backgroundImage = "url(" + t + ")";
                o(s(this).closest(".u-video"))
            }))
        })), s(document).on("opened.np.dialog", ".u-dialog-block", (function (t) {
            o(s(t.currentTarget))
        })), s(document).on("closed.np.dialog", ".u-dialog-block", (function (t) {
            i(s(t.currentTarget))
        }))
    },
    12047: function (t, e, n) {
        "use strict";

        function i(t) {
            this._audioElement = t.querySelector("audio"), this._playButton = t.querySelector(".player-play-btn"), this._playIcon = this._playButton.querySelector(".player-icon-play"), this._pauseIcon = this._playButton.querySelector(".player-icon-pause"), this._progress = t.querySelector(".u-player-progress"), this._playerCurrentTime = t.querySelector(".player-time-current"), this._progressFilled = t.querySelector(".u-player-progress-filled"), this._progressFilled.style.flexBasis = "auto", this._playerDuration = t.querySelector(".player-time-duration"), this._mousedown = false
        }
        var o = n(15);
        i.prototype.build = function t() {
            this.setTimes(), this.initPlayerEvents(), this.initProgressEvents()
        }, i.prototype.initProgressEvents = function t() {
            this._progress.addEventListener("click", this.scrub.bind(this)), this._progress.addEventListener("mousemove", function (t) {
                if (this._mousedown) this.scrub(t)
            }.bind(this)), this._progress.addEventListener("mousedown", (function () {
                this._mousedown = true
            })), this._progress.addEventListener("mouseup", (function () {
                this._mousedown = false
            }))
        }, i.prototype.initPlayerEvents = function t() {
            this._audioElement.addEventListener("timeupdate", function () {
                this.progressUpdate(), this.setTimes()
            }.bind(this)), this._audioElement.addEventListener("loadedmetadata", function () {
                this.setTimes()
            }.bind(this)), this._playButton.addEventListener("click", function () {
                if ("false" === this._playButton.dataset.playing) {
                    var t = this._audioElement.play();
                    if (void 0 !== t) t.then(function () {
                        this._playButton.dataset.playing = "true", this._playIcon.classList.add("u-hidden"), this._pauseIcon.classList.remove("u-hidden")
                    }.bind(this)).catch((function () {}))
                } else if ("true" === this._playButton.dataset.playing) this._audioElement.pause(), this._playButton.dataset.playing = "false", this._pauseIcon.classList.add("u-hidden"), this._playIcon.classList.remove("u-hidden")
            }.bind(this)), this._audioElement.addEventListener("ended", function () {
                this._playButton.dataset.playing = "false", this._pauseIcon.classList.add("u-hidden"), this._playIcon.classList.remove("u-hidden"), this._progressFilled.style.flexBasis = "0%", this._audioElement.currentTime = 0
            }.bind(this))
        }, i.prototype.progressUpdate = function t() {
            var e = this._audioElement.currentTime / this._audioElement.duration * 100;
            this._progressFilled.style.flexBasis = e + "%"
        }, i.prototype.scrub = function t(e) {
            this._audioElement.currentTime = e.offsetX / this._progress.offsetWidth * this._audioElement.duration
        }, i.prototype.setTimes = function t() {
            if (this._audioElement.duration) {
                var e = new Date(1e3 * this._audioElement.currentTime);
                this._playerCurrentTime.textContent = e.toISOString().substring(14, 19);
                var n = new Date(1e3 * this._audioElement.duration);
                this._playerDuration.textContent = n.toISOString().substring(14, 19)
            }
        }, o(window).on("load", (function () {
            o(".u-audio").each((function () {
                var t;
                new i(o(this).get(0)).build()
            }))
        }))
    },
    12048: function (t, e, n) {
        "use strict";
        var i = n(15),
            o = n(12049);
        i((function () {
            (new o).init()
        }))
    },
    12049: function (t, e, n) {
        "use strict";

        function i() {
            this.galleries = null, this._pswpElement = null, this._listeners = [], this._onItemClick = this.onItemClick.bind(this)
        }
        var Utils = n(12050),
            o = n(12051),
            a = n(12052),
            s = n(12053),
            u = n(15),
            l = n(12054),
            c = n(12055);
        t.exports = i, Object.defineProperty(i.prototype, "pswpElement", {
            get: function () {
                if (!this._pswpElement) this._pswpElement = u(".pswp")[0];
                if (!this._pswpElement) {
                    var t = u(a.PSWP_TEMPLATE).appendTo(".u-body");
                    this._pswpElement = t[0]
                }
                return this._pswpElement
            }
        }), i.prototype.init = function () {
            this.initGallery(), this.subscribe(), this.checkHashUrl()
        }, i.prototype.initGallery = function () {
            var t = {};
            u(a.LIGHTBOX_SELECTOR).each((function (t) {
                u(this).attr("data-pswp-uid", t + 1)
            })), u(a.GALLERY_ITEM_SELECTOR).each((function () {
                var e = this.closest(a.LIGHTBOX_SELECTOR);
                if (e && this !== e) {
                    var n = e.getAttribute("data-pswp-uid"),
                        gallery = t[n];
                    if (!gallery) gallery = {
                        dom: e,
                        items: []
                    };
                    this.setAttribute("data-pswp-item-id", gallery.items.length), this.setAttribute("data-gallery-uid", n), gallery.items.push(this), t[n] = gallery
                }
            })), this.galleries = t
        }, i.prototype.subscribe = function () {
            for (var t = Object.keys(this.galleries), e = 0; e < t.length; e++)
                for (var id = t[e], gallery = this.galleries[id], n = 0; n < gallery.items.length; n++) {
                    var i = gallery.items[n];
                    u(i).on("click", this._onItemClick)
                }
        }, i.prototype.onItemClick = function (t) {
            var e = t.currentTarget;
            if (!e.matches("[data-href]")) {
                t.preventDefault(), t.stopPropagation(), t.returnValue = false;
                var index = e.getAttribute("data-pswp-item-id"),
                    n = e.getAttribute("data-gallery-uid"),
                    gallery = this.galleries[n];
                if (gallery && index >= 0) this.openOnClick(index, gallery)
            }
        }, i.prototype.listen = function (t, e) {
            this._listeners.push({
                event: t,
                func: e
            })
        }, i.prototype.checkHashUrl = function () {
            var t = Utils.parseHash();
            if (t.pid && t.gid) this.openFromUrl(t.pid, this.galleries[t.gid])
        }, i.prototype.openOnClick = function (index, gallery) {
            var t = gallery.dom.getAttribute("data-pswp-uid");
            o.gallery(gallery, (function (items) {
                var e = this.buildOptions(t, items);
                e.index = parseFloat(index), e.showPreviews = gallery.dom.classList.contains("u-product-control"), this.showPswp(items, e)
            }), this)
        }, i.prototype.openFromUrl = function (index, gallery) {
            var t = gallery.dom.getAttribute("data-pswp-uid");
            o.gallery(gallery, (function (items) {
                var e = this.buildOptions(t, items);
                if (e.showAnimationDuration = 0, e.index = parseFloat(index) - 1, e.showPreviews = gallery.dom.classList.contains("u-product-control"), e.galleryPIDs)
                    for (var n = 0; n < items.length; n++)
                        if (items[n].pid == index) {
                            e.index = n;
                            break
                        } this.showPswp(items, e)
            }), this)
        }, i.prototype.showPswp = function (items, t) {
            if (Number.isFinite(t.index)) {
                var e = new l(this.pswpElement, c, items, t);
                s.init(e, t), this._listeners.forEach((function (t) {
                    e.listen(t.event, t.func)
                })), e.init()
            }
        }, i.prototype.buildOptions = function (t, items) {
            var e;
            return {
                galleryUID: t,
                getThumbBoundsFn: function (index) {
                    var t = window.pageYOffset || document.documentElement.scrollTop,
                        rect = items[index].el.getBoundingClientRect();
                    return {
                        x: rect.left,
                        y: rect.top + t,
                        w: rect.width
                    }
                },
                addCaptionHTMLFn: function (t, e, n) {
                    if (n) return e.children[0].innerHTML = "<br><br>", true;
                    if (!t.title) return e.children[0].innerHTML = "", false;
                    var html = t.title;
                    if (t.desc) html += "<br><small>" + t.desc + "</small>";
                    return e.children[0].innerHTML = html, true
                },
                showHideOpacity: true,
                history: window.location === window.parent.location
            }
        }, window.Lightbox = i
    },
    12050: function (t, e, n) {
        "use strict";
        var Utils;
        (t.exports = {}).parseHash = function t() {
            var hash = window.location.hash.substring(1),
                e = {};
            if (hash.length < 5) return e;
            for (var n = hash.split("&"), i = 0; i < n.length; i++)
                if (n[i]) {
                    var o = n[i].split("=");
                    if (!(o.length < 2)) e[o[0]] = o[1]
                } if (e.gid) e.gid = parseInt(e.gid, 10);
            return e
        }
    },
    12051: function (t, e, n) {
        "use strict";

        function i(t) {
            return new Promise((function (e, n) {
                if (t.is(".u-background-effect ~ .u-container-layout")) i(t.prev(".u-background-effect").find(".u-background-effect-image")).then((function (t) {
                    e(t)
                }), n);
                else if (t.is("img")) {
                    var a = t[0].naturalWidth || t.attr("data-image-width") || t.attr("imgwidth") || t.width(),
                        s = t[0].naturalHeight || t.attr("data-image-height") || t.attr("imgheight") || t.height();
                    e({
                        el: t[0],
                        src: t.attr("src"),
                        msrc: t.attr("src"),
                        w: parseFloat(a),
                        h: parseFloat(s)
                    })
                } else if (t.is(".u-video")) e({
                    el: t[0],
                    html: t.find(".u-background-video").get(0).outerHTML
                });
                else if (t.is(".u-gallery-item")) i(t.find(".u-back-slide")).then((function (t) {
                    e(t)
                }), n);
                else if (t.is(".u-back-slide")) i(t.find(".u-back-image")).then((function (n) {
                    var i = t.siblings(".u-over-slide"),
                        o = t.closest(".u-gallery").is(".u-layout-thumbnails");
                    if (i.length && !o) n.title = i.find(".u-gallery-heading").html(), n.desc = i.find(".u-gallery-text").html();
                    e(n)
                }), n);
                else o(t).then((function (n) {
                    e({
                        el: t[0],
                        src: n.src,
                        msrc: n.src,
                        w: n.width,
                        h: n.height
                    })
                }), n)
            }))
        }

        function o(t) {
            var e = t.css("background-image"),
                n = e.match(/url\(['"]?(.+?)['"]?\)/);
            return new Promise((function (t, i) {
                if (n) {
                    var o = new Image;
                    o.onload = t.bind(null, o), o.onerror = o.onabort = i, o.src = n[1]
                } else i(new Error("Invalid source: " + e))
            }))
        }
        var a = n(15),
            s;
        (t.exports = {}).gallery = function gallery(gallery, t, e) {
            e = e || null;
            var n = gallery.items.map((function (t) {
                return i(t = a(t))
            }));
            Promise.all(n).then(t.bind(e), console.log)
        }
    },
    12052: function (t, e, n) {
        "use strict";
        var i = t.exports = {};
        i.LIGHTBOX_SELECTOR = ".u-lightbox", i.GALLERY_ITEM_SELECTOR = [".u-image:not(.u-carousel-thumbnail-image):not(.u-background-effect-image)", ".u-gallery-item", ".u-background-effect ~ .u-container-layout"].join(", "), i.PSWP_TEMPLATE = '<div class="pswp" tabindex="-1" role="dialog" aria-hidden="true">\n' + '  <div class="pswp__bg"></div>\n' + '  <div class="pswp__scroll-wrap">\n' + '    <div class="pswp__container">\n' + '     <div class="pswp__item"></div>\n' + '     <div class="pswp__item"></div>\n' + '      <div class="pswp__item"></div>\n' + "    </div>\n" + '    <div class="pswp__ui pswp__ui--hidden">\n' + '      <div class="pswp__top-bar">\n ' + '       <div class="pswp__counter"></div>\n' + '        <button class="pswp__button pswp__button--close" title="Close (Esc)"></button>\n' + '        <button class="pswp__button pswp__button--share" title="Share"></button>\n' + '        <button class="pswp__button pswp__button--fs" title="Toggle fullscreen"></button>\n' + '        <button class="pswp__button pswp__button--zoom" title="Zoom in/out"></button>\n' + '        <div class="pswp__preloader">\n' + '          <div class="pswp__preloader__icn">\n' + '            <div class="pswp__preloader__cut">\n' + '              <div class="pswp__preloader__donut"></div>\n' + "            </div>\n" + "          </div>\n" + "        </div>\n" + "      </div>\n" + '      <div class="pswp__share-modal pswp__share-modal--hidden pswp__single-tap">\n' + '        <div class="pswp__share-tooltip"></div>\n' + "      </div>\n" + '      <button class="pswp__button pswp__button--arrow--left" title="Previous (arrow left)"></button>\n' + '      <button class="pswp__button pswp__button--arrow--right" title="Next (arrow right)"></button>\n' + '      <div class="pswp__previews" data-previews="data-previews" style="display: none"></div>' + '      <div class="pswp__caption">\n' + '        <div class="pswp__caption__center"></div>\n' + "      </div>\n" + "    </div>\n" + "  </div>\n" + "</div>"
    },
    12053: function (t, e, n) {
        "use strict";

        function i(gallery, selector) {
            var t = gallery.scrollWrap,
                e = t.querySelector(selector),
                n;
            t.querySelector(".pswp__caption").style.display = "none", e.style.display = ""
        }

        function o(gallery, selector) {
            var t = gallery.scrollWrap,
                e = t.querySelector(selector),
                n;
            t.querySelector(".pswp__caption").style.display = "", e.style.display = "none"
        }

        function add(gallery, selector) {
            var t = gallery.scrollWrap,
                items = gallery.items,
                e = t.querySelector(selector);
            items.forEach((function (t) {
                var preview = t.msrc,
                    n = document.createElement("img");
                n.setAttribute("src", preview), n.addEventListener("click", (function () {
                    gallery.goTo(items.indexOf(t))
                })), e.appendChild(n)
            }))
        }

        function remove(gallery, selector) {
            var t, e;
            gallery.scrollWrap.querySelector(selector).innerHTML = ""
        }

        function a(gallery, selector) {
            var t = gallery.scrollWrap,
                e, preview = gallery.currItem.msrc,
                n, i;
            t.querySelector(selector).querySelectorAll("img").forEach((function (t) {
                var e, n = "active";
                if (t.getAttribute("src") === preview) t.classList.add(n), t.scrollIntoView({
                    behavior: "smooth"
                });
                else t.classList.remove(n)
            }))
        }
        var s;
        t.exports.init = function init(gallery, t) {
            var e = false;
            gallery.listen("gettingData", (function () {
                if (!e) {
                    if (e = true, t.showPreviews) i(gallery, "[data-previews]");
                    else o(gallery, "[data-previews]");
                    add(gallery, "[data-previews]")
                }
            })), gallery.listen("close", (function () {
                remove(gallery, "[data-previews]")
            })), gallery.listen("afterChange", (function () {
                a(gallery, "[data-previews]")
            }))
        }
    },
    12054: function (t, e, n) {
        "use strict";
        var i, o;
        /*! PhotoSwipe - v4.1.3 - 2019-01-08
         * http://photoswipe.com
         * Copyright (c) 2019 Dmitry Semenov; */
        ! function (a, factory) {
            if (true) !(void 0 !== (o = "function" == typeof (i = factory) ? i.call(e, n, e, t) : i) && (t.exports = o));
            else if ("object" == typeof e) t.exports = factory();
            else a.PhotoSwipe = factory()
        }(this, (function () {
            var t = function (template, t, items, e) {
                var n = {
                    features: null,
                    bind: function (t, type, e, n) {
                        var i = (n ? "remove" : "add") + "EventListener";
                        type = type.split(" ");
                        for (var o = 0; o < type.length; o++)
                            if (type[o]) t[i](type[o], e, false)
                    },
                    isArray: function (t) {
                        return t instanceof Array
                    },
                    createEl: function (t, e) {
                        var el = document.createElement(e || "div");
                        if (t) el.className = t;
                        return el
                    },
                    getScrollY: function () {
                        var t = window.pageYOffset;
                        return void 0 !== t ? t : document.documentElement.scrollTop
                    },
                    unbind: function (t, type, e) {
                        n.bind(t, type, e, true)
                    },
                    removeClass: function (el, t) {
                        var e = new RegExp("(\\s|^)" + t + "(\\s|$)");
                        el.className = el.className.replace(e, " ").replace(/^\s\s*/, "").replace(/\s\s*$/, "")
                    },
                    addClass: function (el, t) {
                        if (!n.hasClass(el, t)) el.className += (el.className ? " " : "") + t
                    },
                    hasClass: function (el, t) {
                        return el.className && new RegExp("(^|\\s)" + t + "(\\s|$)").test(el.className)
                    },
                    getChildByClass: function (t, e) {
                        for (var i = t.firstChild; i;) {
                            if (n.hasClass(i, e)) return i;
                            i = i.nextSibling
                        }
                    },
                    arraySearch: function (t, e, n) {
                        for (var i = t.length; i--;)
                            if (t[i][n] === e) return i;
                        return -1
                    },
                    extend: function (t, e, n) {
                        for (var i in e)
                            if (e.hasOwnProperty(i)) {
                                if (n && t.hasOwnProperty(i)) continue;
                                t[i] = e[i]
                            }
                    },
                    easing: {
                        sine: {
                            out: function (t) {
                                return Math.sin(t * (Math.PI / 2))
                            },
                            inOut: function (t) {
                                return -(Math.cos(Math.PI * t) - 1) / 2
                            }
                        },
                        cubic: {
                            out: function (t) {
                                return --t * t * t + 1
                            }
                        }
                    },
                    detectFeatures: function () {
                        if (n.features) return n.features;
                        var t, e = n.createEl().style,
                            i = "",
                            o = {};
                        if (o.oldIE = document.all && !document.addEventListener, o.touch = "ontouchstart" in window, window.requestAnimationFrame) o.raf = window.requestAnimationFrame, o.caf = window.cancelAnimationFrame;
                        if (o.pointerEvent = !!window.PointerEvent || navigator.msPointerEnabled, !o.pointerEvent) {
                            var a = navigator.userAgent;
                            if (/iP(hone|od)/.test(navigator.platform)) {
                                var s = navigator.appVersion.match(/OS (\d+)_(\d+)_?(\d+)?/);
                                if (s && s.length > 0)
                                    if ((s = parseInt(s[1], 10)) >= 1 && s < 8) o.isOldIOSPhone = true
                            }
                            var u = a.match(/Android\s([0-9\.]*)/),
                                l = u ? u[1] : 0;
                            if ((l = parseFloat(l)) >= 1) {
                                if (l < 4.4) o.isOldAndroid = true;
                                o.androidVersion = l
                            }
                            o.isMobileOpera = /opera mini|opera mobi/i.test(a)
                        }
                        for (var c = ["transform", "perspective", "animationName"], f = ["", "webkit", "Moz", "ms", "O"], h, p, m = 0; m < 4; m++) {
                            i = f[m];
                            for (var g = 0; g < 3; g++)
                                if (h = c[g], p = i + (i ? h.charAt(0).toUpperCase() + h.slice(1) : h), !o[h] && p in e) o[h] = p;
                            if (i && !o.raf)
                                if (i = i.toLowerCase(), o.raf = window[i + "RequestAnimationFrame"], o.raf) o.caf = window[i + "CancelAnimationFrame"] || window[i + "CancelRequestAnimationFrame"]
                        }
                        if (!o.raf) {
                            var v = 0;
                            o.raf = function (t) {
                                var e = (new Date).getTime(),
                                    n = Math.max(0, 16 - (e - v)),
                                    id = window.setTimeout((function () {
                                        t(e + n)
                                    }), n);
                                return v = e + n, id
                            }, o.caf = function (id) {
                                clearTimeout(id)
                            }
                        }
                        return o.svg = !!document.createElementNS && !!document.createElementNS("http://www.w3.org/2000/svg", "svg").createSVGRect, n.features = o, o
                    }
                };
                if (n.detectFeatures(), n.features.oldIE) n.bind = function (t, type, e, n) {
                    type = type.split(" ");
                    for (var i = (n ? "detach" : "attach") + "Event", o, a = function () {
                            e.handleEvent.call(e)
                        }, s = 0; s < type.length; s++)
                        if (o = type[s])
                            if ("object" == typeof e && e.handleEvent) {
                                if (!n) e["oldIE" + o] = a;
                                else if (!e["oldIE" + o]) return false;
                                t[i]("on" + o, e["oldIE" + o])
                            } else t[i]("on" + o, e)
                };
                var i = this,
                    o = 25,
                    a = 3,
                    s = {
                        allowPanToNext: true,
                        spacing: .12,
                        bgOpacity: 1,
                        mouseUsed: false,
                        loop: true,
                        pinchToClose: true,
                        closeOnScroll: true,
                        closeOnVerticalDrag: true,
                        verticalDragRange: .75,
                        hideAnimationDuration: 333,
                        showAnimationDuration: 333,
                        showHideOpacity: false,
                        focus: true,
                        escKey: true,
                        arrowKeys: true,
                        mainScrollEndFriction: .35,
                        panEndFriction: .35,
                        isClickableElement: function (el) {
                            return "A" === el.tagName
                        },
                        getDoubleTapZoom: function (t, e) {
                            if (t) return 1;
                            else return e.initialZoomLevel < .7 ? 1 : 1.33
                        },
                        maxSpreadZoom: 1.33,
                        modal: true,
                        scaleMode: "fit"
                    };
                n.extend(s, e);
                var u = function () {
                        return {
                            x: 0,
                            y: 0
                        }
                    },
                    l, c, f, h, p, m, g = {
                        x: 0,
                        y: 0
                    },
                    v = {
                        x: 0,
                        y: 0
                    },
                    y = {
                        x: 0,
                        y: 0
                    },
                    w, b, C, S = {},
                    x, A, _, T, E, I, k = 0,
                    M = {},
                    L = {
                        x: 0,
                        y: 0
                    },
                    P, O, B = 0,
                    F, N, U, z, H, $, Y = true,
                    W, V = [],
                    G, j, K, Z, X, J, tt, nt = {},
                    rt = false,
                    ot, at = function (t, e) {
                        n.extend(i, e.publicMethods), V.push(t)
                    },
                    st = function (index) {
                        var t = wn();
                        if (index > t - 1) return index - t;
                        else if (index < 0) return t + index;
                        return index
                    },
                    ut = {},
                    lt = function (t, e) {
                        if (!ut[t]) ut[t] = [];
                        return ut[t].push(e)
                    },
                    ct = function (t) {
                        var e = ut[t];
                        if (e) {
                            var n = Array.prototype.slice.call(arguments);
                            n.shift();
                            for (var o = 0; o < e.length; o++) e[o].apply(i, n)
                        }
                    },
                    ft = function () {
                        return (new Date).getTime()
                    },
                    dt = function (t) {
                        Le = t, i.bg.style.opacity = t * s.bgOpacity
                    },
                    ht = function (t, e, n, o, a) {
                        if (!rt || a && a !== i.currItem) o /= a ? a.fitRatio : i.currItem.fitRatio;
                        t[H] = _ + e + "px, " + n + "px" + T + " scale(" + o + ")"
                    },
                    pt = function (t) {
                        if (xe) {
                            if (t)
                                if (x > i.currItem.fitRatio) {
                                    if (!rt) En(i.currItem, false, true), rt = true
                                } else if (rt) En(i.currItem), rt = false;
                            ht(xe, y.x, y.y, x)
                        }
                    },
                    mt = function (t) {
                        if (t.container) ht(t.container.style, t.initialPosition.x, t.initialPosition.y, t.initialZoomLevel, t)
                    },
                    gt = function (t, e) {
                        e[H] = _ + t + "px, 0px" + T
                    },
                    vt = function (t, e) {
                        if (!s.loop && e) {
                            var n = h + (L.x * k - t) / L.x,
                                i = Math.round(t - Se.x);
                            if (n < 0 && i > 0 || n >= wn() - 1 && i < 0) t = Se.x + i * s.mainScrollEndFriction
                        }
                        Se.x = t, gt(t, p)
                    },
                    yt = function (t, e) {
                        var n = _e[t] - M[t];
                        return v[t] + g[t] + n - n * (e / A)
                    },
                    wt = function (t, e) {
                        if (t.x = e.x, t.y = e.y, e.id) t.id = e.id
                    },
                    bt = function (t) {
                        t.x = Math.round(t.x), t.y = Math.round(t.y)
                    },
                    Ct = null,
                    St = function () {
                        if (Ct) n.unbind(document, "mousemove", St), n.addClass(template, "pswp--has_mouse"), s.mouseUsed = true, ct("mouseUsed");
                        Ct = setTimeout((function () {
                            Ct = null
                        }), 100)
                    },
                    xt = function () {
                        if (n.bind(document, "keydown", i), tt.transform) n.bind(i.scrollWrap, "click", i);
                        if (!s.mouseUsed) n.bind(document, "mousemove", St);
                        n.bind(window, "resize scroll orientationchange", i), ct("bindEvents")
                    },
                    At = function () {
                        if (n.unbind(window, "resize scroll orientationchange", i), n.unbind(window, "scroll", C.scroll), n.unbind(document, "keydown", i), n.unbind(document, "mousemove", St), tt.transform) n.unbind(i.scrollWrap, "click", i);
                        if (ue) n.unbind(window, w, i);
                        clearTimeout(ot), ct("unbindEvents")
                    },
                    _t = function (t, update) {
                        var e = xn(i.currItem, S, t);
                        if (update) Ce = e;
                        return e
                    },
                    Tt = function (t) {
                        if (!t) t = i.currItem;
                        return t.initialZoomLevel
                    },
                    Dt = function (t) {
                        if (!t) t = i.currItem;
                        return t.w > 0 ? s.maxSpreadZoom : 1
                    },
                    kt = function (t, e, n, o) {
                        if (o === i.currItem.initialZoomLevel) return n[t] = i.currItem.initialPosition[t], true;
                        else if (n[t] = yt(t, o), n[t] > e.min[t]) return n[t] = e.min[t], true;
                        else if (n[t] < e.max[t]) return n[t] = e.max[t], true;
                        return false
                    },
                    Mt = function () {
                        if (H) {
                            var t = tt.perspective && !W;
                            return _ = "translate" + (t ? "3d(" : "("), T = tt.perspective ? ", 0px)" : ")", void 0
                        }
                        H = "left", n.addClass(template, "pswp--ie"), gt = function (t, e) {
                            e.left = t + "px"
                        }, mt = function (t) {
                            var e = t.fitRatio > 1 ? 1 : t.fitRatio,
                                n = t.container.style,
                                i = e * t.w,
                                o = e * t.h;
                            n.width = i + "px", n.height = o + "px", n.left = t.initialPosition.x + "px", n.top = t.initialPosition.y + "px"
                        }, pt = function () {
                            if (xe) {
                                var t = xe,
                                    e = i.currItem,
                                    n = e.fitRatio > 1 ? 1 : e.fitRatio,
                                    o = n * e.w,
                                    a = n * e.h;
                                t.width = o + "px", t.height = a + "px", t.left = y.x + "px", t.top = y.y + "px"
                            }
                        }
                    },
                    Lt = function (t) {
                        var e = "";
                        if (s.escKey && 27 === t.keyCode) e = "close";
                        else if (s.arrowKeys)
                            if (37 === t.keyCode) e = "prev";
                            else if (39 === t.keyCode) e = "next";
                        if (e)
                            if (!(t.ctrlKey || t.altKey || t.shiftKey || t.metaKey)) {
                                if (t.preventDefault) t.preventDefault();
                                else t.returnValue = false;
                                i[e]()
                            }
                    },
                    Pt = function (t) {
                        if (t)
                            if (fe || ce || Ae || ie) t.preventDefault(), t.stopPropagation()
                    },
                    Ot = function () {
                        i.setScrollOffset(0, n.getScrollY())
                    },
                    Bt = {},
                    Rt = 0,
                    Ft = function (t) {
                        if (Bt[t]) {
                            if (Bt[t].raf) j(Bt[t].raf);
                            Rt--, delete Bt[t]
                        }
                    },
                    Nt = function (t) {
                        if (Bt[t]) Ft(t);
                        if (!Bt[t]) Rt++, Bt[t] = {}
                    },
                    Ut = function () {
                        for (var t in Bt)
                            if (Bt.hasOwnProperty(t)) Ft(t)
                    },
                    qt = function (t, e, n, d, i, o, a) {
                        var s = ft(),
                            u;
                        Nt(t);
                        var l = function () {
                            if (Bt[t]) {
                                if ((u = ft() - s) >= d) {
                                    if (Ft(t), o(n), a) a();
                                    return
                                }
                                o((n - e) * i(u / d) + e), Bt[t].raf = G(l)
                            }
                        };
                        l()
                    },
                    zt = {
                        shout: ct,
                        listen: lt,
                        viewportSize: S,
                        options: s,
                        isMainScrollAnimating: function () {
                            return Ae
                        },
                        getZoomLevel: function () {
                            return x
                        },
                        getCurrentIndex: function () {
                            return h
                        },
                        isDragging: function () {
                            return ue
                        },
                        isZooming: function () {
                            return ye
                        },
                        setScrollOffset: function (t, e) {
                            M.x = t, J = M.y = e, ct("updateScrollOffset", M)
                        },
                        applyZoomPan: function (t, e, n, i) {
                            y.x = e, y.y = n, x = t, pt(i)
                        },
                        init: function () {
                            if (!l && !c) {
                                var e;
                                i.framework = n, i.template = template, i.bg = n.getChildByClass(template, "pswp__bg"), K = template.className, l = true, tt = n.detectFeatures(), G = tt.raf, j = tt.caf, H = tt.transform, X = tt.oldIE, i.scrollWrap = n.getChildByClass(template, "pswp__scroll-wrap"), i.container = n.getChildByClass(i.scrollWrap, "pswp__container"), p = i.container.style, i.itemHolders = P = [{
                                    el: i.container.children[0],
                                    wrap: 0,
                                    index: -1
                                }, {
                                    el: i.container.children[1],
                                    wrap: 0,
                                    index: -1
                                }, {
                                    el: i.container.children[2],
                                    wrap: 0,
                                    index: -1
                                }], P[0].el.style.display = P[2].el.style.display = "none", Mt(), C = {
                                    resize: i.updateSize,
                                    orientationchange: function () {
                                        clearTimeout(ot), ot = setTimeout((function () {
                                            if (S.x !== i.scrollWrap.clientWidth) i.updateSize()
                                        }), 500)
                                    },
                                    scroll: Ot,
                                    keydown: Lt,
                                    click: Pt
                                };
                                var o = tt.isOldIOSPhone || tt.isOldAndroid || tt.isMobileOpera;
                                if (!tt.animationName || !tt.transform || o) s.showAnimationDuration = s.hideAnimationDuration = 0;
                                for (e = 0; e < V.length; e++) i["init" + V[e]]();
                                if (t) {
                                    var u;
                                    (i.ui = new t(i, n)).init()
                                }
                                if (ct("firstUpdate"), h = h || s.index || 0, isNaN(h) || h < 0 || h >= wn()) h = 0;
                                if (i.currItem = yn(h), tt.isOldIOSPhone || tt.isOldAndroid) Y = false;
                                if (template.setAttribute("aria-hidden", "false"), s.modal)
                                    if (!Y) template.style.position = "absolute", template.style.top = n.getScrollY() + "px";
                                    else template.style.position = "fixed";
                                if (void 0 === J) ct("initialLayout"), J = Z = n.getScrollY();
                                var f = "pswp--open ";
                                if (s.mainClass) f += s.mainClass + " ";
                                if (s.showHideOpacity) f += "pswp--animate_opacity ";
                                for (f += W ? "pswp--touch" : "pswp--notouch", f += tt.animationName ? " pswp--css_animation" : "", f += tt.svg ? " pswp--svg" : "", n.addClass(template, f), i.updateSize(), m = -1, B = null, e = 0; e < a; e++) gt((e + m) * L.x, P[e].el.style);
                                if (!X) n.bind(i.scrollWrap, b, i);
                                if (lt("initialZoomInEnd", (function () {
                                        if (i.setContent(P[0], h - 1), i.setContent(P[2], h + 1), P[0].el.style.display = P[2].el.style.display = "block", s.focus) template.focus();
                                        xt()
                                    })), i.setContent(P[1], h), i.updateCurrItem(), ct("afterInit"), !Y) E = setInterval((function () {
                                    if (!Rt && !ue && !ye && x === i.currItem.initialZoomLevel) i.updateSize()
                                }), 1e3);
                                n.addClass(template, "pswp--visible")
                            }
                        },
                        close: function () {
                            if (l) l = false, c = true, ct("close"), At(), fn(i.currItem, null, true, i.destroy)
                        },
                        destroy: function () {
                            if (ct("destroy"), cn) clearTimeout(cn);
                            if (template.setAttribute("aria-hidden", "true"), template.className = K, E) clearInterval(E);
                            n.unbind(i.scrollWrap, b, i), n.unbind(window, "scroll", i), Fe(), Ut(), ut = null
                        },
                        panTo: function (t, e, n) {
                            if (!n) {
                                if (t > Ce.min.x) t = Ce.min.x;
                                else if (t < Ce.max.x) t = Ce.max.x;
                                if (e > Ce.min.y) e = Ce.min.y;
                                else if (e < Ce.max.y) e = Ce.max.y
                            }
                            y.x = t, y.y = e, pt()
                        },
                        handleEvent: function (t) {
                            if (t = t || window.event, C[t.type]) C[t.type](t)
                        },
                        goTo: function (index) {
                            var diff = (index = st(index)) - h;
                            B = diff, h = index, i.currItem = yn(h), k -= diff, vt(L.x * k), Ut(), Ae = false, i.updateCurrItem()
                        },
                        next: function () {
                            i.goTo(h + 1)
                        },
                        prev: function () {
                            i.goTo(h - 1)
                        },
                        updateCurrZoomItem: function (t) {
                            if (t) ct("beforeChange", 0);
                            if (P[1].el.children.length) {
                                var e = P[1].el.children[0];
                                if (n.hasClass(e, "pswp__zoom-wrap")) xe = e.style;
                                else xe = null
                            } else xe = null;
                            if (Ce = i.currItem.bounds, A = x = i.currItem.initialZoomLevel, y.x = Ce.center.x, y.y = Ce.center.y, t) ct("afterChange")
                        },
                        invalidateCurrItems: function () {
                            I = true;
                            for (var t = 0; t < a; t++)
                                if (P[t].item) P[t].item.needsUpdate = true
                        },
                        updateCurrItem: function (t) {
                            if (0 !== B) {
                                var e = Math.abs(B),
                                    n;
                                if (!(t && e < 2)) {
                                    if (i.currItem = yn(h), rt = false, ct("beforeChange", B), e >= a) m += B + (B > 0 ? -a : a), e = a;
                                    for (var o = 0; o < e; o++)
                                        if (B > 0) n = P.shift(), P[a - 1] = n, m++, gt((m + 2) * L.x, n.el.style), i.setContent(n, h - e + o + 1 + 1);
                                        else n = P.pop(), P.unshift(n), m--, gt(m * L.x, n.el.style), i.setContent(n, h + e - o - 1 - 1);
                                    if (xe && 1 === Math.abs(B)) {
                                        var s = yn(O);
                                        if (s.initialZoomLevel !== x) xn(s, S), En(s), mt(s)
                                    }
                                    B = 0, i.updateCurrZoomItem(), O = h, ct("afterChange")
                                }
                            }
                        },
                        updateSize: function (t) {
                            if (!Y && s.modal) {
                                var e = n.getScrollY();
                                if (J !== e) template.style.top = e + "px", J = e;
                                if (!t && nt.x === window.innerWidth && nt.y === window.innerHeight) return;
                                nt.x = window.innerWidth, nt.y = window.innerHeight, template.style.height = nt.y + "px"
                            }
                            if (S.x = i.scrollWrap.clientWidth, S.y = i.scrollWrap.clientHeight, Ot(), L.x = S.x + Math.round(S.x * s.spacing), L.y = S.y, vt(L.x * k), ct("beforeResize"), void 0 !== m) {
                                for (var o, u, l, c = 0; c < a; c++) {
                                    if (o = P[c], gt((c + m) * L.x, o.el.style), l = h + c - 1, s.loop && wn() > 2) l = st(l);
                                    if ((u = yn(l)) && (I || u.needsUpdate || !u.bounds)) {
                                        if (i.cleanSlide(u), i.setContent(o, l), 1 === c) i.currItem = u, i.updateCurrZoomItem(true);
                                        u.needsUpdate = false
                                    } else if (-1 === o.index && l >= 0) i.setContent(o, l);
                                    if (u && u.container) xn(u, S), En(u), mt(u)
                                }
                                I = false
                            }
                            if (A = x = i.currItem.initialZoomLevel, Ce = i.currItem.bounds) y.x = Ce.center.x, y.y = Ce.center.y, pt(true);
                            ct("resize")
                        },
                        zoomTo: function (t, e, i, o, a) {
                            if (e) A = x, _e.x = Math.abs(e.x) - y.x, _e.y = Math.abs(e.y) - y.y, wt(v, y);
                            var s = _t(t, false),
                                u = {};
                            kt("x", s, u, t), kt("y", s, u, t);
                            var l = x,
                                c = y.x,
                                f = y.y;
                            bt(u);
                            var h = function (e) {
                                if (1 === e) x = t, y.x = u.x, y.y = u.y;
                                else x = (t - l) * e + l, y.x = (u.x - c) * e + c, y.y = (u.y - f) * e + f;
                                if (a) a(e);
                                pt(1 === e)
                            };
                            if (i) qt("customZoomTo", 0, 1, i, o || n.easing.sine.inOut, h);
                            else h(1)
                        }
                    },
                    Ht = 30,
                    $t = 10,
                    Yt, Wt, Vt = {},
                    Gt = {},
                    jt = {},
                    Kt = {},
                    Zt = {},
                    Xt = [],
                    Jt = {},
                    Qt, te = [],
                    ee = {},
                    ne, ie, re, oe = 0,
                    ae = {
                        x: 0,
                        y: 0
                    },
                    se = 0,
                    ue, le, ce, fe, pe, ge, ve, ye, we, be, Ce, Se = {
                        x: 0,
                        y: 0
                    },
                    xe, Ae, _e = {
                        x: 0,
                        y: 0
                    },
                    Te = {
                        x: 0,
                        y: 0
                    },
                    Ee, Ie, ke, Le, Pe, Oe = function (t, e) {
                        return t.x === e.x && t.y === e.y
                    },
                    Be = function (t, e) {
                        return Math.abs(t.x - e.x) < o && Math.abs(t.y - e.y) < o
                    },
                    Re = function (t, e) {
                        return ee.x = Math.abs(t.x - e.x), ee.y = Math.abs(t.y - e.y), Math.sqrt(ee.x * ee.x + ee.y * ee.y)
                    },
                    Fe = function () {
                        if (pe) j(pe), pe = null
                    },
                    Ne = function () {
                        if (ue) pe = G(Ne), nn()
                    },
                    Ue = function () {
                        return !("fit" === s.scaleMode && x === i.currItem.initialZoomLevel)
                    },
                    qe = function (el, t) {
                        if (!el || el === document) return false;
                        if (el.getAttribute("class") && el.getAttribute("class").indexOf("pswp__scroll-wrap") > -1) return false;
                        if (t(el)) return el;
                        else return qe(el.parentNode, t)
                    },
                    ze = {},
                    $e = function (t, e) {
                        return ze.prevent = !qe(t.target, s.isClickableElement), ct("preventDragEvent", t, e, ze), ze.prevent
                    },
                    Ye = function (t, e) {
                        return e.x = t.pageX, e.y = t.pageY, e.id = t.identifier, e
                    },
                    We = function (t, e, n) {
                        n.x = .5 * (t.x + e.x), n.y = .5 * (t.y + e.y)
                    },
                    Ve = function (t, e, n) {
                        if (t - Wt > 50) {
                            var i = te.length > 2 ? te.shift() : {};
                            i.x = e, i.y = n, te.push(i), Wt = t
                        }
                    },
                    Ge = function () {
                        var t = y.y - i.currItem.initialPosition.y;
                        return 1 - Math.abs(t / (S.y / 2))
                    },
                    je = {},
                    Ke = {},
                    Ze = [],
                    Xe, Je = function (t) {
                        for (; Ze.length > 0;) Ze.pop();
                        if (!$)
                            if (t.type.indexOf("touch") > -1) {
                                if (t.touches && t.touches.length > 0)
                                    if (Ze[0] = Ye(t.touches[0], je), t.touches.length > 1) Ze[1] = Ye(t.touches[1], Ke)
                            } else je.x = t.pageX, je.y = t.pageY, je.id = "", Ze[0] = je;
                        else Xe = 0, Xt.forEach((function (t) {
                            if (0 === Xe) Ze[0] = t;
                            else if (1 === Xe) Ze[1] = t;
                            Xe++
                        }));
                        return Ze
                    },
                    Qe = function (t, e) {
                        var n, o = 0,
                            a = y[t] + e[t],
                            u, l = e[t] > 0,
                            c = Se.x + e.x,
                            f = Se.x - Jt.x,
                            h, p;
                        if (a > Ce.min[t] || a < Ce.max[t]) n = s.panEndFriction;
                        else n = 1;
                        if (a = y[t] + e[t] * n, s.allowPanToNext || x === i.currItem.initialZoomLevel) {
                            if (!xe) p = c;
                            else if ("h" === Ee && "x" === t && !ce)
                                if (l) {
                                    if (a > Ce.min[t]) n = s.panEndFriction, o = Ce.min[t] - a, u = Ce.min[t] - v[t];
                                    if ((u <= 0 || f < 0) && wn() > 1) {
                                        if (p = c, f < 0 && c > Jt.x) p = Jt.x
                                    } else if (Ce.min.x !== Ce.max.x) h = a
                                } else {
                                    if (a < Ce.max[t]) n = s.panEndFriction, o = a - Ce.max[t], u = v[t] - Ce.max[t];
                                    if ((u <= 0 || f > 0) && wn() > 1) {
                                        if (p = c, f > 0 && c < Jt.x) p = Jt.x
                                    } else if (Ce.min.x !== Ce.max.x) h = a
                                } if ("x" === t) {
                                if (void 0 !== p)
                                    if (vt(p, true), p === Jt.x) ge = false;
                                    else ge = true;
                                if (Ce.min.x !== Ce.max.x)
                                    if (void 0 !== h) y.x = h;
                                    else if (!ge) y.x += e.x * n;
                                return void 0 !== p
                            }
                        }
                        if (!Ae)
                            if (!ge)
                                if (x > i.currItem.fitRatio) y[t] += e[t] * n
                    },
                    tn = function (t) {
                        if (!("mousedown" === t.type && t.button > 0)) {
                            if (gn) return t.preventDefault(), void 0;
                            if (!re || "mousedown" !== t.type) {
                                if ($e(t, true)) t.preventDefault();
                                if (ct("pointerDown"), $) {
                                    var e = n.arraySearch(Xt, t.pointerId, "id");
                                    if (e < 0) e = Xt.length;
                                    Xt[e] = {
                                        x: t.pageX,
                                        y: t.pageY,
                                        id: t.pointerId
                                    }
                                }
                                var o = Je(t),
                                    a = o.length;
                                if (ve = null, Ut(), !ue || 1 === a) ue = Ie = true, n.bind(window, w, i), ne = Pe = ke = ie = ge = fe = le = ce = false, Ee = null, ct("firstTouchStart", o), wt(v, y), g.x = g.y = 0, wt(Kt, o[0]), wt(Zt, Kt), Jt.x = L.x * k, te = [{
                                    x: Kt.x,
                                    y: Kt.y
                                }], Wt = Yt = ft(), _t(x, true), Fe(), Ne();
                                if (!ye && a > 1 && !Ae && !ge) A = x, ce = false, ye = le = true, g.y = g.x = 0, wt(v, y), wt(Vt, o[0]), wt(Gt, o[1]), We(Vt, Gt, Te), _e.x = Math.abs(Te.x) - y.x, _e.y = Math.abs(Te.y) - y.y, we = be = Re(Vt, Gt)
                            }
                        }
                    },
                    en = function (t) {
                        if (t.preventDefault(), $) {
                            var e = n.arraySearch(Xt, t.pointerId, "id");
                            if (e > -1) {
                                var i = Xt[e];
                                i.x = t.pageX, i.y = t.pageY
                            }
                        }
                        if (ue) {
                            var o = Je(t);
                            if (!Ee && !fe && !ye)
                                if (Se.x !== L.x * k) Ee = "h";
                                else {
                                    var diff = Math.abs(o[0].x - Kt.x) - Math.abs(o[0].y - Kt.y);
                                    if (Math.abs(diff) >= $t) Ee = diff > 0 ? "h" : "v", ve = o
                                }
                            else ve = o
                        }
                    },
                    nn = function () {
                        if (ve) {
                            var t = ve.length;
                            if (0 !== t)
                                if (wt(Vt, ve[0]), jt.x = Vt.x - Kt.x, jt.y = Vt.y - Kt.y, ye && t > 1) {
                                    if (Kt.x = Vt.x, Kt.y = Vt.y, !jt.x && !jt.y && Oe(ve[1], Gt)) return;
                                    if (wt(Gt, ve[1]), !ce) ce = true, ct("zoomGestureStarted");
                                    var e = Re(Vt, Gt),
                                        n = un(e);
                                    if (n > i.currItem.initialZoomLevel + i.currItem.initialZoomLevel / 15) Pe = true;
                                    var o = 1,
                                        a = Tt(),
                                        u = Dt();
                                    if (n < a)
                                        if (s.pinchToClose && !Pe && A <= i.currItem.initialZoomLevel) {
                                            var l, c = 1 - (a - n) / (a / 1.2);
                                            dt(c), ct("onPinchClose", c), ke = true
                                        } else {
                                            if ((o = (a - n) / a) > 1) o = 1;
                                            n = a - o * (a / 3)
                                        }
                                    else if (n > u) {
                                        if ((o = (n - u) / (6 * a)) > 1) o = 1;
                                        n = u + o * a
                                    }
                                    if (o < 0) o = 0;
                                    we = e, We(Vt, Gt, ae), g.x += ae.x - Te.x, g.y += ae.y - Te.y, wt(Te, ae), y.x = yt("x", n), y.y = yt("y", n), ne = n > x, x = n, pt()
                                } else {
                                    if (!Ee) return;
                                    if (Ie) {
                                        if (Ie = false, Math.abs(jt.x) >= $t) jt.x -= ve[0].x - Zt.x;
                                        if (Math.abs(jt.y) >= $t) jt.y -= ve[0].y - Zt.y
                                    }
                                    if (Kt.x = Vt.x, Kt.y = Vt.y, 0 === jt.x && 0 === jt.y) return;
                                    if ("v" === Ee && s.closeOnVerticalDrag)
                                        if (!Ue()) {
                                            g.y += jt.y, y.y += jt.y;
                                            var f = Ge();
                                            return ie = true, ct("onVerticalDrag", f), dt(f), pt(), void 0
                                        } var h;
                                    if (Ve(ft(), Vt.x, Vt.y), fe = true, Ce = i.currItem.bounds, !Qe("x", jt)) Qe("y", jt), bt(y), pt()
                                }
                        }
                    },
                    rn = function (t) {
                        if (tt.isOldAndroid) {
                            if (re && "mouseup" === t.type) return;
                            if (t.type.indexOf("touch") > -1) clearTimeout(re), re = setTimeout((function () {
                                re = 0
                            }), 600)
                        }
                        if (ct("pointerUp"), $e(t, false)) t.preventDefault();
                        var e;
                        if ($) {
                            var o = n.arraySearch(Xt, t.pointerId, "id");
                            if (o > -1)
                                if (e = Xt.splice(o, 1)[0], navigator.msPointerEnabled) {
                                    var a = {
                                        4: "mouse",
                                        2: "touch",
                                        3: "pen"
                                    };
                                    if (e.type = a[t.pointerType], !e.type) e.type = t.pointerType || "mouse"
                                } else e.type = t.pointerType || "mouse"
                        }
                        var u = Je(t),
                            l, c = u.length;
                        if ("mouseup" === t.type) c = 0;
                        if (2 === c) return ve = null, true;
                        if (1 === c) wt(Zt, u[0]);
                        if (0 === c && !Ee && !Ae) {
                            if (!e)
                                if ("mouseup" === t.type) e = {
                                    x: t.pageX,
                                    y: t.pageY,
                                    type: "mouse"
                                };
                                else if (t.changedTouches && t.changedTouches[0]) e = {
                                x: t.changedTouches[0].pageX,
                                y: t.changedTouches[0].pageY,
                                type: "touch"
                            };
                            ct("touchRelease", t, e)
                        }
                        var f = -1;
                        if (0 === c)
                            if (ue = false, n.unbind(window, w, i), Fe(), ye) f = 0;
                            else if (-1 !== se) f = ft() - se;
                        if (se = 1 === c ? ft() : -1, -1 !== f && f < 150) l = "zoom";
                        else l = "swipe";
                        if (ye && c < 2) {
                            if (ye = false, 1 === c) l = "zoomPointerUp";
                            ct("zoomGestureEnded")
                        }
                        if (ve = null, fe || ce || Ae || ie) {
                            if (Ut(), !Qt) Qt = on();
                            if (Qt.calculateSwipeSpeed("x"), !ie) {
                                if ((ge || Ae) && 0 === c) {
                                    var h;
                                    if (sn(l, Qt)) return;
                                    l = "zoomPointerUp"
                                }
                                if (!Ae) {
                                    if ("swipe" !== l) return ln(), void 0;
                                    if (!ge && x > i.currItem.fitRatio) an(Qt)
                                }
                            } else {
                                var p;
                                if (Ge() < s.verticalDragRange) i.close();
                                else {
                                    var m = y.y,
                                        g = Le;
                                    qt("verticalDrag", 0, 1, 300, n.easing.cubic.out, (function (t) {
                                        y.y = (i.currItem.initialPosition.y - m) * t + m, dt((1 - g) * t + g), pt()
                                    })), ct("onVerticalDrag", 1)
                                }
                            }
                        }
                    },
                    on = function () {
                        var t, e, i = {
                            lastFlickOffset: {},
                            lastFlickDist: {},
                            lastFlickSpeed: {},
                            slowDownRatio: {},
                            slowDownRatioReverse: {},
                            speedDecelerationRatio: {},
                            speedDecelerationRatioAbs: {},
                            distanceOffset: {},
                            backAnimDestination: {},
                            backAnimStarted: {},
                            calculateSwipeSpeed: function (n) {
                                if (te.length > 1) t = ft() - Wt + 50, e = te[te.length - 2][n];
                                else t = ft() - Yt, e = Zt[n];
                                if (i.lastFlickOffset[n] = Kt[n] - e, i.lastFlickDist[n] = Math.abs(i.lastFlickOffset[n]), i.lastFlickDist[n] > 20) i.lastFlickSpeed[n] = i.lastFlickOffset[n] / t;
                                else i.lastFlickSpeed[n] = 0;
                                if (Math.abs(i.lastFlickSpeed[n]) < .1) i.lastFlickSpeed[n] = 0;
                                i.slowDownRatio[n] = .95, i.slowDownRatioReverse[n] = 1 - i.slowDownRatio[n], i.speedDecelerationRatio[n] = 1
                            },
                            calculateOverBoundsAnimOffset: function (t, e) {
                                if (!i.backAnimStarted[t]) {
                                    if (y[t] > Ce.min[t]) i.backAnimDestination[t] = Ce.min[t];
                                    else if (y[t] < Ce.max[t]) i.backAnimDestination[t] = Ce.max[t];
                                    if (void 0 !== i.backAnimDestination[t])
                                        if (i.slowDownRatio[t] = .7, i.slowDownRatioReverse[t] = 1 - i.slowDownRatio[t], i.speedDecelerationRatioAbs[t] < .05) i.lastFlickSpeed[t] = 0, i.backAnimStarted[t] = true, qt("bounceZoomPan" + t, y[t], i.backAnimDestination[t], e || 300, n.easing.sine.out, (function (e) {
                                            y[t] = e, pt()
                                        }))
                                }
                            },
                            calculateAnimOffset: function (t) {
                                if (!i.backAnimStarted[t]) i.speedDecelerationRatio[t] = i.speedDecelerationRatio[t] * (i.slowDownRatio[t] + i.slowDownRatioReverse[t] - i.slowDownRatioReverse[t] * i.timeDiff / 10), i.speedDecelerationRatioAbs[t] = Math.abs(i.lastFlickSpeed[t] * i.speedDecelerationRatio[t]), i.distanceOffset[t] = i.lastFlickSpeed[t] * i.speedDecelerationRatio[t] * i.timeDiff, y[t] += i.distanceOffset[t]
                            },
                            panAnimLoop: function () {
                                if (Bt.zoomPan)
                                    if (Bt.zoomPan.raf = G(i.panAnimLoop), i.now = ft(), i.timeDiff = i.now - i.lastNow, i.lastNow = i.now, i.calculateAnimOffset("x"), i.calculateAnimOffset("y"), pt(), i.calculateOverBoundsAnimOffset("x"), i.calculateOverBoundsAnimOffset("y"), i.speedDecelerationRatioAbs.x < .05 && i.speedDecelerationRatioAbs.y < .05) return y.x = Math.round(y.x), y.y = Math.round(y.y), pt(), Ft("zoomPan"), void 0
                            }
                        };
                        return i
                    },
                    an = function (t) {
                        if (t.calculateSwipeSpeed("y"), Ce = i.currItem.bounds, t.backAnimDestination = {}, t.backAnimStarted = {}, Math.abs(t.lastFlickSpeed.x) <= .05 && Math.abs(t.lastFlickSpeed.y) <= .05) return t.speedDecelerationRatioAbs.x = t.speedDecelerationRatioAbs.y = 0, t.calculateOverBoundsAnimOffset("x"), t.calculateOverBoundsAnimOffset("y"), true;
                        Nt("zoomPan"), t.lastNow = ft(), t.panAnimLoop()
                    },
                    sn = function (t, e) {
                        var o, a, u;
                        if (!Ae) oe = h;
                        if ("swipe" === t) {
                            var l = Kt.x - Zt.x,
                                c = e.lastFlickDist.x < 10;
                            if (l > Ht && (c || e.lastFlickOffset.x > 20)) a = -1;
                            else if (l < -Ht && (c || e.lastFlickOffset.x < -20)) a = 1
                        }
                        if (a) {
                            if ((h += a) < 0) h = s.loop ? wn() - 1 : 0, u = true;
                            else if (h >= wn()) h = s.loop ? 0 : wn() - 1, u = true;
                            if (!u || s.loop) B += a, k -= a, o = true
                        }
                        var f = L.x * k,
                            p = Math.abs(f - Se.x),
                            m;
                        if (!o && f > Se.x != e.lastFlickSpeed.x > 0) m = 333;
                        else m = Math.abs(e.lastFlickSpeed.x) > 0 ? p / Math.abs(e.lastFlickSpeed.x) : 333, m = Math.min(m, 400), m = Math.max(m, 250);
                        if (oe === h) o = false;
                        if (Ae = true, ct("mainScrollAnimStart"), qt("mainScroll", Se.x, f, m, n.easing.cubic.out, vt, (function () {
                                if (Ut(), Ae = false, oe = -1, o || oe !== h) i.updateCurrItem();
                                ct("mainScrollAnimComplete")
                            })), o) i.updateCurrItem(true);
                        return o
                    },
                    un = function (t) {
                        return 1 / be * t * A
                    },
                    ln = function () {
                        var t = x,
                            e = Tt(),
                            o = Dt();
                        if (x < e) t = e;
                        else if (x > o) t = o;
                        var a = 1,
                            s, u = Le;
                        if (ke && !ne && !Pe && x < e) return i.close(), true;
                        if (ke) s = function (t) {
                            dt((a - u) * t + u)
                        };
                        return i.zoomTo(t, 0, 200, n.easing.cubic.out, s), true
                    };
                at("Gestures", {
                    publicMethods: {
                        initGestures: function () {
                            var t = function (t, e, move, n, i) {
                                if (F = t + e, N = t + move, U = t + n, i) z = t + i;
                                else z = ""
                            };
                            if (($ = tt.pointerEvent) && tt.touch) tt.touch = false;
                            if ($)
                                if (navigator.msPointerEnabled) t("MSPointer", "Down", "Move", "Up", "Cancel");
                                else t("pointer", "down", "move", "up", "cancel");
                            else if (tt.touch) t("touch", "start", "move", "end", "cancel"), W = true;
                            else t("mouse", "down", "move", "up");
                            if (w = N + " " + U + " " + z, b = F, $ && !W) W = navigator.maxTouchPoints > 1 || navigator.msMaxTouchPoints > 1;
                            if (i.likelyTouchDevice = W, C[F] = tn, C[N] = en, C[U] = rn, z) C[z] = C[U];
                            if (tt.touch) b += " mousedown", w += " mousemove mouseup", C.mousedown = C[F], C.mousemove = C[N], C.mouseup = C[U];
                            if (!W) s.allowPanToNext = false
                        }
                    }
                });
                var cn, fn = function (t, e, o, a) {
                        if (cn) clearTimeout(cn);
                        var u;
                        if (gn = true, mn = true, t.initialLayout) u = t.initialLayout, t.initialLayout = null;
                        else u = s.getThumbBoundsFn && s.getThumbBoundsFn(h);
                        var l = o ? s.hideAnimationDuration : s.showAnimationDuration,
                            c = function () {
                                if (Ft("initialZoom"), !o) {
                                    if (dt(1), e) e.style.display = "block";
                                    n.addClass(template, "pswp--animated-in"), ct("initialZoom" + (o ? "OutEnd" : "InEnd"))
                                } else i.template.removeAttribute("style"), i.bg.removeAttribute("style");
                                if (a) a();
                                gn = false
                            };
                        if (l && u && void 0 !== u.x) {
                            var p;
                            (function () {
                                var e = f,
                                    a = !i.currItem.src || i.currItem.loadError || s.showHideOpacity;
                                if (t.miniImg) t.miniImg.style.webkitBackfaceVisibility = "hidden";
                                if (!o) x = u.w / t.w, y.x = u.x, y.y = u.y - Z, i[a ? "template" : "bg"].style.opacity = .001, pt();
                                if (Nt("initialZoom"), o && !e) n.removeClass(template, "pswp--animated-in");
                                if (a)
                                    if (o) n[(e ? "remove" : "add") + "Class"](template, "pswp--animate_opacity");
                                    else setTimeout((function () {
                                        n.addClass(template, "pswp--animate_opacity")
                                    }), 30);
                                cn = setTimeout((function () {
                                    if (ct("initialZoom" + (o ? "Out" : "In")), !o) {
                                        if (x = t.initialZoomLevel, wt(y, t.initialPosition), pt(), dt(1), a) template.style.opacity = 1;
                                        else dt(1);
                                        cn = setTimeout(c, l + 20)
                                    } else {
                                        var i = u.w / t.w,
                                            s = {
                                                x: y.x,
                                                y: y.y
                                            },
                                            f = x,
                                            h = Le,
                                            p = function (t) {
                                                if (1 === t) x = i, y.x = u.x, y.y = u.y - J;
                                                else x = (i - f) * t + f, y.x = (u.x - s.x) * t + s.x, y.y = (u.y - J - s.y) * t + s.y;
                                                if (pt(), a) template.style.opacity = 1 - t;
                                                else dt(h - t * h)
                                            };
                                        if (e) qt("initialZoom", 0, 1, l, n.easing.cubic.out, p, c);
                                        else p(1), cn = setTimeout(c, l + 20)
                                    }
                                }), o ? 25 : 90)
                            })()
                        } else if (ct("initialZoom" + (o ? "Out" : "In")), x = t.initialZoomLevel, wt(y, t.initialPosition), pt(), template.style.opacity = o ? 0 : 1, dt(1), l) setTimeout((function () {
                            c()
                        }), l);
                        else c()
                    },
                    dn, hn = {},
                    pn = [],
                    mn, gn, vn = {
                        index: 0,
                        errorMsg: '<div class="pswp__error-msg"><a href="%url%" target="_blank">The image</a> could not be loaded.</div>',
                        forceProgressiveLoading: false,
                        preload: [1, 1],
                        getNumItemsFn: function () {
                            return dn.length
                        }
                    },
                    yn, wn, bn, Cn = function () {
                        return {
                            center: {
                                x: 0,
                                y: 0
                            },
                            max: {
                                x: 0,
                                y: 0
                            },
                            min: {
                                x: 0,
                                y: 0
                            }
                        }
                    },
                    Sn = function (t, e, n) {
                        var i = t.bounds;
                        i.center.x = Math.round((hn.x - e) / 2), i.center.y = Math.round((hn.y - n) / 2) + t.vGap.top, i.max.x = e > hn.x ? Math.round(hn.x - e) : i.center.x, i.max.y = n > hn.y ? Math.round(hn.y - n) + t.vGap.top : i.center.y, i.min.x = e > hn.x ? 0 : i.center.x, i.min.y = n > hn.y ? t.vGap.top : i.center.y
                    },
                    xn = function (t, e, n) {
                        if (t.src && !t.loadError) {
                            var i = !n;
                            if (i) {
                                if (!t.vGap) t.vGap = {
                                    top: 0,
                                    bottom: 0
                                };
                                ct("parseVerticalMargin", t)
                            }
                            if (hn.x = e.x, hn.y = e.y - t.vGap.top - t.vGap.bottom, i) {
                                var o = hn.x / t.w,
                                    a = hn.y / t.h;
                                t.fitRatio = o < a ? o : a;
                                var u = s.scaleMode;
                                if ("orig" === u) n = 1;
                                else if ("fit" === u) n = t.fitRatio;
                                if (n > 1) n = 1;
                                if (t.initialZoomLevel = n, !t.bounds) t.bounds = {
                                    center: {
                                        x: 0,
                                        y: 0
                                    },
                                    max: {
                                        x: 0,
                                        y: 0
                                    },
                                    min: {
                                        x: 0,
                                        y: 0
                                    }
                                }
                            }
                            if (!n) return;
                            if (Sn(t, t.w * n, t.h * n), i && n === t.initialZoomLevel) t.initialPosition = t.bounds.center;
                            return t.bounds
                        } else return t.w = t.h = 0, t.initialZoomLevel = t.fitRatio = 1, t.bounds = {
                            center: {
                                x: 0,
                                y: 0
                            },
                            max: {
                                x: 0,
                                y: 0
                            },
                            min: {
                                x: 0,
                                y: 0
                            }
                        }, t.initialPosition = t.bounds.center, t.bounds
                    },
                    An = function (index, t, e, n, o, a) {
                        if (!t.loadError)
                            if (n)
                                if (t.imageAppended = true, En(t, n, t === i.currItem && rt), e.appendChild(n), a) setTimeout((function () {
                                    if (t && t.loaded && t.placeholder) t.placeholder.style.display = "none", t.placeholder = null
                                }), 500)
                    },
                    _n = function (t) {
                        t.loading = true, t.loaded = false;
                        var e = t.img = n.createEl("pswp__img", "img"),
                            i = function () {
                                if (t.loading = false, t.loaded = true, t.loadComplete) t.loadComplete(t);
                                else t.img = null;
                                e.onload = e.onerror = null, e = null
                            };
                        return e.onload = i, e.onerror = function () {
                            t.loadError = true, i()
                        }, e.src = t.src, e
                    },
                    Tn = function (t, e) {
                        if (t.src && t.loadError && t.container) {
                            if (e) t.container.innerHTML = "";
                            return t.container.innerHTML = s.errorMsg.replace("%url%", t.src), true
                        }
                    },
                    En = function (t, e, n) {
                        if (t.src) {
                            if (!e) e = t.container.lastChild;
                            var i = n ? t.w : Math.round(t.w * t.fitRatio),
                                o = n ? t.h : Math.round(t.h * t.fitRatio);
                            if (t.placeholder && !t.loaded) t.placeholder.style.width = i + "px", t.placeholder.style.height = o + "px";
                            e.style.width = i + "px", e.style.height = o + "px"
                        }
                    },
                    In = function () {
                        if (pn.length) {
                            for (var t, e = 0; e < pn.length; e++)
                                if ((t = pn[e]).holder.index === t.index) An(t.index, t.item, t.baseDiv, t.img, false, t.clearPlaceholder);
                            pn = []
                        }
                    };
                at("Controller", {
                    publicMethods: {
                        lazyLoadItem: function (index) {
                            index = st(index);
                            var t = yn(index);
                            if (t && (!t.loaded && !t.loading || I))
                                if (ct("gettingData", index, t), t.src) _n(t)
                        },
                        initController: function () {
                            if (n.extend(s, vn, true), i.items = dn = items, yn = i.getItemAt, wn = s.getNumItemsFn, bn = s.loop, wn() < 3) s.loop = false;
                            lt("beforeChange", (function (diff) {
                                var t = s.preload,
                                    e = null === diff ? true : diff >= 0,
                                    n = Math.min(t[0], wn()),
                                    o = Math.min(t[1], wn()),
                                    a;
                                for (a = 1; a <= (e ? o : n); a++) i.lazyLoadItem(h + a);
                                for (a = 1; a <= (e ? n : o); a++) i.lazyLoadItem(h - a)
                            })), lt("initialLayout", (function () {
                                i.currItem.initialLayout = s.getThumbBoundsFn && s.getThumbBoundsFn(h)
                            })), lt("mainScrollAnimComplete", In), lt("initialZoomInEnd", In), lt("destroy", (function () {
                                for (var t, e = 0; e < dn.length; e++) {
                                    if ((t = dn[e]).container) t.container = null;
                                    if (t.placeholder) t.placeholder = null;
                                    if (t.img) t.img = null;
                                    if (t.preloader) t.preloader = null;
                                    if (t.loadError) t.loaded = t.loadError = false
                                }
                                pn = null
                            }))
                        },
                        getItemAt: function (index) {
                            if (index >= 0) return void 0 !== dn[index] ? dn[index] : false;
                            else return false
                        },
                        allowProgressiveImg: function () {
                            return s.forceProgressiveLoading || !W || s.mouseUsed || screen.width > 1200
                        },
                        setContent: function (t, index) {
                            if (s.loop) index = st(index);
                            var e = i.getItemAt(t.index);
                            if (e) e.container = null;
                            var o = i.getItemAt(index),
                                a;
                            if (!o) return t.el.innerHTML = "", void 0;
                            ct("gettingData", index, o), t.index = index, t.item = o;
                            var u = o.container = n.createEl("pswp__zoom-wrap");
                            if (!o.src && o.html)
                                if (o.html.tagName) u.appendChild(o.html);
                                else u.innerHTML = o.html;
                            if (Tn(o), xn(o, S), o.src && !o.loadError && !o.loaded) {
                                if (o.loadComplete = function (e) {
                                        if (l) {
                                            if (t && t.index === index) {
                                                if (Tn(e, true)) {
                                                    if (e.loadComplete = e.img = null, xn(e, S), mt(e), t.index === h) i.updateCurrZoomItem();
                                                    return
                                                }
                                                if (!e.imageAppended)
                                                    if (tt.transform && (Ae || gn)) pn.push({
                                                        item: e,
                                                        baseDiv: u,
                                                        img: e.img,
                                                        index: index,
                                                        holder: t,
                                                        clearPlaceholder: true
                                                    });
                                                    else An(index, e, u, e.img, Ae || gn, true);
                                                else if (!gn && e.placeholder) e.placeholder.style.display = "none", e.placeholder = null
                                            }
                                            e.loadComplete = null, e.img = null, ct("imageLoadComplete", index, e)
                                        }
                                    }, n.features.transform) {
                                    var c = "pswp__img pswp__img--placeholder";
                                    c += o.msrc ? "" : " pswp__img--placeholder--blank";
                                    var placeholder = n.createEl(c, o.msrc ? "img" : "");
                                    if (o.msrc) placeholder.src = o.msrc;
                                    En(o, placeholder), u.appendChild(placeholder), o.placeholder = placeholder
                                }
                                if (!o.loading) _n(o);
                                if (i.allowProgressiveImg())
                                    if (!mn && tt.transform) pn.push({
                                        item: o,
                                        baseDiv: u,
                                        img: o.img,
                                        index: index,
                                        holder: t
                                    });
                                    else An(index, o, u, o.img, true, true)
                            } else if (o.src && !o.loadError)(a = n.createEl("pswp__img", "img")).style.opacity = 1, a.src = o.src, En(o, a), An(index, o, u, a, true);
                            if (!mn && index === h) xe = u.style, fn(o, a || o.img);
                            else mt(o);
                            t.el.innerHTML = "", t.el.appendChild(u)
                        },
                        cleanSlide: function (t) {
                            if (t.img) t.img.onload = t.img.onerror = null;
                            t.loaded = t.loading = t.img = t.imageAppended = false
                        }
                    }
                });
                var Dn, kn = {},
                    Mn = function (t, e, n) {
                        var i = document.createEvent("CustomEvent"),
                            o = {
                                origEvent: t,
                                target: t.target,
                                releasePoint: e,
                                pointerType: n || "touch"
                            };
                        i.initCustomEvent("pswpTap", true, true, o), t.target.dispatchEvent(i)
                    },
                    Ln;
                at("Tap", {
                    publicMethods: {
                        initTap: function () {
                            lt("firstTouchStart", i.onTapStart), lt("touchRelease", i.onTapRelease), lt("destroy", (function () {
                                kn = {}, Dn = null
                            }))
                        },
                        onTapStart: function (t) {
                            if (t.length > 1) clearTimeout(Dn), Dn = null
                        },
                        onTapRelease: function (t, e) {
                            if (e)
                                if (!fe && !le && !Rt) {
                                    var i = e,
                                        o;
                                    if (Dn)
                                        if (clearTimeout(Dn), Dn = null, Be(i, kn)) return ct("doubleTap", i), void 0;
                                    if ("mouse" === e.type) return Mn(t, e, "mouse"), void 0;
                                    if ("BUTTON" === t.target.tagName.toUpperCase() || n.hasClass(t.target, "pswp__single-tap")) return Mn(t, e), void 0;
                                    wt(kn, i), Dn = setTimeout((function () {
                                        Mn(t, e), Dn = null
                                    }), 300)
                                }
                        }
                    }
                }), at("DesktopZoom", {
                    publicMethods: {
                        initDesktopZoom: function () {
                            if (!X)
                                if (W) lt("mouseUsed", (function () {
                                    i.setupDesktopZoom()
                                }));
                                else i.setupDesktopZoom(true)
                        },
                        setupDesktopZoom: function (t) {
                            Ln = {};
                            var events = "wheel mousewheel DOMMouseScroll";
                            lt("bindEvents", (function () {
                                n.bind(template, events, i.handleMouseWheel)
                            })), lt("unbindEvents", (function () {
                                if (Ln) n.unbind(template, events, i.handleMouseWheel)
                            })), i.mouseZoomedIn = false;
                            var e, o = function () {
                                    if (i.mouseZoomedIn) n.removeClass(template, "pswp--zoomed-in"), i.mouseZoomedIn = false;
                                    if (x < 1) n.addClass(template, "pswp--zoom-allowed");
                                    else n.removeClass(template, "pswp--zoom-allowed");
                                    a()
                                },
                                a = function () {
                                    if (e) n.removeClass(template, "pswp--dragging"), e = false
                                };
                            if (lt("resize", o), lt("afterChange", o), lt("pointerDown", (function () {
                                    if (i.mouseZoomedIn) e = true, n.addClass(template, "pswp--dragging")
                                })), lt("pointerUp", a), !t) o()
                        },
                        handleMouseWheel: function (t) {
                            if (x <= i.currItem.fitRatio) {
                                if (s.modal)
                                    if (!s.closeOnScroll || Rt || ue) t.preventDefault();
                                    else if (H && Math.abs(t.deltaY) > 2) f = true, i.close();
                                return true
                            }
                            if (t.stopPropagation(), Ln.x = 0, "deltaX" in t)
                                if (1 === t.deltaMode) Ln.x = 18 * t.deltaX, Ln.y = 18 * t.deltaY;
                                else Ln.x = t.deltaX, Ln.y = t.deltaY;
                            else if ("wheelDelta" in t) {
                                if (t.wheelDeltaX) Ln.x = -.16 * t.wheelDeltaX;
                                if (t.wheelDeltaY) Ln.y = -.16 * t.wheelDeltaY;
                                else Ln.y = -.16 * t.wheelDelta
                            } else if ("detail" in t) Ln.y = t.detail;
                            else return;
                            _t(x, true);
                            var e = y.x - Ln.x,
                                n = y.y - Ln.y;
                            if (s.modal || e <= Ce.min.x && e >= Ce.max.x && n <= Ce.min.y && n >= Ce.max.y) t.preventDefault();
                            i.panTo(e, n)
                        },
                        toggleDesktopZoom: function (t) {
                            t = t || {
                                x: S.x / 2 + M.x,
                                y: S.y / 2 + M.y
                            };
                            var e = s.getDoubleTapZoom(true, i.currItem),
                                o = x === e;
                            i.mouseZoomedIn = !o, i.zoomTo(o ? i.currItem.initialZoomLevel : e, t, 333), n[(!o ? "add" : "remove") + "Class"](template, "pswp--zoomed-in")
                        }
                    }
                });
                var Pn = {
                        history: true,
                        galleryUID: 1
                    },
                    On, Bn, Rn, Fn, Nn, Un, qn, zn, Hn, $n, Yn, Wn, Vn = function () {
                        return Yn.hash.substring(1)
                    },
                    Gn = function () {
                        if (On) clearTimeout(On);
                        if (Rn) clearTimeout(Rn)
                    },
                    jn = function () {
                        var hash = Vn(),
                            t = {};
                        if (hash.length < 5) return t;
                        var e, n = hash.split("&");
                        for (e = 0; e < n.length; e++)
                            if (n[e]) {
                                var i = n[e].split("=");
                                if (!(i.length < 2)) t[i[0]] = i[1]
                            } if (s.galleryPIDs) {
                            var o = t.pid;
                            for (t.pid = 0, e = 0; e < dn.length; e++)
                                if (dn[e].pid === o) {
                                    t.pid = e;
                                    break
                                }
                        } else t.pid = parseInt(t.pid, 10) - 1;
                        if (t.pid < 0) t.pid = 0;
                        return t
                    },
                    Kn = function () {
                        if (Rn) clearTimeout(Rn);
                        if (Rt || ue) return Rn = setTimeout(Kn, 500), void 0;
                        if (Fn) clearTimeout(Bn);
                        else Fn = true;
                        var t = h + 1,
                            e = yn(h);
                        if (e.hasOwnProperty("pid")) t = e.pid;
                        var n = qn + "&" + "gid=" + s.galleryUID + "&" + "pid=" + t;
                        if (!zn)
                            if (-1 === Yn.hash.indexOf(n)) $n = true;
                        var i = Yn.href.split("#")[0] + "#" + n;
                        if (Wn) {
                            if ("#" + n !== window.location.hash) history[zn ? "replaceState" : "pushState"]("", document.title, i)
                        } else if (zn) Yn.replace(i);
                        else Yn.hash = n;
                        zn = true, Bn = setTimeout((function () {
                            Fn = false
                        }), 60)
                    };
                at("History", {
                    publicMethods: {
                        initHistory: function () {
                            if (n.extend(s, Pn, true), s.history) {
                                if (Yn = window.location, $n = false, Hn = false, zn = false, qn = Vn(), Wn = "pushState" in history, qn.indexOf("gid=") > -1) qn = (qn = qn.split("&gid=")[0]).split("?gid=")[0];
                                lt("afterChange", i.updateURL), lt("unbindEvents", (function () {
                                    n.unbind(window, "hashchange", i.onHashChange)
                                }));
                                var t = function () {
                                    if (Un = true, !Hn)
                                        if ($n) history.back();
                                        else if (qn) Yn.hash = qn;
                                    else if (Wn) history.pushState("", document.title, Yn.pathname + Yn.search);
                                    else Yn.hash = "";
                                    Gn()
                                };
                                lt("unbindEvents", (function () {
                                    if (f) t()
                                })), lt("destroy", (function () {
                                    if (!Un) t()
                                })), lt("firstUpdate", (function () {
                                    h = jn().pid
                                }));
                                var index = qn.indexOf("pid=");
                                if (index > -1)
                                    if ("&" === (qn = qn.substring(0, index)).slice(-1)) qn = qn.slice(0, -1);
                                setTimeout((function () {
                                    if (l) n.bind(window, "hashchange", i.onHashChange)
                                }), 40)
                            }
                        },
                        onHashChange: function () {
                            if (Vn() === qn) return Hn = true, i.close(), void 0;
                            if (!Fn) Nn = true, i.goTo(jn().pid), Nn = false
                        },
                        updateURL: function () {
                            if (Gn(), !Nn)
                                if (!zn) Kn();
                                else On = setTimeout(Kn, 800)
                        }
                    }
                }), n.extend(i, zt)
            };
            return t
        }))
    },
    12055: function (t, e, n) {
        "use strict";
        var i, o;
        /*! PhotoSwipe Default UI - 4.1.3 - 2019-01-08
         * http://photoswipe.com
         * Copyright (c) 2019 Dmitry Semenov; */
        ! function (a, factory) {
            if (true) !(void 0 !== (o = "function" == typeof (i = factory) ? i.call(e, n, e, t) : i) && (t.exports = o));
            else if ("object" == typeof e) t.exports = factory();
            else a.PhotoSwipeUI_Default = factory()
        }(this, (function () {
            var t;
            return function (t, e) {
                var n = this,
                    i = false,
                    o = true,
                    a, s, u, l, c, f, h, p = true,
                    m, g, v, y, w, b, C, S, x = {
                        barsSize: {
                            top: 44,
                            bottom: "auto"
                        },
                        closeElClasses: ["item", "caption", "zoom-wrap", "ui", "top-bar"],
                        timeToIdle: 4e3,
                        timeToIdleOutside: 1e3,
                        loadingIndicatorDelay: 1e3,
                        addCaptionHTMLFn: function (t, e) {
                            if (!t.title) return e.children[0].innerHTML = "", false;
                            else return e.children[0].innerHTML = t.title, true
                        },
                        closeEl: true,
                        captionEl: true,
                        fullscreenEl: true,
                        zoomEl: true,
                        shareEl: true,
                        counterEl: true,
                        arrowEl: true,
                        preloaderEl: true,
                        tapToClose: false,
                        tapToToggleControls: true,
                        clickToCloseNonZoomable: true,
                        shareButtons: [{
                            id: "facebook",
                            label: "Share on Facebook",
                            url: "https://www.facebook.com/sharer/sharer.php?u={{url}}"
                        }, {
                            id: "twitter",
                            label: "Tweet",
                            url: "https://twitter.com/intent/tweet?text={{text}}&url={{url}}"
                        }, {
                            id: "pinterest",
                            label: "Pin it",
                            url: "http://www.pinterest.com/pin/create/button/" + "?url={{url}}&media={{image_url}}&description={{text}}"
                        }, {
                            id: "download",
                            label: "Download image",
                            url: "{{raw_image_url}}",
                            download: true
                        }],
                        getImageURLForShare: function () {
                            return t.currItem.src || ""
                        },
                        getPageURLForShare: function () {
                            return window.location.href
                        },
                        getTextForShare: function () {
                            return t.currItem.title || ""
                        },
                        indexIndicatorSep: " / ",
                        fitControlsWidth: 1200
                    },
                    A, _, T = function (t) {
                        if (A) return true;
                        if (t = t || window.event, S.timeToIdle && S.mouseUsed && !g) z();
                        for (var n, i, o = (t.target || t.srcElement).getAttribute("class") || "", a, s = 0; s < K.length; s++)
                            if ((i = K[s]).onTap && o.indexOf("pswp__" + i.name) > -1) i.onTap(), a = true;
                        if (a) {
                            if (t.stopPropagation) t.stopPropagation();
                            A = true;
                            var u = e.features.isOldAndroid ? 600 : 30;
                            _ = setTimeout((function () {
                                A = false
                            }), u)
                        }
                    },
                    E = function () {
                        return !t.likelyTouchDevice || S.mouseUsed || screen.width > S.fitControlsWidth
                    },
                    I = function (el, t, add) {
                        e[(add ? "add" : "remove") + "Class"](el, "pswp__" + t)
                    },
                    k = function () {
                        var t = 1 === S.getNumItemsFn();
                        if (t !== C) I(s, "ui--one-slide", t), C = t
                    },
                    M = function () {
                        I(h, "share-modal--hidden", p)
                    },
                    L = function () {
                        if (!(p = !p)) M(), setTimeout((function () {
                            if (!p) e.addClass(h, "pswp__share-modal--fade-in")
                        }), 30);
                        else e.removeClass(h, "pswp__share-modal--fade-in"), setTimeout((function () {
                            if (p) M()
                        }), 300);
                        if (!p) O();
                        return false
                    },
                    P = function (e) {
                        var n = (e = e || window.event).target || e.srcElement;
                        if (t.shout("shareLinkClick", e, n), !n.href) return false;
                        if (n.hasAttribute("download")) return true;
                        if (window.open(n.href, "pswp_share", "scrollbars=yes,resizable=yes,toolbar=no," + "location=yes,width=550,height=420,top=100,left=" + (window.screen ? Math.round(screen.width / 2 - 275) : 100)), !p) L();
                        return false
                    },
                    O = function () {
                        for (var t = "", e, n, i, o, a, s = 0; s < S.shareButtons.length; s++)
                            if (e = S.shareButtons[s], i = S.getImageURLForShare(e), o = S.getPageURLForShare(e), a = S.getTextForShare(e), t += '<a href="' + (n = e.url.replace("{{url}}", encodeURIComponent(o)).replace("{{image_url}}", encodeURIComponent(i)).replace("{{raw_image_url}}", i).replace("{{text}}", encodeURIComponent(a))) + '" target="_blank" ' + 'class="pswp__share--' + e.id + '"' + (e.download ? "download" : "") + ">" + e.label + "</a>", S.parseShareButtonOut) t = S.parseShareButtonOut(e, t);
                        h.children[0].innerHTML = t, h.children[0].onclick = P
                    },
                    B = function (t) {
                        for (var n = 0; n < S.closeElClasses.length; n++)
                            if (e.hasClass(t, "pswp__" + S.closeElClasses[n])) return true
                    },
                    F, N, U = 0,
                    z = function () {
                        if (clearTimeout(N), U = 0, g) n.setIdle(false)
                    },
                    H = function (t) {
                        var e = (t = t ? t : window.event).relatedTarget || t.toElement;
                        if (!e || "HTML" === e.nodeName) clearTimeout(N), N = setTimeout((function () {
                            n.setIdle(true)
                        }), S.timeToIdleOutside)
                    },
                    $ = function () {
                        if (S.fullscreenEl && !e.features.isOldAndroid) {
                            if (!a) a = n.getFullscreenAPI();
                            if (a) e.bind(document, a.eventK, n.updateFullscreen), n.updateFullscreen(), e.addClass(t.template, "pswp--supports-fs");
                            else e.removeClass(t.template, "pswp--supports-fs")
                        }
                    },
                    Y = function () {
                        if (S.preloaderEl) W(true), v("beforeChange", (function () {
                            clearTimeout(b), b = setTimeout((function () {
                                if (t.currItem && t.currItem.loading) {
                                    if (!t.allowProgressiveImg() || t.currItem.img && !t.currItem.img.naturalWidth) W(false)
                                } else W(true)
                            }), S.loadingIndicatorDelay)
                        })), v("imageLoadComplete", (function (index, e) {
                            if (t.currItem === e) W(true)
                        }))
                    },
                    W = function (t) {
                        if (w !== t) I(y, "preloader--active", !t), w = t
                    },
                    V = function (t) {
                        var n = t.vGap;
                        if (E()) {
                            var i = S.barsSize;
                            if (S.captionEl && "auto" === i.bottom) {
                                if (!l)(l = e.createEl("pswp__caption pswp__caption--fake")).appendChild(e.createEl("pswp__caption__center")), s.insertBefore(l, u), e.addClass(s, "pswp__ui--fit");
                                if (S.addCaptionHTMLFn(t, l, true)) {
                                    var o = l.clientHeight;
                                    n.bottom = parseInt(o, 10) || 44
                                } else n.bottom = i.top
                            } else n.bottom = "auto" === i.bottom ? 0 : i.bottom;
                            n.top = i.top
                        } else n.top = n.bottom = 0
                    },
                    G = function () {
                        if (S.timeToIdle) v("mouseUsed", (function () {
                            e.bind(document, "mousemove", z), e.bind(document, "mouseout", H), F = setInterval((function () {
                                if (2 === ++U) n.setIdle(true)
                            }), S.timeToIdle / 2)
                        }))
                    },
                    j = function () {
                        var t;
                        v("onVerticalDrag", (function (t) {
                            if (o && t < .95) n.hideControls();
                            else if (!o && t >= .95) n.showControls()
                        })), v("onPinchClose", (function (e) {
                            if (o && e < .9) n.hideControls(), t = true;
                            else if (t && !o && e > .9) n.showControls()
                        })), v("zoomGestureEnded", (function () {
                            if ((t = false) && !o) n.showControls()
                        }))
                    },
                    K = [{
                        name: "caption",
                        option: "captionEl",
                        onInit: function (el) {
                            u = el
                        }
                    }, {
                        name: "share-modal",
                        option: "shareEl",
                        onInit: function (el) {
                            h = el
                        },
                        onTap: function () {
                            L()
                        }
                    }, {
                        name: "button--share",
                        option: "shareEl",
                        onInit: function (el) {
                            f = el
                        },
                        onTap: function () {
                            L()
                        }
                    }, {
                        name: "button--zoom",
                        option: "zoomEl",
                        onTap: t.toggleDesktopZoom
                    }, {
                        name: "counter",
                        option: "counterEl",
                        onInit: function (el) {
                            c = el
                        }
                    }, {
                        name: "button--close",
                        option: "closeEl",
                        onTap: t.close
                    }, {
                        name: "button--arrow--left",
                        option: "arrowEl",
                        onTap: t.prev
                    }, {
                        name: "button--arrow--right",
                        option: "arrowEl",
                        onTap: t.next
                    }, {
                        name: "button--fs",
                        option: "fullscreenEl",
                        onTap: function () {
                            if (a.isFullscreen()) a.exit();
                            else a.enter()
                        }
                    }, {
                        name: "preloader",
                        option: "preloaderEl",
                        onInit: function (el) {
                            y = el
                        }
                    }],
                    Z = function () {
                        var t, n, i, o = function (o) {
                            if (o)
                                for (var a = o.length, s = 0; s < a; s++) {
                                    t = o[s], n = t.className;
                                    for (var u = 0; u < K.length; u++)
                                        if (i = K[u], n.indexOf("pswp__" + i.name) > -1)
                                            if (S[i.option]) {
                                                if (e.removeClass(t, "pswp__element--disabled"), i.onInit) i.onInit(t)
                                            } else e.addClass(t, "pswp__element--disabled")
                                }
                        };
                        o(s.children);
                        var a = e.getChildByClass(s, "pswp__top-bar");
                        if (a) o(a.children)
                    };
                n.init = function () {
                    if (e.extend(t.options, x, true), S = t.options, s = e.getChildByClass(t.scrollWrap, "pswp__ui"), v = t.listen, j(), v("beforeChange", n.update), v("doubleTap", (function (e) {
                            var n = t.currItem.initialZoomLevel;
                            if (t.getZoomLevel() !== n) t.zoomTo(n, e, 333);
                            else t.zoomTo(S.getDoubleTapZoom(false, t.currItem), e, 333)
                        })), v("preventDragEvent", (function (t, e, n) {
                            var i = t.target || t.srcElement;
                            if (i && i.getAttribute("class") && t.type.indexOf("mouse") > -1 && (i.getAttribute("class").indexOf("__caption") > 0 || /(SMALL|STRONG|EM)/i.test(i.tagName))) n.prevent = false
                        })), v("bindEvents", (function () {
                            if (e.bind(s, "pswpTap click", T), e.bind(t.scrollWrap, "pswpTap", n.onGlobalTap), !t.likelyTouchDevice) e.bind(t.scrollWrap, "mouseover", n.onMouseOver)
                        })), v("unbindEvents", (function () {
                            if (!p) L();
                            if (F) clearInterval(F);
                            if (e.unbind(document, "mouseout", H), e.unbind(document, "mousemove", z), e.unbind(s, "pswpTap click", T), e.unbind(t.scrollWrap, "pswpTap", n.onGlobalTap), e.unbind(t.scrollWrap, "mouseover", n.onMouseOver), a) {
                                if (e.unbind(document, a.eventK, n.updateFullscreen), a.isFullscreen()) S.hideAnimationDuration = 0, a.exit();
                                a = null
                            }
                        })), v("destroy", (function () {
                            if (S.captionEl) {
                                if (l) s.removeChild(l);
                                e.removeClass(u, "pswp__caption--empty")
                            }
                            if (h) h.children[0].onclick = null;
                            e.removeClass(s, "pswp__ui--over-close"), e.addClass(s, "pswp__ui--hidden"), n.setIdle(false)
                        })), !S.showAnimationDuration) e.removeClass(s, "pswp__ui--hidden");
                    if (v("initialZoomIn", (function () {
                            if (S.showAnimationDuration) e.removeClass(s, "pswp__ui--hidden")
                        })), v("initialZoomOut", (function () {
                            e.addClass(s, "pswp__ui--hidden")
                        })), v("parseVerticalMargin", V), Z(), S.shareEl && f && h) p = true;
                    k(), G(), $(), Y()
                }, n.setIdle = function (t) {
                    g = t, I(s, "ui--idle", t)
                }, n.update = function () {
                    if (o && t.currItem) {
                        if (n.updateIndexIndicator(), S.captionEl) S.addCaptionHTMLFn(t.currItem, u), I(u, "caption--empty", !t.currItem.title);
                        i = true
                    } else i = false;
                    if (!p) L();
                    k()
                }, n.updateFullscreen = function (n) {
                    if (n) setTimeout((function () {
                        t.setScrollOffset(0, e.getScrollY())
                    }), 50);
                    e[(a.isFullscreen() ? "add" : "remove") + "Class"](t.template, "pswp--fs")
                }, n.updateIndexIndicator = function () {
                    if (S.counterEl) c.innerHTML = t.getCurrentIndex() + 1 + S.indexIndicatorSep + S.getNumItemsFn()
                }, n.onGlobalTap = function (i) {
                    var a = (i = i || window.event).target || i.srcElement;
                    if (!A)
                        if (i.detail && "mouse" === i.detail.pointerType) {
                            if (B(a)) return t.close(), void 0;
                            if (e.hasClass(a, "pswp__img"))
                                if (1 === t.getZoomLevel() && t.getZoomLevel() <= t.currItem.fitRatio) {
                                    if (S.clickToCloseNonZoomable) t.close()
                                } else t.toggleDesktopZoom(i.detail.releasePoint)
                        } else {
                            if (S.tapToToggleControls)
                                if (o) n.hideControls();
                                else n.showControls();
                            if (S.tapToClose && (e.hasClass(a, "pswp__img") || B(a))) return t.close(), void 0
                        }
                }, n.onMouseOver = function (t) {
                    var e = (t = t || window.event).target || t.srcElement;
                    I(s, "ui--over-close", B(e))
                }, n.hideControls = function () {
                    e.addClass(s, "pswp__ui--hidden"), o = false
                }, n.showControls = function () {
                    if (o = true, !i) n.update();
                    e.removeClass(s, "pswp__ui--hidden")
                }, n.supportsFullscreen = function () {
                    var d = document;
                    return !!(d.exitFullscreen || d.mozCancelFullScreen || d.webkitExitFullscreen || d.msExitFullscreen)
                }, n.getFullscreenAPI = function () {
                    var e = document.documentElement,
                        n, i = "fullscreenchange";
                    if (e.requestFullscreen) n = {
                        enterK: "requestFullscreen",
                        exitK: "exitFullscreen",
                        elementK: "fullscreenElement",
                        eventK: i
                    };
                    else if (e.mozRequestFullScreen) n = {
                        enterK: "mozRequestFullScreen",
                        exitK: "mozCancelFullScreen",
                        elementK: "mozFullScreenElement",
                        eventK: "moz" + i
                    };
                    else if (e.webkitRequestFullscreen) n = {
                        enterK: "webkitRequestFullscreen",
                        exitK: "webkitExitFullscreen",
                        elementK: "webkitFullscreenElement",
                        eventK: "webkit" + i
                    };
                    else if (e.msRequestFullscreen) n = {
                        enterK: "msRequestFullscreen",
                        exitK: "msExitFullscreen",
                        elementK: "msFullscreenElement",
                        eventK: "MSFullscreenChange"
                    };
                    if (n) n.enter = function () {
                        if (m = S.closeOnScroll, S.closeOnScroll = false, "webkitRequestFullscreen" === this.enterK) t.template[this.enterK](Element.ALLOW_KEYBOARD_INPUT);
                        else return t.template[this.enterK]()
                    }, n.exit = function () {
                        return S.closeOnScroll = m, document[this.exitK]()
                    }, n.isFullscreen = function () {
                        return document[this.elementK]
                    };
                    return n
                }
            }
        }))
    },
    12056: function (t, e, n) {
        "use strict";
        var i = n(15);
        if (!window.Utility) window.Utility = {};
        Utility.decodeJsonAttribute = function (t) {
            return JSON.parse(decodeURIComponent(atob(t)))
        }, i(window.loadMapsContent)
    },
    12057: function (t, e, n) {
        "use strict";
        var i = n(15);
        n(12058), i(window).on("load", (function () {
            var t;
            if (!/Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent || navigator.vendor || window.opera)) {
                var items = i(".u-parallax");
                if (items.length > 0) {
                    items.each((function () {
                        var t = i(this);
                        if (t.css("background-attachment", "fixed"), t.hasClass("u-shading")) t.attr("data-bottom-top", "background-position: 50% 0, 50% 0vh;"), t.attr("data-top-bottom", "background-position: 50% 0, 50% -20vh");
                        else t.attr("data-bottom-top", "background-position: 50% 0vh;"), t.attr("data-top-bottom", "background-position: 50% -20vh")
                    }));
                    var e = {
                        forceHeight: false
                    };
                    skrollr.init(e)
                }
            }
        }))
    },
    12058: function (t, e) {
        var e = void 0,
            t = void 0;
        (function () {
            /*!
             * skrollr core
             *
             * Alexander Prinzhorn - https://github.com/Prinzhorn/skrollr
             *
             * Free to use under terms of MIT license
             */
            ! function (e, n, i) {
                "use strict";

                function o(t) {
                    if (c = n.documentElement, f = n.body, X(), Mt = this, Nt = (t = t || {}).constants || {}, t.easing)
                        for (var i in t.easing) nt[i] = t.easing[i];
                    if (Jt = t.edgeStrategy || "set", Ot = {
                            beforerender: t.beforerender,
                            render: t.render,
                            keyframe: t.keyframe
                        }, Bt = false !== t.forceHeight) Ft = t.scale || 1;
                    if (Ut = t.mobileDeceleration || E, Gt = false !== t.smoothScrolling, jt = t.smoothScrollingDuration || k, Kt = {
                            targetTop: Mt.getScrollTop()
                        }, Qt = (t.mobileCheck || function () {
                            return /Android|iPhone|iPad|iPod|BlackBerry/i.test(navigator.userAgent || navigator.vendor || e.opera)
                        })()) {
                        if (Pt = n.getElementById(t.skrollrBody || I)) mt();
                        rt(), At(c, [C, A], [S])
                    } else At(c, [C, x], [S]);
                    Mt.refresh(), gt(e, "resize orientationchange", (function () {
                        var t = c.clientWidth,
                            e = c.clientHeight;
                        if (e !== Yt || t !== $t) Yt = e, $t = t, Wt = true
                    }));
                    var o = J();
                    return ! function t() {
                        st(), ie = o(t)
                    }(), Mt
                }
                var a = {
                        get: function () {
                            return Mt
                        },
                        init: function (t) {
                            return Mt || new o(t)
                        },
                        VERSION: "0.6.30"
                    },
                    s = Object.prototype.hasOwnProperty,
                    u = e.Math,
                    l = e.getComputedStyle,
                    c, f, h = "touchstart",
                    p = "touchmove",
                    m = "touchcancel",
                    g = "touchend",
                    v = "skrollable",
                    y = v + "-before",
                    w = v + "-between",
                    b = v + "-after",
                    C = "skrollr",
                    S = "no-" + C,
                    x = C + "-desktop",
                    A = C + "-mobile",
                    _ = "linear",
                    T = 1e3,
                    E = .004,
                    I = "skrollr-body",
                    k = 200,
                    M = "start",
                    L = "end",
                    P = "center",
                    O = "bottom",
                    B = "___skrollable_id",
                    F = /^(?:input|textarea|button|select)$/i,
                    N = /^\s+|\s+$/g,
                    U = /^data(?:-(_\w+))?(?:-?(-?\d*\.?\d+p?))?(?:-?(start|end|top|center|bottom))?(?:-?(top|center|bottom))?$/,
                    z = /\s*(@?[\w\-\[\]]+)\s*:\s*(.+?)\s*(?:;|$)/gi,
                    H = /^(@?[a-z\-]+)\[(\w+)\]$/,
                    $ = /-([a-z0-9_])/g,
                    Y = function (t, e) {
                        return e.toUpperCase()
                    },
                    W = /[\-+]?[\d]*\.?[\d]+/g,
                    V = /\{\?\}/g,
                    G = /rgba?\(\s*-?\d+\s*,\s*-?\d+\s*,\s*-?\d+/g,
                    j = /[a-z\-]+-gradient/g,
                    K = "",
                    Z = "",
                    X = function () {
                        var t = /^(?:O|Moz|webkit|ms)|(?:-(?:o|moz|webkit|ms)-)/;
                        if (l) {
                            var style = l(f, null);
                            for (var e in style)
                                if (K = e.match(t) || +e == e && style[e].match(t)) break;
                            if (!K) return K = Z = "", void 0;
                            if ("-" === (K = K[0]).slice(0, 1)) Z = K, K = {
                                "-webkit-": "webkit",
                                "-moz-": "Moz",
                                "-ms-": "ms",
                                "-o-": "O"
                            } [K];
                            else Z = "-" + K.toLowerCase() + "-"
                        }
                    },
                    J = function () {
                        var t = e.requestAnimationFrame || e[K.toLowerCase() + "RequestAnimationFrame"],
                            n = Dt();
                        if (Qt || !t) t = function (t) {
                            var i = Dt() - n,
                                o = u.max(0, 1e3 / 60 - i);
                            return e.setTimeout((function () {
                                n = Dt(), t()
                            }), o)
                        };
                        return t
                    },
                    tt = function () {
                        var t = e.cancelAnimationFrame || e[K.toLowerCase() + "CancelAnimationFrame"];
                        if (Qt || !t) t = function (t) {
                            return e.clearTimeout(t)
                        };
                        return t
                    },
                    nt = {
                        begin: function () {
                            return 0
                        },
                        end: function () {
                            return 1
                        },
                        linear: function (t) {
                            return t
                        },
                        quadratic: function (t) {
                            return t * t
                        },
                        cubic: function (t) {
                            return t * t * t
                        },
                        swing: function (t) {
                            return -u.cos(t * u.PI) / 2 + .5
                        },
                        sqrt: function (t) {
                            return u.sqrt(t)
                        },
                        outCubic: function (t) {
                            return u.pow(t - 1, 3) + 1
                        },
                        bounce: function (t) {
                            var e;
                            if (t <= .5083) e = 3;
                            else if (t <= .8489) e = 9;
                            else if (t <= .96208) e = 27;
                            else if (t <= .99981) e = 91;
                            else return 1;
                            return 1 - u.abs(3 * u.cos(t * e * 1.028) / e)
                        }
                    };
                o.prototype.refresh = function (t) {
                    var e, o, a = false;
                    if (t === i) a = true, Lt = [], Xt = 0, t = n.getElementsByTagName("*");
                    else if (t.length === i) t = [t];
                    for (e = 0, o = t.length; e < o; e++) {
                        var el = t[e],
                            s = el,
                            u = [],
                            l = Gt,
                            c = Jt,
                            f = false;
                        if (a && B in el) delete el[B];
                        if (el.attributes) {
                            for (var h = 0, p = el.attributes.length; h < p; h++) {
                                var m = el.attributes[h];
                                if ("data-anchor-target" !== m.name)
                                    if ("data-smooth-scrolling" !== m.name)
                                        if ("data-edge-strategy" !== m.name)
                                            if ("data-emit-events" !== m.name) {
                                                var g = m.name.match(U);
                                                if (null !== g) {
                                                    var y = {
                                                        props: m.value,
                                                        element: el,
                                                        eventType: m.name.replace($, Y)
                                                    };
                                                    u.push(y);
                                                    var w = g[1];
                                                    if (w) y.constant = w.substr(1);
                                                    var b = g[2];
                                                    if (/p$/.test(b)) y.isPercentage = true, y.offset = (0 | b.slice(0, -1)) / 100;
                                                    else y.offset = 0 | b;
                                                    var C = g[3],
                                                        S = g[4] || C;
                                                    if (!C || C === M || C === L) {
                                                        if (y.mode = "absolute", C === L) y.isEnd = true;
                                                        else if (!y.isPercentage) y.offset = y.offset * Ft
                                                    } else y.mode = "relative", y.anchors = [C, S]
                                                }
                                            } else f = true;
                                else c = m.value;
                                else l = "off" !== m.value;
                                else if (null === (s = n.querySelector(m.value))) throw 'Unable to find anchor target "' + m.value + '"'
                            }
                            if (u.length) {
                                var x, A, id;
                                if (!a && B in el) id = el[B], x = Lt[id].styleAttr, A = Lt[id].classAttr;
                                else id = el[B] = Xt++, x = el.style.cssText, A = xt(el);
                                Lt[id] = {
                                    element: el,
                                    styleAttr: x,
                                    classAttr: A,
                                    anchorTarget: s,
                                    keyFrames: u,
                                    smoothScrolling: l,
                                    edgeStrategy: c,
                                    emitEvents: f,
                                    lastFrameIndex: -1
                                }, At(el, [v], [])
                            }
                        }
                    }
                    for (bt(), e = 0, o = t.length; e < o; e++) {
                        var sk = Lt[t[e][B]];
                        if (sk !== i) ut(sk), ct(sk)
                    }
                    return Mt
                }, o.prototype.relativeToAbsolute = function (t, e, n) {
                    var i = c.clientHeight,
                        o = t.getBoundingClientRect(),
                        a = o.top,
                        s = o.bottom - o.top;
                    if (e === O) a -= i;
                    else if (e === P) a -= i / 2;
                    if (n === O) a += s;
                    else if (n === P) a += s / 2;
                    return (a += Mt.getScrollTop()) + .5 | 0
                }, o.prototype.animateTo = function (t, e) {
                    e = e || {};
                    var n = Dt(),
                        o = Mt.getScrollTop(),
                        a = e.duration === i ? T : e.duration;
                    if (!(Vt = {
                            startTop: o,
                            topDiff: t - o,
                            targetTop: t,
                            duration: a,
                            startTime: n,
                            endTime: n + a,
                            easing: nt[e.easing || _],
                            done: e.done
                        }).topDiff) {
                        if (Vt.done) Vt.done.call(Mt, false);
                        Vt = i
                    }
                    return Mt
                }, o.prototype.stopAnimateTo = function () {
                    if (Vt && Vt.done) Vt.done.call(Mt, true);
                    Vt = i
                }, o.prototype.isAnimatingTo = function () {
                    return !!Vt
                }, o.prototype.isMobile = function () {
                    return Qt
                }, o.prototype.setScrollTop = function (t, n) {
                    if (Zt = true === n, Qt) te = u.min(u.max(t, 0), Rt);
                    else e.scrollTo(0, t);
                    return Mt
                }, o.prototype.getScrollTop = function () {
                    if (Qt) return te;
                    else return e.pageYOffset || c.scrollTop || f.scrollTop || 0
                }, o.prototype.getMaxScrollTop = function () {
                    return Rt
                }, o.prototype.on = function (t, e) {
                    return Ot[t] = e, Mt
                }, o.prototype.off = function (t) {
                    return delete Ot[t], Mt
                }, o.prototype.destroy = function () {
                    var t;
                    tt()(ie), yt(), At(c, [S], [C, x, A]);
                    for (var e = 0, n = Lt.length; e < n; e++) pt(Lt[e].element);
                    if (c.style.overflow = f.style.overflow = "", c.style.height = f.style.height = "", Pt) a.setStyle(Pt, "transform", "none");
                    Mt = i, Pt = i, Ot = i, Bt = i, Rt = 0, Ft = 1, Nt = i, Ut = i, qt = "down", zt = -1, $t = 0, Yt = 0, Wt = false, Vt = i, Gt = i, jt = i, Kt = i, Zt = i, Xt = 0, Jt = i, Qt = false, te = 0, ee = i
                };
                var rt = function () {
                        var t, o, a, s, l, v, y, w, b, C, S, x;
                        gt(c, [h, p, m, g].join(" "), (function (e) {
                            var c = e.changedTouches[0];
                            for (s = e.target; 3 === s.nodeType;) s = s.parentNode;
                            if (l = c.clientY, v = c.clientX, C = e.timeStamp, !F.test(s.tagName)) e.preventDefault();
                            switch (e.type) {
                                case h:
                                    if (t) t.blur();
                                    Mt.stopAnimateTo(), t = s, o = y = l, a = v, b = C;
                                    break;
                                case p:
                                    if (F.test(s.tagName) && n.activeElement !== s) e.preventDefault();
                                    w = l - y, x = C - S, Mt.setScrollTop(te - w, true), y = l, S = C;
                                    break;
                                default:
                                case m:
                                case g:
                                    var f = o - l,
                                        A = a - v,
                                        _;
                                    if (A * A + f * f < 49) {
                                        if (!F.test(t.tagName)) {
                                            t.focus();
                                            var T = n.createEvent("MouseEvents");
                                            T.initMouseEvent("click", true, true, e.view, 1, c.screenX, c.screenY, c.clientX, c.clientY, e.ctrlKey, e.altKey, e.shiftKey, e.metaKey, 0, null), t.dispatchEvent(T)
                                        }
                                        return
                                    }
                                    t = i;
                                    var E = w / x;
                                    E = u.max(u.min(E, 3), -3);
                                    var I = u.abs(E / Ut),
                                        k = E * I + .5 * Ut * I * I,
                                        M = Mt.getScrollTop() - k,
                                        L = 0;
                                    if (M > Rt) L = (Rt - M) / k, M = Rt;
                                    else if (M < 0) L = -M / k, M = 0;
                                    I *= 1 - L, Mt.animateTo(M + .5 | 0, {
                                        easing: "outCubic",
                                        duration: I
                                    });
                                    break
                            }
                        })), e.scrollTo(0, 0), c.style.overflow = f.style.overflow = "hidden"
                    },
                    ot = function () {
                        var t = c.clientHeight,
                            e = Ct(),
                            n, i, o, a, s, l, f, h, p, m, g;
                        for (h = 0, p = Lt.length; h < p; h++)
                            for (i = (n = Lt[h]).element, o = n.anchorTarget, s = 0, l = (a = n.keyFrames).length; s < l; s++) {
                                if (m = (f = a[s]).offset, g = e[f.constant] || 0, f.frame = m, f.isPercentage) m *= t, f.frame = m;
                                if ("relative" === f.mode) pt(i), f.frame = Mt.relativeToAbsolute(o, f.anchors[0], f.anchors[1]) - m, pt(i, true);
                                if (f.frame += g, Bt)
                                    if (!f.isEnd && f.frame > Rt) Rt = f.frame
                            }
                        for (Rt = u.max(Rt, St()), h = 0, p = Lt.length; h < p; h++) {
                            for (s = 0, l = (a = (n = Lt[h]).keyFrames).length; s < l; s++)
                                if (g = e[(f = a[s]).constant] || 0, f.isEnd) f.frame = Rt - f.offset + g;
                            n.keyFrames.sort(kt)
                        }
                    },
                    at = function (t, e) {
                        for (var n = 0, i = Lt.length; n < i; n++) {
                            var o = Lt[n],
                                u = o.element,
                                l = o.smoothScrolling ? t : e,
                                c = o.keyFrames,
                                f = c.length,
                                h = c[0],
                                p = c[c.length - 1],
                                m = l < h.frame,
                                g = l > p.frame,
                                C = m ? h : p,
                                S = o.emitEvents,
                                x = o.lastFrameIndex,
                                A, _;
                            if (m || g) {
                                if (m && -1 === o.edge || g && 1 === o.edge) continue;
                                if (m) {
                                    if (At(u, [y], [b, w]), S && x > -1) wt(u, h.eventType, qt), o.lastFrameIndex = -1
                                } else if (At(u, [b], [y, w]), S && x < f) wt(u, p.eventType, qt), o.lastFrameIndex = f;
                                switch (o.edge = m ? -1 : 1, o.edgeStrategy) {
                                    case "reset":
                                        pt(u);
                                        continue;
                                    case "ease":
                                        l = C.frame;
                                        break;
                                    default:
                                    case "set":
                                        var props = C.props;
                                        for (A in props)
                                            if (s.call(props, A))
                                                if (_ = ht(props[A].value), 0 === A.indexOf("@")) u.setAttribute(A.substr(1), _);
                                                else a.setStyle(u, A, _);
                                        continue
                                }
                            } else if (0 !== o.edge) At(u, [v, w], [y, b]), o.edge = 0;
                            for (var T = 0; T < f - 1; T++)
                                if (l >= c[T].frame && l <= c[T + 1].frame) {
                                    var E = c[T],
                                        I = c[T + 1];
                                    for (A in E.props)
                                        if (s.call(E.props, A)) {
                                            var k = (l - E.frame) / (I.frame - E.frame);
                                            if (k = E.props[A].easing(k), _ = dt(E.props[A].value, I.props[A].value, k), _ = ht(_), 0 === A.indexOf("@")) u.setAttribute(A.substr(1), _);
                                            else a.setStyle(u, A, _)
                                        } if (S)
                                        if (x !== T) {
                                            if ("down" === qt) wt(u, E.eventType, qt);
                                            else wt(u, I.eventType, qt);
                                            o.lastFrameIndex = T
                                        } break
                                }
                        }
                    },
                    st = function () {
                        if (Wt) Wt = false, bt();
                        var t = Mt.getScrollTop(),
                            e, n = Dt(),
                            o;
                        if (Vt) {
                            if (n >= Vt.endTime) t = Vt.targetTop, e = Vt.done, Vt = i;
                            else o = Vt.easing((n - Vt.startTime) / Vt.duration), t = Vt.startTop + o * Vt.topDiff | 0;
                            Mt.setScrollTop(t, true)
                        } else if (!Zt) {
                            var s;
                            if (Kt.targetTop - t) Kt = {
                                startTop: zt,
                                topDiff: t - zt,
                                targetTop: t,
                                startTime: Ht,
                                endTime: Ht + jt
                            };
                            if (n <= Kt.endTime) o = nt.sqrt((n - Kt.startTime) / jt), t = Kt.startTop + o * Kt.topDiff | 0
                        }
                        if (Zt || zt !== t) {
                            Zt = false;
                            var u = {
                                    curTop: t,
                                    lastTop: zt,
                                    maxTop: Rt,
                                    direction: qt = t > zt ? "down" : t < zt ? "up" : qt
                                },
                                l;
                            if (false !== (Ot.beforerender && Ot.beforerender.call(Mt, u))) {
                                if (at(t, Mt.getScrollTop()), Qt && Pt) a.setStyle(Pt, "transform", "translate(0, " + -te + "px) " + ee);
                                if (zt = t, Ot.render) Ot.render.call(Mt, u)
                            }
                            if (e) e.call(Mt, false)
                        }
                        Ht = n
                    },
                    ut = function (t) {
                        for (var e = 0, n = t.keyFrames.length; e < n; e++) {
                            for (var i = t.keyFrames[e], o, a, s, props = {}, u; null !== (u = z.exec(i.props));) {
                                if (s = u[1], a = u[2], null !== (o = s.match(H))) s = o[1], o = o[2];
                                else o = _;
                                a = a.indexOf("!") ? lt(a) : [a.slice(1)], props[s] = {
                                    value: a,
                                    easing: nt[o]
                                }
                            }
                            i.props = props
                        }
                    },
                    lt = function (t) {
                        var e = [];
                        if (G.lastIndex = 0, t = t.replace(G, (function (t) {
                                return t.replace(W, (function (t) {
                                    return t / 255 * 100 + "%"
                                }))
                            })), Z) j.lastIndex = 0, t = t.replace(j, (function (t) {
                            return Z + t
                        }));
                        return t = t.replace(W, (function (t) {
                            return e.push(+t), "{?}"
                        })), e.unshift(t), e
                    },
                    ct = function (sk) {
                        var t = {},
                            e, n;
                        for (e = 0, n = sk.keyFrames.length; e < n; e++) ft(sk.keyFrames[e], t);
                        for (t = {}, e = sk.keyFrames.length - 1; e >= 0; e--) ft(sk.keyFrames[e], t)
                    },
                    ft = function (t, e) {
                        var n;
                        for (n in e)
                            if (!s.call(t.props, n)) t.props[n] = e[n];
                        for (n in t.props) e[n] = t.props[n]
                    },
                    dt = function (t, e, n) {
                        var i, o = t.length;
                        if (o !== e.length) throw "Can't interpolate between \"" + t[0] + '" and "' + e[0] + '"';
                        var a = [t[0]];
                        for (i = 1; i < o; i++) a[i] = t[i] + (e[i] - t[i]) * n;
                        return a
                    },
                    ht = function (t) {
                        var e = 1;
                        return V.lastIndex = 0, t[0].replace(V, (function () {
                            return t[e++]
                        }))
                    },
                    pt = function (t, e) {
                        for (var n, i, o = 0, a = (t = [].concat(t)).length; o < a; o++)
                            if (i = t[o], n = Lt[i[B]])
                                if (e) i.style.cssText = n.dirtyStyleAttr, At(i, n.dirtyClassAttr);
                                else n.dirtyStyleAttr = i.style.cssText, n.dirtyClassAttr = xt(i), i.style.cssText = n.styleAttr, At(i, n.classAttr)
                    },
                    mt = function () {
                        ee = "translateZ(0)", a.setStyle(Pt, "transform", ee);
                        var t = l(Pt),
                            e = t.getPropertyValue("transform"),
                            n = t.getPropertyValue(Z + "transform"),
                            i;
                        if (!(e && "none" !== e || n && "none" !== n)) ee = ""
                    };
                a.setStyle = function (el, t, e) {
                    var style = el.style;
                    if ("zIndex" === (t = t.replace($, Y).replace("-", "")))
                        if (isNaN(e)) style[t] = e;
                        else style[t] = "" + (0 | e);
                    else if ("float" === t) style.styleFloat = style.cssFloat = e;
                    else try {
                        if (K) style[K + t.slice(0, 1).toUpperCase() + t.slice(1)] = e;
                        style[t] = e
                    } catch (t) {}
                };
                var gt = a.addEvent = function (t, names, n) {
                        for (var i = function (t) {
                                if (!(t = t || e.event).target) t.target = t.srcElement;
                                if (!t.preventDefault) t.preventDefault = function () {
                                    t.returnValue = false, t.defaultPrevented = true
                                };
                                return n.call(this, t)
                            }, o, a = 0, s = (names = names.split(" ")).length; a < s; a++) {
                            if (o = names[a], t.addEventListener) t.addEventListener(o, n, false);
                            else t.attachEvent("on" + o, i);
                            ne.push({
                                element: t,
                                name: o,
                                listener: n
                            })
                        }
                    },
                    vt = a.removeEvent = function (t, names, e) {
                        for (var n = 0, i = (names = names.split(" ")).length; n < i; n++)
                            if (t.removeEventListener) t.removeEventListener(names[n], e, false);
                            else t.detachEvent("on" + names[n], e)
                    },
                    yt = function () {
                        for (var t, e = 0, n = ne.length; e < n; e++) t = ne[e], vt(t.element, t.name, t.listener);
                        ne = []
                    },
                    wt = function (t, e, n) {
                        if (Ot.keyframe) Ot.keyframe.call(Mt, t, e, n)
                    },
                    bt = function () {
                        var t = Mt.getScrollTop();
                        if (Rt = 0, Bt && !Qt) f.style.height = "";
                        if (ot(), Bt && !Qt) f.style.height = Rt + c.clientHeight + "px";
                        if (Qt) Mt.setScrollTop(u.min(Mt.getScrollTop(), Rt));
                        else Mt.setScrollTop(t, true);
                        Zt = true
                    },
                    Ct = function () {
                        var t = c.clientHeight,
                            copy = {},
                            e, n;
                        for (e in Nt) {
                            if ("function" == typeof (n = Nt[e])) n = n.call(Mt);
                            else if (/p$/.test(n)) n = n.slice(0, -1) / 100 * t;
                            copy[e] = n
                        }
                        return copy
                    },
                    St = function () {
                        var t = 0,
                            e;
                        if (Pt) t = u.max(Pt.offsetHeight, Pt.scrollHeight);
                        return (e = u.max(t, f.scrollHeight, f.offsetHeight, c.scrollHeight, c.offsetHeight, c.clientHeight)) - c.clientHeight
                    },
                    xt = function (t) {
                        var n = "className";
                        if (e.SVGElement && t instanceof e.SVGElement) t = t[n], n = "baseVal";
                        return t[n]
                    },
                    At = function (t, add, remove) {
                        var n = "className";
                        if (e.SVGElement && t instanceof e.SVGElement) t = t[n], n = "baseVal";
                        if (remove === i) return t[n] = add, void 0;
                        for (var o = t[n], a = 0, s = remove.length; a < s; a++) o = Tt(o).replace(Tt(remove[a]), " ");
                        o = _t(o);
                        for (var u = 0, l = add.length; u < l; u++)
                            if (-1 === Tt(o).indexOf(Tt(add[u]))) o += " " + add[u];
                        t[n] = _t(o)
                    },
                    _t = function (t) {
                        return t.replace(N, "")
                    },
                    Tt = function (t) {
                        return " " + t + " "
                    },
                    Dt = Date.now || function () {
                        return +new Date
                    },
                    kt = function (t, e) {
                        return t.frame - e.frame
                    },
                    Mt, Lt, Pt, Ot, Bt, Rt = 0,
                    Ft = 1,
                    Nt, Ut, qt = "down",
                    zt = -1,
                    Ht = Dt(),
                    $t = 0,
                    Yt = 0,
                    Wt = false,
                    Vt, Gt, jt, Kt, Zt, Xt = 0,
                    Jt, Qt = false,
                    te = 0,
                    ee, ne = [],
                    ie;
                if ("function" == typeof define && define.amd) define([], (function () {
                    return a
                }));
                else if (void 0 !== t && t.exports) t.exports = a;
                else e.skrollr = a
            }(window, document)
        }).call(window)
    },
    12059: function (t, e, n) {
        "use strict";

        function i(t) {
            this.initialize(t)
        }

        function o(t) {
            if (!window.getComputedStyle) return null;
            var transform = getComputedStyle(t).transform,
                e = /matrix\(([^)]+)\)/.exec(transform);
            if (!e || e.length < 2) return null;
            if ((e = e[1].split(",")).length < 6) return null;
            else return {
                a: parseFloat(e[0], 10),
                b: parseFloat(e[1], 10),
                c: parseFloat(e[2], 10),
                d: parseFloat(e[3], 10),
                tx: parseFloat(e[4], 10),
                ty: parseFloat(e[5], 10)
            }
        }

        function a(t, e, n, i) {
            var a = o(e),
                s = 0,
                u = 0,
                l, c;
            if (a && !isNaN(a.tx)) s = a.tx;
            if (a && !isNaN(a.ty)) u = a.ty;
            if ("horizontal" === n) l = t.innerWidth(), c = s;
            else l = t.innerHeight(), c = u;
            return Math.ceil(l * i + c)
        }

        function s(t) {
            if (!t && !t.element) return false;
            var e = t.element.getAttribute("data-animation-name");
            if (e && "slidein" === e.toLowerCase()) return true;
            else return false
        }

        function u(t) {
            if (!s(t)) return t;
            var e = t.offset;
            if ("string" == typeof e)
                if (e = parseFloat(e), t.offset.indexOf("%") > -1) e /= 100;
            return (t = $.extend({}, t)).offset = function () {
                return a(this.context, this.element, this.axis, e)
            }, t
        }
        n(12060), i.prototype.initialize = function t(e) {
            if (!this.waypoint)
                if (e && e.element && "function" == typeof e.handler) e = u(e), this.waypoint = new Waypoint(e)
        }, i.prototype.destroy = function t() {
            if (this.waypoint) this.waypoint.destroy(), this.waypoint = null
        }, window.WaypointAdapter = i
    },
    12060: function (t, e) {
        var e = void 0,
            t = void 0;
        (function () {
            /*!
            Waypoints - 4.0.1
            Copyright © 2011-2016 Caleb Troughton
            Licensed under the MIT license.
            https://github.com/imakewebthings/waypoints/blob/master/licenses.txt
            */
            ! function () {
                "use strict";

                function t(i) {
                    if (!i) throw new Error("No options passed to Waypoint constructor");
                    if (!i.element) throw new Error("No element option passed to Waypoint constructor");
                    if (!i.handler) throw new Error("No handler option passed to Waypoint constructor");
                    if (this.key = "waypoint-" + e, this.options = t.Adapter.extend({}, t.defaults, i), this.element = this.options.element, this.adapter = new t.Adapter(this.element), this.callback = i.handler, this.axis = this.options.horizontal ? "horizontal" : "vertical", this.enabled = this.options.enabled, this.triggerPoint = null, this.group = t.Group.findOrCreate({
                            name: this.options.group,
                            axis: this.axis
                        }), this.context = t.Context.findOrCreateByElement(this.options.context), t.offsetAliases[this.options.offset]) this.options.offset = t.offsetAliases[this.options.offset];
                    this.group.add(this), this.context.add(this), n[this.key] = this, e += 1
                }
                var e = 0,
                    n = {};
                t.prototype.queueTrigger = function (t) {
                    this.group.queueTrigger(this, t)
                }, t.prototype.trigger = function (t) {
                    if (this.enabled)
                        if (this.callback) this.callback.apply(this, t)
                }, t.prototype.destroy = function () {
                    this.context.remove(this), this.group.remove(this), delete n[this.key]
                }, t.prototype.disable = function () {
                    return this.enabled = false, this
                }, t.prototype.enable = function () {
                    return this.context.refresh(), this.enabled = true, this
                }, t.prototype.next = function () {
                    return this.group.next(this)
                }, t.prototype.previous = function () {
                    return this.group.previous(this)
                }, t.invokeAll = function (t) {
                    var e = [];
                    for (var i in n) e.push(n[i]);
                    for (var o = 0, a = e.length; o < a; o++) e[o][t]()
                }, t.destroyAll = function () {
                    t.invokeAll("destroy")
                }, t.disableAll = function () {
                    t.invokeAll("disable")
                }, t.enableAll = function () {
                    for (var e in t.Context.refreshAll(), n) n[e].enabled = true;
                    return this
                }, t.refreshAll = function () {
                    t.Context.refreshAll()
                }, t.viewportHeight = function () {
                    return window.innerHeight || document.documentElement.clientHeight
                }, t.viewportWidth = function () {
                    return document.documentElement.clientWidth
                }, t.adapters = [], t.defaults = {
                    context: window,
                    continuous: true,
                    enabled: true,
                    group: "default",
                    horizontal: false,
                    offset: 0
                }, t.offsetAliases = {
                    "bottom-in-view": function () {
                        return this.context.innerHeight() - this.adapter.outerHeight()
                    },
                    "right-in-view": function () {
                        return this.context.innerWidth() - this.adapter.outerWidth()
                    }
                }, window.Waypoint = t
            }(),
            function () {
                "use strict";

                function t(t) {
                    window.setTimeout(t, 1e3 / 60)
                }

                function e(t) {
                    if (this.element = t, this.Adapter = o.Adapter, this.adapter = new this.Adapter(t), this.key = "waypoint-context-" + n, this.didScroll = false, this.didResize = false, this.oldScroll = {
                            x: this.adapter.scrollLeft(),
                            y: this.adapter.scrollTop()
                        }, this.waypoints = {
                            vertical: {},
                            horizontal: {}
                        }, t.waypointContextKey = this.key, i[t.waypointContextKey] = this, n += 1, !o.windowContext) o.windowContext = true, o.windowContext = new e(window);
                    this.createThrottledScrollHandler(), this.createThrottledResizeHandler()
                }
                var n = 0,
                    i = {},
                    o = window.Waypoint,
                    a = window.onload;
                e.prototype.add = function (t) {
                    var e = t.options.horizontal ? "horizontal" : "vertical";
                    this.waypoints[e][t.key] = t, this.refresh()
                }, e.prototype.checkEmpty = function () {
                    var t = this.Adapter.isEmptyObject(this.waypoints.horizontal),
                        e = this.Adapter.isEmptyObject(this.waypoints.vertical),
                        n = this.element == this.element.window;
                    if (t && e && !n) this.adapter.off(".waypoints"), delete i[this.key]
                }, e.prototype.createThrottledResizeHandler = function () {
                    function t() {
                        e.handleResize(), e.didResize = false
                    }
                    var e = this;
                    this.adapter.on("resize.waypoints", (function () {
                        if (!e.didResize) e.didResize = true, o.requestAnimationFrame(t)
                    }))
                }, e.prototype.createThrottledScrollHandler = function () {
                    function t() {
                        e.handleScroll(), e.didScroll = false
                    }
                    var e = this;
                    this.adapter.on("scroll.waypoints", (function () {
                        if (!e.didScroll || o.isTouch) e.didScroll = true, o.requestAnimationFrame(t)
                    }))
                }, e.prototype.handleResize = function () {
                    o.Context.refreshAll()
                }, e.prototype.handleScroll = function () {
                    var t = {},
                        e = {
                            horizontal: {
                                newScroll: this.adapter.scrollLeft(),
                                oldScroll: this.oldScroll.x,
                                forward: "right",
                                backward: "left"
                            },
                            vertical: {
                                newScroll: this.adapter.scrollTop(),
                                oldScroll: this.oldScroll.y,
                                forward: "down",
                                backward: "up"
                            }
                        };
                    for (var n in e) {
                        var i = e[n],
                            o, a = i.newScroll > i.oldScroll ? i.forward : i.backward;
                        for (var s in this.waypoints[n]) {
                            var u = this.waypoints[n][s];
                            if (null !== u.triggerPoint) {
                                var l = i.oldScroll < u.triggerPoint,
                                    c = i.newScroll >= u.triggerPoint,
                                    f, h;
                                if (l && c || !l && !c) u.queueTrigger(a), t[u.group.id] = u.group
                            }
                        }
                    }
                    for (var p in t) t[p].flushTriggers();
                    this.oldScroll = {
                        x: e.horizontal.newScroll,
                        y: e.vertical.newScroll
                    }
                }, e.prototype.innerHeight = function () {
                    if (this.element == this.element.window) return o.viewportHeight();
                    else return this.adapter.innerHeight()
                }, e.prototype.remove = function (t) {
                    delete this.waypoints[t.axis][t.key], this.checkEmpty()
                }, e.prototype.innerWidth = function () {
                    if (this.element == this.element.window) return o.viewportWidth();
                    else return this.adapter.innerWidth()
                }, e.prototype.destroy = function () {
                    var t = [];
                    for (var e in this.waypoints)
                        for (var n in this.waypoints[e]) t.push(this.waypoints[e][n]);
                    for (var i = 0, o = t.length; i < o; i++) t[i].destroy()
                }, e.prototype.refresh = function () {
                    var t = this.element == this.element.window,
                        e = t ? void 0 : this.adapter.offset(),
                        n = {},
                        i;
                    for (var a in this.handleScroll(), i = {
                            horizontal: {
                                contextOffset: t ? 0 : e.left,
                                contextScroll: t ? 0 : this.oldScroll.x,
                                contextDimension: this.innerWidth(),
                                oldScroll: this.oldScroll.x,
                                forward: "right",
                                backward: "left",
                                offsetProp: "left"
                            },
                            vertical: {
                                contextOffset: t ? 0 : e.top,
                                contextScroll: t ? 0 : this.oldScroll.y,
                                contextDimension: this.innerHeight(),
                                oldScroll: this.oldScroll.y,
                                forward: "down",
                                backward: "up",
                                offsetProp: "top"
                            }
                        }) {
                        var s = i[a];
                        for (var u in this.waypoints[a]) {
                            var l = this.waypoints[a][u],
                                c = l.options.offset,
                                f = l.triggerPoint,
                                h = 0,
                                p = null == f,
                                m, g, v, y, w;
                            if (l.element !== l.element.window) h = l.adapter.offset()[s.offsetProp];
                            if ("function" == typeof c) c = c.apply(l);
                            else if ("string" == typeof c)
                                if (c = parseFloat(c), l.options.offset.indexOf("%") > -1) c = Math.ceil(s.contextDimension * c / 100);
                            if (m = s.contextScroll - s.contextOffset, l.triggerPoint = Math.floor(h + m - c), g = f < s.oldScroll, v = l.triggerPoint >= s.oldScroll, w = !g && !v, !p && (y = g && v)) l.queueTrigger(s.backward), n[l.group.id] = l.group;
                            else if (!p && w) l.queueTrigger(s.forward), n[l.group.id] = l.group;
                            else if (p && s.oldScroll >= l.triggerPoint) l.queueTrigger(s.forward), n[l.group.id] = l.group
                        }
                    }
                    return o.requestAnimationFrame((function () {
                        for (var t in n) n[t].flushTriggers()
                    })), this
                }, e.findOrCreateByElement = function (t) {
                    return e.findByElement(t) || new e(t)
                }, e.refreshAll = function () {
                    for (var t in i) i[t].refresh()
                }, e.findByElement = function (t) {
                    return i[t.waypointContextKey]
                }, window.onload = function () {
                    if (a) a();
                    e.refreshAll()
                }, o.requestAnimationFrame = function (e) {
                    var n;
                    (window.requestAnimationFrame || window.mozRequestAnimationFrame || window.webkitRequestAnimationFrame || t).call(window, e)
                }, o.Context = e
            }(),
            function () {
                "use strict";

                function t(t, e) {
                    return t.triggerPoint - e.triggerPoint
                }

                function e(t, e) {
                    return e.triggerPoint - t.triggerPoint
                }

                function Group(t) {
                    this.name = t.name, this.axis = t.axis, this.id = this.name + "-" + this.axis, this.waypoints = [], this.clearTriggerQueues(), n[this.axis][this.name] = this
                }
                var n = {
                        vertical: {},
                        horizontal: {}
                    },
                    i = window.Waypoint;
                Group.prototype.add = function (t) {
                    this.waypoints.push(t)
                }, Group.prototype.clearTriggerQueues = function () {
                    this.triggerQueues = {
                        up: [],
                        down: [],
                        left: [],
                        right: []
                    }
                }, Group.prototype.flushTriggers = function () {
                    for (var n in this.triggerQueues) {
                        var i = this.triggerQueues[n],
                            o = "up" === n || "left" === n;
                        i.sort(o ? e : t);
                        for (var a = 0, s = i.length; a < s; a += 1) {
                            var u = i[a];
                            if (u.options.continuous || a === i.length - 1) u.trigger([n])
                        }
                    }
                    this.clearTriggerQueues()
                }, Group.prototype.next = function (e) {
                    this.waypoints.sort(t);
                    var index = i.Adapter.inArray(e, this.waypoints),
                        n;
                    return index === this.waypoints.length - 1 ? null : this.waypoints[index + 1]
                }, Group.prototype.previous = function (e) {
                    this.waypoints.sort(t);
                    var index = i.Adapter.inArray(e, this.waypoints);
                    return index ? this.waypoints[index - 1] : null
                }, Group.prototype.queueTrigger = function (t, e) {
                    this.triggerQueues[e].push(t)
                }, Group.prototype.remove = function (t) {
                    var index = i.Adapter.inArray(t, this.waypoints);
                    if (index > -1) this.waypoints.splice(index, 1)
                }, Group.prototype.first = function () {
                    return this.waypoints[0]
                }, Group.prototype.last = function () {
                    return this.waypoints[this.waypoints.length - 1]
                }, Group.findOrCreate = function (t) {
                    return n[t.axis][t.name] || new Group(t)
                }, i.Group = Group
            }(),
            function () {
                "use strict";

                function t(t) {
                    return t === t.window
                }

                function e(e) {
                    if (t(e)) return e;
                    else return e.defaultView
                }

                function n(t) {
                    this.element = t, this.handlers = {}
                }
                var i = window.Waypoint;
                n.prototype.innerHeight = function () {
                    var e;
                    return t(this.element) ? this.element.innerHeight : this.element.clientHeight
                }, n.prototype.innerWidth = function () {
                    var e;
                    return t(this.element) ? this.element.innerWidth : this.element.clientWidth
                }, n.prototype.off = function (t, e) {
                    function n(t, e, n) {
                        for (var i = 0, o = e.length - 1; i < o; i++) {
                            var a = e[i];
                            if (!n || n === a) t.removeEventListener(a)
                        }
                    }
                    var i = t.split("."),
                        o = i[0],
                        a = i[1],
                        s = this.element;
                    if (a && this.handlers[a] && o) n(s, this.handlers[a][o], e), this.handlers[a][o] = [];
                    else if (o)
                        for (var u in this.handlers) n(s, this.handlers[u][o] || [], e), this.handlers[u][o] = [];
                    else if (a && this.handlers[a]) {
                        for (var type in this.handlers[a]) n(s, this.handlers[a][type], e);
                        this.handlers[a] = {}
                    }
                }, n.prototype.offset = function () {
                    if (!this.element.ownerDocument) return null;
                    var t = this.element.ownerDocument.documentElement,
                        n = e(this.element.ownerDocument),
                        rect = {
                            top: 0,
                            left: 0
                        };
                    if (this.element.getBoundingClientRect) rect = this.element.getBoundingClientRect();
                    return {
                        top: rect.top + n.pageYOffset - t.clientTop,
                        left: rect.left + n.pageXOffset - t.clientLeft
                    }
                }, n.prototype.on = function (t, e) {
                    var n = t.split("."),
                        i = n[0],
                        o = n[1] || "__default",
                        a = this.handlers[o] = this.handlers[o] || {},
                        s;
                    (a[i] = a[i] || []).push(e), this.element.addEventListener(i, e)
                }, n.prototype.outerHeight = function (e) {
                    var n = this.innerHeight(),
                        i;
                    if (e && !t(this.element)) i = window.getComputedStyle(this.element), n += parseInt(i.marginTop, 10), n += parseInt(i.marginBottom, 10);
                    return n
                }, n.prototype.outerWidth = function (e) {
                    var n = this.innerWidth(),
                        i;
                    if (e && !t(this.element)) i = window.getComputedStyle(this.element), n += parseInt(i.marginLeft, 10), n += parseInt(i.marginRight, 10);
                    return n
                }, n.prototype.scrollLeft = function () {
                    var t = e(this.element);
                    return t ? t.pageXOffset : this.element.scrollLeft
                }, n.prototype.scrollTop = function () {
                    var t = e(this.element);
                    return t ? t.pageYOffset : this.element.scrollTop
                }, n.extend = function () {
                    function merge(t, e) {
                        if ("object" == typeof t && "object" == typeof e)
                            for (var n in e)
                                if (e.hasOwnProperty(n)) t[n] = e[n];
                        return t
                    }
                    for (var t = Array.prototype.slice.call(arguments), e = 1, n = t.length; e < n; e++) merge(t[0], t[e]);
                    return t[0]
                }, n.inArray = function (t, e, n) {
                    return null == e ? -1 : e.indexOf(t, n)
                }, n.isEmptyObject = function (t) {
                    for (var e in t) return false;
                    return true
                }, i.adapters.push({
                    name: "noframework",
                    Adapter: n
                }), i.Adapter = n
            }()
        }).call(window)
    },
    12061: function (t, e, n) {
        "use strict";
        var i = n(15);
        i(document).ready((function () {
            function t(t) {
                return e() ? 0 : n(t)
            }

            function e() {
                return a.hasClass("u-overlap")
            }

            function n(t) {
                var rect;
                return t[0].getBoundingClientRect().height
            }
            var o = i("header.u-sticky");
            if (o.length && !o.closest(".u-overlap").length && !CSS.supports("position", "sticky") && !CSS.supports("position", "-webkit-sticky")) {
                o.css("width", "100%");
                var update = function () {
                    o.each((function () {
                        var t = i(this),
                            e = t.height(),
                            n = t.data("additionalMargin") || 0;
                        if (e !== n) {
                            t.data("additionalMargin", e);
                            var o = t;
                            do {
                                o = o.next()
                            } while (o.length > 0 && "none" === o.css("display"));
                            o.css("margin-top", parseFloat(o.css("margin-top")) - n + e + "px")
                        }
                    }))
                };
                update(), i(window).load(update), i(window).resize(update)
            }
            var a = i(".u-body");
            if (a.hasClass("u-overlap-transparent")) a.data("overlap-transparent", true);
            if (a.hasClass("u-overlap-contrast")) a.data("overlap-contrast", true);
            i(window).scroll((function e() {
                i("header.u-sticky").each((function () {
                    var e = i(this),
                        n = e.nextAll(":visible:first");
                    if (n.length) {
                        var o = n.offset().top,
                            s = e.offset().top,
                            u, l = s + t(e) > o,
                            c;
                        if (a.toggleClass("u-sticky-fixed", l), s > o) a.addClass("u-sticky-scroll"), a.removeClass("u-overlap-transparent u-overlap-contrast");
                        else a.toggleClass("u-overlap-transparent", !!a.data("overlap-transparent")), a.toggleClass("u-overlap-contrast", !!a.data("overlap-contrast")), a.removeClass("u-sticky-scroll")
                    }
                }))
            }))
        }))
    },
    12062: function (t, e, n) {
        "use strict";

        function i(t) {
            function e() {
                c = [];
                var e = o("html").scrollTop();
                t.each((function () {
                    var rect = this.getBoundingClientRect();
                    c.push({
                        height: rect.height,
                        top: rect.top + e
                    })
                }))
            }

            function n(index) {
                for (var e = 0, n = 0; n < index; n++) {
                    var i;
                    if (t.eq(n).hasClass(f)) {
                        var rect;
                        e += (c[n] || {}).height || 0
                    }
                }
                return e
            }

            function i() {
                l.refresh()
            }

            function a() {
                clearTimeout(p), p = setTimeout((function () {
                    for (var n = 0; n < t.length; n++) {
                        var i;
                        u(t.eq(n))
                    }
                    e(), l.refresh()
                }), 25)
            }

            function s(t, e, n) {
                if (!(t = o(t)).hasClass(f)) {
                    var i = o("<div></div>");
                    i.addClass(h), i.css("height", e + "px"), t.after(i), t.addClass(f), t.css("top", n + "px")
                }
            }

            function u(t) {
                (t = o(t)).nextAll("." + h).remove(), t.removeClass(f), t.css("top", "")
            }
            var l = {},
                c = [],
                f = "u-sticky-fixed",
                h = "u-sticky-placeholder",
                p = null;
            return l.init = function init() {
                o(window).on("scroll", i), o(window).on("resize", a), e()
            }, l.destroy = function t() {
                o(window).off("scroll", i), o(window).off("resize", a)
            }, l.refresh = function e() {
                var i = document.documentElement.scrollTop || document.body.scrollTop;
                t.each((function (t, el) {
                    var e = n(t);
                    if (i + e > c[t].top) s(el, c[t].height, e);
                    else u(el)
                }))
            }, l
        }
        var o = n(15);
        o(window).on("load", (function () {
            var t, sticky = i(o(".u-section-row.u-sticky"));
            sticky.init(), sticky.refresh()
        })), window._npStickyStack = i
    },
    12063: function (t, e, n) {
        "use strict";
        var i = n(15);
        i((function () {
            i(".u-nav-container .u-nav-link").each((function () {
                window._npInitMenuLink(i(this))
            })), i(".u-nav-container-collapse .u-nav-link").each((function () {
                window._npInitMenuLink(i(this), true)
            }))
        })), window._npInitMenuLink = function t(e, n) {
            var o = i("body"),
                a = /\/?#.*?$/,
                s = o.attr("data-home-page-name"),
                homePage = o.attr("data-home-page"),
                pageTitle = i("title").text().trim(),
                nav = e.closest(".u-menu"),
                u = nav.attr("data-submenu-level") || "on-click",
                l = nav.is(".u-menu-mega"),
                c = e.attr("href") || "",
                f = (e[0].href || "").replace(a, ""),
                h = c.replace(a, ""),
                p = s || pageTitle,
                m = e.text().trim(),
                hash = c.replace(/^[^#]+/, ""),
                g = f.split(".").slice(0, -1).join("."),
                pageName = h.replace(".html", ""),
                v = new RegExp(pageName + "_[\\s\\S]+?.html", "gm"),
                y = hash && i(hash).length,
                w = h && window.location.href.toString() === f && !y,
                b = h && window.location.href.toString() === g && !y,
                C = h && window.location.href.toString().search(v) > -1,
                S = h && hash && window.location.href.toString().search(h + hash) > -1,
                x, A, _;
            if (w || b || C || S || m && p === m || !y && homePage && h === homePage) {
                var T = e;
                if (!l || n) T = e.parents(".u-nav-item").children(".u-nav-link");
                if (T.addClass("active"), "with-reload" === u && n) T.siblings(".u-nav-popup").addClass("open").css("max-height", "none")
            }
        }
    },
    12064: function (t, e, n) {
        "use strict";
        var i = n(15),
            o;
        if ("Microsoft Internet Explorer" === navigator.appName || !!(navigator.userAgent.match(/Trident/) || navigator.userAgent.match(/rv:11/)) || void 0 !== i.browser && 1 === i.browser.msie) i((function () {
            i(".u-social-icons, .u-language").each((function (t, e) {
                var n = i(e),
                    size = n.css("height");
                n.find(".u-svg-link").css("width", size)
            }))
        }))
    },
    12065: function (t, e, n) {
        "use strict";
        var Animation = n(12066),
            i = n(267);
        n(586), n(12070), window.uAnimation = new Animation(i.instance()).init()
    },
    12066: function (t, e, n) {
        "use strict";

        function Animation(factory) {
            this.factory = factory, this.animationElements = null, this.animationEvents = [], this._section = null, this._sliderNode = null, this._slideNumber = null, this._slideEvent = null, this._animationInfo = null, this._animation = null, this._subscribeQueue = [], this.status = "loading", this._onDOMContentLoaded = this._onDOMContentLoaded.bind(this), this._onLoadingComplete = this._onLoadingComplete.bind(this)
        }

        function i(t) {
            var e = window.requestAnimationFrame || window.mozRequestAnimationFrame || window.webkitRequestAnimationFrame || window.msRequestAnimationFrame;
            if (!e) return t(), void 0;
            e.apply(window, arguments)
        }

        function o(t) {
            return "string" == typeof t.name && -1 !== m.indexOf(t.name.toLowerCase())
        }

        function a(t) {
            return "string" == typeof t.direction && -1 !== g.indexOf(t.direction.toLowerCase())
        }

        function s(section, t) {
            if (t && t.length)
                if (u())
                    for (var e = 0; e < t.length; e++)
                        if (a(t[e]) || o(t[e])) {
                            section.style.overflow = "hidden";
                            break
                        }
        }

        function u() {
            return /Android|webOS|iPhone|iPad|iPod|BlackBerry|IEMobile|Opera Mini/i.test(navigator.userAgent || navigator.vendor || window.opera)
        }
        var l = n(368),
            c = n(369),
            f = n(12067),
            h = n(12068),
            p = n(12069);
        Animation.utils = l, Animation.prototype.init = function init() {
            if ("loading" !== document.readyState) return this._onDOMContentLoaded(), void 0;
            else return document.addEventListener("DOMContentLoaded", this._onDOMContentLoaded), this
        }, Animation.prototype.start = function t() {
            var e = this._subscribeQueue;
            i((function () {
                e.forEach((function (el) {
                    if (el.event && el.animation) el.event.subscribe(el.animation)
                })), e.length = 0
            }))
        }, Animation.prototype.visitSection = function t(e) {
            if (e.classList.contains("u-carousel")) return this.visitSlider(e), void 0;
            this._section = e, this._visitElementsInContentSlider(e), this._visitElementsNotInSlider(e), this._section = null
        }, Animation.prototype._visitElementsInContentSlider = function (t) {
            for (var e = t.querySelectorAll(".u-carousel"), n = 0; n < e.length; n++) this.visitSlider(e[n])
        }, Animation.prototype._visitElementsNotInSlider = function (t) {
            for (var e = [], n = t.querySelectorAll("[data-animation-name]"), o = 0; o < n.length; o++) {
                var a = n[o];
                if (a.closest && null === a.closest(".u-carousel") && a.getAttribute("data-animation-name")) this.visitAnimatedElement(a), e.push(this._animationInfo), this._subscribeQueue.push({
                    animation: this._animation,
                    event: f
                }), i(this._animation.init.bind(this._animation))
            }
            s(t, e)
        }, Animation.prototype.visitSlider = function t(e) {
            this._sliderNode = e;
            for (var n = e.querySelectorAll(".u-carousel-item"), i = 0; i < n.length; i++) this._slideNumber = i, this.visitSlide(n[i])
        }, Animation.prototype.visitSlide = function t(e) {
            var n = e.querySelectorAll("[data-animation-name]"),
                i = [];
            this._slideEvent = new h(this._sliderNode, e, this._slideNumber);
            for (var o = 0; o < n.length; o++)
                if (n[o].getAttribute("data-animation-name")) this.visitAnimatedElement(n[o]), i.push(this._animationInfo), this._animation.init(), this._slideEvent.animations.push(this._animation);
            this._slideEvent.init(), s(e, i)
        }, Animation.prototype.visitAnimatedElement = function t(e) {
            this._animationInfo = new c(e, this._section), this._animation = this.factory.createAnimation(this._animationInfo), this.animationElements.push(this._animation)
        }, Animation.prototype._onDOMContentLoaded = function () {
            if (this.status = "DOMContentLoaded", document.removeEventListener("DOMContentLoaded", this._onDOMContentLoaded), !this.animationElements) {
                this.animationElements = [], this.factory.setHint(p);
                var sections = $("section, header, footer"),
                    length = sections.length;
                if (sections.each(function (index, t) {
                        if (this.visitSection(t), !--length) this.factory.setHint(null)
                    }.bind(this)), "interactive" !== document.readyState) return this._onLoadingComplete(), void 0;
                window.addEventListener("load", this._onLoadingComplete)
            }
        }, Animation.prototype._onLoadingComplete = function () {
            this.status = "complete", window.removeEventListener("load", this._onLoadingComplete), this.start()
        };
        var m = ["lightspeedin", "flipin", "flipout"],
            g = ["right", "downright", "upright"];
        t.exports = Animation, window.Animation = Animation
    },
    12067: function (t, e, n) {
        "use strict";

        function i(animation) {
            if (animation.start(), !animation.isInOutAnimation() && !animation.info.infinite) {
                var t = animation.info.duration,
                    e = animation.info.delay;
                setTimeout((function () {
                    animation.clear()
                }), t + e)
            }
        }

        function o(animation) {
            if (animation.isInOutAnimation()) animation.startOut()
        }

        function a(animation) {
            return animation.info && 0 === animation.info.animationOut && animation.info.element.classList.contains("animated-once")
        }
        var s = {
            subscribe: function t(animation) {
                var e = animation && animation.info || {},
                    n = e.section || e.element;
                animation.info.eventObject = new WaypointAdapter({
                    element: n,
                    handler: function (t) {
                        if (animation)
                            if ("up" === t || a(animation)) return o(animation), void 0;
                            else return i(animation), void 0
                    },
                    offset: "70%"
                })
            }
        };
        t.exports = s, window.AnimationEventScroll = s
    },
    12068: function (t, e, n) {
        "use strict";

        function i(carousel, slide, t) {
            this.carousel = $(carousel), this.slide = $(slide), this.slideNum = t, this.animations = [], this._delays = [], this._autoplayPaused = false, this._handleSlide = o.bind(this), this._handleSlid = a.bind(this)
        }

        function o(t) {
            if (t)
                if (t.from === this.slideNum) this.slideOut(t)
        }

        function a(t) {
            if (t && t.to === this.slideNum) this.pauseAutoplayWhileInAnimation(), this.startInAnimation()
        }
        i.prototype.init = function init() {
            if ($(this.carousel).on("u-slide.bs.u-carousel", this._handleSlide), $(this.carousel).on("slid.bs.u-carousel", this._handleSlid), this.slide.is(".u-active")) {
                if (this._isAutoplayOnStart()) this.pauseAutoplayWhileInAnimation();
                this.startInAnimation()
            }
        }, i.prototype.deinit = function t() {
            $(this.carousel).off("slid.bs.u-carousel", this._handleSlid), $(this.carousel).off("u-slide.bs.u-carousel", this._handleSlide)
        }, i.prototype.resetAnimations = function t() {
            for (var e = 0; e < this.animations.length; e++)
                if (this.animations[e].reset) this.animations[e].reset()
        }, i.prototype.pauseAutoplayWhileInAnimation = function t() {
            var e = this.countMaxInAnimationTime();
            if (e > 0) this._pauseAutoplay(), this._delay(e, function () {
                this._continueAutoplay(), this._clearDelays()
            }.bind(this))
        }, i.prototype.startInAnimation = function t() {
            this.animations.forEach(function (animation) {
                animation.start()
            }.bind(this))
        }, i.prototype.needOutAnimation = function t() {
            for (var e = 0, length = this.animations.length; e < length; e++)
                if (this.animations[e].needOutAnimation && this.animations[e].needOutAnimation()) return true;
            return false
        }, i.prototype.startOutAnimations = function t() {
            for (var e = 0; e < this.animations.length; e++)
                if (this.animations[e].startOut) this.animations[e].startOut()
        }, i.prototype.countMaxOutAnimationTime = function t() {
            if (!this.animations || !this.animations.length) return 0;
            var e = this.animations.map((function (animation) {
                return animation.getOutTime()
            }));
            return Math.max.apply(null, e)
        }, i.prototype.countMaxInAnimationTime = function t() {
            if (!this.animations || !this.animations.length) return 0;
            var e = this.animations.map((function (animation) {
                return animation.getTime()
            }));
            return Math.max.apply(null, e)
        }, i.prototype.slideOut = function t(e) {
            if (this._delays.length > 0) this._cancelDelays();
            if (this._continueAutoplay(), !this.needOutAnimation()) return this.resetAnimations(), void 0;
            e.preventDefault();
            var n = this.countMaxOutAnimationTime(),
                i = "number" == typeof e.to ? e.to : null,
                o = e.direction;
            setTimeout(function () {
                if (this.resetAnimations(), null !== i) return $(e.target)["u-carousel"](i), void 0;
                if ("left" === o) return $(e.target)["u-carousel"]("next"), void 0;
                if ("right" === o) $(e.target)["u-carousel"]("prev")
            }.bind(this), n), this.startOutAnimations()
        }, i.prototype._delay = function t(e, n) {
            this._delays.push(setTimeout((function () {
                n()
            }), e))
        }, i.prototype._cancelDelays = function t() {
            this._delays.forEach((function (id) {
                clearTimeout(id)
            })), this._delays.length = 0
        }, i.prototype._clearDelays = function t() {
            this._delays.length = 0
        }, i.prototype._isAutoplayOnStart = function t() {
            var e = this.carousel.attr("data-u-ride");
            if (!e) return false;
            else return "carousel" === (e = e.toLowerCase())
        }, i.prototype._pauseAutoplay = function t() {
            this.carousel["u-carousel"]("pause"), this._autoplayPaused = true
        }, i.prototype._continueAutoplay = function t() {
            if (this._autoplayPaused) this.carousel["u-carousel"]("cycle"), this._autoplayPaused = false
        }, t.exports = i, window.AnimationEventSlider = i
    },
    12069: function (t, e, n) {
        "use strict";

        function i(t) {
            var e = [];
            if (-1 !== a.indexOf(t.name) || t.direction) e.push("transform");
            if (-1 !== s.indexOf(t.name)) e.push("opacity");
            if (-1 !== u.indexOf(t.name)) e.push("contents");
            if (0 === e.length) e.push("auto");
            return e.join(", ")
        }
        var o = {},
            a = ["bounce", "headShake", "heartBeat", "jello", "pulse", "rubberBand", "shake", "swing", "tada", "wobble", "bounceIn", "flip", "flipInX", "flipInY", "flipOutX", "flipOutY", "lightSpeedIn", "rotateIn", "slideIn", "hinge", "jackInTheBox", "rollIn", "zoomIn", "customAnimationIn", "customAnimationOut"],
            s = ["flash", "bounceIn", "fadeIn", "flipInX", "flipInY", "flipOutX", "flipOutY", "lightSpeedIn", "rotateIn", "hinge", "jackInTheBox", "rollIn", "zoomIn", "customAnimationIn", "customAnimationOut"],
            u = ["counter"];
        o.hintBrowser = function t(e) {
            if (e && e.element) e.element.style.willChange = i(e)
        }, o.removeHint = function t(e) {
            e.element.style.willChange = "auto"
        }, t.exports = o, window.WillChangeHint = o
    },
    12070: function (t, e, n) {
        "use strict";
        var i = n(12071);
        document.addEventListener("np.responsive.init", function (t) {
            setTimeout((function () {
                var e;
                new i(t.detail && t.detail.mode).subscribe()
            }), 0)
        }.bind(this), false)
    },
    12071: function (t, e, n) {
        "use strict";

        function i(t) {
            this.mode = t || "XL", this.animations = [], this._responsiveListener = this.responsiveListener.bind(this), this._prevState = {}, this._app = {
                raf: null
            }
        }
        t.exports = i;
        var o = n(12072);
        i.prototype.subscribe = function () {
            this.animations = this.initTimeline(), document.addEventListener("np.responsive.changed", this._responsiveListener, false);
            var t = this._app,
                e = this.render.bind(this);
            ! function n() {
                e(), t.raf = requestAnimationFrame(n)
            }()
        }, i.prototype.destroy = function () {
            cancelAnimationFrame(this._app.raf), document.removeEventListener("np.responsive.changed", this._responsiveListener, false), this.animations = null
        }, i.prototype.responsiveListener = function (t) {
            if (t.detail && this.mode !== t.detail.mode) this.mode = t.detail.mode, this.animations = this.initTimeline()
        }, i.prototype.initTimeline = function () {
            this._prevState = {};
            var t = document.body.querySelectorAll("[data-custom-animation]");
            return Array.from(t).reduce(function (t, el) {
                var e = el.getAttribute("data-custom-animation"),
                    n;
                if (!e) return t;
                try {
                    n = JSON.parse(e)
                } catch (t) {
                    n = null
                }
                if (n) n.animation = new o(el, n.animation, this.mode), t.push(n);
                return t
            }.bind(this), [])
        }, i.prototype.render = function () {
            var t = this.getGlobal();
            if (this._prevState.scrollY !== t.scrollY) this.animations.forEach((function (e) {
                e.animation.setGlobal(t), e.animation.calc(), e.animation.apply()
            })), this._prevState = t
        }, i.prototype.getGlobal = function () {
            var t = Math.max(document.documentElement.clientHeight || 0, window.innerHeight || 0) || 1,
                e = Math.max(0, window.scrollY),
                n = document.documentElement.scrollHeight || 1,
                i;
            return {
                vh: t,
                scrollY: e,
                scrollHeight: n,
                scrollHeightRelative: n / t
            }
        }, window.ScrollTimeline = i
    },
    12072: function (t, e, n) {
        "use strict";

        function i(t, animation, e) {
            this.dom = t, this.mode = e, this.animation = animation || {}, this.initSteps(), this.state = null, this.global = null
        }
        var o = n(583);
        t.exports = i;
        var a = "before",
            s = "start",
            u = "end",
            l = "top",
            c = "middle",
            f = "bottom";
        Object.defineProperty(i.prototype, "currentAnimation", {
            get: function () {
                return this.animation.XL || {}
            }
        }), Object.defineProperty(i.prototype, "steps", {
            get: function () {
                return this.currentAnimation.steps || []
            }
        }), i.prototype.initSteps = function () {
            var t, e = this.dom.getBoundingClientRect();
            this.domWidth = e.width || 0, this.domHeight = e.height || 0, this.domTop = e.top + Math.max(0, window.scrollY), window._responsive.modes.forEach((function (e) {
                var n = this.animation[e];
                if (n) {
                    var i = n.steps || [],
                        o = 0;
                    i.forEach((function (t, e) {
                        var n = parseFloat(t.dist) || 0;
                        t.index = e, t.start = o, t.end = o + n, o = t.end
                    })), t = n
                } else if (t) this.animation[e] = JSON.parse(JSON.stringify(t))
            }), this)
        }, i.prototype.setGlobal = function (t) {
            this.global = t
        }, i.prototype.calc = function () {
            var t = this.animation[this.mode] || {};
            if (this.state = {
                    blur: 0,
                    sticky: false,
                    fixed: false,
                    _fixedDist: 0,
                    _unfixedDist: 0,
                    mx: 0,
                    my: 0,
                    op: 1,
                    rot: 0,
                    sx: 1,
                    sy: 1,
                    bgy: 0
                }, !t.hidden && (this.domHeight || this.domWidth)) {
                var e = this.getGlobalProgress();
                this.steps.forEach((function (t) {
                    var n = a;
                    if (e >= t.start && e < t.end) n = s;
                    else if (e >= t.end) n = u;
                    else if (e < t.start) n = a;
                    this.calcStep(n, t, e)
                }), this)
            }
        }, i.prototype.getGlobalProgress = function () {
            var t = this.currentAnimation.start || {},
                e = t.at || f,
                n = parseFloat(t.off) || 0,
                i = this.domTop,
                o;
            if (e === l && this.domTop < 0) i += -this.domTop;
            if (e === c) {
                if (this.domTop < this.global.vh / 2) i += this.global.vh / 2 - this.domTop;
                i -= this.global.vh / 2
            }
            if (e === f) {
                if (this.domTop < this.global.vh) i += this.global.vh - this.domTop;
                i -= this.global.vh
            }
            return (this.global.scrollY + n - i) * this.global.scrollHeightRelative / this.global.scrollHeight
        }, i.prototype.calcStep = function (t, e, n) {
            this.state.willChange = t !== u, this.calcStepPropertyToggle(t, e, "sticky", true), this.calcStepPropertyToggle(t, e, "fixed"), this.calcFixed(t, e, n);
            var i = this.getStepProgress(t, e, n);
            this.state.mx += (e.mx - this.state.mx) * i, this.state.my += (e.my - this.state.my) * i, this.state.op += (e.op - this.state.op) * i, this.state.sx += (e.sx - this.state.sx) * i, this.state.sy += (e.sy - this.state.sy) * i, this.state.rot += (e.rot - this.state.rot) * i, this.state.bgy += (e.bgy - this.state.bgy) * i, this.state.blur += (e.blur - this.state.blur) * i
        }, i.prototype.getStepProgress = function (t, e, n) {
            if (t === a) return 0;
            if (t === u) return 1;
            else return (n - e.start) / (e.end - e.start)
        }, i.prototype.calcStepPropertyToggle = function (t, e, n, i) {
            if (e[n])
                if (!(t === a && this.state[n] && e.index > 0))
                    if (t === s) this.state[n] = true;
                    else if (t === u) this.state[n] = i ? e[n] : false
        }, i.prototype.calcFixed = function (t, e, n) {
            if (!e.fixed) return this.state._unfixedDist += this.global.vh * e.dist, void 0;
            if (t === s) this.state._fixedDist = this.global.vh * n - this.state._unfixedDist;
            else if (t === u) this.state._fixedDist += this.global.vh * e.dist
        }, i.prototype.apply = function () {
            if (this.state) o.apply(this.dom, this.state)
        }, window.StepAnimation = i
    },
    12073: function (t, e, n) {
        "use strict";

        function i() {}

        function o(t, props) {
            document.body.classList.add("u-scrollspy-prevent"), t.animate(props, {
                done: function () {
                    document.body.classList.remove("u-scrollspy-prevent")
                }
            })
        }
        var a = n(15);
        i.prototype.scroll = function (t) {
            var e = 1,
                n = a(".u-section-row.u-sticky, header.u-sticky").toArray().reduce((function (t, el) {
                    return t + (a(el).outerHeight(true) || 0) - e
                }), 0);
            o(a("html, body"), {
                scrollTop: t.offset().top - n
            })
        }, i.prototype.scrollTop = function () {
            o(a("html, body"), {
                scrollTop: 0
            })
        }, i.prototype.update = function (t) {
            var e = "string" == typeof t ? t : a(t.currentTarget).attr("href");
            if ((e = (e || "").replace(/^[^#]+/, "")).match(/^#[\d\w-_]+$/i)) {
                var n = a(e);
                if (n.length) {
                    if (t.preventDefault) t.preventDefault();
                    this.scroll(n)
                }
            }
        }, window._npScrollAnchor = new i, a(window).on("load", (function () {
            window._npScrollAnchor.update(window.location.hash), a("body").on("click", "a:not([data-u-slide], [data-u-slide-to], [data-toggle], .u-tab-link, .u-quantity-button)", (function (t) {
                if (!a(this).is(".u-dialog-link")) window._npScrollAnchor.update(t)
            })), a("body").on("click", ".u-back-to-top", (function () {
                window._npScrollAnchor.scrollTop()
            }))
        }))
    },
    12074: function (t, e, n) {
        "use strict";
        var i = n(15),
            o = n(12075),
            a = "u-gdpr-cookie",
            s = "u-cookies-consent",
            u = "u-button-confirm",
            l = "u-button-decline",
            c = "_u_GDPRConfirmCode";
        i((function () {
            function t() {
                var t = f(),
                    n = f();
                e("sessionId", t, .5 / 24), e("userId", n, 365)
            }

            function e(t, e, n) {
                if (!o.get(t)) o.set(t, e, {
                    expires: n,
                    secure: true
                })
            }

            function n() {
                function t() {
                    return Math.floor(65536 * (1 + Math.random())).toString(16).substring(1)
                }
                return t() + t() + "-" + t() + "-" + t() + "-" + t() + "-" + t() + t() + t()
            }

            function f() {
                if (crypto && "function" == typeof crypto.getRandomValues && "function" == typeof window.Uint8Array) {
                    var t = new window.Uint8Array(16),
                        guid;
                    crypto.getRandomValues(t), t[6] = 15 & t[6] | 64, t[8] = 63 & t[8] | 128;
                    for (var e = [], i = "", o = 0; o < t.length; o++) {
                        if ((i = t[o].toString(16)).length < 2) i = "0" + i;
                        e.push(i)
                    }
                    return e.slice(0, 4).join("") + "-" + e.slice(4, 6).join("") + "-" + e.slice(6, 8).join("") + "-" + e.slice(8, 10).join("") + "-" + e.slice(10).join("")
                }
                return n()
            }
            var h = i("." + s),
                p;
            if (!h.length) return t(), void 0;
            try {
                p = o.get(a)
            } catch (t) {
                p = false
            }
            var m = window[c] || function () {};
            if (!p) h.addClass("show"), h.find("." + u).on("click", (function (e) {
                e.preventDefault(), t(), o.set(a, true, {
                    expires: 365,
                    secure: true
                }), h.removeClass("show"), m()
            })), h.find("." + l).on("click", (function (t) {
                t.preventDefault(), o.set(a, false, {
                    expires: 365,
                    secure: false
                }), h.removeClass("show")
            }));
            else if ("true" === p) t(), m()
        }))
    },
    12075: function (t, e, n) {
        "use strict";
        var i, o;
        /*!
         * JavaScript Cookie v2.2.1
         * https://github.com/js-cookie/js-cookie
         *
         * Copyright 2006, 2015 Klaus Hartl & Fagner Brack
         * Released under the MIT license
         */
        ! function (factory) {
            var a;
            if (true) !(void 0 !== (o = "function" == typeof (i = factory) ? i.call(e, n, e, t) : i) && (t.exports = o)), a = true;
            if (true) t.exports = factory(), a = true;
            if (!a) {
                var s = window.Cookies,
                    u = window.Cookies = factory();
                u.noConflict = function () {
                    return window.Cookies = s, u
                }
            }
        }((function () {
            function t() {
                for (var t = 0, e = {}; t < arguments.length; t++) {
                    var n = arguments[t];
                    for (var i in n) e[i] = n[i]
                }
                return e
            }

            function e(t) {
                return t.replace(/(%[0-9A-Z]{2})+/g, decodeURIComponent)
            }

            function init(n) {
                function i() {}

                function o(e, o, a) {
                    if ("undefined" != typeof document) {
                        if ("number" == typeof (a = t({
                                path: "/"
                            }, i.defaults, a)).expires) a.expires = new Date(1 * new Date + 864e5 * a.expires);
                        a.expires = a.expires ? a.expires.toUTCString() : "";
                        try {
                            var s = JSON.stringify(o);
                            if (/^[\{\[]/.test(s)) o = s
                        } catch (t) {}
                        o = n.write ? n.write(o, e) : encodeURIComponent(String(o)).replace(/%(23|24|26|2B|3A|3C|3E|3D|2F|3F|40|5B|5D|5E|60|7B|7D|7C)/g, decodeURIComponent), e = encodeURIComponent(String(e)).replace(/%(23|24|26|2B|5E|60|7C)/g, decodeURIComponent).replace(/[\(\)]/g, escape);
                        var u = "";
                        for (var l in a)
                            if (a[l])
                                if (u += "; " + l, true !== a[l]) u += "=" + a[l].split(";")[0];
                        return document.cookie = e + "=" + o + u
                    }
                }

                function a(t, i) {
                    if ("undefined" != typeof document) {
                        for (var o = {}, a = document.cookie ? document.cookie.split("; ") : [], s = 0; s < a.length; s++) {
                            var u = a[s].split("="),
                                l = u.slice(1).join("=");
                            if (!i && '"' === l.charAt(0)) l = l.slice(1, -1);
                            try {
                                var c = e(u[0]);
                                if (l = (n.read || n)(l, c) || e(l), i) try {
                                    l = JSON.parse(l)
                                } catch (t) {}
                                if (o[c] = l, t === c) break
                            } catch (t) {}
                        }
                        return t ? o[t] : o
                    }
                }
                return i.set = o, i.get = function (t) {
                    return a(t, false)
                }, i.getJSON = function (t) {
                    return a(t, true)
                }, i.remove = function (e, n) {
                    o(e, "", t(n, {
                        expires: -1
                    }))
                }, i.defaults = {}, i.withConverter = init, i
            }
            return init((function () {}))
        }))
    },
    12076: function (t, e, n) {
        "use strict";
        $((function () {
            var selector = ".u-back-to-top";
            $(selector).hide(), $(window).scroll((function () {
                if ($(this).scrollTop() > 100) $(selector).fadeIn().css("display", "block");
                else $(selector).fadeOut()
            }))
        }))
    },
    12077: function (t, e, n) {
        "use strict";
        var i = n(15),
            o = n(12078);
        window._npScrollSpyInit = function () {
            var t = '.u-menu .u-nav-container .u-nav-link[href*="#"]',
                e = '.u-menu .u-nav-container-collapse .u-nav-link[href*="#"]',
                n;
            if (document.querySelectorAll(t).length) try {
                o(t, {
                    nested: true,
                    offset: function () {
                        var t, e;
                        return (i(".u-header.u-sticky").outerHeight(true) || 0) + 1
                    }
                }), o(e, {
                    nested: true,
                    offset: function () {
                        return i(".u-header.u-sticky").outerHeight(true) || 0
                    }
                })
            } catch (t) {
                console.warn("ScrollSpy: has no items")
            }
        }, document.addEventListener("gumshoeActivate", (function (t) {
            var link;
            t.detail.link.classList.add("active")
        }), false), document.addEventListener("gumshoeDeactivate", (function (t) {
            var link;
            t.detail.link.classList.remove("active")
        }), false), i((function () {
            window._npScrollSpyInit()
        }))
    },
    12078: function (t, e, n) {
        "use strict";
        (function (n) {
            var i, o;
            /*!
             * gumshoejs v5.1.2
             * A simple, framework-agnostic scrollspy script.
             * (c) 2019 Chris Ferdinandi
             * MIT License
             * http://github.com/cferdinandi/gumshoe
             */
            ! function (n, factory) {
                if (true) !(void 0 !== (o = function () {
                    return factory(n)
                }.apply(e, i = [])) && (t.exports = o));
                else if ("object" == typeof e) t.exports = factory(n);
                else n.Gumshoe = factory(n)
            }(void 0 !== n ? n : "undefined" != typeof window ? window : this, (function (t) {
                var e = {
                        navClass: "active",
                        contentClass: "active",
                        nested: false,
                        nestedClass: "active",
                        offset: 0,
                        reflow: false,
                        events: true
                    },
                    n = function () {
                        var t = {};
                        return Array.prototype.forEach.call(arguments, (function (e) {
                            for (var n in e)
                                if (e.hasOwnProperty(n)) t[n] = e[n]
                        })), t
                    },
                    i = function (type, t, e) {
                        if (e.settings.events) {
                            var n = new CustomEvent(type, {
                                bubbles: true,
                                cancelable: true,
                                detail: e
                            });
                            t.dispatchEvent(n)
                        }
                    },
                    o = function (t) {
                        var e = 0;
                        if (t.offsetParent)
                            for (; t;) e += t.offsetTop, t = t.offsetParent;
                        return e >= 0 ? e : 0
                    },
                    a = function (t) {
                        if (t) t.sort((function (t, e) {
                            var n, i;
                            if (o(t.content) < o(e.content)) return -1;
                            else return 1
                        }))
                    },
                    s = function (settings) {
                        if ("function" == typeof settings.offset) return parseFloat(settings.offset());
                        else return parseFloat(settings.offset)
                    },
                    u = function () {
                        return Math.max(document.body.scrollHeight, document.documentElement.scrollHeight, document.body.offsetHeight, document.documentElement.offsetHeight, document.body.clientHeight, document.documentElement.clientHeight)
                    },
                    l = function (e, settings, n) {
                        var i = e.getBoundingClientRect(),
                            o = s(settings);
                        if (n) return parseInt(i.bottom, 10) < (t.innerHeight || document.documentElement.clientHeight);
                        else return parseInt(i.top, 10) <= o
                    },
                    c = function () {
                        if (t.innerHeight + t.pageYOffset >= u()) return true;
                        else return false
                    },
                    f = function (t, settings) {
                        if (c() && l(t.content, settings, true)) return true;
                        else return false
                    },
                    h = function (t, settings) {
                        if (t.length) {
                            var e = t[t.length - 1];
                            if (f(e, settings)) return e;
                            for (var n = t.length - 1; n >= 0; n--)
                                if (l(t[n].content, settings)) return t[n]
                        }
                    },
                    p = function (nav, settings) {
                        if (settings.nested && nav.parentNode) {
                            var t = nav.parentNode.closest("li");
                            if (t) t.classList.remove(settings.nestedClass), p(t, settings)
                        }
                    },
                    m = function (items, settings) {
                        if (items) {
                            var t = items.nav.closest("li");
                            if (t) t.classList.remove(settings.navClass), items.content.classList.remove(settings.contentClass), p(t, settings), i("gumshoeDeactivate", t, {
                                link: items.nav,
                                content: items.content,
                                settings: settings
                            })
                        }
                    },
                    g = function (nav, settings) {
                        if (settings.nested) {
                            var t = nav.parentNode.closest("li");
                            if (t) t.classList.add(settings.nestedClass), g(t, settings)
                        }
                    },
                    v = function (items, settings) {
                        if (items) {
                            var t = items.nav.closest("li");
                            if (t) t.classList.add(settings.navClass), items.content.classList.add(settings.contentClass), g(t, settings), i("gumshoeActivate", t, {
                                link: items.nav,
                                content: items.content,
                                settings: settings
                            })
                        }
                    },
                    y;
                return function (selector, i) {
                    var o = {},
                        s, u, l, c, settings;
                    o.setup = function () {
                        s = document.querySelectorAll(selector), u = [], Array.prototype.forEach.call(s, (function (t) {
                            var e = document.getElementById(decodeURIComponent(t.hash.substr(1)));
                            if (e) u.push({
                                nav: t,
                                content: e
                            })
                        })), a(u)
                    }, o.detect = function () {
                        if (!document.body.classList.contains("u-scrollspy-prevent")) {
                            var t = h(u, settings);
                            if (t) {
                                if (!l || t.content !== l.content) m(l, settings), v(t, settings), l = t
                            } else if (l) m(l, settings), l = null
                        }
                    };
                    var f = function () {
                            if (c) t.cancelAnimationFrame(c);
                            c = t.requestAnimationFrame(o.detect)
                        },
                        p = function () {
                            if (c) t.cancelAnimationFrame(c);
                            c = t.requestAnimationFrame((function () {
                                a(u), o.detect()
                            }))
                        },
                        init;
                    return o.destroy = function () {
                            if (l) m(l, settings);
                            if (t.removeEventListener("scroll", f, false), settings.reflow) t.removeEventListener("resize", p, false);
                            u = null, s = null, l = null, c = null, settings = null
                        },
                        function () {
                            if (settings = n(e, i || {}), o.setup(), o.detect(), t.addEventListener("scroll", f, false), settings.reflow) t.addEventListener("resize", p, false)
                        }(), o
                }
            }))
        }).call(e, n(58))
    },
    12079: function (t, e, n) {
        "use strict";
        var i = n(15),
            Filter = n(12080),
            o = n(12082),
            HorizontalLayoutSlider = n(398);
        i(window).on("load", (function () {
            setTimeout((function () {
                i(".u-gallery").removeClass("u-no-transition"), i(".u-layout-horizontal").each((function () {
                    var gallery = i(this),
                        slider = new HorizontalLayoutSlider(gallery, true);
                    gallery.children(".u-gallery-nav").click((function (t) {
                        t.preventDefault();
                        var e = i(t.currentTarget);
                        slider.navigate(e)
                    }))
                }))
            }), 250)
        })), i((function () {
            var t;
            i("body").on("mouseenter", ".u-gallery.u-no-transition", (function () {
                i(this).closest(".u-gallery").removeClass("u-no-transition")
            })), new o([".u-gallery.u-product-zoom.u-layout-thumbnails", ".u-gallery.u-product-zoom.u-layout-carousel"]).init(), Filter.init()
        }))
    },
    12080: function (t, e, n) {
        "use strict";
        var i = n(15),
            GalleryLayout = n(12081),
            Filter;
        t.exports.init = function () {
            var filter = i(".u-gallery-filter");
            filter.on("click", ".u-filter-item", (function (t) {
                t.preventDefault();
                var gallery = filter.closest(".u-gallery"),
                    e = gallery.find(".u-gallery-item"),
                    n = i(t.currentTarget),
                    o = GalleryLayout.init(gallery);
                filter.find(".active").removeClass("active"), n.addClass("active");
                var a = n.text().trim(),
                    s = n.index();
                e.each((function () {
                    var galleryItem = i(this),
                        t;
                    if (galleryItem.attr("data-category") === a || 0 === s) galleryItem.removeClass("hide"), galleryItem.addClass("show");
                    else galleryItem.removeClass("show"), galleryItem.addClass("hide")
                })), o.updateHeight()
            }))
        }
    },
    12081: function (t, e, n) {
        "use strict";

        function GalleryLayout(gallery) {
            this.columnsRegEx = /repeat\((\d+),\s*auto\)/i, this.columnsSplitRegEx = /\s+/, this.gallery = gallery, this.inner = gallery.find(".u-gallery-inner"), this.controls = gallery.find(".u-gallery-controls")
        }
        t.exports = GalleryLayout, GalleryLayout.init = function (gallery) {
            var model = new GalleryLayout(gallery);
            return model.init(), model.updateHeight(), model
        }, GalleryLayout.prototype.init = function () {
            var t = this.inner.css("grid-template-columns") || "",
                e = t.match(this.columnsRegEx);
            if (e) this.columns = parseFloat(e[1]);
            else this.columns = t.split(this.columnsSplitRegEx).length;
            if (!this.columns) this.columns = 1;
            this.allItems = this.inner.find(".u-gallery-item"), this.allRows = Math.ceil(this.allItems.length / this.columns), this._updateState();
            var n = this.inner.height(),
                i = parseFloat(this.inner.css("gap")) || 0,
                o = this.visibleRows > 0 ? i * (this.visibleRows - 1) : 0;
            this.rowHeight = (n - o) / this.visibleRows
        }, GalleryLayout.prototype._updateState = function () {
            this.visibleItems = this.allItems.filter(":not(.hide)"), this.visibleRows = Math.ceil(this.visibleItems.length / this.columns)
        }, GalleryLayout.prototype.updateHeight = function () {
            if (this._updateState(), this.visibleRows) {
                var t = parseFloat(this.gallery.css("gap")) || 0,
                    e = parseFloat(this.inner.css("gap")) || 0,
                    n = this.controls.height() + t,
                    i = this.visibleRows > 0 ? e * (this.visibleRows - 1) : 0,
                    o = n + this.rowHeight * this.visibleRows + i;
                this.gallery.css("height", o + "px")
            }
        }
    },
    12082: function (t, e, n) {
        "use strict";

        function i(t) {
            this.galleryZoomSelector = t
        }

        function o(t) {
            var e = t.currentTarget,
                n, i = u(e).closest(".u-gallery-item").data("zoom_click"),
                o = e.getBoundingClientRect(),
                a = e.querySelector("img"),
                s = t.clientX,
                l = t.clientY,
                c = t.originalEvent.changedTouches;
            if (!i && !c) {
                u(e).addClass("hover");
                var f = s - o.x,
                    h = l - o.y;
                requestAnimationFrame((function () {
                    var t = f * (1 - a.offsetWidth / e.offsetWidth),
                        n = h * (1 - a.offsetHeight / e.offsetHeight);
                    a.style.left = t + "px", a.style.top = n + "px"
                }))
            }
        }

        function a(t) {
            var e = u(t.currentTarget),
                n;
            u(e).removeClass("hover"), u(e).closest(".u-gallery-item").data("zoom_click")
        }

        function s(t) {
            var e = u(t.currentTarget);
            u(e).removeClass("hover")
        }
        var u = n(15);
        t.exports = i, i.prototype.init = function () {
            var t = this.galleryZoomSelector.map((function (selector) {
                    return selector + " .u-back-slide"
                })).join(", "),
                e = this.galleryZoomSelector.map((function (selector) {
                    return selector + " .u-back-image"
                })).join(", ");
            u("body").on("mousedown touchstart", t, a), u("body").on("mousemove touchmove", t, o), u("body").on("click mouseup mouseout touchend touchcancel", t, s), u(e).each((function (t, e) {
                var url = e.getAttribute("src");
                u(e).parent().css("background-image", "url(" + url + ")")
            }))
        }, window.ImageZoom = i
    },
    12083: function (t, e, n) {
        "use strict";
        var i = n(15),
            TabsControl = n(270);
        window._npTabsInit = function () {
            function t(t) {
                t.preventDefault(), t.stopPropagation();
                var link = i(t.currentTarget),
                    tabsControl;
                new TabsControl(link).show()
            }
            i("body").on("click", ".u-tab-link", t)
        }, i((function () {
            window._npTabsInit()
        }))
    },
    12084: function (t, e, n) {
        "use strict";
        var i = n(12085);
        window._npLazyImages = {
            setup: function () {
                window.lazySizesConfig = window.lazySizesConfig || {}, window.lazySizesConfig.init = false, document.addEventListener("lazybeforeunveil", (function (t) {
                    var el = t.target;
                    if (el.matches("video")) {
                        var e = el.getAttribute("data-src"),
                            n = el.querySelector("source");
                        if (n && e) n.setAttribute("src", e)
                    } else {
                        var i = el.getAttribute("data-bg");
                        if (i) {
                            var list = cssBgParser.parseElementStyle(getComputedStyle(el));
                            if (list.backgrounds.length) list.backgrounds[0].color = "";
                            list.backgrounds.push(new cssBgParser.Background({
                                image: i
                            })), el.style.backgroundImage = list.toString("image")
                        }
                    }
                }))
            },
            init: function () {
                i.init()
            }
        }, window._npLazyImages.setup(), $((function () {
            window._npLazyImages.init()
        }))
    },
    12085: function (t, e, n) {
        "use strict";
        ! function (e, factory) {
            var n = factory(e, e.document, Date);
            if (e.lazySizes = n, "object" == typeof t && t.exports) t.exports = n
        }("undefined" != typeof window ? window : {}, (function t(e, n, Date) {
            var i, o;
            if (! function () {
                    var t, n = {
                        lazyClass: "lazyload",
                        loadedClass: "lazyloaded",
                        loadingClass: "lazyloading",
                        preloadClass: "lazypreload",
                        errorClass: "lazyerror",
                        autosizesClass: "lazyautosizes",
                        srcAttr: "data-src",
                        srcsetAttr: "data-srcset",
                        sizesAttr: "data-sizes",
                        minSize: 40,
                        customMedia: {},
                        init: true,
                        expFactor: 1.5,
                        hFac: .8,
                        loadMode: 2,
                        loadHidden: true,
                        ricTimeout: 0,
                        throttleDelay: 125
                    };
                    for (t in o = e.lazySizesConfig || e.lazysizesConfig || {}, n)
                        if (!(t in o)) o[t] = n[t]
                }(), !n || !n.getElementsByClassName) return {
                init: function () {},
                cfg: o,
                noSupport: true
            };
            var a = n.documentElement,
                s = e.HTMLPictureElement,
                u = "addEventListener",
                l = "getAttribute",
                c = e[u].bind(e),
                f = e.setTimeout,
                h = e.requestAnimationFrame || f,
                p = e.requestIdleCallback,
                m = /^picture$/i,
                g = ["load", "error", "lazyincluded", "_lazyloaded"],
                v = {},
                y = Array.prototype.forEach,
                w = function (t, e) {
                    if (!v[e]) v[e] = new RegExp("(\\s|^)" + e + "(\\s|$)");
                    return v[e].test(t[l]("class") || "") && v[e]
                },
                b = function (t, e) {
                    if (!w(t, e)) t.setAttribute("class", (t[l]("class") || "").trim() + " " + e)
                },
                C = function (t, e) {
                    var n;
                    if (n = w(t, e)) t.setAttribute("class", (t[l]("class") || "").replace(n, " "))
                },
                S = function (t, e, add) {
                    var n = add ? u : "removeEventListener";
                    if (add) S(t, e);
                    g.forEach((function (i) {
                        t[n](i, e)
                    }))
                },
                x = function (t, e, o, a, s) {
                    var u = n.createEvent("Event");
                    if (!o) o = {};
                    return o.instance = i, u.initEvent(e, !a, !s), u.detail = o, t.dispatchEvent(u), u
                },
                A = function (el, t) {
                    var n;
                    if (!s && (n = e.picturefill || o.pf)) {
                        if (t && t.src && !el[l]("srcset")) el.setAttribute("srcset", t.src);
                        n({
                            reevaluate: true,
                            elements: [el]
                        })
                    } else if (t && t.src) el.src = t.src
                },
                _ = function (t, style) {
                    return (getComputedStyle(t, null) || {})[style]
                },
                T = function (t, e, n) {
                    for (n = n || t.offsetWidth; n < o.minSize && e && !t._lazysizesWidth;) n = e.offsetWidth, e = e.parentNode;
                    return n
                },
                E = (L = [], P = M = [], B = function (t, e) {
                    if (I && !e) t.apply(this, arguments);
                    else if (P.push(t), !k) k = true, (n.hidden ? f : h)(O)
                }, B._lsFlush = O = function () {
                    var t = P;
                    for (P = M.length ? L : M, I = true, k = false; t.length;) t.shift()();
                    I = false
                }, B),
                I, k, M, L, P, O, B, F = function (t, simple) {
                    return simple ? function () {
                        E(t)
                    } : function () {
                        var e = this,
                            n = arguments;
                        E((function () {
                            t.apply(e, n)
                        }))
                    }
                },
                N = function (t) {
                    var e, n = 0,
                        i = o.throttleDelay,
                        a = o.ricTimeout,
                        s = function () {
                            e = false, n = Date.now(), t()
                        },
                        u = p && a > 49 ? function () {
                            if (p(s, {
                                    timeout: a
                                }), a !== o.ricTimeout) a = o.ricTimeout
                        } : F((function () {
                            f(s)
                        }), true);
                    return function (t) {
                        var o;
                        if (t = true === t) a = 33;
                        if (!e) {
                            if (e = true, (o = i - (Date.now() - n)) < 0) o = 0;
                            if (t || o < 9) u();
                            else f(u, o)
                        }
                    }
                },
                U = function (t) {
                    var e, n, i = 99,
                        o = function () {
                            e = null, t()
                        },
                        a = function () {
                            var t = Date.now() - n;
                            if (t < i) f(a, i - t);
                            else(p || o)(o)
                        };
                    return function () {
                        if (n = Date.now(), !e) e = f(a, i)
                    }
                },
                loader = (tt = /^img$/i, nt = /^iframe$/i, rt = "onscroll" in e && !/(gle|ing)bot/.test(navigator.userAgent), ot = 0, at = 0, st = 0, ut = -1, lt = function (t) {
                    if (st--, !t || st < 0 || !t.target) st = 0
                }, ct = function (t) {
                    if (null == J) J = "hidden" == _(n.body, "visibility");
                    return J || !("hidden" == _(t.parentNode, "visibility") && "hidden" == _(t, "visibility"))
                }, ft = function (t, e) {
                    var i, o = t,
                        visible = ct(t);
                    for (j -= e, X += e, K -= e, Z += e; visible && (o = o.offsetParent) && o != n.body && o != a;)
                        if ((visible = (_(o, "opacity") || 1) > 0) && "visible" != _(o, "overflow")) i = o.getBoundingClientRect(), visible = Z > i.left && K < i.right && X > i.top - 1 && j < i.bottom + 1;
                    return visible
                }, ht = N(dt = function () {
                    var t, e, rect, s, u, c, f, h, p, m, g, v, y = i.elements;
                    if ((Y = o.loadMode) && st < 8 && (t = y.length)) {
                        for (e = 0, ut++; e < t; e++)
                            if (y[e] && !y[e]._lazyRace)
                                if (!(!rt || i.prematureUnveil && i.prematureUnveil(y[e]))) {
                                    if (!(h = y[e][l]("data-expand")) || !(c = 1 * h)) c = at;
                                    if (!m)
                                        if (m = !o.expand || o.expand < 1 ? a.clientHeight > 500 && a.clientWidth > 500 ? 500 : 370 : o.expand, i._defEx = m, g = m * o.expFactor, v = o.hFac, J = null, at < g && st < 1 && ut > 2 && Y > 2 && !n.hidden) at = g, ut = 0;
                                        else if (Y > 1 && ut > 1 && st < 6) at = m;
                                    else at = ot;
                                    if (p !== c) V = innerWidth + c * v, G = innerHeight + c, f = -1 * c, p = c;
                                    if (rect = y[e].getBoundingClientRect(), (X = rect.bottom) >= f && (j = rect.top) <= G && (Z = rect.right) >= f * v && (K = rect.left) <= V && (X || Z || K || j) && (o.loadHidden || ct(y[e])) && (H && st < 3 && !h && (Y < 3 || ut < 4) || ft(y[e], c))) {
                                        if (bt(y[e]), u = true, st > 9) break
                                    } else if (!u && H && !s && st < 4 && ut < 4 && Y > 2 && (z[0] || o.preloadAfterLoad) && (z[0] || !h && (X || Z || K || j || "auto" != y[e][l](o.sizesAttr)))) s = z[0] || y[e]
                                } else bt(y[e]);
                        if (s && !u) bt(s)
                    }
                }), mt = F(pt = function (t) {
                    var e = t.target;
                    if (e._lazyCache) return delete e._lazyCache, void 0;
                    lt(t), b(e, o.loadedClass), C(e, o.loadingClass), S(e, gt), x(e, "lazyloaded")
                }), gt = function (t) {
                    mt({
                        target: t.target
                    })
                }, vt = function (t, e) {
                    try {
                        t.contentWindow.location.replace(e)
                    } catch (n) {
                        t.src = e
                    }
                }, yt = function (t) {
                    var e, n = t[l](o.srcsetAttr);
                    if (e = o.customMedia[t[l]("data-media") || t[l]("media")]) t.setAttribute("media", e);
                    if (n) t.setAttribute("srcset", n)
                }, wt = F((function (t, e, n, i, a) {
                    var s, u, c, h, p, g;
                    if (!(p = x(t, "lazybeforeunveil", e)).defaultPrevented) {
                        if (i)
                            if (n) b(t, o.autosizesClass);
                            else t.setAttribute("sizes", i);
                        if (u = t[l](o.srcsetAttr), s = t[l](o.srcAttr), a) h = (c = t.parentNode) && m.test(c.nodeName || "");
                        if (g = e.firesLoad || "src" in t && (u || s || h), p = {
                                target: t
                            }, b(t, o.loadingClass), g) clearTimeout($), $ = f(lt, 2500), S(t, gt, true);
                        if (h) y.call(c.getElementsByTagName("source"), yt);
                        if (u) t.setAttribute("srcset", u);
                        else if (s && !h)
                            if (nt.test(t.nodeName)) vt(t, s);
                            else t.src = s;
                        if (a && (u || h)) A(t, {
                            src: s
                        })
                    }
                    if (t._lazyRace) delete t._lazyRace;
                    C(t, o.lazyClass), E((function () {
                        var e = t.complete && t.naturalWidth > 1;
                        if (!g || e) {
                            if (e) b(t, "ls-is-cached");
                            pt(p), t._lazyCache = true, f((function () {
                                if ("_lazyCache" in t) delete t._lazyCache
                            }), 9)
                        }
                        if ("lazy" == t.loading) st--
                    }), true)
                })), bt = function (t) {
                    if (!t._lazyRace) {
                        var e, n = tt.test(t.nodeName),
                            i = n && (t[l](o.sizesAttr) || t[l]("sizes")),
                            a = "auto" == i;
                        if (!a && H || !n || !t[l]("src") && !t.srcset || t.complete || w(t, o.errorClass) || !w(t, o.lazyClass)) {
                            if (e = x(t, "lazyunveilread").detail, a) At.updateElem(t, true, t.offsetWidth);
                            t._lazyRace = true, st++, wt(t, e, a, i, n)
                        }
                    }
                }, Ct = U((function () {
                    o.loadMode = 3, ht()
                })), xt = function () {
                    if (!H) {
                        if (Date.now() - W < 999) return f(xt, 999), void 0;
                        H = true, o.loadMode = 3, ht(), c("scroll", St, true)
                    }
                }, {
                    _: function () {
                        if (W = Date.now(), i.elements = n.getElementsByClassName(o.lazyClass), z = n.getElementsByClassName(o.lazyClass + " " + o.preloadClass), c("scroll", ht, true), c("resize", ht, true), c("pageshow", (function (t) {
                                if (t.persisted) {
                                    var e = n.querySelectorAll("." + o.loadingClass);
                                    if (e.length && e.forEach) h((function () {
                                        e.forEach((function (t) {
                                            if (t.complete) bt(t)
                                        }))
                                    }))
                                }
                            })), e.MutationObserver) new MutationObserver(ht).observe(a, {
                            childList: true,
                            subtree: true,
                            attributes: true
                        });
                        else a[u]("DOMNodeInserted", ht, true), a[u]("DOMAttrModified", ht, true), setInterval(ht, 999);
                        if (c("hashchange", ht, true), ["focus", "mouseover", "click", "load", "transitionend", "animationend"].forEach((function (t) {
                                n[u](t, ht, true)
                            })), /d$|^c/.test(n.readyState)) xt();
                        else c("load", xt), n[u]("DOMContentLoaded", ht), f(xt, 2e4);
                        if (i.elements.length) dt(), E._lsFlush();
                        else ht()
                    },
                    checkElems: ht,
                    unveil: bt,
                    _aLSL: St = function () {
                        if (3 == o.loadMode) o.loadMode = 2;
                        Ct()
                    }
                }),
                z, H, $, Y, W, V, G, j, K, Z, X, J, tt, nt, rt, ot, at, st, ut, lt, ct, ft, dt, ht, pt, mt, gt, vt, yt, wt, bt, Ct, St, xt, At = (Tt = F((function (t, e, n, i) {
                    var o, a, s;
                    if (t._lazysizesWidth = i, i += "px", t.setAttribute("sizes", i), m.test(e.nodeName || ""))
                        for (a = 0, s = (o = e.getElementsByTagName("source")).length; a < s; a++) o[a].setAttribute("sizes", i);
                    if (!n.detail.dataAttr) A(t, n.detail)
                })), Dt = function (t, e, n) {
                    var i, o = t.parentNode;
                    if (o)
                        if (n = T(t, o, n), !(i = x(t, "lazybeforesizes", {
                                width: n,
                                dataAttr: !!e
                            })).defaultPrevented)
                            if ((n = i.detail.width) && n !== t._lazysizesWidth) Tt(t, o, i, n)
                }, {
                    _: function () {
                        _t = n.getElementsByClassName(o.autosizesClass), c("resize", Mt)
                    },
                    checkElems: Mt = U((function () {
                        var t, e = _t.length;
                        if (e)
                            for (t = 0; t < e; t++) Dt(_t[t])
                    })),
                    updateElem: Dt
                }),
                _t, Tt, Dt, kt, Mt, init = function () {
                    if (!init.i && n.getElementsByClassName) init.i = true, At._(), loader._()
                };
            return f((function () {
                if (o.init) init()
            })), i = {
                cfg: o,
                autoSizer: At,
                loader: loader,
                init: init,
                uP: A,
                aC: b,
                rC: C,
                hC: w,
                fire: x,
                gW: T,
                rAF: E
            }
        }))
    },
    12086: function (t, e, n) {
        "use strict";
        var i = n(15),
            Dialog = n(279);
        window._npDialogsInit = function () {
            function t(t) {
                var dialog = o(t);
                if (dialog)
                    if (t.preventDefault(), t.stopPropagation(), !e(t)) dialog.open()
            }

            function e(t) {
                return i(t.currentTarget).hasClass("disabled")
            }

            function n(t) {
                var dialog;
                t.preventDefault(), t.stopPropagation(), o(t).close()
            }

            function o(t) {
                var link = i(t.currentTarget),
                    e = link.attr("href") || link.attr("data-href"),
                    n;
                try {
                    n = i(e)
                } catch (t) {
                    return null
                }
                return n = n.length ? n : link, new Dialog(n, link)
            }

            function a() {
                return new Dialog(i('[data-dialog-show-on="page_exit"]'))
            }

            function s() {
                return new Dialog(i('[data-dialog-show-on="timer"]'))
            }

            function u(t) {
                if (t.clientY < 50 && null == t.relatedTarget && "select" !== t.target.nodeName.toLowerCase()) {
                    var dialog;
                    a().open((function () {
                        document.removeEventListener("mouseout", u)
                    }))
                }
            }

            function l() {
                var dialog = s();
                setTimeout((function () {
                    dialog.open()
                }), dialog.getInterval())
            }

            function c(t) {
                var e = i(t.currentTarget);
                setTimeout((function () {
                    new Dialog(e).close()
                }))
            }
            i("body").on("click", ".u-dialog-link", t), i("body").on("click", '.u-shopping-cart[href^="#"]', t), i("body").on("click", ".u-dialog-close-button", n), i("body").on("click", ".u-dialog .u-btn:not(.u-btn-step):not(.u-stripe-button)", c), document.addEventListener("mouseout", u), l()
        }, i((function () {
            window._npDialogsInit()
        }))
    },
    12087: function (t, e, n) {
        "use strict";
        var i = n(15),
            CountdownUpdater = n(269);
        i(window).on("load", (function () {
            function update() {
                t.each((function (t, el) {
                    var countdownUpdater;
                    new CountdownUpdater(i(el)).startUpdate("runtime")
                }))
            }
            var t = CountdownUpdater.findAll();
            if (t.length) update()
        }))
    },
    12088: function (t, e, n) {
        "use strict";
        var i = n(15);
        i((function () {
            i(document).on("click", ".u-quantity-input a", (function (t) {
                var e;
                t.preventDefault();
                var n = i(this),
                    o = n.siblings("input");
                if (n.hasClass("minus")) e = (e = parseFloat(o.val()) - 1) < 1 ? 1 : e, o.val(e);
                if (n.hasClass("plus")) e = parseFloat(o.val()) + 1, o.val(e);
                n.siblings(".minus").addBack(".minus").toggleClass("disabled", 1 === e), o.change()
            }))
        }))
    },
    12089: function (t, e, n) {
        "use strict";
        var i = n(15);
        i((function () {
            i(".u-show-second-image").each((function () {
                var t;
                i(this).find(".u-repeater-item").each((function () {
                    var repeaterItem = i(this),
                        image = repeaterItem.find(".u-image:not(.u-product-second-image)").eq(0);
                    if (repeaterItem.hasClass("u-image")) image = repeaterItem;
                    var t = repeaterItem.find(".u-product-second-image");
                    if (t.length) {
                        var e = t.attr("src"),
                            n = image.clone(),
                            o = image.clone();
                        if ("IMG" === image.get(0).tagName) o.attr("src", e);
                        else o.get(0).style.backgroundImage = "url('" + e + "')";
                        var a = i('<div class="u-product-second-image-wrapper"/>');
                        a.append(n), a.append(o), image.replaceWith(a)
                    }
                }))
            }))
        }))
    },
    12090: function (t, e, n) {
        "use strict";
        var i = n(15),
            Accordion = n(219);
        window._npAccordionInit = function () {
            function t(t) {
                t.preventDefault(), t.stopPropagation();
                var link = i(t.currentTarget),
                    accordion;
                new Accordion(link).show()
            }
            i("body").on("click", ".u-accordion-link", t)
        }, i((function () {
            window._npAccordionInit()
        }))
    },
    12091: function (t, e, n) {
        "use strict";

        function i(t) {
            var form = l(this),
                password = form.find("input[name=password]").val() || "",
                e = form.find("input[name=password_hash]");
            if (e.length) {
                var hash = u.create().update(password).digest().toHex();
                return e.val(hash), void 0
            }
            t.preventDefault(), t.stopPropagation(), a(password, (function () {
                s(form)
            }))
        }

        function o() {
            a(localStorage.getItem(c)), l("#password-redirect-style").remove()
        }

        function a(password, t) {
            if (password) {
                var e = l("body"),
                    n = e.attr("data-salt"),
                    i = e.attr("data-salted-password"),
                    hash = u.create().update(password).digest().toHex(),
                    o = u.create().update(password + n).digest().toHex(),
                    homePage, url = (e.attr("data-home-page") || window.location.pathname).replace(/\.html(\?[\s\S]*)?$/, "_" + hash + ".html$1");
                if (o === i) localStorage.setItem(c, password), window.location.replace(url);
                else if ("function" == typeof t) t()
            }
        }

        function s(form) {
            var t = form.find(".u-form-send-error");
            t.show(), setTimeout((function () {
                t.hide()
            }), 2e3)
        }
        var u = n(257),
            l = n(15),
            c = "auth_key";
        if (window.sha256 = u, window._npAuthInit = function () {
                var form;
                l(".u-password-control form").submit(i)
            }, jQuery && -1 !== document.location.href.indexOf("http")) jQuery((function () {
            window._npAuthInit(), o()
        }))
    },
    12092: function (t, e, n) {
        "use strict";
        var i = n(15);
        i((function () {
            i("body").on("click", ".u-language-active", (function (t) {
                t.preventDefault()
            }))
        }))
    },
    12093: function (t, e, n) {
        "use strict";
        var FormRating = t.exports = {},
            i = n(15),
            o = ".u-form-rating-item:visible";
        i((function () {
            FormRating.init()
        })), FormRating.selectStars = function t(e, n) {
            var o = e.find(".u-active-icon"),
                a = e.find(".u-passive-icon"),
                s = o.length;
            o.hide(), a.hide(), i(o.toArray().slice(0, n)).show(), i(a.toArray().slice(0, s - n)).show()
        }, FormRating.onStarClick = function t(e) {
            var n = i(e.currentTarget),
                a = n.parents(".u-form-rating").find("input"),
                s, u = n.prevAll(o).length + 1,
                l = a.val() + "";
            if (u.toString() === l) return a.val(""), void 0;
            a.val(u)
        }, FormRating.onStarHover = function t(e) {
            var n = i(e.currentTarget),
                a = n.prevAll(o);
            FormRating.selectStars(n.parent(), a.length + 1)
        }, FormRating.onLeave = function t(e) {
            var n = i(e.currentTarget),
                o, a = n.find("input").val() || 0;
            FormRating.selectStars(n, a)
        }, FormRating.init = function init() {
            var t = ".u-form .u-form-rating .u-form-rating-item",
                e = i(".u-form .u-form-rating");
            FormRating.onLeave({
                currentTarget: e
            }), e.mouseleave(FormRating.onLeave), i(t).hover(FormRating.onStarHover), i(t).click(FormRating.onStarClick);
            var n = e.find("input[type=hidden][required]");
            if (n && n.length) n.addClass("u-input-hidden"), n.attr("type", "text")
        }
    },
    12094: function (t, e, n) {
        "use strict";
        var i = n(15);
        i((function () {
            i("body").on("click", ".u-form .u-gallery-item", (function (t) {
                if (!i(t.target).is("input, label")) {
                    var input = i(this).find("input");
                    input.prop("checked", !input.prop("checked"))
                }
            }))
        }))
    },
    12095: function (t, e, n) {
        "use strict";

        function i(input) {
            var t = parseFloat(input.prop("max")),
                e = parseFloat(input.prop("min")),
                n = parseFloat(input.prop("value")),
                i = 0;
            if (n) i = 100 * (n - e) / (t - e);
            var formField = input.closest(".u-form-number");
            if (formField.length) formField[0].style.setProperty("--progress", i + "%")
        }

        function o(t, e) {
            if (e.length && t.length) e.prop("value", t.prop("value")), e.trigger("change")
        }

        function a(t) {
            if (t.length) {
                var e = t.prop("value");
                t.closest(".u-input-row").attr("data-value", e)
            }
        }
        var s = n(15);
        s((function () {
            var t = s("body");
            t.on("input", '.u-form .u-form-number input[type="range"]', (function () {
                var input = s(this),
                    t = input.siblings("input");
                if (t.length) o(input, t);
                i(input), a(input)
            })), t.on("input", '.u-form .u-form-number input[type="number"]', (function () {
                var input = s(this),
                    t = input.siblings("input");
                if (t.length) o(input, t), i(t);
                a(input)
            }))
        }))
    },
    12096: function (t, e, n) {
        "use strict";

        function i(t, dependency) {
            var e = ['[name="' + dependency.field + '"]', '[name="' + dependency.field + '[]"]'].join(", "),
                n = t.find(e);
            if (!n.length) return false;
            if (!(dependency.condition in s)) return false;
            else return s[dependency.condition](n, dependency.value)
        }

        function o(t, e) {
            if (e in u) u[e](t)
        }
        var FormDependency = t.exports,
            a = n(15),
            s = n(12097);
        a((function () {
            a(".u-form").each((function () {
                FormDependency.process(a(this))
            }));
            var t = function () {
                FormDependency.process(a(this).closest(".u-form"))
            };
            a("body").on("input", ".u-form input[name], .u-form input[name]", t).on("change", ".u-form input[name], .u-form select[name]", t)
        })), FormDependency.process = function t(e) {
            e.find("[data-dependency]").each((function () {
                var t = a(this),
                    dependency;
                try {
                    dependency = JSON.parse(t.attr("data-dependency"))[0]
                } catch (t) {
                    dependency = null
                }
                if (dependency)
                    if (i(e, dependency)) o(t, dependency.action);
                    else {
                        var n;
                        o(t, {
                            hide: "show",
                            show: "hide"
                        } [dependency.action])
                    }
            }))
        };
        var u = {
            show: function (t) {
                t.closest(".u-form-group").show()
            },
            hide: function (t) {
                t.closest(".u-form-group").hide()
            }
        }
    },
    12097: function (t, e, n) {
        "use strict";

        function i(t) {
            return t.toArray().filter((function (el) {
                return el.checked
            })).map((function (el) {
                var t = el.value;
                if (!t) t = el.getAttribute("data-calc") || "";
                return String(t).trim()
            }))
        }

        function o(t, e) {
            return String(t).trim() === String(e).trim()
        }
        var a = t.exports;
        a.equal = function (t, e) {
            if (t.is('input[type="checkbox"], input[type="radio"]')) return a.has.apply(null, arguments);
            else return o(t.val(), e)
        }, a["not-equal"] = function () {
            return !a.equal.apply(null, arguments)
        }, a.contain = function (t, e) {
            if (t.is('input[type="checkbox"], input[type="radio"]')) {
                var n;
                return i(t).some((function (t) {
                    return String(t).includes(e)
                }))
            }
            return String(t.val()).includes(e)
        }, a["not-contain"] = function () {
            return !a.contain.apply(null, arguments)
        }, a.has = function (t, e) {
            return i(t).includes(String(e).trim())
        }, a["not-has"] = function () {
            return !a.has.apply(null, arguments)
        }, a["number-equal"] = function (t, e) {
            var n = parseFloat(t.val());
            if (n === (e = parseFloat(e))) return true;
            var diff = Math.abs(n - e),
                i;
            if (diff < Number.EPSILON) return true;
            else return diff <= Math.min(Math.abs(n), Math.abs(e)) * Number.EPSILON
        }, a["number-not-equal"] = function () {
            return a["number-equal"].apply(null, arguments)
        }, a["number-greater"] = function (t, e) {
            var n;
            return parseFloat(t.val()) > (e = parseFloat(e))
        }, a["number-greater-or-equal"] = function () {
            return a["number-greater"].apply(null, arguments) || a["number-equal"].apply(null, arguments)
        }, a["number-less"] = function (t, e) {
            var n;
            return parseFloat(t.val()) < (e = parseFloat(e))
        }, a["number-less-or-equal"] = function () {
            return a["number-less"].apply(null, arguments) || a["number-equal"].apply(null, arguments)
        }, window.FormDependencyCondition = a
    },
    12098: function (t, e, n) {
        "use strict";

        function i(form) {
            var activeSlide, t;
            return form.find(".u-slide.active, .u-slide.u-active").find("input, textarea, select").toArray().every((function (input) {
                return input.reportValidity()
            }))
        }
        var o = n(15),
            FormProgress = n(657),
            a = n(658),
            s = "u-carousel";
        o((function () {
            var t = o("body"),
                e = o(".u-form.u-carousel");
            e.find(".u-carousel-inner").css("overflow", "unset"), a.update(e), FormProgress.update(e), t.on("click", ".u-btn-step", (function (t) {
                t.preventDefault();
                var button = o(this),
                    e = button.closest(".u-carousel");
                if (e.length)
                    if (button.hasClass("u-btn-step-next")) e[s]("next");
                    else if (button.hasClass("u-btn-step-prev")) e[s]("prev")
            })), e.on("u-slide.bs.u-carousel", (function (t) {
                var form = o(this);
                if (0 !== t.to && t.to > t.from && !i(form)) return t.preventDefault(), void 0;
                a.update(o(this), t.to), FormProgress.update(o(this), t.to), form.find(".u-carousel-inner").css("overflow", "")
            })).on("slid.bs.u-carousel", (function () {
                var form;
                o(this).find(".u-carousel-inner").css("overflow", "unset")
            })).on("reset", (function () {
                o(this)[s](0)
            }))
        }))
    },
    12099: function (t, e, n) {
        "use strict";

        function i() {
            return -1 !== (c("html").attr("class") || "").search(/u-responsive-(xs|sm)/)
        }

        function o(t) {
            var e = 0;
            if (Intl && Intl.Locale && navigator.language && new Intl.Locale(navigator.language).weekInfo) e = new Intl.Locale(navigator.language).weekInfo.firstDay || 0;
            t.startDay = e
        }

        function a(t) {
            var e = [];
            [1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12].forEach((function (t) {
                var n = new Date;
                n.setDate(1), n.setMonth(t - 1);
                var i = n.toLocaleString("default", {
                    month: "long"
                });
                e.push(i.charAt(0).toUpperCase() + i.slice(1))
            })), t.customMonths = e
        }

        function s(t) {
            var e = new Date,
                n = e.getDay(),
                diff = e.getDate() - n + (0 === n ? -6 : 1),
                i = new Date(e.setDate(diff)),
                o = [];
            [1, 2, 3, 4, 5, 6, 7].forEach((function (t) {
                var e;
                if (1 === t) e = i;
                else(e = new Date(i)).setDate(e.getDate() + t - 1);
                var n = e.toLocaleString("default", {
                    weekday: "short"
                });
                if (n = n.charAt(0).toUpperCase() + n.slice(1), 7 === t) o.unshift(n);
                else o.push(n)
            })), t.customDays = o
        }
        var u = n(12100),
            l = n(12101),
            c = n(15),
            f = {
                init: function (el) {
                    if (i()) return f.switchToDate(el), null;
                    else return f.create(el)
                },
                create: function (el) {
                    f.switchToText(el);
                    var t = {
                        formatter: function (input, date) {
                            var format = input.getAttribute("data-date-format");
                            if ("local" === format && Intl && Intl.DateTimeFormat) date = Intl.DateTimeFormat().format(date);
                            else date = l(date, format || "default");
                            input.setAttribute("value", date)
                        }
                    };
                    return o(t), a(t), s(t), u(el, t)
                },
                remove: function (el, t) {
                    if (t) t.remove();
                    f.switchToDate(el)
                },
                switchToDate: function (el) {
                    el.removeAttribute("value"), el.classList.remove("readonly"), el.type = "date"
                },
                switchToText: function (el) {
                    el.classList.add("readonly"), el.type = "text"
                }
            };
        c((function () {
            var selector;
            c("form input.u-input[data-date-format]").each((function () {
                var t = f.init(this);
                c(this).focus((function (e) {
                    var n = e.target;
                    if (!i()) {
                        if (!t) t = f.create(n)
                    } else if (t) f.remove(n, t), t = null
                }))
            })), c(".u-input.readonly").on("keydown paste focus", (function (t) {
                if (9 !== t.keyCode) t.preventDefault()
            }))
        }))
    },
    12100: function (t, e, n) {
        "use strict";
        var i, o;
        i = window, o = function () {
            return function (t) {
                function e(i) {
                    if (n[i]) return n[i].exports;
                    var r = n[i] = {
                        i: i,
                        l: !1,
                        exports: {}
                    };
                    return t[i].call(r.exports, r, r.exports, e), r.l = !0, r.exports
                }
                var n = {};
                return e.m = t, e.c = n, e.d = function (t, n, i) {
                    e.o(t, n) || Object.defineProperty(t, n, {
                        enumerable: !0,
                        get: i
                    })
                }, e.r = function (t) {
                    "undefined" != typeof Symbol && Symbol.toStringTag && Object.defineProperty(t, Symbol.toStringTag, {
                        value: "Module"
                    }), Object.defineProperty(t, "__esModule", {
                        value: !0
                    })
                }, e.t = function (t, n) {
                    if (1 & n && (t = e(t)), 8 & n) return t;
                    if (4 & n && "object" == typeof t && t && t.__esModule) return t;
                    var i = Object.create(null);
                    if (e.r(i), Object.defineProperty(i, "default", {
                            enumerable: !0,
                            value: t
                        }), 2 & n && "string" != typeof t)
                        for (var r in t) e.d(i, r, function (e) {
                            return t[e]
                        }.bind(null, r));
                    return i
                }, e.n = function (t) {
                    var n = t && t.__esModule ? function () {
                        return t.default
                    } : function () {
                        return t
                    };
                    return e.d(n, "a", n), n
                }, e.o = function (t, e) {
                    return Object.prototype.hasOwnProperty.call(t, e)
                }, e.p = "", e(e.s = 0)
            }([function (t, e, n) {
                function i() {}

                function d(t) {
                    U.forEach((function (e) {
                        t.addEventListener(e, t === document ? S : x)
                    }))
                }

                function o(t) {
                    return Array.isArray(t) ? t.map(o) : "[object Object]" === b(t) ? Object.keys(t).reduce((function (e, n) {
                        return e[n] = o(t[n]), e
                    }), {}) : t
                }

                function a(t, e) {
                    var n = t.calendar.querySelector(".qs-overlay"),
                        i = n && !n.classList.contains("qs-hidden");
                    e = e || new Date(t.currentYear, t.currentMonth), t.calendar.innerHTML = [s(e, t, i), u(e, t, i), l(t, i)].join(""), i && window.requestAnimationFrame((function () {
                        y(!0, t)
                    }))
                }

                function s(t, e, n) {
                    return ['<div class="qs-controls' + (n ? " qs-blur" : "") + '">', '<div class="qs-arrow qs-left"></div>', '<div class="qs-month-year">', '<span class="qs-month">' + e.months[t.getMonth()] + "</span>", '<span class="qs-year">' + t.getFullYear() + "</span>", "</div>", '<div class="qs-arrow qs-right"></div>', "</div>"].join("")
                }

                function u(t, e, n) {
                    var i = e.currentMonth,
                        r = e.currentYear,
                        o = e.dateSelected,
                        a = e.maxDate,
                        s = e.minDate,
                        u = e.showAllDates,
                        d = e.days,
                        l = e.disabledDates,
                        c = e.startDay,
                        f = e.weekendIndices,
                        h = e.events,
                        p = e.getRange ? e.getRange() : {},
                        m = +p.start,
                        v = +p.end,
                        y = g(new Date(t).setDate(1)),
                        w = y.getDay() - c,
                        D = w < 0 ? 7 : 0;
                    y.setMonth(y.getMonth() + 1), y.setDate(0);
                    var b = y.getDate(),
                        q = [],
                        C = D + 7 * ((w + b) / 7 | 0);
                    C += (w + b) % 7 ? 7 : 0;
                    for (var S = 1; S <= C; S++) {
                        var x = (S - 1) % 7,
                            A = d[x],
                            _ = S - (w >= 0 ? w : 7 + w),
                            T = new Date(r, i, _),
                            E = h[+T],
                            I = _ < 1 || _ > b,
                            k = I ? _ < 1 ? -1 : 1 : 0,
                            M = I && !u,
                            L = M ? "" : T.getDate(),
                            P = +T == +o,
                            O = x === f[0] || x === f[1],
                            B = m !== v,
                            F = "qs-square " + A;
                        E && !M && (F += " qs-event"), I && (F += " qs-outside-current-month"), !u && I || (F += " qs-num"), P && (F += " qs-active"), (l[+T] || e.disabler(T) || O && e.noWeekends || s && +T < +s || a && +T > +a) && !M && (F += " qs-disabled"), +g(new Date) == +T && (F += " qs-current"), +T === m && v && B && (F += " qs-range-start"), +T > m && +T < v && (F += " qs-range-middle"), +T === v && m && B && (F += " qs-range-end"), M && (F += " qs-empty", L = ""), q.push('<div class="' + F + '" data-direction="' + k + '">' + L + "</div>")
                    }
                    var R = d.map((function (t) {
                        return '<div class="qs-square qs-day">' + t + "</div>"
                    })).concat(q);
                    return R.unshift('<div class="qs-squares' + (n ? " qs-blur" : "") + '">'), R.push("</div>"), R.join("")
                }

                function l(t, e) {
                    var n = t.overlayPlaceholder,
                        i = t.overlayButton;
                    return ['<div class="qs-overlay' + (e ? "" : " qs-hidden") + '">', "<div>", '<input class="qs-overlay-year" placeholder="' + n + '" inputmode="numeric" />', '<div class="qs-close">&#10005;</div>', "</div>", '<div class="qs-overlay-month-container">' + t.overlayMonths.map((function (t, e) {
                        return '<div class="qs-overlay-month" data-month-num="' + e + '">' + t + "</div>"
                    })).join("") + "</div>", '<div class="qs-submit qs-disabled">' + i + "</div>", "</div>"].join("")
                }

                function c(t, e, n) {
                    var i = e.el,
                        r = e.calendar.querySelector(".qs-active"),
                        o = t.textContent,
                        s = e.sibling;
                    (i.disabled || i.readOnly) && e.respectDisabledReadOnly || (e.dateSelected = n ? void 0 : new Date(e.currentYear, e.currentMonth, o), r && r.classList.remove("qs-active"), n || t.classList.add("qs-active"), h(i, e, n), n || q(e), s && (f({
                        instance: e,
                        deselect: n
                    }), e.first && !s.dateSelected && (s.currentYear = e.currentYear, s.currentMonth = e.currentMonth, s.currentMonthName = e.currentMonthName), a(e), a(s)), e.onSelect(e, n ? void 0 : new Date(e.dateSelected)))
                }

                function f(t) {
                    var e = t.instance.first ? t.instance : t.instance.sibling,
                        n = e.sibling;
                    e === t.instance ? t.deselect ? (e.minDate = e.originalMinDate, n.minDate = n.originalMinDate) : n.minDate = e.dateSelected : t.deselect ? (n.maxDate = n.originalMaxDate, e.maxDate = e.originalMaxDate) : e.maxDate = n.dateSelected
                }

                function h(t, e, n) {
                    if (!e.nonInput) return n ? t.value = "" : e.formatter !== i ? e.formatter(t, e.dateSelected, e) : void(t.value = e.dateSelected.toDateString())
                }

                function p(t, e, n, i) {
                    n || i ? (n && (e.currentYear = +n), i && (e.currentMonth = +i)) : (e.currentMonth += t.contains("qs-right") ? 1 : -1, 12 === e.currentMonth ? (e.currentMonth = 0, e.currentYear++) : -1 === e.currentMonth && (e.currentMonth = 11, e.currentYear--)), e.currentMonthName = e.months[e.currentMonth], a(e), e.onMonthChange(e)
                }

                function D(t) {
                    if (!t.noPosition) {
                        var e = t.position.top,
                            n = t.position.right;
                        if (t.position.centered) return t.calendarContainer.classList.add("qs-centered");
                        var i = t.positionedEl.getBoundingClientRect(),
                            r = t.el.getBoundingClientRect(),
                            o = t.calendarContainer.getBoundingClientRect(),
                            a = r.top - i.top + (e ? -1 * o.height : r.height) + "px",
                            s = r.left - i.left + (n ? r.width - o.width : 0) + "px";
                        t.calendarContainer.style.setProperty("top", a), t.calendarContainer.style.setProperty("left", s)
                    }
                }

                function m(t) {
                    return "[object Date]" === b(t) && "Invalid Date" !== t.toString()
                }

                function g(t) {
                    if (m(t) || "number" == typeof t && !isNaN(t)) {
                        var e = new Date(+t);
                        return new Date(e.getFullYear(), e.getMonth(), e.getDate())
                    }
                }

                function q(t) {
                    t.disabled || !t.calendarContainer.classList.contains("qs-hidden") && !t.alwaysShow && ("overlay" !== t.defaultView && y(!0, t), t.calendarContainer.classList.add("qs-hidden"), t.onHide(t))
                }

                function v(t) {
                    t.disabled || (t.calendarContainer.classList.remove("qs-hidden"), "overlay" === t.defaultView && y(!1, t), D(t), t.onShow(t))
                }

                function y(t, e) {
                    var n = e.calendar,
                        i = n.querySelector(".qs-overlay"),
                        r = i.querySelector(".qs-overlay-year"),
                        o = n.querySelector(".qs-controls"),
                        a = n.querySelector(".qs-squares");
                    t ? (i.classList.add("qs-hidden"), o.classList.remove("qs-blur"), a.classList.remove("qs-blur"), r.value = "") : (i.classList.remove("qs-hidden"), o.classList.add("qs-blur"), a.classList.add("qs-blur"), r.focus())
                }

                function w(t, e, n, i) {
                    var r = isNaN(+(new Date).setFullYear(e.value || void 0)),
                        o = r ? null : e.value;
                    if (13 === t.which || 13 === t.keyCode || "click" === t.type) i ? p(null, n, o, i) : r || e.classList.contains("qs-disabled") || p(null, n, o);
                    else if (n.calendar.contains(e)) n.calendar.querySelector(".qs-submit").classList[r ? "add" : "remove"]("qs-disabled")
                }

                function b(t) {
                    return {}.toString.call(t)
                }

                function C(t) {
                    B.forEach((function (e) {
                        e !== t && q(e)
                    }))
                }

                function S(t) {
                    if (!t.__qs_shadow_dom) {
                        var e = t.which || t.keyCode,
                            n = t.type,
                            r = t.target,
                            i = r.classList,
                            o = B.filter((function (t) {
                                return t.calendar.contains(r) || t.el === r
                            }))[0],
                            s = o && o.calendar.contains(r);
                        if (!(o && o.isMobile && o.disableMobile))
                            if ("click" === n) {
                                if (!o) return B.forEach(q);
                                if (o.disabled) return;
                                var d = o.calendar,
                                    u = o.calendarContainer,
                                    l = o.disableYearOverlay,
                                    f = o.nonInput,
                                    h = d.querySelector(".qs-overlay-year"),
                                    m = !!d.querySelector(".qs-hidden"),
                                    g = d.querySelector(".qs-month-year").contains(r),
                                    D = r.dataset.monthNum;
                                if (o.noPosition && !s)(u.classList.contains("qs-hidden") ? v : q)(o);
                                else if (i.contains("qs-arrow")) p(i, o);
                                else if (g || i.contains("qs-close")) l || y(!m, o);
                                else if (D) w(t, h, o, D);
                                else {
                                    if (i.contains("qs-disabled")) return;
                                    if (i.contains("qs-num")) {
                                        var b = r.textContent,
                                            S = +r.dataset.direction,
                                            x = new Date(o.currentYear, o.currentMonth + S, b);
                                        if (S) {
                                            o.currentYear = x.getFullYear(), o.currentMonth = x.getMonth(), o.currentMonthName = F[o.currentMonth], a(o);
                                            for (var A, _ = o.calendar.querySelectorAll('[data-direction="0"]'), T = 0; !A;) {
                                                var E = _[T];
                                                E.textContent === b && (A = E), T++
                                            }
                                            r = A
                                        }
                                        return void(+x == +o.dateSelected ? c(r, o, !0) : r.classList.contains("qs-disabled") || c(r, o))
                                    }
                                    i.contains("qs-submit") ? w(t, h, o) : f && r === o.el && (v(o), C(o))
                                }
                            } else if ("focusin" === n && o) v(o), C(o);
                        else if ("keydown" === n && 9 === e && o) q(o);
                        else if ("keydown" === n && o && !o.disabled) {
                            var I = !o.calendar.querySelector(".qs-overlay").classList.contains("qs-hidden");
                            13 === e && I && s ? w(t, r, o) : 27 === e && I && s && y(!0, o)
                        } else if ("input" === n) {
                            if (!o || !o.calendar.contains(r)) return;
                            var k = o.calendar.querySelector(".qs-submit"),
                                M = r.value.split("").reduce((function (t, e) {
                                    return t || "0" !== e ? t + (e.match(/[0-9]/) ? e : "") : ""
                                }), "").slice(0, 4);
                            r.value = M, k.classList[4 === M.length ? "remove" : "add"]("qs-disabled")
                        }
                    }
                }

                function x(t) {
                    S(t), t.__qs_shadow_dom = !0
                }

                function A(t, e) {
                    U.forEach((function (n) {
                        t.removeEventListener(n, e)
                    }))
                }

                function _() {
                    v(this)
                }

                function T() {
                    q(this)
                }

                function E(t, e) {
                    var n = g(t),
                        i = this.currentYear,
                        r = this.currentMonth,
                        o = this.sibling;
                    if (null == t) return this.dateSelected = void 0, h(this.el, this, !0), o && (f({
                        instance: this,
                        deselect: !0
                    }), a(o)), a(this), this;
                    if (!m(t)) throw new Error("`setDate` needs a JavaScript Date object.");
                    if (this.disabledDates[+n] || n < this.minDate || n > this.maxDate) throw new Error("You can't manually set a date that's disabled.");
                    this.dateSelected = n, e && (this.currentYear = n.getFullYear(), this.currentMonth = n.getMonth(), this.currentMonthName = this.months[n.getMonth()]), h(this.el, this), o && (f({
                        instance: this
                    }), a(o));
                    var s = i === n.getFullYear() && r === n.getMonth();
                    return s || e ? a(this, n) : s || a(this, new Date(i, r, 1)), this
                }

                function I(t) {
                    return M(this, t, !0)
                }

                function k(t) {
                    return M(this, t)
                }

                function M(t, e, n) {
                    function i() {
                        return "original" + d + "Date"
                    }

                    function o() {
                        return d.toLowerCase() + "Date"
                    }

                    function s() {
                        return "set" + d
                    }

                    function u() {
                        throw new Error("Out-of-range date passed to " + s())
                    }
                    var l = t.dateSelected,
                        r = t.first,
                        c = t.sibling,
                        f = t.minDate,
                        h = t.maxDate,
                        p = g(e),
                        d = n ? "Min" : "Max";
                    if (null == e) t[i()] = void 0, c ? (c[i()] = void 0, n ? (r && !l || !r && !c.dateSelected) && (t.minDate = void 0, c.minDate = void 0) : (r && !c.dateSelected || !r && !l) && (t.maxDate = void 0, c.maxDate = void 0)) : t[o()] = void 0;
                    else {
                        if (!m(e)) throw new Error("Invalid date passed to " + s());
                        c ? ((r && n && p > (l || h) || r && !n && p < (c.dateSelected || f) || !r && n && p > (c.dateSelected || h) || !r && !n && p < (l || f)) && u(), t[i()] = p, c[i()] = p, (n && (r && !l || !r && !c.dateSelected) || !n && (r && !c.dateSelected || !r && !l)) && (t[o()] = p, c[o()] = p)) : ((n && p > (l || h) || !n && p < (l || f)) && u(), t[o()] = p)
                    }
                    return c && a(c), a(t), t
                }

                function L() {
                    var t = this.first ? this : this.sibling,
                        e = t.sibling;
                    return {
                        start: t.dateSelected,
                        end: e.dateSelected
                    }
                }

                function R() {
                    var t = this.shadowDom,
                        e = this.positionedEl,
                        n = this.calendarContainer,
                        r = this.sibling,
                        i = this;
                    this.inlinePosition && (B.some((function (t) {
                        return t !== i && t.positionedEl === e
                    })) || e.style.setProperty("position", null)), n.remove(), B = B.filter((function (t) {
                        return t !== i
                    })), r && delete r.sibling, B.length || A(document, S);
                    var o = B.some((function (e) {
                        return e.shadowDom === t
                    }));
                    for (var a in t && !o && A(t, x), this) delete this[a];
                    B.length || U.forEach((function (t) {
                        document.removeEventListener(t, S)
                    }))
                }

                function P(t, e) {
                    var n = new Date(t);
                    if (!m(n)) throw new Error("Invalid date passed to `navigate`");
                    this.currentYear = n.getFullYear(), this.currentMonth = n.getMonth(), a(this), e && this.onMonthChange(this)
                }

                function O() {
                    var t = !this.calendarContainer.classList.contains("qs-hidden"),
                        e = !this.calendarContainer.querySelector(".qs-overlay").classList.contains("qs-hidden");
                    t && y(e, this)
                }
                n.r(e);
                var B = [],
                    r = ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat"],
                    F = ["January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"],
                    N = {
                        t: "top",
                        r: "right",
                        b: "bottom",
                        l: "left",
                        c: "centered"
                    },
                    U = ["click", "focusin", "keydown", "input"];
                e.default = function (t, e) {
                    var n = function (t, e) {
                        var n, a, d = function (t) {
                                function e(t) {
                                    throw new Error('"dateSelected" in options is ' + (t ? "less" : "greater") + ' than "' + (t || "max") + 'Date".')
                                }
                                var n = o(t);
                                n.events && (n.events = n.events.reduce((function (t, e) {
                                    if (!m(e)) throw new Error('"options.events" must only contain valid JavaScript Date objects.');
                                    return t[+g(e)] = !0, t
                                }), {})), ["startDate", "dateSelected", "minDate", "maxDate"].forEach((function (t) {
                                    var e = n[t];
                                    if (e && !m(e)) throw new Error('"options.' + t + '" needs to be a valid JavaScript Date object.');
                                    n[t] = g(e)
                                }));
                                var a = n.position,
                                    s = n.maxDate,
                                    u = n.minDate,
                                    d = n.dateSelected,
                                    l = n.overlayPlaceholder,
                                    c = n.overlayButton,
                                    f = n.startDay,
                                    h = n.id;
                                if (n.startDate = g(n.startDate || d || new Date), n.disabledDates = (n.disabledDates || []).reduce((function (t, e) {
                                        var n = +g(e);
                                        if (!m(e)) throw new Error('You supplied an invalid date to "options.disabledDates".');
                                        if (n === +g(d)) throw new Error('"disabledDates" cannot contain the same date as "dateSelected".');
                                        return t[n] = 1, t
                                    }), {}), n.hasOwnProperty("id") && null == h) throw new Error("`id` cannot be `null` or `undefined`");
                                if (null != h) {
                                    var p = B.filter((function (t) {
                                        return t.id === h
                                    }));
                                    if (p.length > 1) throw new Error("Only two datepickers can share an id.");
                                    p.length ? (n.second = !0, n.sibling = p[0]) : n.first = !0
                                }
                                var v = ["tr", "tl", "br", "bl", "c"].some((function (t) {
                                    return a === t
                                }));
                                if (a && !v) throw new Error('"options.position" must be one of the following: tl, tr, bl, br, or c.');
                                if (n.position = function (t) {
                                        var e = t[0],
                                            n = t[1],
                                            i = {};
                                        return i[N[e]] = 1, n && (i[N[n]] = 1), i
                                    }(a || "bl"), s < u) throw new Error('"maxDate" in options is less than "minDate".');
                                if (d && (u > d && e("min"), s < d && e()), ["onSelect", "onShow", "onHide", "onMonthChange", "formatter", "disabler"].forEach((function (t) {
                                        "function" != typeof n[t] && (n[t] = i)
                                    })), ["customDays", "customMonths", "customOverlayMonths"].forEach((function (t, e) {
                                        var i = n[t],
                                            r = e ? 12 : 7;
                                        if (i) {
                                            if (!Array.isArray(i) || i.length !== r || i.some((function (t) {
                                                    return "string" != typeof t
                                                }))) throw new Error('"' + t + '" must be an array with ' + r + " strings.");
                                            n[e ? e < 2 ? "months" : "overlayMonths" : "days"] = i
                                        }
                                    })), f && f > 0 && f < 7) {
                                    var y = (n.customDays || r).slice(),
                                        D = y.splice(0, f);
                                    n.customDays = y.concat(D), n.startDay = +f, n.weekendIndices = [y.length - 1, y.length]
                                } else n.startDay = 0, n.weekendIndices = [6, 0];
                                "string" != typeof l && delete n.overlayPlaceholder, "string" != typeof c && delete n.overlayButton;
                                var q = n.defaultView;
                                if (q && "calendar" !== q && "overlay" !== q) throw new Error('options.defaultView must either be "calendar" or "overlay".');
                                return n.defaultView = q || "calendar", n
                            }(e || {
                                startDate: g(new Date),
                                position: "bl",
                                defaultView: "calendar"
                            }),
                            s = t;
                        if ("string" == typeof s) s = "#" === s[0] ? document.getElementById(s.slice(1)) : document.querySelector(s);
                        else {
                            if ("[object ShadowRoot]" === b(s)) throw new Error("Using a shadow DOM as your selector is not supported.");
                            for (var u, l = s.parentNode; !u;) {
                                var c = b(l);
                                "[object HTMLDocument]" === c ? u = !0 : "[object ShadowRoot]" === c ? (u = !0, n = l, a = l.host) : l = l.parentNode
                            }
                        }
                        if (!s) throw new Error("No selector / element found.");
                        if (B.some((function (t) {
                                return t.el === s
                            }))) throw new Error("A datepicker already exists on that element.");
                        var f = s === document.body,
                            p = n ? s.parentElement || n : f ? document.body : s.parentElement,
                            y = n ? s.parentElement || a : p,
                            D = document.createElement("div"),
                            q = document.createElement("div");
                        D.className = "qs-datepicker-container qs-hidden", q.className = "qs-datepicker";
                        var w = {
                            shadowDom: n,
                            customElement: a,
                            positionedEl: y,
                            el: s,
                            parent: p,
                            nonInput: "INPUT" !== s.nodeName,
                            noPosition: f,
                            position: !f && d.position,
                            startDate: d.startDate,
                            dateSelected: d.dateSelected,
                            disabledDates: d.disabledDates,
                            minDate: d.minDate,
                            maxDate: d.maxDate,
                            noWeekends: !!d.noWeekends,
                            weekendIndices: d.weekendIndices,
                            calendarContainer: D,
                            calendar: q,
                            currentMonth: (d.startDate || d.dateSelected).getMonth(),
                            currentMonthName: (d.months || F)[(d.startDate || d.dateSelected).getMonth()],
                            currentYear: (d.startDate || d.dateSelected).getFullYear(),
                            events: d.events || {},
                            defaultView: d.defaultView,
                            setDate: E,
                            remove: R,
                            setMin: I,
                            setMax: k,
                            show: _,
                            hide: T,
                            navigate: P,
                            toggleOverlay: O,
                            onSelect: d.onSelect,
                            onShow: d.onShow,
                            onHide: d.onHide,
                            onMonthChange: d.onMonthChange,
                            formatter: d.formatter,
                            disabler: d.disabler,
                            months: d.months || F,
                            days: d.customDays || r,
                            startDay: d.startDay,
                            overlayMonths: d.overlayMonths || (d.months || F).map((function (t) {
                                return t.slice(0, 3)
                            })),
                            overlayPlaceholder: d.overlayPlaceholder || "4-digit year",
                            overlayButton: d.overlayButton || "Submit",
                            disableYearOverlay: !!d.disableYearOverlay,
                            disableMobile: !!d.disableMobile,
                            isMobile: "ontouchstart" in window,
                            alwaysShow: !!d.alwaysShow,
                            id: d.id,
                            showAllDates: !!d.showAllDates,
                            respectDisabledReadOnly: !!d.respectDisabledReadOnly,
                            first: d.first,
                            second: d.second
                        };
                        if (d.sibling) {
                            var C = d.sibling,
                                S = w,
                                x = C.minDate || S.minDate,
                                A = C.maxDate || S.maxDate;
                            S.sibling = C, C.sibling = S, C.minDate = x, C.maxDate = A, S.minDate = x, S.maxDate = A, C.originalMinDate = x, C.originalMaxDate = A, S.originalMinDate = x, S.originalMaxDate = A, C.getRange = L, S.getRange = L
                        }
                        d.dateSelected && h(s, w);
                        var M = getComputedStyle(y).position;
                        f || M && "static" !== M || (w.inlinePosition = !0, y.style.setProperty("position", "relative"));
                        var U = B.filter((function (t) {
                            return t.positionedEl === w.positionedEl
                        }));
                        return U.some((function (t) {
                            return t.inlinePosition
                        })) && (w.inlinePosition = !0, U.forEach((function (t) {
                            t.inlinePosition = !0
                        }))), D.appendChild(q), p.appendChild(D), w.alwaysShow && v(w), w
                    }(t, e);
                    if (B.length || d(document), n.shadowDom && (B.some((function (t) {
                            return t.shadowDom === n.shadowDom
                        })) || d(n.shadowDom)), B.push(n), n.second) {
                        var s = n.sibling;
                        f({
                            instance: n,
                            deselect: !n.dateSelected
                        }), f({
                            instance: s,
                            deselect: !s.dateSelected
                        }), a(s)
                    }
                    return a(n, n.startDate || n.dateSelected), n.alwaysShow && D(n), n
                }
            }]).default
        }, !void(true ? t.exports = o() : "function" == typeof define && define.amd ? define([], o) : "object" == typeof e ? e.datepicker = o() : i.datepicker = o())
    },
    12101: function (t, e, n) {
        "use strict";

        function i(t) {
            if ("function" == typeof Symbol && "symbol" == typeof Symbol.iterator) i = function t(e) {
                return typeof e
            };
            else i = function t(e) {
                return e && "function" == typeof Symbol && e.constructor === Symbol && e !== Symbol.prototype ? "symbol" : typeof e
            };
            return i(t)
        }
        var o;
        "use strict",
        function (a) {
            var s = arguments,
                u = (l = /d{1,4}|D{3,4}|m{1,4}|yy(?:yy)?|([HhMsTt])\1?|W{1,2}|[LlopSZN]|"[^"]*"|'[^']*'/g, c = /\b(?:[PMCEA][SDP]T|(?:Pacific|Mountain|Central|Eastern|Atlantic) (?:Standard|Daylight|Prevailing) Time|(?:GMT|UTC)(?:[-+]\d{4})?)\b/g, f = /[^-+\dA-Z]/g, function (date, t, e, n) {
                    if (1 === s.length && "string" === v(date) && !/\d/.test(date)) t = date, date = void 0;
                    if (!((date = date || 0 === date ? date : new Date) instanceof Date)) date = new Date(date);
                    if (isNaN(date)) throw TypeError("Invalid date");
                    var i = (t = String(u.masks[t] || t || u.masks["default"])).slice(0, 4);
                    if ("UTC:" === i || "GMT:" === i)
                        if (t = t.slice(4), e = true, "GMT:" === i) n = true;
                    var o = function t() {
                            return e ? "getUTC" : "get"
                        },
                        a = function d() {
                            return date[o() + "Date"]()
                        },
                        D = function D() {
                            return date[o() + "Day"]()
                        },
                        y = function t() {
                            return date[o() + "Month"]()
                        },
                        w = function t() {
                            return date[o() + "FullYear"]()
                        },
                        b = function t() {
                            return date[o() + "Hours"]()
                        },
                        C = function t() {
                            return date[o() + "Minutes"]()
                        },
                        S = function t() {
                            return date[o() + "Seconds"]()
                        },
                        x = function t() {
                            return date[o() + "Milliseconds"]()
                        },
                        A = function t() {
                            return e ? 0 : date.getTimezoneOffset()
                        },
                        _ = function t() {
                            return m(date)
                        },
                        T = function t() {
                            return g(date)
                        },
                        E = {
                            d: function d() {
                                return a()
                            },
                            dd: function t() {
                                return h(a())
                            },
                            ddd: function t() {
                                return u.i18n.dayNames[D()]
                            },
                            DDD: function t() {
                                return p({
                                    y: w(),
                                    m: y(),
                                    d: a(),
                                    _: o(),
                                    dayName: u.i18n.dayNames[D()],
                                    short: true
                                })
                            },
                            dddd: function t() {
                                return u.i18n.dayNames[D() + 7]
                            },
                            DDDD: function t() {
                                return p({
                                    y: w(),
                                    m: y(),
                                    d: a(),
                                    _: o(),
                                    dayName: u.i18n.dayNames[D() + 7]
                                })
                            },
                            m: function t() {
                                return y() + 1
                            },
                            mm: function t() {
                                return h(y() + 1)
                            },
                            mmm: function t() {
                                return u.i18n.monthNames[y()]
                            },
                            mmmm: function t() {
                                return u.i18n.monthNames[y() + 12]
                            },
                            yy: function t() {
                                return String(w()).slice(2)
                            },
                            yyyy: function t() {
                                return h(w(), 4)
                            },
                            h: function t() {
                                return b() % 12 || 12
                            },
                            hh: function t() {
                                return h(b() % 12 || 12)
                            },
                            H: function t() {
                                return b()
                            },
                            HH: function t() {
                                return h(b())
                            },
                            M: function t() {
                                return C()
                            },
                            MM: function t() {
                                return h(C())
                            },
                            s: function t() {
                                return S()
                            },
                            ss: function t() {
                                return h(S())
                            },
                            l: function t() {
                                return h(x(), 3)
                            },
                            L: function t() {
                                return h(Math.floor(x() / 10))
                            },
                            t: function t() {
                                return b() < 12 ? u.i18n.timeNames[0] : u.i18n.timeNames[1]
                            },
                            tt: function t() {
                                return b() < 12 ? u.i18n.timeNames[2] : u.i18n.timeNames[3]
                            },
                            T: function t() {
                                return b() < 12 ? u.i18n.timeNames[4] : u.i18n.timeNames[5]
                            },
                            TT: function t() {
                                return b() < 12 ? u.i18n.timeNames[6] : u.i18n.timeNames[7]
                            },
                            Z: function t() {
                                return n ? "GMT" : e ? "UTC" : (String(date).match(c) || [""]).pop().replace(f, "").replace(/GMT\+0000/g, "UTC")
                            },
                            o: function t() {
                                return (A() > 0 ? "-" : "+") + h(100 * Math.floor(Math.abs(A()) / 60) + Math.abs(A()) % 60, 4)
                            },
                            p: function t() {
                                return (A() > 0 ? "-" : "+") + h(Math.floor(Math.abs(A()) / 60), 2) + ":" + h(Math.floor(Math.abs(A()) % 60), 2)
                            },
                            S: function t() {
                                return ["th", "st", "nd", "rd"][a() % 10 > 3 ? 0 : (a() % 100 - a() % 10 != 10) * a() % 10]
                            },
                            W: function t() {
                                return _()
                            },
                            WW: function t() {
                                return h(_())
                            },
                            N: function t() {
                                return T()
                            }
                        };
                    return t.replace(l, (function (t) {
                        if (t in E) return E[t]();
                        else return t.slice(1, t.length - 1)
                    }))
                }),
                l, c, f;
            u.masks = {
                default: "ddd mmm dd yyyy HH:MM:ss",
                shortDate: "m/d/yy",
                paddedShortDate: "mm/dd/yyyy",
                mediumDate: "mmm d, yyyy",
                longDate: "mmmm d, yyyy",
                fullDate: "dddd, mmmm d, yyyy",
                shortTime: "h:MM TT",
                mediumTime: "h:MM:ss TT",
                longTime: "h:MM:ss TT Z",
                isoDate: "yyyy-mm-dd",
                isoTime: "HH:MM:ss",
                isoDateTime: "yyyy-mm-dd'T'HH:MM:sso",
                isoUtcDateTime: "UTC:yyyy-mm-dd'T'HH:MM:ss'Z'",
                expiresHeaderFormat: "ddd, dd mmm yyyy HH:MM:ss Z"
            }, u.i18n = {
                dayNames: ["Sun", "Mon", "Tue", "Wed", "Thu", "Fri", "Sat", "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday"],
                monthNames: ["Jan", "Feb", "Mar", "Apr", "May", "Jun", "Jul", "Aug", "Sep", "Oct", "Nov", "Dec", "January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December"],
                timeNames: ["a", "p", "am", "pm", "A", "P", "AM", "PM"]
            };
            var h = function t(e, n) {
                    for (e = String(e), n = n || 2; e.length < n;) e = "0" + e;
                    return e
                },
                p = function t(e) {
                    var n = e.y,
                        i = e.m,
                        d = e.d,
                        o = e._,
                        a = e.dayName,
                        s = e["short"],
                        u = void 0 === s ? false : s,
                        l = new Date,
                        c = new Date;
                    c.setDate(c[o + "Date"]() - 1);
                    var f = new Date;
                    f.setDate(f[o + "Date"]() + 1);
                    var h = function t() {
                            return l[o + "Date"]()
                        },
                        p = function t() {
                            return l[o + "Month"]()
                        },
                        m, g = function t() {
                            return c[o + "Date"]()
                        },
                        v = function t() {
                            return c[o + "Month"]()
                        },
                        y = function t() {
                            return c[o + "FullYear"]()
                        },
                        w = function t() {
                            return f[o + "Date"]()
                        },
                        b = function t() {
                            return f[o + "Month"]()
                        },
                        C = function t() {
                            return f[o + "FullYear"]()
                        };
                    if (function t() {
                            return l[o + "FullYear"]()
                        }() === n && p() === i && h() === d) return u ? "Tdy" : "Today";
                    else if (y() === n && v() === i && g() === d) return u ? "Ysd" : "Yesterday";
                    else if (C() === n && b() === i && w() === d) return u ? "Tmw" : "Tomorrow";
                    return a
                },
                m = function t(date) {
                    var e = new Date(date.getFullYear(), date.getMonth(), date.getDate());
                    e.setDate(e.getDate() - (e.getDay() + 6) % 7 + 3);
                    var n = new Date(e.getFullYear(), 0, 4);
                    n.setDate(n.getDate() - (n.getDay() + 6) % 7 + 3);
                    var i = e.getTimezoneOffset() - n.getTimezoneOffset();
                    e.setHours(e.getHours() - i);
                    var o = (e - n) / (864e5 * 7);
                    return 1 + Math.floor(o)
                },
                g = function t(date) {
                    var e = date.getDay();
                    if (0 === e) e = 7;
                    return e
                },
                v = function t(e) {
                    if (null === e) return "null";
                    if (void 0 === e) return "undefined";
                    if ("object" !== i(e)) return i(e);
                    if (Array.isArray(e)) return "array";
                    else return {}.toString.call(e).slice(8, -1).toLowerCase()
                };
            if (true) !(void 0 !== (o = function () {
                return u
            }.call(e, n, e, t)) && (t.exports = o));
            else if ("object" === (void 0 === e ? "undefined" : i(e))) t.exports = u;
            else a.dateFormat = u
        }(void 0)
    },
    12102: function (t, e, n) {
        "use strict";
        var i = n(15);
        i((function () {
            var selector;
            i("form input[type=time]").each((function () {
                var t = i(this),
                    e = t.attr("data-time-value") || "";
                if ("--:--" !== e) {
                    if (!e) {
                        var n = new Date;
                        e = ("0" + n.getHours()).slice(-2) + ":" + ("0" + n.getMinutes()).slice(-2)
                    }
                    t.val(e)
                }
            }))
        }))
    },
    12103: function (t, e, n) {
        "use strict";

        function i(t) {
            return new Promise((function (e) {
                var n = document.createElement("script");
                n.async = "", n.onload = e, n.src = t, document.head.appendChild(n)
            }))
        }

        function o(t) {
            return new Promise((function (e) {
                var link = document.createElement("link");
                link.rel = "stylesheet", link.type = "text/css", link.onload = e, link.href = t, document.head.appendChild(link)
            }))
        }

        function a(t, e, n) {
            var i = ["Invalid number", "Invalid country code", "Too short", "Too long", "Invalid number"];
            e.each((function () {
                var container = u(this),
                    e = container.find("input[type=tel]");
                container.replaceWith(e), e.each((function () {
                    var input = u(this)[0],
                        e = u(this).attr("data-country-code") || "us";
                    input.removeAttribute("pattern");
                    var n = intlTelInput(input, {
                        autoPlaceholder: "aggressive",
                        utilsScript: t + "utils.js",
                        initialCountry: e
                    });
                    input.addEventListener("blur", (function () {
                        if (l(u(input)), input.value.trim())
                            if (!n.isValidNumber()) {
                                var t = n.getValidationError();
                                c(u(input), i[t] || "Invalid number")
                            }
                    }))
                }))
            })), n.each((function () {
                var container, t;
                u(this).find("input[type=tel]").each((function () {
                    var input = u(this)[0],
                        t = u(this).attr("data-country-code") || "us";
                    intlTelInput(input, {
                        initialCountry: t,
                        allowDropdown: false,
                        showFlags: false,
                        autoPlaceholder: "aggressive"
                    });
                    var e = u(this).closest(".u-form-phone").find(".iti");
                    e.parent().append(input), e.remove()
                }))
            }))
        }

        function s(t, e) {
            var n = "https://capp." + "n" + "i" + "c" + "e" + "p" + "a" + "g" + "e" + ".com/assets/",
                s = u("meta[data-intl-tel-input-cdn-path]");
            if (s.length) n = s.attr("data-intl-tel-input-cdn-path");
            if (t.length || e.length) Promise.all([i(n + "intlTelInput.min.js"), o(n + "intlTelInput.css")]).then((function () {
                a(n, t, e)
            }))
        }
        var u = n(15),
            l = function (input) {
                input.parent(".iti").parent().find("#error-msg").remove()
            },
            c = function (input, t) {
                var e = u("<span id='error-msg' style='color:#F95D51'>" + t + "</span>");
                input.parent(".iti").after(e)
            };
        u((function () {
            s(u("form .iti"), u("form .u-form-phone > input[data-country-code]").closest(".u-form-phone"))
        }))
    },
    12104: function (t, e, n) {
        "use strict";
        var i = n(12105),
            o = n(15);
        o((function () {
            o("form .u-form-country select").each((function () {
                var select = o(this),
                    data = i.getData();
                if (data.unshift({
                        name: "",
                        code: ""
                    }), data.forEach((function (t) {
                        var e = o("<option></option>");
                        if (e.prop({
                                value: t.name,
                                text: t.name
                            }), e.attr("value")) select.append(e)
                    })), select.find("option:eq(0)").length) select.find("option:eq(0)").remove();
                var t = select.attr("data-country-code") || "us",
                    e = data.find((function (e) {
                        return e.code === t.toUpperCase()
                    }));
                if (e) {
                    var n = select.find('option[value="' + e.name + '"]');
                    if (n.length) n.prop("selected", true)
                }
            }))
        }))
    },
    12105: function (t, e, n) {
        "use strict";

        function i(t) {
            o[t.name.toLowerCase()] = t.code, a[t.code.toLowerCase()] = t.name
        }
        var data = n(450),
            o = {},
            a = {};
        data.forEach(i);
        var s = {
            overwrite: function t(e) {
                if (e && e.length) e.forEach((function (t) {
                    var e = data.findIndex((function (e) {
                        return e.code === t.code
                    }));
                    data[e] = t, i(t)
                }))
            },
            getCode: function t(e) {
                return o[e.toLowerCase()]
            },
            getName: function t(e) {
                return a[e.toLowerCase()]
            },
            getNames: function t() {
                return data.map((function (t) {
                    return t.name
                }))
            },
            getCodes: function t() {
                return data.map((function (t) {
                    return t.code
                }))
            },
            getCodeList: function t() {
                return a
            },
            getNameList: function t() {
                return o
            },
            getData: function t() {
                return data
            }
        };
        t.exports = s, window.CountryList = s
    },
    12106: function (t, e, n) {
        "use strict";
        var i = n(15),
            o = n(12107);
        i((function () {
            i("form .u-form-signature canvas").each((function () {
                var t;
                new o(this).start()
            }))
        }))
    },
    12107: function (t, e, n) {
        "use strict";

        function i(t) {
            this.canvas = t, this.drawData = {
                drawing: false,
                mousePos: {
                    x: 0,
                    y: 0
                },
                lastPos: {
                    x: 0,
                    y: 0
                }
            }, this.addMouseEvents(), this.addTouchEvents(), window.onresize = this.resize.bind(this), window.orientationchange = this.resize.bind(this), this.resize(), this.initClearButton()
        }

        function o(t, e) {
            var rect = t.getBoundingClientRect();
            return {
                x: e.clientX - rect.left,
                y: e.clientY - rect.top
            }
        }

        function a(t, e) {
            var rect = t.getBoundingClientRect();
            return {
                x: e.touches[0].clientX - rect.left,
                y: e.touches[0].clientY - rect.top
            }
        }
        var s = n(15);
        i.prototype.initClearButton = function t() {
            var e;
            this.canvas.parentNode.querySelector(".u-clear-button").addEventListener("click", function (t) {
                t.preventDefault(), t.stopPropagation(), this.reset()
            }.bind(this), false)
        }, i.prototype.resize = function t() {
            var e = Math.max(window.devicePixelRatio || 1, 1);
            this.canvas.width = this.canvas.offsetWidth * e, this.canvas.height = this.canvas.offsetHeight * e, this.canvas.getContext("2d").scale(e, e), this.reset()
        }, i.prototype.reset = function t() {
            var e = this.canvas.parentNode,
                n = s(e),
                i = n.is(":visible"),
                o = {},
                a, u;
            if (!i) {
                if (u = "u-active", !(a = n.parents(".u-carousel-item")).length) a = n.parents(".u-dialog-block"), u = "u-dialog-open";
                if (!a.length) a = n.parent();
                o = a.css(["position", "left"]), a.css({
                    position: "absolute",
                    left: "-10000px"
                }), a.addClass(u)
            }
            var l = window.getComputedStyle(e, null),
                c = e.clientWidth - (parseFloat(l.paddingLeft) + parseFloat(l.paddingRight)),
                f = 200,
                h = c / 100 * 20,
                p = f / 100 * 20;
            if (!i) a.removeClass(u), a.css(o);
            var m = {
                    width: c,
                    height: f,
                    lineWidth: 2,
                    strokeStyle: l.getPropertyValue("color") || "#000000",
                    fillStyle: l.getPropertyValue("background-color") || "#ffffff",
                    signatureLine: {
                        startX: h,
                        startY: f - p,
                        endX: c - h,
                        endY: f - p
                    }
                },
                g = this.canvas.getContext("2d");
            g.canvas.width = m.width, g.canvas.height = m.height, g.clearRect(0, 0, m.width, m.height), g.lineWidth = m.lineWidth, g.strokeStyle = m.strokeStyle, g.fillStyle = m.fillStyle, g.fillRect(0, 0, m.width, m.height), g.beginPath(), g.moveTo(m.signatureLine.startX, m.signatureLine.startY), g.lineTo(m.signatureLine.endX, m.signatureLine.endY), g.stroke(), this.canvas.setAttribute("data-canvas-default-options", JSON.stringify(m))
        }, i.prototype.addTouchEvents = function t() {
            this.canvas.addEventListener("touchmove", function (t) {
                var e = t.touches[0],
                    me = new MouseEvent("mousemove", {
                        clientX: e.clientX,
                        clientY: e.clientY
                    });
                this.canvas.dispatchEvent(me)
            }.bind(this), false), this.canvas.addEventListener("touchstart", function (t) {
                this.drawData.mousePos = a(this.canvas, t);
                var e = t.touches[0],
                    me = new MouseEvent("mousedown", {
                        clientX: e.clientX,
                        clientY: e.clientY
                    });
                this.canvas.dispatchEvent(me)
            }.bind(this), false), this.canvas.addEventListener("touchend", function () {
                var me = new MouseEvent("mouseup", {});
                this.canvas.dispatchEvent(me)
            }.bind(this), false), document.body.addEventListener("touchstart", function (t) {
                if (t.target === this.canvas) t.preventDefault()
            }.bind(this), {
                passive: false
            }), document.body.addEventListener("touchend", function (t) {
                if (t.target === this.canvas) t.preventDefault()
            }.bind(this), {
                passive: false
            }), document.body.addEventListener("touchmove", function (t) {
                if (t.target === this.canvas) t.preventDefault()
            }.bind(this), {
                passive: false
            })
        }, i.prototype.addMouseEvents = function t() {
            this.canvas.addEventListener("mousedown", function (t) {
                this.drawData.drawing = true, this.drawData.lastPos = o(this.canvas, t)
            }.bind(this), false), this.canvas.addEventListener("mouseup", function () {
                this.drawData.drawing = false
            }.bind(this), false), this.canvas.addEventListener("mousemove", function (t) {
                this.drawData.mousePos = o(this.canvas, t)
            }.bind(this), false)
        }, i.prototype.renderCanvas = function t() {
            if (this.drawData.drawing) {
                var e = this.canvas.getContext("2d");
                e.moveTo(this.drawData.lastPos.x, this.drawData.lastPos.y), e.lineTo(this.drawData.mousePos.x, this.drawData.mousePos.y), e.stroke(), this.drawData.lastPos = this.drawData.mousePos
            }
        }, i.prototype.start = function t() {
            var e;
            (function t() {
                window.signRequestAnimFrame(t.bind(this)), this.renderCanvas()
            }).bind(this)()
        }, window.signRequestAnimFrame = window.requestAnimationFrame || window.webkitRequestAnimationFrame || window.mozRequestAnimationFrame || window.oRequestAnimationFrame || window.msRequestAnimaitonFrame || function (t) {
            window.setTimeout(t, 1e3 / 60)
        }, t.exports = i
    },
    12108: function (t, e, n) {
        "use strict";
        var i = n(15);
        i((function () {
            ["blog"].forEach((function (type) {
                i(".u-" + type + " .u-pagination a[href^='#']").click((function (t) {
                    t.preventDefault();
                    var link = i(this),
                        e = (link.attr("href") || "").slice(1),
                        list = link.parents(".u-" + type),
                        n = "blog" === type ? "posts" : type,
                        o = list.find(".u-repeater-item.u-page-" + n + "-" + e),
                        a = list.find(".u-repeater-item:not(.u-page-" + n + "-" + e + ")"),
                        s = list.find(".u-pagination.u-page-" + n + "-pagination-" + e),
                        u = list.find(".u-pagination:not(.u-page-" + n + "-pagination-" + e + ")");
                    a.addClass("u-hidden"), u.addClass("u-hidden"), o.removeClass("u-hidden"), s.removeClass("u-hidden")
                }))
            }))
        }))
    },
    12109: function (t, e, n) {
        "use strict";
        var i = n(12110),
            o = n(12111),
            a = n(12117),
            s, u;
        new o(i).subscribe(), new a(i).subscribe()
    },
    12110: function (t, e, n) {
        "use strict";
        t.exports = {
            sessionId: Math.random().toString(36).slice(2),
            payPalSdkUrl: "https://www.paypal.com/sdk/js"
        }
    },
    12111: function (t, e, n) {
        "use strict";

        function i(t) {
            this.paymentConfig = t, this.paymentMessage = new s, this.paypalCurrencyWarning = new h, this.isCart = false, this._onChangeQuantity = this.onChangeQuantity.bind(this), this._onRemoveProduct = this.onRemoveProduct.bind(this), this.zeroDecimalCurrencies = ["BIF", "CLP", "DJF", "GNF", "JPY", "KMF", "KRW", "MGA", "PYG", "RWF", "UGX", "VND", "VUV", "XAF", "XOF", "XPF", "HUF", "TWD"]
        }
        var o = n(15),
            Const = n(3437),
            TabsControl = n(270),
            a = n(12112),
            s = n(3438),
            u = n(3439),
            l = n(12114),
            c = n(944),
            f = n(3440),
            h = n(12116);
        t.exports = i, i.prototype.subscribe = function t() {
            o(document).on("opened.np.dialog", ".u-dialog-block", function (t, dialog, e) {
                var modal = o(t.currentTarget);
                this.initModal(modal, e)
            }.bind(this)), o(document).on("closed.np.dialog", ".u-dialog-block", function (t) {
                var modal = o(t.currentTarget);
                this.deInitModal(modal)
            }.bind(this))
        }, i.prototype.initModal = function t(e, n) {
            var products;
            if (this.paymentMessage.setDialog(e), this.paypalCurrencyWarning.setDialog(e), this.isCart = n.is(".u-shopping-cart"), this.isCart) {
                if (!(products = c.getCart().getProducts())) return this.paymentMessage.cartEmpty(), void 0
            } else {
                var i;
                products = new u(n).getProducts()
            }
            if (!products) return this.paymentMessage.productError(), void 0;
            this.fillModal(e, products), this.paypalCurrencyWarning.setProducts(products), this.checkOutOfStockProducts(e, products, this.isCart), e.find(".u-product-quantity input").on("change", this._onChangeQuantity), e.find(".product-remove").on("click", this._onRemoveProduct), this.initServices(e, n, products), this.paypalCurrencyWarning.showIfHasUnsupportedCurrency()
        }, i.prototype.initServices = function t(e, n, products) {
            var i, o = new l(n).getService();
            if (!o) return this.paymentMessage.serviceError(), void 0;
            var a = o.paymentMethods.find((function (t) {
                    return "paypal" === t.type
                })),
                stripeMethod = o.paymentMethods.find((function (t) {
                    return "stripe" === t.type
                })),
                s = o.paymentMethods.find((function (t) {
                    return "email" === t.type
                }));
            if (a) this.injectPaypal(e, o, products), this.paypalCurrencyWarning.enabled = true, this.checkAndEnablePaymentMethods(e, {
                method: {
                    name: "paypal",
                    exists: true
                },
                method1: {
                    name: "stripe",
                    exists: stripeMethod
                },
                method2: {
                    name: "email",
                    exists: s
                }
            });
            if (stripeMethod) this.initStripe(e, o, products), this.checkAndEnablePaymentMethods(e, {
                method: {
                    name: "stripe",
                    exists: true
                },
                method1: {
                    name: "paypal",
                    exists: a
                },
                method2: {
                    name: "email",
                    exists: s
                }
            });
            if (s) this.initEmail(e, o, products), this.checkAndEnablePaymentMethods(e, {
                method: {
                    name: "email",
                    exists: true
                },
                method1: {
                    name: "paypal",
                    exists: a
                },
                method2: {
                    name: "stripe",
                    exists: stripeMethod
                }
            });
            if (!stripeMethod && !a && !s) e.find(".u-payment-services").hide()
        }, i.prototype.checkAndEnablePaymentMethods = function t(e, n) {
            if (!n.method1.exists && !n.method2.exists) {
                e.find(".u-tab-link").hide();
                var pane = e.find(".u-payment-" + n.method.name + ".u-tab-pane"),
                    tabsControl;
                new TabsControl(pane).show()
            }
            if (!n.method1.exists) e.find(".u-tab-link.u-payment-" + n.method1.name).hide();
            if (!n.method2.exists) e.find(".u-tab-link.u-payment-" + n.method2.name).hide()
        }, i.prototype.checkOutOfStockProducts = function t(e, products, n) {
            var i = false;
            if (products.forEach((function (product) {
                    if (product.outOfStock) return i = true, false
                })), i) {
                var o;
                new s(e).productOutOfStock(n)
            }
        }, i.prototype.deInitModal = function t(e) {
            this.deInitStripe(e), this.deInitEmail(e), e.find(".u-product-quantity input").off("change", this._onChangeQuantity), e.find(".product-remove").off("click", this._onRemoveProduct);
            var n = new s(e),
                i = e.find(".u-payment-services-inner");
            if (!i.length) return n.configError(), void 0;
            i.empty(), this.paypalCurrencyWarning.setDialog(e).clear(), e.find(".cart-empty, .product-out-of-stock-message").remove(), e.find(".u-dialog > .u-container-layout >").show();
            var o = e.find(".u-payment-services .u-tab-item:eq(0)");
            if (o.length) {
                var tabsControl;
                new TabsControl(o).show()
            }
        }, i.prototype.initStripe = function (t, e, products) {
            t.find(".u-stripe-button").on("click", (function () {
                var data = [];
                products.forEach((function (product) {
                    var input = t.find('.u-quantity-input input[data-product-id="' + product.id + '"]');
                    if (input.length) product.quantity = parseInt(input.val(), 10) || 1, data.push(product)
                })), fetch(Const.stripeCheckoutUrl, {
                    method: "POST",
                    body: JSON.stringify({
                        userToken: e.userToken,
                        paymentServiceToken: e.id || "",
                        products: data,
                        referrer: window.location.host || "Unknown"
                    })
                }).then((function (t) {
                    if (t.ok) return t.json();
                    else return Promise.reject(t)
                })).then((function (t) {
                    if (t && t.sessionUrl) window.location.href = t.sessionUrl
                })).catch((function () {
                    var e;
                    new s(t).stripeError()
                }))
            }))
        }, i.prototype.initEmail = function (t, e, products) {
            t.find("form .u-btn-submit").on("click", (function (t) {
                t.preventDefault(), t.stopPropagation(), o(this).closest("form").find('input[type="submit"]').click()
            })), t.find("form").submit((function (n) {
                n.preventDefault(), n.stopPropagation();
                var data = [];
                products.forEach((function (product) {
                    var input = t.find('.u-quantity-input input[data-product-id="' + product.id + '"]');
                    if (input.length) product.quantity = parseInt(input.val(), 10) || 1, data.push(product)
                }));
                var form = o(this),
                    email = form.find("#payment-email").val() || "",
                    i = form.find("#payment-notes").val() || "";
                fetch(Const.emailCheckoutUrl, {
                    method: "POST",
                    body: JSON.stringify({
                        userToken: e.userToken,
                        paymentServiceToken: e.id || "",
                        products: data,
                        referrer: window.location.host || "Unknown",
                        form: {
                            email: email,
                            notes: i
                        }
                    })
                }).then((function (t) {
                    if (t.ok) return t.text();
                    else return Promise.reject(t)
                })).then((function (text) {
                    if (!text) {
                        var t;
                        (new f).goToThankYouPage()
                    }
                })).catch((function () {
                    var e;
                    new s(t).emailError()
                }))
            }))
        }, i.prototype.deInitStripe = function (t) {
            t.find(".u-stripe-button").off("click")
        }, i.prototype.deInitEmail = function (t) {
            t.find(".u-email-button").off("click")
        }, i.prototype.onChangeQuantity = function (t) {
            var e = o(".u-payment-dialog.u-dialog-open");
            if (e.length) {
                var n = t.target;
                this.postMessage(e, {
                    quantity: n.value,
                    id: n.getAttribute("data-product-id")
                }), this.updateTotalPrice(e)
            }
        }, i.prototype.onRemoveProduct = function (t) {
            var e = o(t.target),
                n = e.attr("data-product-id"),
                i = o(".u-dialog-open"),
                a;
            if (i.find(".u-repeater-item .product-remove").length > 1) e.parents(".u-repeater-item").remove(), this.updateTotalPrice(i);
            else i.find(".u-dialog-close-button").click();
            c.getCart().removeProductById(n);
            var s = i.find('.u-price:contains("Out Of Stock")'),
                u = i.find(".product-out-of-stock-message");
            if (u.length && !s.length) u.remove(), i.find(".u-dialog").css("min-height", ""), i.find(".u-payment-services").show();
            this.paypalCurrencyWarning.setDialog(i).hideIfNoUnsupportedCurrency(), this.postMessage(i, {
                action: "remove",
                id: n
            })
        }, i.prototype.fillModal = function t(e, products) {
            var n = e.find(".u-text:not(.u-product-control)"),
                i = n.next(".u-text:not(.u-product-control)");
            if (!i.length)(i = n.clone()).text("Your cart"), n.after(i);
            n.toggle(!this.isCart), i.toggle(this.isCart);
            var repeaterItem = e.find(".u-repeater-item").eq(0),
                a = repeaterItem.find(".product-remove");
            if (!a.length) a = o('<span class="product-remove"/>'), repeaterItem.find(".u-price").after(a);
            a.toggle(this.isCart);
            var container = o("<div/>"),
                data = {
                    price: 0,
                    currency: ""
                };
            products.forEach(function (product) {
                var t = repeaterItem.clone(),
                    e = product.quantity || 1,
                    n = t.find(".u-product-out-of-stock");
                if (n.length) n.css("visibility", product.outOfStock ? "visible" : "hidden");
                var image = t.find(".u-product-control.u-image");
                if (image.length && product.images.length) image.attr("src", this.preparePath(document.body.getAttribute("data-path-to-root") || "", product.images[0].url || ""));
                var i = "true" === t.find(".u-product-price").attr("data-add-zero-cents");
                product.price = this.addZeroCents(product.price, i), product.price = this.fixZeroDecimalCurrency(product.price, product.currency), product.oldPrice = this.addZeroCents(product.oldPrice, i), product.oldPrice = this.fixZeroDecimalCurrency(product.oldPrice, product.currency), data.price += product.price * e, data.currency = product.currency, data.addZeroCents = i, this.fillItem(t, product), container.append(t)
            }.bind(this)), this.createTotalPrice(container, repeaterItem, data), e.find(".u-repeater").html(container.html())
        }, i.prototype.preparePath = function t(e, url) {
            if (!url) return "";
            if (!e || url.startsWith("data:image") || url.startsWith("images") && "./" === e) return url;
            if (url.startsWith("images")) return e + url;
            var n = url.indexOf("/");
            if (-1 !== n) return e + url.substring(n + 1);
            else return ""
        }, i.prototype.addZeroCents = function t(e, t) {
            if (!e) return e;
            if ("string" != typeof e) e = e.toString();
            var n = e.split("."),
                i = n[1] || "00";
            if ("00" === i) e = n[0];
            if (t) e = n[0] + "." + i;
            return e
        }, i.prototype.fixZeroDecimalCurrency = function t(e, currency) {
            if (!e) return e;
            if ("string" != typeof e) e = e.toString();
            var n = (currency || "USD").toUpperCase();
            if (!this.zeroDecimalCurrencies.includes(n)) return e;
            var i = e.indexOf(".");
            if (-1 === i) return e;
            else return e.substring(0, i)
        }, i.prototype.updateTotalPrice = function t(e) {
            var n = e.find(".payment-total-price");
            if (n.length) {
                var a = 0,
                    currency = "";
                if (e.find(".u-repeater-item").each((function () {
                        var t = o(this),
                            e = t.find(".u-quantity-input input"),
                            n = t.find(".u-product-price .u-price"),
                            i = n.text();
                        if (n.length && -1 === i.indexOf("Out Of Stock")) {
                            var s = i.split(" ");
                            currency = s[1], a += parseFloat(s[0]) * parseInt(e.val(), 10)
                        }
                    })), !Number.isInteger(a)) a = a.toFixed(2);
                var s = "true" === e.find(".u-repeater-item:eq(0)").find(".u-product-price").attr("data-add-zero-cents");
                if (a = i.prototype.addZeroCents(a, s), n.text(a + " " + currency), !this.isCart) n.parents(".payment-total-container").show()
            }
        }, i.prototype.createTotalPrice = function t(e, n, data) {
            var a = n.clone(),
                s = o('<div class="payment-total-container"/>'),
                u = o('<div class="payment-total-label"/>');
            u.text("Total"), s.append(u);
            var l = o('<div class="payment-total-price"/>'),
                layout;
            if (l.text(i.prototype.addZeroCents(data.price, data.addZeroCents) + " " + data.currency), s.append(l), a.find(".u-container-layout").html(o("<div/>").append(s).html()), !this.isCart) a.find(".payment-total-container").hide();
            e.append(a)
        }, i.prototype.fillItem = function t(e, product) {
            var title = product.title || "",
                n = product.description || "",
                i = product.price || "",
                a = product.oldPrice || "",
                currency = product.currency || "",
                s = product.quantity || 1,
                id = product.id,
                u = product.outOfStock,
                l = product.sku || "",
                c = e.find(".u-product-title-link"),
                f = c.attr("class"),
                h = o("<span/>").addClass(f).text(title);
            c.parent().empty().append(h), e.find(".u-product-quantity input").attr({
                value: s,
                "data-product-id": id
            }), e.find(".u-quantity-input a.minus").toggleClass("disabled", 1 === s);
            var p = e.find(".u-product-desc p");
            if (!p.length) p = e.find(".u-product-desc");
            p.text(n);
            var m = e.find(".u-product-sku p");
            if (!m.length) m = e.find(".u-product-sku");
            m.text(l), e.find(".u-price").text(u ? "Out Of Stock" : i + " " + currency), e.find(".u-old-price").text(u ? "" : a + " " + currency), this.addCategories(e, product.categoriesData), e.find(".product-remove").attr("data-product-id", id)
        }, i.prototype.addCategories = function t(e, categories) {
            if (categories) {
                var n = e.find(".u-product-category"),
                    i = n.find("a");
                if (!i.length) return;
                var o = i.eq(0).clone();
                n.empty(), (categories || []).forEach((function (t, index) {
                    var e = o.clone();
                    e.text((index > 0 ? ", " : "") + t.title), e.attr("href", t.link), n.append(e)
                }))
            }
        }, i.prototype.injectPaypal = function t(e, n, products) {
            var i = new s(e),
                o = e.find(".u-payment-services");
            if (!o.length) return i.configError(), void 0;
            var u = o.find(".u-payment-services-inner");
            u.empty();
            var l = new a(this.paymentConfig, {
                    paymentControl: o,
                    service: n,
                    products: products
                }),
                c = document.createElement("iframe");
            c.setAttribute("style", "width: 100%; min-height: 100%;"), c.setAttribute("id", "np-payment-frame"), c.setAttribute("frameborder", "0"), c.onload = function t() {
                var e = c.contentDocument;
                e.open(), e.write(l.generate()), e.close()
            }, u.append(c)
        }, i.prototype.postMessage = function (t, e) {
            var n;
            if (t.find("#np-payment-frame").length) {
                var i = t.find("#np-payment-frame")[0],
                    o = i.contentWindow || i || {};
                if (o.postMessage) o.postMessage(this.paymentConfig.sessionId + JSON.stringify(e), "*")
            }
        }, window.PaymentButtons = i
    },
    12112: function (t, e, n) {
        "use strict";

        function i(t, data) {
            this.paymentConfig = t, this.paymentControl = data.paymentControl, this.service = data.service, this.products = data.products
        }
        var o = n(12113);
        t.exports = i, i.prototype.generate = function t() {
            var e = this.paymentControl.attr("data-payment-paypal-layout") || "vertical",
                n = this.paymentControl.attr("data-payment-paypal-shape") || "rect",
                i = this.paymentControl.attr("data-payment-paypal-color") || "gold",
                a = this.getPayPalDisableFunding() || this.products[0].hiddenButtons,
                s = this.replaceAll(o, "[PAYPALSDK_URL]", this.paymentConfig.payPalSdkUrl);
            if (s = this.replaceAll(s, "[PAYPALCLIENT_ID]", this.getPayPalClientId()), s = this.replaceAll(s, "[REFERENCE_ID]", this.computeReferenceIdv2()), s = this.replaceAll(s, "[SESSION_ID]", this.paymentConfig.sessionId), s = this.replaceAll(s, "[PRODUCTS]", JSON.stringify(this.products)), s = this.replaceAll(s, "[CURRENCY]", this.products[0].currency), s = this.replaceAll(s, "[PAYPAL_STYLE_LAYOUT]", e), s = this.replaceAll(s, "[PAYPAL_STYLE_SHAPE]", n), s = this.replaceAll(s, "[PAYPAL_STYLE_COLOR]", i), a) s = this.replaceAll(s, "[PAYPAL_HIDDEN_BUTTONS]", a);
            else s = this.replaceAll(s, "&disable-funding=[PAYPAL_HIDDEN_BUTTONS]", "");
            return s
        }, i.prototype.getPayPalClientId = function t() {
            var e = this.service.paymentMethods.find((function (t) {
                return "paypal" === t.type
            }));
            if (!e) return null;
            else return e.clientId
        }, i.prototype.getPayPalDisableFunding = function t() {
            var e = this.service.paymentMethods.find((function (t) {
                return "paypal" === t.type
            }));
            if (!e) return null;
            else return e.disableFunding
        }, i.prototype.computeReferenceIdv2 = function t() {
            var e = window.location.host || "Unknown";
            return "v2:" + this.service.id + ";" + e
        }, i.prototype.replaceAll = function t(e, n, i) {
            var o = n.replace(/[-[\]{}()*+?.,\\^$|#\s]/g, "\\$&");
            return e.replace(new RegExp(o, "g"), i)
        }, window.PaypalProductHtml = i
    },
    12113: function (t, e) {
        t.exports = "<style>\n    body {\n        margin: 0;\n    }\n</style>\n<div id=\"paypal-button-container\"></div>\n<script src=\"[PAYPALSDK_URL]?client-id=[PAYPALCLIENT_ID]&currency=[CURRENCY]&disable-funding=[PAYPAL_HIDDEN_BUTTONS]\"><\/script>\n<script>\n    (function () {\n        const sessionId = '[SESSION_ID]';\n        const products = [PRODUCTS];\n\n        const paypalStyle = {\n            layout: '[PAYPAL_STYLE_LAYOUT]',\n            shape: '[PAYPAL_STYLE_SHAPE]',\n            color: '[PAYPAL_STYLE_COLOR]',\n        };\n\n        const buttons = {\n            style: paypalStyle,\n            createOrder: async function (data, actions) {\n                postMessageToParent({type: 'ORDER_CREATED'});\n\n                var items = [];\n                var totalPrice = 0;\n                var currencyCode;\n                products.forEach(function (product) {\n                    var price = parseFloat(product.price);\n                    var quantity = parseFloat(product.quantity);\n                    totalPrice += price * quantity;\n                    currencyCode = product.currency;\n                    var item = {\n                        name: product.title,\n                        description: product.description,\n                        sku: product.sku,\n                        unit_amount: {\n                            currency_code: product.currency,\n                            value: price,\n                        },\n                        quantity: quantity,\n                    };\n                    items.push(item);\n                });\n\n                return actions.order.create({\n                    purchase_units: [\n                        {\n                            reference_id: '[REFERENCE_ID]',\n                            amount: {\n                                currency_code: currencyCode,\n                                value: totalPrice,\n                                breakdown: {\n                                    item_total: {\n                                        currency_code: currencyCode,\n                                        value: totalPrice,\n                                    },\n                                },\n                            },\n                            items: items,\n                        },\n                    ],\n                });\n            },\n            onApprove: async function (data, actions) {\n                return actions.order.capture().then(function () {\n                    postMessageToParent({type: 'ORDER_APPROVED'});\n                })\n            },\n            onCancel(data) {\n                postMessageToParent({type: 'ORDER_CANCELED'});\n            },\n            onError(err) {\n                postMessageToParent({type: 'ORDER_ERROR'});\n            }\n        };\n\n        paypal.Buttons(buttons).render('#paypal-button-container');\n\n        window.addEventListener('message', function ({data}) {\n            console.log('Data: ', data);\n            data = data || '';\n\n            if (!data.startsWith(sessionId)) {\n                return;\n            }\n\n            try {\n                data = JSON.parse(data.replace(sessionId, ''));\n            } catch (e) {\n                console.warn(e);\n                data = {};\n            }\n\n            if (data.action === 'remove') {\n                var index = products.findIndex(function (product) {\n                    return product.id === data.id;\n                });\n                if (index !== -1) {\n                    products.splice(index, 1);\n                }\n                return;\n            }\n\n            var foundProduct = products.filter(function (product) {\n                return product.id === data.id;\n            })[0];\n\n            if (foundProduct) {\n                Object.assign(foundProduct, data);\n            }\n        });\n\n        window.addEventListener('resize', function (event) {\n            postMessageToParent({type: 'IFRAME_HEIGHT', height: document.body.scrollHeight});\n        }, true);\n\n        document.addEventListener('DOMContentLoaded', function (event) {\n            postMessageToParent({type: 'IFRAME_HEIGHT', height: document.body.scrollHeight});\n        }, true);\n\n        function postMessageToParent(obj) {\n            parent.postMessage(sessionId + JSON.stringify(obj), '*');\n        }\n    })();\n<\/script>\n"
    },
    12114: function (t, e, n) {
        "use strict";

        function i(t) {
            this.$btn = t
        }
        t.exports = i, i.prototype.getService = function t() {
            var e = this.$btn.attr("data-payment-service");
            if (!e) return null;
            var n = JSON.parse(e);
            if (!(n && n.paymentMethods && n.paymentMethods.length && n.userToken)) return null;
            else return n
        }, window.PaymentService = i
    },
    12115: function (t, e, n) {
        "use strict";
        var i = {
            add: function (products) {
                localStorage.setItem("products", products)
            },
            get: function () {
                return localStorage.getItem("products")
            },
            remove: function () {
                localStorage.removeItem("products")
            }
        };
        t.exports = i
    },
    12116: function (t, e, n) {
        "use strict";

        function i() {
            this.$dialog = $(), this.products = null, this.enabled = false, this._className = "product-priced-in-unsupported-currencies", this._content = "You use some Products with prices in unsupported currencies.<br/>Please remove such Products from your Shopping Cart.", this._paypalCurrencies = ["USD", "EUR", "AUD", "BRL", "CAD", "CNY", "CZK", "DKK", "HKD", "HUF", "ILS", "JPY", "MYR", "MXN", "TWD", "NZD", "NOK", "PHP", "PLN", "GBP", "SGD", "SEK", "CHF", "THB"]
        }
        t.exports = i, i.prototype.setDialog = function t(e) {
            return this.$dialog = e, this
        }, i.prototype.setProducts = function t(products) {
            return this.products = products, this
        }, i.prototype.setEnabled = function t(e) {
            return this.enabled = e, this
        }, i.prototype.clear = function t() {
            this.hide(), this.$dialog = $(), this.products = null, this.enabled = false
        }, i.prototype.showIfHasUnsupportedCurrency = function t() {
            if (this.enabled && this.hasUnsupportedCurrency()) this.show();
            return this
        }, i.prototype.hideIfNoUnsupportedCurrency = function t() {
            if (this.enabled && !this.hasUnsupportedCurrency()) this.hide();
            return this
        }, i.prototype.hasUnsupportedCurrency = function t() {
            if (!this.products || !this.products.length) return false;
            for (var e = 0; e < this.products.length; e++)
                if (-1 === this._paypalCurrencies.indexOf(this.products[e].currency)) return true;
            return false
        }, i.prototype.show = function show() {
            if (!this.enabled) return this;
            else return this.$dialog.find(".u-payment-paypal .u-payment-services-inner").after('<div class="' + this._className + '"><p>' + this._content + "</p></div>"), this.$dialog.find(".u-payment-paypal .u-payment-services-inner").hide(), this
        }, i.prototype.hide = function t() {
            if (!this.enabled) return this;
            else return this.$dialog.find(".u-payment-paypal ." + this._className).remove(), this.$dialog.find(".u-payment-paypal .u-payment-services-inner").show(), this
        }, window.PayPalCurrencyWarning = i
    },
    12117: function (t, e, n) {
        "use strict";

        function i(t) {
            this.paymentConfig = t, this.eventListener = this.listener.bind(this)
        }
        var o = n(3438),
            a = n(944),
            s = n(3440);
        t.exports = i, i.prototype.subscribe = function t() {
            window.addEventListener("message", this.eventListener)
        }, i.prototype.unsubscribe = function t() {
            window.removeEventListener("message", this.eventListener)
        }, i.prototype.listener = function t(e) {
            var n = new s;
            if (n.isThankYouPage()) return a.getCart().clear(), void 0;
            var i = this.paymentConfig.sessionId;
            if ("string" == typeof e.data && e.data.startsWith(i)) {
                var u = $(".u-dialog-open"),
                    data = JSON.parse(e.data.replace(i, "")),
                    l = new o(u);
                switch (data.type) {
                    case "ORDER_CREATED":
                        break;
                    case "ORDER_APPROVED":
                        l.orderApproved(), setTimeout((function () {
                            n.goToThankYouPage()
                        }), 1e3);
                        break;
                    case "ORDER_CANCELED":
                        break;
                    case "ORDER_ERROR":
                        l.orderError();
                        break;
                    case "IFRAME_HEIGHT":
                        var c = u.find(".u-payment-services-inner"),
                            f = parseFloat(c.css("padding-top")) || 0,
                            h = parseFloat(c.css("padding-bottom")) || 0,
                            p = data.height + f + h;
                        u.find(".u-payment-services-inner").css("height", p + "px");
                        break;
                    default:
                        break
                }
            }
        }, window.PaymentEventListener = i
    },
    12118: function (t, e, n) {
        "use strict";
        var i = n(15),
            o = n(3439),
            a = n(944),
            s = n(3441);
        window._npCartInit = function () {
            function t(t) {
                if (t.preventDefault(), t.stopPropagation(), !e(t)) {
                    var link = i(t.currentTarget),
                        a, product = new o(link).getProduct();
                    if (!product) return null;
                    n.addProduct(product)
                }
            }

            function e(t) {
                return i(t.currentTarget).hasClass("disabled")
            }
            i("body").on("click", ".u-add-to-cart-link", t);
            var n = a.getCart();
            if (n.$cart.length) s.getModel().load((function (t, data) {
                if (data && data.products) n.init(data)
            }))
        }, i((function () {
            window._npCartInit()
        }))
    },
    12119: function (t, e, n) {
        "use strict";
        var i = n(15);
        i((function () {
            var selectors = [".u-expand-closed > .u-categories-item-content > a .u-icon", ".u-expand-open > .u-categories-item-content > a .u-icon"].join(", ");
            i(selectors).click((function (t) {
                t.preventDefault(), t.stopPropagation();
                var el = i(this),
                    e = el.closest("li");
                if (!e.hasClass("u-expand-leaf")) {
                    var n = e.hasClass("u-expand-open") ? "-closed" : "-open",
                        o = /\-open|\-closed/;
                    e.attr("class", (e.attr("class") || "").replace(o, n)), el.html(el.html().replace(o, n))
                }
            }))
        }))
    },
    12120: function (t, e, n) {
        "use strict";
        var i = n(15),
            ProductBadge = n(943),
            o = n(12121),
            a = n(3442),
            s = n(12122),
            u = n(3441),
            l = n(12123),
            ProductsBuilder = n(12124),
            model = u.getModel(),
            c = new l;
        c.attachHandler((function (id, page, sorting, t) {
            if (page = parseFloat(page) || 1, id) {
                var list = i(".u-products[data-products-id=" + id + "]");
                if (list.length) model.load((function (e, data) {
                    if (e) throw e;
                    if (data) {
                        t = t || "";
                        var n = new ProductsBuilder(list, data),
                            view;
                        n.build(page, sorting, t), new o(list).render(n.getResult())
                    }
                }))
            }
        })), i((function () {
            c.handle((function (routes) {
                i(".u-products").each((function () {
                    var list = i(this);
                    if (!list.closest(".u-payment-dialog").length) {
                        var t = list.attr("data-products-id"),
                            e;
                        if ("site" === list.attr("data-products-datasource"))
                            if (!routes[t]) model.load((function (t, data) {
                                if (data) {
                                    var e = o.getDefaultParams(list, data),
                                        view = new o(list);
                                    view.renderPagination(e), view.renderSorter(e), view.renderCategories(e)
                                }
                            }))
                    }
                }))
            })), i(".u-products .u-select-sorting").on("change", (function (t) {
                var list = i(t.currentTarget).closest(".u-products");
                if (!list.closest(".u-payment-dialog").length) {
                    var e;
                    if ("site" === list.attr("data-products-datasource")) {
                        var id = list.attr("data-products-id"),
                            sorting = this.value,
                            n = a.getActiveCategory(list);
                        c.navigate(id, 1, sorting, n)
                    }
                }
            })), i(".u-products .u-select-categories").on("change", (function (t) {
                var list = i(t.currentTarget).closest(".u-products");
                if (!list.closest(".u-payment-dialog").length) {
                    var e;
                    if ("site" === list.attr("data-products-datasource")) {
                        var id = list.attr("data-products-id"),
                            sorting = s.getActiveSorting(list),
                            n = this.value || "";
                        c.navigate(id, 1, sorting, n)
                    }
                }
            })), i(".u-categories .u-category-link").on("click", (function (t) {
                var link = i(this);
                if ("#" === link.attr("href")) {
                    var list = a.findNearestProducts(link.closest(".u-categories")).eq(0);
                    if (list.length)
                        if (!list.closest(".u-payment-dialog").length) {
                            var e;
                            if ("site" === list.attr("data-products-datasource")) {
                                t.preventDefault();
                                var id = list.attr("data-products-id"),
                                    sorting = s.getActiveSorting(list),
                                    n = link.attr("data-category") || "";
                                c.navigate(id, 1, sorting, n)
                            }
                        }
                }
            })), i(".u-products").on("click", ".u-pagination-item .u-nav-link", (function (t) {
                var list = i(t.currentTarget).closest(".u-products");
                if (!list.closest(".u-payment-dialog").length) {
                    var e;
                    if ("site" === list.attr("data-products-datasource")) {
                        t.preventDefault();
                        var id = list.attr("data-products-id"),
                            n = this.getAttribute("href") || "",
                            sorting = s.getActiveSorting(list),
                            o = a.getActiveCategory(list),
                            page = parseFloat(n.replace(/[^\d.,]/g, "") || 1);
                        c.navigate(id, page, sorting, o)
                    }
                }
            })), ProductBadge.update()
        }))
    },
    12121: function (t, e, n) {
        "use strict";

        function i(list) {
            this.list = list
        }
        t.exports = i;
        var PaginationBuilder = n(532),
            o = n(3442);
        i.prototype.render = function (t) {
            if (t.items && t.items.length) {
                var container = this.list.children(".u-repeater");
                this.updateHeight(container.children().length, t.items.length), container.empty(), t.items.forEach((function (t) {
                    container.append(t)
                }))
            }
            this.renderPagination(t), this.renderSorter(t), this.renderCategories(t)
        }, i.prototype.renderPagination = function (t) {
            var pagination = this.list.find(".u-pagination"),
                paginationBuilder = new PaginationBuilder(pagination, {
                    listItems: {
                        length: t.totalPages
                    }
                }, {
                    isPage: true,
                    listHref: "products/products.html"
                });
            pagination.replaceWith(paginationBuilder.getPagination(t.currentPage - 1))
        }, i.prototype.renderSorter = function (t) {
            this.list.find(".u-select-sorting").val(t.sorting || "")
        }, i.prototype.renderCategories = function (t) {
            var categories;
            this.list.find(".u-select-categories").val(t.category || ""), o.findNearestCategories(this.list).each((function () {
                o.setActiveCategory($(this), t.category)
            }))
        }, i.prototype.updateHeight = function (t, e) {
            var grid = this.list.find(".u-repeater");
            if (grid.length) {
                var n = grid.css("grid-template-columns") || "",
                    i = parseFloat(grid.css("grid-row-gap")) || 0,
                    o = n.split(/\s+/).length || 1,
                    a = Math.ceil(t / o) || 1,
                    s = Math.ceil(e / o) || 1,
                    u = grid.height() - i * (a - 1),
                    l, c = u / a * s + i * (s - 1);
                grid.css("min-height", c + "px");
                var f = this.list.closest(".u-sheet, section, header, footer");
                if (f.length) {
                    var h = parseFloat(f.css("min-height")) || 0;
                    if (h) {
                        var p = h + (c - u);
                        f.css("min-height", p + "px")
                    }
                }
            }
        }, i.getDefaultParams = function (list, data) {
            var products = data.products || [],
                t = parseFloat(list.attr("data-items-per-page")) || 3,
                e = list.attr("data-site-sorting-prop") || "title",
                n = list.attr("data-site-sorting-order") || "asc",
                i = list.attr("data-site-category") || "";
            return {
                totalPages: Math.ceil(products.length / t),
                currentPage: 1,
                sorting: e + "-" + n,
                category: i
            }
        }, window.ProductsView = i
    },
    12122: function (t, e, n) {
        "use strict";
        var i;
        t.exports.getActiveSorting = function (list) {
            var t = list.find(".u-select-sorting");
            if (t.length) return t.val();
            else return "name-asc"
        }
    },
    12123: function (t, e, n) {
        "use strict";

        function i() {
            this.regexp = /\/([^/&]+)\/(\d*)\/([^&/]*)(?:\/([^&]*))?/g, this.handler = null, this.visitedRoutes = {}, this._onHashChange = this.onHashChange.bind(this)
        }

        function o() {
            return "/" + Array.from(arguments).join("/")
        }
        t.exports = i;
        var a = n(15);
        i.prototype.attachHandler = function (t) {
            this.handler = t
        }, i.prototype.handle = function (t) {
            if (a(window).on("hashchange", this._onHashChange), a(window).trigger("hashchange"), "function" == typeof t) t(this.parseHash())
        }, i.prototype.destroy = function () {
            a(window).off("hashchange", this._onHashChange), this.visitedRoutes = {}
        }, i.prototype.onHashChange = function () {
            if ("function" == typeof this.handler) {
                var routes = this.parseHash();
                Object.keys(routes).forEach((function (id) {
                    var t = routes[id],
                        e = o.apply(null, t);
                    if (this.visitedRoutes[id] !== e) this.visitedRoutes[id] = e, this.handler.apply(this, t)
                }), this)
            }
        }, i.prototype.navigate = function (id) {
            var routes = this.parseHash();
            routes[id] = Array.from(arguments), window.location.hash = this.buildHash(routes)
        }, i.prototype.parseHash = function () {
            for (var hash = window.location.hash || "#", t, routes = {}; null !== (t = this.regexp.exec(hash));) {
                var e;
                routes[t[1]] = t.slice(1)
            }
            return routes
        }, i.prototype.buildHash = function (routes) {
            return Object.values(routes).map((function (t) {
                return o.apply(null, t)
            })).join("&")
        }, window.ProductsRouter = i
    },
    12124: function (t, e, n) {
        "use strict";

        function ProductsBuilder(list, model) {
            this.list = list, this.products = model.products ? model.products : [], this.categories = model.categories ? model.categories : [], this.pathToRoot = document.body.getAttribute("data-path-to-root") || "./", this.isCms = list.hasClass("u-cms"), this._result = {
                items: [],
                itemsPerPage: 3,
                currentPage: 1,
                totalPages: 1,
                sorting: ""
            }
        }
        t.exports = ProductsBuilder;
        var Currency = n(207),
            ProductsUtils = n(348),
            ProductBadge = n(943);
        ProductsBuilder.prototype.build = function (page, sorting, t) {
            if (!Number.isFinite(page)) page = 1;
            var template = this.list.find(".u-repeater").children().eq(0).clone(),
                products = ProductsUtils.categoryFilter(this.products, t),
                e = ProductsUtils.sort(products, this.getSortingParam(sorting), $("html").attr("lang") || "en"),
                n = parseFloat(this.list.attr("data-max-items")) || parseFloat(this.list.attr("data-items-per-page")) || 3,
                i = products.slice((page - 1) * n, page * n);
            this._result.currentPage = page, this._result.itemsPerPage = n, this._result.totalPages = Math.ceil(products.length / n), this._result.sorting = e, this._result.category = t || "";
            var o = {
                showSecondImage: this.list.hasClass("u-show-second-image")
            };
            i.reduce(function (t, data) {
                var listItem = template.clone();
                return this.buildProduct(listItem, data, o), t.push(listItem), t
            }.bind(this), this._result.items)
        }, ProductsBuilder.prototype.getSortingParam = function (sorting) {
            var t = (sorting || "").split("-"),
                e, n;
            return {
                prop: t[0] || this.list.attr("data-site-sorting-prop"),
                order: t[1] || this.list.attr("data-site-sorting-order")
            }
        }, ProductsBuilder.prototype.buildProduct = function (listItem, data, t) {
            var e;
            listItem.attr("data-product-id", data.id), listItem.find(".u-product-control").each(function (e, el) {
                var n = $(el),
                    i = n.find(".u-product-title-link");
                if (i.length) this.applyTitle(i, data);
                else if (n.hasClass("u-image")) this.applyImage(n, data, t);
                else if (n.hasClass("u-product-desc")) this.applyDesc(n, data);
                else if (n.hasClass("u-product-full-desc")) this.applyFullDesc(n, data);
                else if (n.hasClass("u-btn")) this.applyButton(n, data);
                else if (n.hasClass("u-product-price")) this.applyPrice(n, data);
                else if (n.hasClass("u-product-category")) this.applyCategories(n, data);
                else if (n.hasClass("u-product-badge")) this.applyBadge(n, data);
                else if (n.hasClass("u-product-sku")) this.applySku(n, data)
            }.bind(this))
        }, ProductsBuilder.prototype.applyTitle = function (t, data) {
            if (data.title) {
                t[0].innerHTML = data.title;
                var e = this.isCms ? data.link : t[0].href.replace(/[^/]+$/, data.name + ".html");
                t[0].href = e
            }
        }, ProductsBuilder.prototype.applyImage = function (t, data, e) {
            if (data.images && data.images.length) {
                var url = data.images[0].url || "";
                if (!url.startsWith("http") && !url.startsWith("data:image")) url = this.pathToRoot + url.replace(/^\/+/, "");
                if (data.images[1]) {
                    var n = t.closest(".u-repeater-item, .u-product");
                    if (n.find(".u-product-second-image").remove(), e.showSecondImage) {
                        var i = $("<img/>"),
                            o = data.images[1].url || "";
                        if (!o.startsWith("http") && !o.startsWith("data:image")) o = this.pathToRoot + o.replace(/^\/+/, "");
                        i.attr("src", o), i.addClass("u-product-second-image"), n.prepend(i)
                    }
                }
                var a = this.isCms ? data.link : this.pathToRoot + "products/" + data.name + ".html";
                if (t.is("img")) {
                    var link;
                    t.attr("src", url), t.closest(".u-product-title-link").attr("href", a)
                } else t.css("background-image", url), t.attr("data-href", a)
            }
        }, ProductsBuilder.prototype.applyDesc = function (t, data) {
            if (data.description) t[0].innerHTML = data.description
        }, ProductsBuilder.prototype.applyFullDesc = function (t, data) {
            if (data.fullDescription) t[0].innerHTML = data.fullDescription
        }, ProductsBuilder.prototype.applyButton = function (t, data) {
            var e = t.attr("data-product-button-click-type");
            if ("go-to-page" === e) {
                var n = this.isCms ? data.link : this.pathToRoot + "products/" + data.name + ".html";
                t.attr("href", n)
            } else if ("buy-now" === e) t.attr("data-product-id", data.id), t.attr("data-product", JSON.stringify(data));
            else t.attr("data-product", JSON.stringify(data)), t.attr("href", "#")
        }, ProductsBuilder.prototype.applyPrice = function (t, data) {
            var e = t.find(".u-price");
            if (e.length) e[0].innerHTML = Currency.format(data.price, data.currency, "true" === e.closest(".u-product-price").attr("data-add-zero-cents"));
            var n = t.find(".u-old-price");
            if (n.length) n[0].innerHTML = Currency.format(data.oldPrice, data.currency, "true" === n.closest(".u-product-price").attr("data-add-zero-cents"))
        }, ProductsBuilder.prototype.applySku = function (t, data) {
            if (data.sku) t[0].innerHTML = data.sku
        }, ProductsBuilder.prototype.applyCategories = function (t, data) {
            var e = t.find("a");
            if (e.length) {
                var n = e.eq(0).clone();
                if (t.empty(), !data.categories || !data.categories.length) return n.html("Uncategorized").attr("href", "#"), t.append(n), void 0;
                var i = this.categories;
                if (data.categoriesData) data.categoriesData.forEach((function (e, index) {
                    this.setCategory(e, n, t, index)
                }), this);
                else data.categories.forEach((function (id, index) {
                    var e = i.find((function (t) {
                        return t.id === id
                    }));
                    this.setCategory(e, n, t, index)
                }), this)
            }
        }, ProductsBuilder.prototype.setCategory = function (t, e, n, index) {
            if (t) {
                var i = e.clone();
                i.removeAttr("data-category"), i.attr("href", t.link), i.text((index > 0 ? ", " : "") + t.title), n.append(i)
            }
        }, ProductsBuilder.prototype.applyBadge = function (t, data) {
            var e = t.attr("data-badge-source") || "new";
            if (t.removeClass("u-hidden-block"), "new" === e) t.attr("data-product-created", data.created), t.addClass("u-hidden-block");
            else {
                var n = parseFloat(data.price) || 0,
                    i = parseFloat(data.oldPrice) || 0;
                if (n && i && n < i) {
                    var o = "-" + parseInt(100 - 100 * n / i, 10) + "%";
                    t[0].innerHTML = t[0].innerHTML.replace(/-[\d]+%/, o)
                } else t.addClass("u-hidden-block")
            }
            ProductBadge.update(t)
        }, ProductsBuilder.prototype.getResult = function () {
            return this._result
        }, window.ProductsBuilder = ProductsBuilder
    },
    12125: function (t, e) {},
    140: function (t, e, n) {
        "use strict";
        t.exports = {
            IMAGES: "IMAGES",
            DOCUMENTS: "DOCUMENTS",
            VIDEO: "VIDEO",
            AUDIO: "AUDIO",
            CUSTOM: "CUSTOM"
        }
    },
    15: function (t, e) {
        t.exports = jQuery
    },
    19: function (t, e, n) {
        "use strict";
        t.exports = {
            options: {
                usePureJavaScript: false
            }
        }
    },
    207: function (t, e, n) {
        "use strict";

        function i(t, currency, e) {
            var n = currency.locale,
                i = {
                    currency: currency.code
                };
            if (n) i.style = "currency";
            if (!e) i.maximumFractionDigits = 0, i.minimumFractionDigits = 0;
            return new Intl.NumberFormat(n || "en-US", i).format(t)
        }

        function o(t, currency, e) {
            var n;
            if (currency.mask) n = currency.mask;
            else if (currency.symbol) n = "{0} " + currency.symbol;
            else n = "{0} " + currency.code;
            return t = e ? t : Math.trunc(t), n.replace("{0}", t)
        }
        var a = n(357),
            Currency = t.exports,
            s = a.reduce((function (t, e) {
                return t[e.code] = e, t
            }), {});
        Currency.format = function (t, e, n) {
            if (("string" == typeof t || void 0 === t) && !t) return "";
            e = e || "USD", t = parseFloat(t) || 0;
            var currency = s[e] || {},
                a = i(t, currency, n);
            if (a.includes(currency.symbol)) return a;
            else return o(t, currency)
        }, Currency.getSymbol = function (t) {
            var e = s[t] || {};
            return e && e.symbol
        }, Currency.getMask = function (t) {
            var e = s[t] || {};
            return e && e.mask
        }
    },
    219: function (t, e, n) {
        "use strict";

        function Accordion(link) {
            this.selector = ".u-accordion", this.activeClass = "u-accordion-active", this._paneSelector = ".u-accordion-pane", this.activeSelector = "." + this.activeClass, this._linkSelector = ".u-accordion-link", this.activeLinkClass = "active", this.activeLinkSelector = "." + this.activeLinkClass, this._isCollapsedByDefaultSelector = ".u-collapsed-by-default", this._link = link, this._accordion = this._link.closest(this.selector)
        }
        t.exports = Accordion, Accordion.prototype.show = function (t) {
            var link = this._link;
            if (link.is(this.activeLinkSelector) && !t) return this._removeActiveLink(), this._hidePane(link), void 0;
            this._removeActiveLink(), this._hidePane(link), this._addActiveLink(link), this._activatePane(link)
        }, Accordion.prototype._removeActiveLink = function () {
            var t = this._getActiveLink();
            t.removeClass(this.activeLinkClass), t.attr("aria-selected", false)
        }, Accordion.prototype._getActiveLink = function () {
            return this._accordion.find(this.activeLinkSelector)
        }, Accordion.prototype._addActiveLink = function (link) {
            link.addClass(this.activeLinkClass), link.attr("aria-selected", true)
        }, Accordion.prototype._activatePane = function (link) {
            var pane;
            this._accordion.find(this.activeSelector).removeClass(this.activeClass), this._getPane(link).addClass(this.activeClass)
        }, Accordion.prototype._getPane = function (link) {
            return link.siblings(this._paneSelector)
        }, Accordion.prototype._hidePane = function (link) {
            var pane;
            this._getPane(link).removeClass(this.activeClass)
        }, Accordion.prototype.closeAll = function () {
            this._accordion.find(this._linkSelector + this.activeLinkSelector).removeClass(this.activeLinkClass).attr("aria-selected", false), this._accordion.find(this._paneSelector + this.activeSelector).removeClass(this.activeClass)
        }, Accordion.prototype.isCollapsedByDefault = function () {
            return this._accordion.is(this._isCollapsedByDefaultSelector)
        }
    },
    22: function (t, e, n) {
        "use strict";
        (function (e, i, o, a) {
            function s(t) {
                if (!(8 === t || 16 === t || 24 === t || 32 === t)) throw new Error("Only 8, 16, 24, or 32 bits supported: " + t)
            }

            function u(t) {
                if (this.data = "", this.read = 0, "string" == typeof t) this.data = t;
                else if (util.isArrayBuffer(t) || util.isArrayBufferView(t))
                    if (void 0 !== a && t instanceof a) this.data = t.toString("binary");
                    else {
                        var e = new Uint8Array(t);
                        try {
                            this.data = String.fromCharCode.apply(null, e)
                        } catch (t) {
                            for (var n = 0; n < e.length; ++n) this.putByte(e[n])
                        }
                    }
                else if (t instanceof u || "object" == typeof t && "string" == typeof t.data && "number" == typeof t.read) this.data = t.data, this.read = t.read;
                this._constructedStringLength = 0
            }

            function l(t, e) {
                e = e || {}, this.read = e.readOffset || 0, this.growSize = e.growSize || 1024;
                var n = util.isArrayBuffer(t),
                    i = util.isArrayBufferView(t);
                if (n || i) {
                    if (n) this.data = new DataView(t);
                    else this.data = new DataView(t.buffer, t.byteOffset, t.byteLength);
                    return this.write = "writeOffset" in e ? e.writeOffset : this.data.byteLength, void 0
                }
                if (this.data = new DataView(new ArrayBuffer(0)), this.write = 0, null != t) this.putBytes(t);
                if ("writeOffset" in e) this.write = e.writeOffset
            }
            var c = n(19),
                f = n(537),
                util = t.exports = c.util = c.util || {};
            ! function () {
                if (void 0 === e || !e.nextTick || e.browser) {
                    if ("function" == typeof i) return util.setImmediate = function () {
                        return i.apply(void 0, arguments)
                    }, util.nextTick = function (t) {
                        return i(t)
                    }, void 0;
                    if (util.setImmediate = function (t) {
                            setTimeout(t, 0)
                        }, "undefined" != typeof window && "function" == typeof window.postMessage) {
                        var t = "forge.setImmediate",
                            n = [];

                        function e(e) {
                            if (e.source === window && e.data === t) {
                                e.stopPropagation();
                                var copy = n.slice();
                                n.length = 0, copy.forEach((function (t) {
                                    t()
                                }))
                            }
                        }
                        util.setImmediate = function (e) {
                            if (n.push(e), 1 === n.length) window.postMessage(t, "*")
                        }, window.addEventListener("message", e, true)
                    }
                    if ("undefined" != typeof MutationObserver) {
                        var o = Date.now(),
                            a = true,
                            s = document.createElement("div"),
                            n = [];
                        new MutationObserver((function () {
                            var copy = n.slice();
                            n.length = 0, copy.forEach((function (t) {
                                t()
                            }))
                        })).observe(s, {
                            attributes: true
                        });
                        var u = util.setImmediate;
                        util.setImmediate = function (t) {
                            if (Date.now() - o > 15) o = Date.now(), u(t);
                            else if (n.push(t), 1 === n.length) s.setAttribute("a", a = !a)
                        }
                    }
                    util.nextTick = util.setImmediate
                } else if (util.nextTick = e.nextTick, "function" == typeof i) util.setImmediate = i;
                else util.setImmediate = util.nextTick
            }(), util.isNodejs = void 0 !== e && e.versions && e.versions.node, util.globalScope = function () {
                if (util.isNodejs) return o;
                else return "undefined" == typeof self ? window : self
            }(), util.isArray = Array.isArray || function (t) {
                return "[object Array]" === Object.prototype.toString.call(t)
            }, util.isArrayBuffer = function (t) {
                return "undefined" != typeof ArrayBuffer && t instanceof ArrayBuffer
            }, util.isArrayBufferView = function (t) {
                return t && util.isArrayBuffer(t.buffer) && void 0 !== t.byteLength
            }, util.ByteBuffer = u, util.ByteStringBuffer = u;
            var h = 4096;
            util.ByteStringBuffer.prototype._optimizeConstructedString = function (t) {
                if (this._constructedStringLength += t, this._constructedStringLength > h) this.data.substr(0, 1), this._constructedStringLength = 0
            }, util.ByteStringBuffer.prototype.length = function () {
                return this.data.length - this.read
            }, util.ByteStringBuffer.prototype.isEmpty = function () {
                return this.length() <= 0
            }, util.ByteStringBuffer.prototype.putByte = function (t) {
                return this.putBytes(String.fromCharCode(t))
            }, util.ByteStringBuffer.prototype.fillWithByte = function (t, e) {
                t = String.fromCharCode(t);
                for (var d = this.data; e > 0;) {
                    if (1 & e) d += t;
                    if ((e >>>= 1) > 0) t += t
                }
                return this.data = d, this._optimizeConstructedString(e), this
            }, util.ByteStringBuffer.prototype.putBytes = function (t) {
                return this.data += t, this._optimizeConstructedString(t.length), this
            }, util.ByteStringBuffer.prototype.putString = function (t) {
                return this.putBytes(util.encodeUtf8(t))
            }, util.ByteStringBuffer.prototype.putInt16 = function (t) {
                return this.putBytes(String.fromCharCode(t >> 8 & 255) + String.fromCharCode(255 & t))
            }, util.ByteStringBuffer.prototype.putInt24 = function (t) {
                return this.putBytes(String.fromCharCode(t >> 16 & 255) + String.fromCharCode(t >> 8 & 255) + String.fromCharCode(255 & t))
            }, util.ByteStringBuffer.prototype.putInt32 = function (t) {
                return this.putBytes(String.fromCharCode(t >> 24 & 255) + String.fromCharCode(t >> 16 & 255) + String.fromCharCode(t >> 8 & 255) + String.fromCharCode(255 & t))
            }, util.ByteStringBuffer.prototype.putInt16Le = function (t) {
                return this.putBytes(String.fromCharCode(255 & t) + String.fromCharCode(t >> 8 & 255))
            }, util.ByteStringBuffer.prototype.putInt24Le = function (t) {
                return this.putBytes(String.fromCharCode(255 & t) + String.fromCharCode(t >> 8 & 255) + String.fromCharCode(t >> 16 & 255))
            }, util.ByteStringBuffer.prototype.putInt32Le = function (t) {
                return this.putBytes(String.fromCharCode(255 & t) + String.fromCharCode(t >> 8 & 255) + String.fromCharCode(t >> 16 & 255) + String.fromCharCode(t >> 24 & 255))
            }, util.ByteStringBuffer.prototype.putInt = function (t, e) {
                s(e);
                var n = "";
                do {
                    e -= 8, n += String.fromCharCode(t >> e & 255)
                } while (e > 0);
                return this.putBytes(n)
            }, util.ByteStringBuffer.prototype.putSignedInt = function (t, e) {
                if (t < 0) t += 2 << e - 1;
                return this.putInt(t, e)
            }, util.ByteStringBuffer.prototype.putBuffer = function (t) {
                return this.putBytes(t.getBytes())
            }, util.ByteStringBuffer.prototype.getByte = function () {
                return this.data.charCodeAt(this.read++)
            }, util.ByteStringBuffer.prototype.getInt16 = function () {
                var t = this.data.charCodeAt(this.read) << 8 ^ this.data.charCodeAt(this.read + 1);
                return this.read += 2, t
            }, util.ByteStringBuffer.prototype.getInt24 = function () {
                var t = this.data.charCodeAt(this.read) << 16 ^ this.data.charCodeAt(this.read + 1) << 8 ^ this.data.charCodeAt(this.read + 2);
                return this.read += 3, t
            }, util.ByteStringBuffer.prototype.getInt32 = function () {
                var t = this.data.charCodeAt(this.read) << 24 ^ this.data.charCodeAt(this.read + 1) << 16 ^ this.data.charCodeAt(this.read + 2) << 8 ^ this.data.charCodeAt(this.read + 3);
                return this.read += 4, t
            }, util.ByteStringBuffer.prototype.getInt16Le = function () {
                var t = this.data.charCodeAt(this.read) ^ this.data.charCodeAt(this.read + 1) << 8;
                return this.read += 2, t
            }, util.ByteStringBuffer.prototype.getInt24Le = function () {
                var t = this.data.charCodeAt(this.read) ^ this.data.charCodeAt(this.read + 1) << 8 ^ this.data.charCodeAt(this.read + 2) << 16;
                return this.read += 3, t
            }, util.ByteStringBuffer.prototype.getInt32Le = function () {
                var t = this.data.charCodeAt(this.read) ^ this.data.charCodeAt(this.read + 1) << 8 ^ this.data.charCodeAt(this.read + 2) << 16 ^ this.data.charCodeAt(this.read + 3) << 24;
                return this.read += 4, t
            }, util.ByteStringBuffer.prototype.getInt = function (t) {
                s(t);
                var e = 0;
                do {
                    e = (e << 8) + this.data.charCodeAt(this.read++), t -= 8
                } while (t > 0);
                return e
            }, util.ByteStringBuffer.prototype.getSignedInt = function (t) {
                var e = this.getInt(t),
                    n = 2 << t - 2;
                if (e >= n) e -= n << 1;
                return e
            }, util.ByteStringBuffer.prototype.getBytes = function (t) {
                var e;
                if (t) t = Math.min(this.length(), t), e = this.data.slice(this.read, this.read + t), this.read += t;
                else if (0 === t) e = "";
                else e = 0 === this.read ? this.data : this.data.slice(this.read), this.clear();
                return e
            }, util.ByteStringBuffer.prototype.bytes = function (t) {
                return void 0 === t ? this.data.slice(this.read) : this.data.slice(this.read, this.read + t)
            }, util.ByteStringBuffer.prototype.at = function (t) {
                return this.data.charCodeAt(this.read + t)
            }, util.ByteStringBuffer.prototype.setAt = function (t, e) {
                return this.data = this.data.substr(0, this.read + t) + String.fromCharCode(e) + this.data.substr(this.read + t + 1), this
            }, util.ByteStringBuffer.prototype.last = function () {
                return this.data.charCodeAt(this.data.length - 1)
            }, util.ByteStringBuffer.prototype.copy = function () {
                var t = util.createBuffer(this.data);
                return t.read = this.read, t
            }, util.ByteStringBuffer.prototype.compact = function () {
                if (this.read > 0) this.data = this.data.slice(this.read), this.read = 0;
                return this
            }, util.ByteStringBuffer.prototype.clear = function () {
                return this.data = "", this.read = 0, this
            }, util.ByteStringBuffer.prototype.truncate = function (t) {
                var e = Math.max(0, this.length() - t);
                return this.data = this.data.substr(this.read, e), this.read = 0, this
            }, util.ByteStringBuffer.prototype.toHex = function () {
                for (var t = "", e = this.read; e < this.data.length; ++e) {
                    var n = this.data.charCodeAt(e);
                    if (n < 16) t += "0";
                    t += n.toString(16)
                }
                return t
            }, util.ByteStringBuffer.prototype.toString = function () {
                return util.decodeUtf8(this.bytes())
            }, util.DataBuffer = l, util.DataBuffer.prototype.length = function () {
                return this.write - this.read
            }, util.DataBuffer.prototype.isEmpty = function () {
                return this.length() <= 0
            }, util.DataBuffer.prototype.accommodate = function (t, e) {
                if (this.length() >= t) return this;
                e = Math.max(e || this.growSize, t);
                var n = new Uint8Array(this.data.buffer, this.data.byteOffset, this.data.byteLength),
                    i = new Uint8Array(this.length() + e);
                return i.set(n), this.data = new DataView(i.buffer), this
            }, util.DataBuffer.prototype.putByte = function (t) {
                return this.accommodate(1), this.data.setUint8(this.write++, t), this
            }, util.DataBuffer.prototype.fillWithByte = function (t, e) {
                this.accommodate(e);
                for (var n = 0; n < e; ++n) this.data.setUint8(t);
                return this
            }, util.DataBuffer.prototype.putBytes = function (t, e) {
                if (util.isArrayBufferView(t)) {
                    var n, i = (n = new Uint8Array(t.buffer, t.byteOffset, t.byteLength)).byteLength - n.byteOffset,
                        o;
                    return this.accommodate(i), (o = new Uint8Array(this.data.buffer, this.write)).set(n), this.write += i, this
                }
                if (util.isArrayBuffer(t)) {
                    var n = new Uint8Array(t),
                        o;
                    return this.accommodate(n.byteLength), (o = new Uint8Array(this.data.buffer)).set(n, this.write), this.write += n.byteLength, this
                }
                if (t instanceof util.DataBuffer || "object" == typeof t && "number" == typeof t.read && "number" == typeof t.write && util.isArrayBufferView(t.data)) {
                    var n = new Uint8Array(t.data.byteLength, t.read, t.length()),
                        o;
                    return this.accommodate(n.byteLength), (o = new Uint8Array(t.data.byteLength, this.write)).set(n), this.write += n.byteLength, this
                }
                if (t instanceof util.ByteStringBuffer) t = t.data, e = "binary";
                if (e = e || "binary", "string" == typeof t) {
                    var view;
                    if ("hex" === e) return this.accommodate(Math.ceil(t.length / 2)), view = new Uint8Array(this.data.buffer, this.write), this.write += util.binary.hex.decode(t, view, this.write), this;
                    if ("base64" === e) return this.accommodate(3 * Math.ceil(t.length / 4)), view = new Uint8Array(this.data.buffer, this.write), this.write += util.binary.base64.decode(t, view, this.write), this;
                    if ("utf8" === e) t = util.encodeUtf8(t), e = "binary";
                    if ("binary" === e || "raw" === e) return this.accommodate(t.length), view = new Uint8Array(this.data.buffer, this.write), this.write += util.binary.raw.decode(view), this;
                    if ("utf16" === e) return this.accommodate(2 * t.length), view = new Uint16Array(this.data.buffer, this.write), this.write += util.text.utf16.encode(view), this;
                    throw new Error("Invalid encoding: " + e)
                }
                throw Error("Invalid parameter: " + t)
            }, util.DataBuffer.prototype.putBuffer = function (t) {
                return this.putBytes(t), t.clear(), this
            }, util.DataBuffer.prototype.putString = function (t) {
                return this.putBytes(t, "utf16")
            }, util.DataBuffer.prototype.putInt16 = function (t) {
                return this.accommodate(2), this.data.setInt16(this.write, t), this.write += 2, this
            }, util.DataBuffer.prototype.putInt24 = function (t) {
                return this.accommodate(3), this.data.setInt16(this.write, t >> 8 & 65535), this.data.setInt8(this.write, t >> 16 & 255), this.write += 3, this
            }, util.DataBuffer.prototype.putInt32 = function (t) {
                return this.accommodate(4), this.data.setInt32(this.write, t), this.write += 4, this
            }, util.DataBuffer.prototype.putInt16Le = function (t) {
                return this.accommodate(2), this.data.setInt16(this.write, t, true), this.write += 2, this
            }, util.DataBuffer.prototype.putInt24Le = function (t) {
                return this.accommodate(3), this.data.setInt8(this.write, t >> 16 & 255), this.data.setInt16(this.write, t >> 8 & 65535, true), this.write += 3, this
            }, util.DataBuffer.prototype.putInt32Le = function (t) {
                return this.accommodate(4), this.data.setInt32(this.write, t, true), this.write += 4, this
            }, util.DataBuffer.prototype.putInt = function (t, e) {
                s(e), this.accommodate(e / 8);
                do {
                    e -= 8, this.data.setInt8(this.write++, t >> e & 255)
                } while (e > 0);
                return this
            }, util.DataBuffer.prototype.putSignedInt = function (t, e) {
                if (s(e), this.accommodate(e / 8), t < 0) t += 2 << e - 1;
                return this.putInt(t, e)
            }, util.DataBuffer.prototype.getByte = function () {
                return this.data.getInt8(this.read++)
            }, util.DataBuffer.prototype.getInt16 = function () {
                var t = this.data.getInt16(this.read);
                return this.read += 2, t
            }, util.DataBuffer.prototype.getInt24 = function () {
                var t = this.data.getInt16(this.read) << 8 ^ this.data.getInt8(this.read + 2);
                return this.read += 3, t
            }, util.DataBuffer.prototype.getInt32 = function () {
                var t = this.data.getInt32(this.read);
                return this.read += 4, t
            }, util.DataBuffer.prototype.getInt16Le = function () {
                var t = this.data.getInt16(this.read, true);
                return this.read += 2, t
            }, util.DataBuffer.prototype.getInt24Le = function () {
                var t = this.data.getInt8(this.read) ^ this.data.getInt16(this.read + 1, true) << 8;
                return this.read += 3, t
            }, util.DataBuffer.prototype.getInt32Le = function () {
                var t = this.data.getInt32(this.read, true);
                return this.read += 4, t
            }, util.DataBuffer.prototype.getInt = function (t) {
                s(t);
                var e = 0;
                do {
                    e = (e << 8) + this.data.getInt8(this.read++), t -= 8
                } while (t > 0);
                return e
            }, util.DataBuffer.prototype.getSignedInt = function (t) {
                var e = this.getInt(t),
                    n = 2 << t - 2;
                if (e >= n) e -= n << 1;
                return e
            }, util.DataBuffer.prototype.getBytes = function (t) {
                var e;
                if (t) t = Math.min(this.length(), t), e = this.data.slice(this.read, this.read + t), this.read += t;
                else if (0 === t) e = "";
                else e = 0 === this.read ? this.data : this.data.slice(this.read), this.clear();
                return e
            }, util.DataBuffer.prototype.bytes = function (t) {
                return void 0 === t ? this.data.slice(this.read) : this.data.slice(this.read, this.read + t)
            }, util.DataBuffer.prototype.at = function (t) {
                return this.data.getUint8(this.read + t)
            }, util.DataBuffer.prototype.setAt = function (t, e) {
                return this.data.setUint8(t, e), this
            }, util.DataBuffer.prototype.last = function () {
                return this.data.getUint8(this.write - 1)
            }, util.DataBuffer.prototype.copy = function () {
                return new util.DataBuffer(this)
            }, util.DataBuffer.prototype.compact = function () {
                if (this.read > 0) {
                    var t = new Uint8Array(this.data.buffer, this.read),
                        e = new Uint8Array(t.byteLength);
                    e.set(t), this.data = new DataView(e), this.write -= this.read, this.read = 0
                }
                return this
            }, util.DataBuffer.prototype.clear = function () {
                return this.data = new DataView(new ArrayBuffer(0)), this.read = this.write = 0, this
            }, util.DataBuffer.prototype.truncate = function (t) {
                return this.write = Math.max(0, this.length() - t), this.read = Math.min(this.read, this.write), this
            }, util.DataBuffer.prototype.toHex = function () {
                for (var t = "", e = this.read; e < this.data.byteLength; ++e) {
                    var n = this.data.getUint8(e);
                    if (n < 16) t += "0";
                    t += n.toString(16)
                }
                return t
            }, util.DataBuffer.prototype.toString = function (t) {
                var view = new Uint8Array(this.data, this.read, this.length());
                if ("binary" === (t = t || "utf8") || "raw" === t) return util.binary.raw.encode(view);
                if ("hex" === t) return util.binary.hex.encode(view);
                if ("base64" === t) return util.binary.base64.encode(view);
                if ("utf8" === t) return util.text.utf8.decode(view);
                if ("utf16" === t) return util.text.utf16.decode(view);
                throw new Error("Invalid encoding: " + t)
            }, util.createBuffer = function (input, t) {
                if (t = t || "raw", void 0 !== input && "utf8" === t) input = util.encodeUtf8(input);
                return new util.ByteBuffer(input)
            }, util.fillString = function (t, e) {
                for (var n = ""; e > 0;) {
                    if (1 & e) n += t;
                    if ((e >>>= 1) > 0) t += t
                }
                return n
            }, util.xorBytes = function (t, e, n) {
                for (var i = "", o = "", a = "", s = 0, u = 0; n > 0; --n, ++s) {
                    if (o = t.charCodeAt(s) ^ e.charCodeAt(s), u >= 10) i += a, a = "", u = 0;
                    a += String.fromCharCode(o), ++u
                }
                return i += a
            }, util.hexToBytes = function (t) {
                var e = "",
                    n = 0;
                if (t.length & 1 == 1) n = 1, e += String.fromCharCode(parseInt(t[0], 16));
                for (; n < t.length; n += 2) e += String.fromCharCode(parseInt(t.substr(n, 2), 16));
                return e
            }, util.bytesToHex = function (t) {
                return util.createBuffer(t).toHex()
            }, util.int32ToBytes = function (t) {
                return String.fromCharCode(t >> 24 & 255) + String.fromCharCode(t >> 16 & 255) + String.fromCharCode(t >> 8 & 255) + String.fromCharCode(255 & t)
            };
            var p = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/=",
                m = [62, -1, -1, -1, 63, 52, 53, 54, 55, 56, 57, 58, 59, 60, 61, -1, -1, -1, 64, -1, -1, -1, 0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, -1, -1, -1, -1, -1, -1, 26, 27, 28, 29, 30, 31, 32, 33, 34, 35, 36, 37, 38, 39, 40, 41, 42, 43, 44, 45, 46, 47, 48, 49, 50, 51],
                g = "123456789ABCDEFGHJKLMNPQRSTUVWXYZabcdefghijkmnopqrstuvwxyz";
            util.encode64 = function (input, t) {
                for (var line = "", e = "", n, i, o, a = 0; a < input.length;) {
                    if (n = input.charCodeAt(a++), i = input.charCodeAt(a++), o = input.charCodeAt(a++), line += p.charAt(n >> 2), line += p.charAt((3 & n) << 4 | i >> 4), isNaN(i)) line += "==";
                    else line += p.charAt((15 & i) << 2 | o >> 6), line += isNaN(o) ? "=" : p.charAt(63 & o);
                    if (t && line.length > t) e += line.substr(0, t) + "\r\n", line = line.substr(t)
                }
                return e += line
            }, util.decode64 = function (input) {
                input = input.replace(/[^A-Za-z0-9\+\/\=]/g, "");
                for (var t = "", e, n, i, o, a = 0; a < input.length;)
                    if (e = m[input.charCodeAt(a++) - 43], n = m[input.charCodeAt(a++) - 43], i = m[input.charCodeAt(a++) - 43], o = m[input.charCodeAt(a++) - 43], t += String.fromCharCode(e << 2 | n >> 4), 64 !== i)
                        if (t += String.fromCharCode((15 & n) << 4 | i >> 2), 64 !== o) t += String.fromCharCode((3 & i) << 6 | o);
                return t
            }, util.encodeUtf8 = function (t) {
                return unescape(encodeURIComponent(t))
            }, util.decodeUtf8 = function (t) {
                return decodeURIComponent(escape(t))
            }, util.binary = {
                raw: {},
                hex: {},
                base64: {},
                base58: {},
                baseN: {
                    encode: f.encode,
                    decode: f.decode
                }
            }, util.binary.raw.encode = function (t) {
                return String.fromCharCode.apply(null, t)
            }, util.binary.raw.decode = function (t, e, n) {
                var i = e;
                if (!i) i = new Uint8Array(t.length);
                for (var o = n = n || 0, a = 0; a < t.length; ++a) i[o++] = t.charCodeAt(a);
                return e ? o - n : i
            }, util.binary.hex.encode = util.bytesToHex, util.binary.hex.decode = function (t, e, n) {
                var i = e;
                if (!i) i = new Uint8Array(Math.ceil(t.length / 2));
                var o = 0,
                    a = n = n || 0;
                if (1 & t.length) o = 1, i[a++] = parseInt(t[0], 16);
                for (; o < t.length; o += 2) i[a++] = parseInt(t.substr(o, 2), 16);
                return e ? a - n : i
            }, util.binary.base64.encode = function (input, t) {
                for (var line = "", e = "", n, i, o, a = 0; a < input.byteLength;) {
                    if (n = input[a++], i = input[a++], o = input[a++], line += p.charAt(n >> 2), line += p.charAt((3 & n) << 4 | i >> 4), isNaN(i)) line += "==";
                    else line += p.charAt((15 & i) << 2 | o >> 6), line += isNaN(o) ? "=" : p.charAt(63 & o);
                    if (t && line.length > t) e += line.substr(0, t) + "\r\n", line = line.substr(t)
                }
                return e += line
            }, util.binary.base64.decode = function (input, t, e) {
                var n = t,
                    i, o, a, s;
                if (!n) n = new Uint8Array(3 * Math.ceil(input.length / 4));
                input = input.replace(/[^A-Za-z0-9\+\/\=]/g, "");
                for (var u = 0, l = e = e || 0; u < input.length;)
                    if (i = m[input.charCodeAt(u++) - 43], o = m[input.charCodeAt(u++) - 43], a = m[input.charCodeAt(u++) - 43], s = m[input.charCodeAt(u++) - 43], n[l++] = i << 2 | o >> 4, 64 !== a)
                        if (n[l++] = (15 & o) << 4 | a >> 2, 64 !== s) n[l++] = (3 & a) << 6 | s;
                return t ? l - e : n.subarray(0, l)
            }, util.binary.base58.encode = function (input, t) {
                return util.binary.baseN.encode(input, g, t)
            }, util.binary.base58.decode = function (input, t) {
                return util.binary.baseN.decode(input, g, t)
            }, util.text = {
                utf8: {},
                utf16: {}
            }, util.text.utf8.encode = function (t, e, n) {
                t = util.encodeUtf8(t);
                var i = e;
                if (!i) i = new Uint8Array(t.length);
                for (var o = n = n || 0, a = 0; a < t.length; ++a) i[o++] = t.charCodeAt(a);
                return e ? o - n : i
            }, util.text.utf8.decode = function (t) {
                return util.decodeUtf8(String.fromCharCode.apply(null, t))
            }, util.text.utf16.encode = function (t, e, n) {
                var i = e;
                if (!i) i = new Uint8Array(2 * t.length);
                for (var view = new Uint16Array(i.buffer), o = n = n || 0, a = n, s = 0; s < t.length; ++s) view[a++] = t.charCodeAt(s), o += 2;
                return e ? o - n : i
            }, util.text.utf16.decode = function (t) {
                return String.fromCharCode.apply(null, new Uint16Array(t.buffer))
            }, util.deflate = function (t, e, n) {
                if (e = util.decode64(t.deflate(util.encode64(e)).rval), n) {
                    var i = 2,
                        o;
                    if (32 & e.charCodeAt(1)) i = 6;
                    e = e.substring(i, e.length - 4)
                }
                return e
            }, util.inflate = function (t, e, n) {
                var i = t.inflate(util.encode64(e)).rval;
                return null === i ? null : util.decode64(i)
            };
            var v = function (t, id, e) {
                    if (!t) throw new Error("WebStorage not available.");
                    var n;
                    if (null === e) n = t.removeItem(id);
                    else e = util.encode64(JSON.stringify(e)), n = t.setItem(id, e);
                    if (void 0 !== n && true !== n.rval) {
                        var i = new Error(n.error.message);
                        throw i.id = n.error.id, i.name = n.error.name, i
                    }
                },
                y = function (t, id) {
                    if (!t) throw new Error("WebStorage not available.");
                    var e = t.getItem(id);
                    if (t.init)
                        if (null === e.rval) {
                            if (e.error) {
                                var n = new Error(e.error.message);
                                throw n.id = e.error.id, n.name = e.error.name, n
                            }
                            e = null
                        } else e = e.rval;
                    if (null !== e) e = JSON.parse(util.decode64(e));
                    return e
                },
                w = function (t, id, e, data) {
                    var n = y(t, id);
                    if (null === n) n = {};
                    n[e] = data, v(t, id, n)
                },
                b = function (t, id, e) {
                    var n = y(t, id);
                    if (null !== n) n = e in n ? n[e] : null;
                    return n
                },
                C = function (t, id, e) {
                    var n = y(t, id);
                    if (null !== n && e in n) {
                        delete n[e];
                        var empty = true;
                        for (var i in n) {
                            empty = false;
                            break
                        }
                        if (empty) n = null;
                        v(t, id, n)
                    }
                },
                S = function (t, id) {
                    v(t, id, null)
                },
                x = function (t, e, n) {
                    var i = null,
                        type;
                    if (void 0 === n) n = ["web", "flash"];
                    var o = false,
                        a = null;
                    for (var s in n) {
                        type = n[s];
                        try {
                            if ("flash" === type || "both" === type) {
                                if (null === e[0]) throw new Error("Flash local storage not available.");
                                i = t.apply(this, e), o = "flash" === type
                            }
                            if ("web" === type || "both" === type) e[0] = localStorage, i = t.apply(this, e), o = true
                        } catch (t) {
                            a = t
                        }
                        if (o) break
                    }
                    if (!o) throw a;
                    return i
                };
            util.setItem = function (t, id, e, data, n) {
                x(w, arguments, n)
            }, util.getItem = function (t, id, e, n) {
                return x(b, arguments, n)
            }, util.removeItem = function (t, id, e, n) {
                x(C, arguments, n)
            }, util.clearItems = function (t, id, e) {
                x(S, arguments, e)
            }, util.isEmpty = function (t) {
                for (var e in t)
                    if (t.hasOwnProperty(e)) return false;
                return true
            }, util.format = function (format) {
                for (var t = /%./g, e, n, i = 0, o = [], a = 0; e = t.exec(format);) {
                    if ((n = format.substring(a, t.lastIndex - 2)).length > 0) o.push(n);
                    a = t.lastIndex;
                    var s = e[0][1];
                    switch (s) {
                        case "s":
                        case "o":
                            if (i < arguments.length) o.push(arguments[i++ + 1]);
                            else o.push("<?>");
                            break;
                        case "%":
                            o.push("%");
                            break;
                        default:
                            o.push("<%" + s + "?>")
                    }
                }
                return o.push(format.substring(a)), o.join("")
            }, util.formatNumber = function (t, e, n, i) {
                var o = t,
                    a = isNaN(e = Math.abs(e)) ? 2 : e,
                    d = void 0 === n ? "," : n,
                    s = void 0 === i ? "." : i,
                    u = o < 0 ? "-" : "",
                    l = parseInt(o = Math.abs(+o || 0).toFixed(a), 10) + "",
                    c = l.length > 3 ? l.length % 3 : 0;
                return u + (c ? l.substr(0, c) + s : "") + l.substr(c).replace(/(\d{3})(?=\d)/g, "$1" + s) + (a ? d + Math.abs(o - l).toFixed(a).slice(2) : "")
            }, util.formatSize = function (size) {
                if (size >= 1073741824) size = util.formatNumber(size / 1073741824, 2, ".", "") + " GiB";
                else if (size >= 1048576) size = util.formatNumber(size / 1048576, 2, ".", "") + " MiB";
                else if (size >= 1024) size = util.formatNumber(size / 1024, 0) + " KiB";
                else size = util.formatNumber(size, 0) + " bytes";
                return size
            }, util.bytesFromIP = function (t) {
                if (-1 !== t.indexOf(".")) return util.bytesFromIPv4(t);
                if (-1 !== t.indexOf(":")) return util.bytesFromIPv6(t);
                else return null
            }, util.bytesFromIPv4 = function (t) {
                if (4 !== (t = t.split(".")).length) return null;
                for (var e = util.createBuffer(), n = 0; n < t.length; ++n) {
                    var i = parseInt(t[n], 10);
                    if (isNaN(i)) return null;
                    e.putByte(i)
                }
                return e.getBytes()
            }, util.bytesFromIPv6 = function (t) {
                for (var e = 0, n = 2 * (8 - (t = t.split(":").filter((function (t) {
                        if (0 === t.length) ++e;
                        return true
                    }))).length + e), i = util.createBuffer(), o = 0; o < 8; ++o)
                    if (t[o] && 0 !== t[o].length) {
                        var a = util.hexToBytes(t[o]);
                        if (a.length < 2) i.putByte(0);
                        i.putBytes(a)
                    } else i.fillWithByte(0, n), n = 0;
                return i.getBytes()
            }, util.bytesToIP = function (t) {
                if (4 === t.length) return util.bytesToIPv4(t);
                if (16 === t.length) return util.bytesToIPv6(t);
                else return null
            }, util.bytesToIPv4 = function (t) {
                if (4 !== t.length) return null;
                for (var e = [], n = 0; n < t.length; ++n) e.push(t.charCodeAt(n));
                return e.join(".")
            }, util.bytesToIPv6 = function (t) {
                if (16 !== t.length) return null;
                for (var e = [], n = [], i = 0, o = 0; o < t.length; o += 2) {
                    for (var a = util.bytesToHex(t[o] + t[o + 1]);
                        "0" === a[0] && "0" !== a;) a = a.substr(1);
                    if ("0" === a) {
                        var s = n[n.length - 1],
                            u = e.length;
                        if (!s || u !== s.end + 1) n.push({
                            start: u,
                            end: u
                        });
                        else if (s.end = u, s.end - s.start > n[i].end - n[i].start) i = n.length - 1
                    }
                    e.push(a)
                }
                if (n.length > 0) {
                    var group = n[i];
                    if (group.end - group.start > 0) {
                        if (e.splice(group.start, group.end - group.start + 1, ""), 0 === group.start) e.unshift("");
                        if (7 === group.end) e.push("")
                    }
                }
                return e.join(":")
            }, util.estimateCores = function (t, e) {
                function n(t, a, s) {
                    if (0 === a) {
                        var u = Math.floor(t.reduce((function (t, e) {
                            return t + e
                        }), 0) / t.length);
                        return util.cores = Math.max(1, u), URL.revokeObjectURL(o), e(null, util.cores)
                    }
                    map(s, (function (e, o) {
                        t.push(i(s, o)), n(t, a - 1, s)
                    }))
                }

                function map(t, e) {
                    for (var n = [], i = [], a = 0; a < t; ++a) {
                        var worker = new Worker(o);
                        worker.addEventListener("message", (function (o) {
                            if (i.push(o.data), i.length === t) {
                                for (var a = 0; a < t; ++a) n[a].terminate();
                                e(null, i)
                            }
                        })), n.push(worker)
                    }
                    for (var a = 0; a < t; ++a) n[a].postMessage(a)
                }

                function i(t, e) {
                    for (var n = [], i = 0; i < t; ++i)
                        for (var o = e[i], overlap = n[i] = [], a = 0; a < t; ++a)
                            if (i !== a) {
                                var s = e[a];
                                if (o.st > s.st && o.st < s.et || s.st > o.st && s.st < o.et) overlap.push(a)
                            } return n.reduce((function (t, overlap) {
                        return Math.max(t, overlap.length)
                    }), 0)
                }
                if ("function" == typeof t) e = t, t = {};
                if (t = t || {}, "cores" in util && !t.update) return e(null, util.cores);
                if ("undefined" != typeof navigator && "hardwareConcurrency" in navigator && navigator.hardwareConcurrency > 0) return util.cores = navigator.hardwareConcurrency, e(null, util.cores);
                if ("undefined" == typeof Worker) return util.cores = 1, e(null, util.cores);
                if ("undefined" == typeof Blob) return util.cores = 2, e(null, util.cores);
                var o = URL.createObjectURL(new Blob(["(", function () {
                    self.addEventListener("message", (function (t) {
                        for (var e = Date.now(), et = e + 4; Date.now() < et;);
                        self.postMessage({
                            st: e,
                            et: et
                        })
                    }))
                }.toString(), ")()"], {
                    type: "application/javascript"
                }));
                n([], 5, 16)
            }
        }).call(e, n(112), n(255).setImmediate, n(58), n(60).Buffer)
    },
    255: function (t, e, n) {
        "use strict";
        (function (t) {
            function i(id, t) {
                this._id = id, this._clearFn = t
            }
            var o = void 0 !== t && t || "undefined" != typeof self && self || window,
                a = Function.prototype.apply;
            e.setTimeout = function () {
                return new i(a.call(setTimeout, o, arguments), clearTimeout)
            }, e.setInterval = function () {
                return new i(a.call(setInterval, o, arguments), clearInterval)
            }, e.clearTimeout = e.clearInterval = function (t) {
                if (t) t.close()
            }, i.prototype.unref = i.prototype.ref = function () {}, i.prototype.close = function () {
                this._clearFn.call(o, this._id)
            }, e.enroll = function (t, e) {
                clearTimeout(t._idleTimeoutId), t._idleTimeout = e
            }, e.unenroll = function (t) {
                clearTimeout(t._idleTimeoutId), t._idleTimeout = -1
            }, e._unrefActive = e.active = function (t) {
                clearTimeout(t._idleTimeoutId);
                var e = t._idleTimeout;
                if (e >= 0) t._idleTimeoutId = setTimeout((function e() {
                    if (t._onTimeout) t._onTimeout()
                }), e)
            }, n(535), e.setImmediate = "undefined" != typeof self && self.setImmediate || void 0 !== t && t.setImmediate || this && this.setImmediate, e.clearImmediate = "undefined" != typeof self && self.clearImmediate || void 0 !== t && t.clearImmediate || this && this.clearImmediate
        }).call(e, n(58))
    },
    257: function (t, e, n) {
        "use strict";

        function i() {
            u = String.fromCharCode(128), u += a.util.fillString(String.fromCharCode(0), 64), c = [1116352408, 1899447441, 3049323471, 3921009573, 961987163, 1508970993, 2453635748, 2870763221, 3624381080, 310598401, 607225278, 1426881987, 1925078388, 2162078206, 2614888103, 3248222580, 3835390401, 4022224774, 264347078, 604807628, 770255983, 1249150122, 1555081692, 1996064986, 2554220882, 2821834349, 2952996808, 3210313671, 3336571891, 3584528711, 113926993, 338241895, 666307205, 773529912, 1294757372, 1396182291, 1695183700, 1986661051, 2177026350, 2456956037, 2730485921, 2820302411, 3259730800, 3345764771, 3516065817, 3600352804, 4094571909, 275423344, 430227734, 506948616, 659060556, 883997877, 958139571, 1322822218, 1537002063, 1747873779, 1955562222, 2024104815, 2227730452, 2361852424, 2428436474, 2756734187, 3204031479, 3329325298], l = true
        }

        function o(t, e, n) {
            for (var i, o, a, s, u, l, f, h, p, m, d, g, v, y, w, b = n.length(); b >= 64;) {
                for (f = 0; f < 16; ++f) e[f] = n.getInt32();
                for (; f < 64; ++f) i = ((i = e[f - 2]) >>> 17 | i << 15) ^ (i >>> 19 | i << 13) ^ i >>> 10, o = ((o = e[f - 15]) >>> 7 | o << 25) ^ (o >>> 18 | o << 14) ^ o >>> 3, e[f] = i + e[f - 7] + o + e[f - 16] | 0;
                for (h = t.h0, p = t.h1, m = t.h2, d = t.h3, g = t.h4, v = t.h5, y = t.h6, w = t.h7, f = 0; f < 64; ++f) a = (h >>> 2 | h << 30) ^ (h >>> 13 | h << 19) ^ (h >>> 22 | h << 10), l = h & p | m & (h ^ p), i = w + (s = (g >>> 6 | g << 26) ^ (g >>> 11 | g << 21) ^ (g >>> 25 | g << 7)) + (u = y ^ g & (v ^ y)) + c[f] + e[f], w = y, y = v, v = g, g = d + i >>> 0, d = m, m = p, p = h, h = i + (o = a + l) >>> 0;
                t.h0 = t.h0 + h | 0, t.h1 = t.h1 + p | 0, t.h2 = t.h2 + m | 0, t.h3 = t.h3 + d | 0, t.h4 = t.h4 + g | 0, t.h5 = t.h5 + v | 0, t.h6 = t.h6 + y | 0, t.h7 = t.h7 + w | 0, b -= 64
            }
        }
        var a = n(19);
        n(87), n(22);
        var s = t.exports = a.sha256 = a.sha256 || {};
        a.md.sha256 = a.md.algorithms.sha256 = s, s.create = function () {
            if (!l) i();
            var t = null,
                e = a.util.createBuffer(),
                n = new Array(64),
                s = {
                    algorithm: "sha256",
                    blockLength: 64,
                    digestLength: 32,
                    messageLength: 0,
                    fullMessageLength: null,
                    messageLengthSize: 8,
                    start: function () {
                        s.messageLength = 0, s.fullMessageLength = s.messageLength64 = [];
                        for (var n = s.messageLengthSize / 4, i = 0; i < n; ++i) s.fullMessageLength.push(0);
                        return e = a.util.createBuffer(), t = {
                            h0: 1779033703,
                            h1: 3144134277,
                            h2: 1013904242,
                            h3: 2773480762,
                            h4: 1359893119,
                            h5: 2600822924,
                            h6: 528734635,
                            h7: 1541459225
                        }, s
                    }
                };
            return s.start(), s.update = function (i, u) {
                if ("utf8" === u) i = a.util.encodeUtf8(i);
                var l = i.length;
                s.messageLength += l, l = [l / 4294967296 >>> 0, l >>> 0];
                for (var c = s.fullMessageLength.length - 1; c >= 0; --c) s.fullMessageLength[c] += l[1], l[1] = l[0] + (s.fullMessageLength[c] / 4294967296 >>> 0), s.fullMessageLength[c] = s.fullMessageLength[c] >>> 0, l[0] = l[1] / 4294967296 >>> 0;
                if (e.putBytes(i), o(t, n, e), e.read > 2048 || 0 === e.length()) e.compact();
                return s
            }, s.digest = function () {
                var i = a.util.createBuffer();
                i.putBytes(e.bytes());
                var l, c = s.fullMessageLength[s.fullMessageLength.length - 1] + s.messageLengthSize & s.blockLength - 1,
                    f, h;
                i.putBytes(u.substr(0, s.blockLength - c));
                for (var p = 8 * s.fullMessageLength[0], m = 0; m < s.fullMessageLength.length - 1; ++m) p += h = (f = 8 * s.fullMessageLength[m + 1]) / 4294967296 >>> 0, i.putInt32(p >>> 0), p = f >>> 0;
                i.putInt32(p);
                var g = {
                    h0: t.h0,
                    h1: t.h1,
                    h2: t.h2,
                    h3: t.h3,
                    h4: t.h4,
                    h5: t.h5,
                    h6: t.h6,
                    h7: t.h7
                };
                o(g, n, i);
                var v = a.util.createBuffer();
                return v.putInt32(g.h0), v.putInt32(g.h1), v.putInt32(g.h2), v.putInt32(g.h3), v.putInt32(g.h4), v.putInt32(g.h5), v.putInt32(g.h6), v.putInt32(g.h7), v
            }, s
        };
        var u = null,
            l = false,
            c = null
    },
    267: function (t, e, n) {
        "use strict";

        function i() {
            this.hint = null, this.animations = []
        }
        t.exports = i;
        var o = null;
        i.instance = function instance() {
            if (!o) o = new i;
            return o
        }, i.prototype.createAnimation = function t(e) {
            for (var n = 0; n < this.animations.length; n++)
                if (this.animations[n].isMatch(e)) return this.animations[n].create(e, this.hint);
            return null
        }, i.prototype.setHint = function t(e) {
            this.hint = e
        }, i.prototype.registerAnimation = function (animation) {
            this.animations.push(animation)
        }, window.AnimationFactory = i
    },
    268: function (t, e, n) {
        "use strict";

        function i(t, e) {
            if (!t) throw new Error("animationInfo is null or undefined");
            if (this.info = t, this.hint = e, this.animatedClass = ["animated"], this.animatedOnceClass = ["animated-once"], this.backstageClass = ["backstage"], this.animationInClass = this.getAnimationClass(), this.isInOutAnimation()) this.animationOutClass = this.getAnimationOutClass();
            this._reqestId = null, this._timeoutId = null, this._animationInTimeoutId = null, this._handleAnimationEnd = this._handleAnimationEnd.bind(this), this._playing = null, this._playNext = null, this._playNextDuration = null
        }

        function o(t) {
            if (!t) return null;
            if (t < l) t = l;
            return t + "ms"
        }

        function a(t, e) {
            if (e = o(e)) t.style["animation-duration"] = e
        }

        function s(t) {
            switch (t) {
                case "Down":
                    return "Up";
                case "Up":
                    return "Down";
                default:
                    return t
            }
        }
        var u = n(368);
        t.exports = i;
        var l = 100,
            c = 500,
            f = "In",
            h = "Out";
        i.isMatch = function () {
            return true
        }, i.create = function (t, e) {
            return new i(t, e)
        }, i.prototype._handleAnimationEnd = function t(e) {
            if (e.target === this.info.element) {
                if (this._playing = null, this.info.element.classList.contains(this.animationInClass)) this.info.element.classList.remove(this.animationInClass), this.info.element.classList.add(this.animationInClass + "-played");
                else this.info.element.classList.remove(this.animationInClass + "-played");
                if (this._playNext) {
                    var n = this._playNext,
                        i = this._playNextDuration;
                    this._playNext = null, this._playNextDuration = null, this._play(n, i)
                }
            }
        }, i.prototype.subscribe = function t() {
            this.info.element.addEventListener("animationend", this._handleAnimationEnd)
        }, i.prototype.unsubscribe = function t() {
            this.info.element.removeEventListener("animationend", this._handleAnimationEnd)
        }, i.prototype.init = function init() {
            if (this.hint) this.hint.hintBrowser(this.info);
            this.subscribe(), this.reset()
        }, i.prototype.clear = function t() {
            if (this.info) {
                if (this.backstageClass) this.info.element.classList.remove.apply(this.info.element.classList, this.backstageClass);
                if (this.animatedClass) this.info.element.classList.remove.apply(this.info.element.classList, this.animatedClass), this.info.element.classList.add.apply(this.info.element.classList, this.animatedOnceClass);
                if (this.animationInClass) this.info.element.classList.remove(this.animationInClass);
                if (this.animationOutClass) this.info.element.classList.remove(this.animationOutClass);
                if (this.info.element.style["animation-duration"] = "", this.hint) this.hint.removeHint(this.info);
                if (this._animationInTimeoutId) clearTimeout(this._animationInTimeoutId), this._animationInTimeoutId = null;
                this._playing = null, this._playNext = null, this.unsubscribe()
            }
        }, i.prototype.requestAnimationFrame = function t(e) {
            return u.requestAnimationFrame(e)
        }, i.prototype.cancelAnimationFrame = function t(id) {
            if (window.cancelAnimationFrame) return window.cancelAnimationFrame(id), void 0;
            if (window.mozCancelAnimationFrame) window.mozCancelAnimationFrame(id)
        }, i.prototype.getAnimationClass = function t() {
            if (!this.info) return null;
            var e = this.info.name;
            if (this.info.direction) e += this.info.direction;
            return e
        }, i.prototype.getAnimationOutClass = function t() {
            if (!this.info) return null;
            var e = this.info.name;
            if (this.isInOutAnimation()) e = e.slice(0, 0 - f.length) + h;
            if (this.info.direction) e += s(this.info.direction);
            return e
        }, i.prototype.isInOutAnimation = function t() {
            if (!this.info || !this.info.name || !this.info.animationOut) return false;
            else return this.info.name.indexOf(f) + f.length === this.info.name.length
        }, i.prototype.start = function t() {
            if (this.info) {
                var e = this.info.delay,
                    n = function () {
                        this._animationInTimeoutId = null, this._play(this.animationInClass, this.info.duration)
                    }.bind(this);
                if (this._animationInTimeoutId) clearTimeout(this._animationInTimeoutId);
                if (!e) return n(), void 0;
                this._animationInTimeoutId = setTimeout(n, e)
            }
        }, i.prototype.startOut = function t() {
            if (this.info)
                if (this.animationOutClass)
                    if (this._animationInTimeoutId) return clearInterval(this._animationInTimeoutId), this._animationInTimeoutId = null, void 0;
                    else return this._play(this.animationOutClass, c), void 0
        }, i.prototype._play = function t(animation, e) {
            if (!animation) animation = this.animationInClass;
            if (e) a(this.info.element, e);
            if (this._playing === animation) return this._playNext = null, void 0;
            if (this._playing) return this._playNext = animation, this._playNextDuration = e, void 0;
            if (this._playing = animation, this._reqestId) this.cancelAnimationFrame(this._reqestId);
            this._reqestId = this.requestAnimationFrame(function () {
                if (this._reqestId = null, this.backstageClass) this.info.element.classList.remove.apply(this.info.element.classList, this.backstageClass);
                if (this.animationOutClass) this.info.element.classList.remove(this.animationOutClass);
                if (this.animationInClass) this.info.element.classList.remove(this.animationInClass);
                if (animation) this.info.element.classList.add(animation)
            }.bind(this))
        }, i.prototype.reset = function t() {
            if (this.info) {
                var e = this.info.duration;
                if (a(this.info.element, e), this._playing = null, this._playNext = null, this.backstageClass) this.info.element.classList.add.apply(this.info.element.classList, this.backstageClass);
                if (this.animatedClass) this.info.element.classList.add.apply(this.info.element.classList, this.animatedClass)
            }
        }, i.prototype.needOutAnimation = function t() {
            if (!this.isInOutAnimation()) return false;
            if (this._animationInTimeoutId) return true;
            else return (this.info.element.classList.contains(this.animationInClass) || this.info.element.classList.contains(this.animationInClass + "-played")) && !this.info.element.classList.contains(this.backstageClass[0])
        }, i.prototype.getTime = function t() {
            if (!this.info) return 0;
            var e = this.info.duration,
                n = this.info.delay;
            if (isNaN(n)) n = 0;
            return n + e
        }, i.prototype.getOutTime = function t() {
            if (!this.info || !this.isInOutAnimation()) return 0;
            else return c
        }
    },
    269: function (t, e, n) {
        "use strict";

        function CountdownUpdater(t) {
            this.$dom = t, this.countdownCommon = new CountdownCommon(t)
        }
        t.exports = CountdownUpdater;
        var CountdownCommon = n(52);
        CountdownUpdater.prototype.startUpdate = function (t) {
            var e = this.getUpdateTimeout();
            if (e) this.update(t, true), setInterval(this.update.bind(this), e, t)
        }, CountdownUpdater.prototype.getUpdateTimeout = function () {
            if (this.countdownCommon.getAfterCountFinished()) return 0;
            var countdownType = this.countdownCommon.getType();
            if ("to-date" === countdownType || "to-time" === countdownType) return 350;
            if ("to-number" === countdownType) {
                var t = this.countdownCommon.getFrequency(),
                    e = CountdownCommon.timeStringToMilliseconds(t);
                return e = Math.max(e, 0), e = Math.min(e, 350)
            }
            return 0
        }, CountdownUpdater.prototype.getAnimationProps = function (t, e) {
            if (e) return {
                animation: "none"
            };
            else return {
                animation: "runtime" === t && this.countdownCommon.getCountAnimation() || "none",
                animationSpeed: this.getUpdateTimeout()
            }
        }, CountdownUpdater.prototype.update = function (t, e) {
            if (!this.countdownCommon.getAfterCountFinished()) {
                var countdownType = this.countdownCommon.getType();
                if ("to-date" === countdownType || "to-time" === countdownType) this.updateDateAndTime(t, e);
                if ("to-number" === countdownType) this.updateNumber(t, e)
            }
        }, CountdownUpdater.prototype.updateDateAndTime = function (t, e) {
            var n = this.countdownCommon.getDate(),
                diff = this.getTimeDiff(n);
            if (!this.afterCount(diff, t)) {
                var props = this.getAnimationProps(t, e);
                this.countdownCommon.setValue("years", diff.years, false, props), this.countdownCommon.setValue("days", diff.days, false, props), this.countdownCommon.setValue("hours", diff.hours, false, props), this.countdownCommon.setValue("minutes", diff.minutes, false, props), this.countdownCommon.setValue("seconds", diff.seconds, false, props), this.countdownCommon.showLabel("years", !!diff.years), this.countdownCommon.showLabel("days", !!diff.days)
            }
        }, CountdownUpdater.prototype.updateNumber = function (t, e) {
            var n = this.countdownCommon.getNumber(),
                i = this.countdownCommon.getStartTime(),
                o = this.countdownCommon.getFrequency(),
                diff = this.countdownCommon.calcNumber(n, i, o);
            if ("per-visitor" === this.countdownCommon.getFor()) {
                var a = this.countdownCommon.getTimerId();
                i = this.getStartDate(a), diff = this.countdownCommon.calcNumber(n, i, o)
            }
            if (!this.afterCount(diff, t)) {
                var props = this.getAnimationProps(t, e);
                this.countdownCommon.setValue("numbers", diff, false, props)
            }
        }, CountdownUpdater.prototype.getTimeDiff = function (t) {
            if ("everyone" === this.countdownCommon.getFor()) return this.countdownCommon.timeDiff(t);
            var e = this.getStartDate(),
                n = this.countdownCommon.getTimeLeft();
            return t = this.countdownCommon.parseTime(n, e), this.countdownCommon.timeDiff(t)
        }, CountdownUpdater.prototype.getStartDate = function () {
            var t = this.countdownCommon.getTimerKey(),
                e = localStorage.getItem(t);
            if (e) return new Date(e);
            var n = new Date;
            return localStorage.setItem(t, n.toUTCString()), n
        }, CountdownUpdater.prototype.afterCount = function (diff, t) {
            var e = this.countdownCommon.getDirection(),
                n = this.countdownCommon.getAfterCount();
            if (t = t || "", "none" !== n && "down" === e && CountdownCommon.isEmptyDiff(diff)) {
                if ("message" === n) this.showMessage();
                if ("redirect" === n)
                    if (this.$dom.find(".u-countdown-message").text("Redirecting..."), this.showMessage(), "preview" !== t) {
                        var i = this.countdownCommon.getRedirectUrl();
                        window.location.href = i
                    } if ("preview" !== t) this.countdownCommon.setAfterCountFinished();
                return true
            }
            return false
        }, CountdownUpdater.prototype.showMessage = function () {
            if (this.$dom.find(".u-countdown-message").is(".u-hidden")) this.$dom.find(".u-countdown-wrapper").addClass("u-invisible"), this.$dom.find(".u-countdown-message").removeClass("u-hidden")
        }, CountdownUpdater.prototype.hideMessage = function () {
            if (this.$dom.find(".u-countdown-message").not(".u-hidden")) this.$dom.find(".u-countdown-wrapper").removeClass("u-invisible"), this.$dom.find(".u-countdown-message").addClass("u-hidden")
        }, CountdownUpdater.findAll = function () {
            return $(".u-countdown")
        }
    },
    270: function (t, e, n) {
        "use strict";

        function TabsControl(t) {
            this.tabsSelector = ".u-tabs", this.activeClass = "u-tab-active", this.activeSelector = "." + this.activeClass, this.activeLinkClass = "active", this.activeLinkSelector = "." + this.activeLinkClass, this.tabListSelector = ".u-tab-list", this.tabContentSelector = ".u-tab-content", this.tabLinkSelector = ".u-tab-link", this.tabPaneSelector = ".u-tab-pane", this._tabLink = this._getLink(t), this._tabList = this._tabLink.closest(this.tabListSelector), this._tabContent = this._tabLink.closest(this.tabsSelector).children(this.tabContentSelector)
        }
        TabsControl.prototype.show = function () {
            var link = this._tabLink;
            if (!link.is(this.activeLinkSelector)) this._removeActiveLink(), this._addActiveLink(link), this._activateTabPane(link)
        }, TabsControl.prototype._getLink = function (t) {
            if (t.is(this.tabPaneSelector)) return this._findLinkByPane(t);
            else return t.is(this.tabLinkSelector) ? t : t.children(this.tabLinkSelector)
        }, TabsControl.prototype._findLinkByPane = function (pane) {
            var t = pane.attr("aria-labelledby"),
                tabList;
            return pane.closest(this.tabsSelector).children(this.tabListSelector).find("#" + t)
        }, TabsControl.prototype._removeActiveLink = function () {
            var t = this._getActiveLink();
            t.removeClass(this.activeLinkClass), t.attr("aria-selected", false), t.find("input").removeAttr("checked").prop("checked", false)
        }, TabsControl.prototype._getActiveLink = function () {
            return this._tabList.find(this.activeLinkSelector)
        }, TabsControl.prototype._addActiveLink = function (link) {
            link.addClass(this.activeLinkClass), link.attr("aria-selected", true), link.find("input").attr("checked", "").prop("checked", true)
        }, TabsControl.prototype._activateTabPane = function (link) {
            var t, e;
            this._tabContent.children(this.activeSelector).removeClass(this.activeClass), this.getTabPane(link).addClass(this.activeClass)
        }, TabsControl.prototype.getTabPane = function (t) {
            var link, e = this._getLink(t).attr("href");
            return this._tabContent.children(e)
        }, TabsControl.prototype.getTabLink = function () {
            return this._tabLink
        }, TabsControl.prototype.removeId = function () {
            this._tabList.find(this.tabLinkSelector).removeAttr("id"), this._tabContent.children().removeAttr("id")
        }, t.exports = TabsControl, window.TabsControl = TabsControl
    },
    279: function (t, e, n) {
        "use strict";

        function Dialog(t, e) {
            this._openClass = "u-dialog-open", this._dialogBlockClass = "u-dialog-block", this._dialogBlockSelector = "." + this._dialogBlockClass, this._dialog = t.closest(this._dialogBlockSelector), this._btn = e
        }

        function i(t) {
            if (!window._responsive) return false;
            var e = t.find(".u-dialog"),
                n = window._responsive.mode || "XL";
            return e.is(".u-hidden, .u-hidden-" + n.toLowerCase())
        }
        t.exports = Dialog, Dialog.prototype.open = function (t) {
            this._dialog.each(function (e, block) {
                var n = $(block);
                if (!i(n)) {
                    if (n.addClass(this._openClass), "function" == typeof t) t(n);
                    n.trigger("opened.np.dialog", [this, this._btn])
                }
            }.bind(this))
        }, Dialog.prototype.close = function () {
            this._dialog.removeClass(this._openClass), this._dialog.trigger("closed.np.dialog", [this])
        }, Dialog.prototype.getInterval = function () {
            return this._dialog.attr("data-dialog-show-interval") || 3e3
        }
    },
    282: function (t, e) {},
    3436: function (t, e, n) {
        "use strict";
        var FormMessage = t.exports = {},
            i = n(15);
        FormMessage.showSuccess = function t(form) {
            form.trigger("reset");
            var e = form.find(".u-form-send-success"),
                n = e.find(".u-form-send-message-close");
            if (!n.length) n = i('<a href="#" class="u-form-send-message-close">x</a>'), e.append(n);
            e.show(), n.one("click", (function (t) {
                t.preventDefault(), e.hide()
            })), form.find('input[type="submit"]').prop("disabled", false)
        }, FormMessage.showError = function t(form, e, n, o) {
            var a = e ? form.find(".u-form-send-error").clone() : form.find(".u-form-send-error");
            if (e) {
                if (n)
                    if (560 === n && o) e = "Unable to submit the Contact Form, as the submission email is not verified.\n" + "</br></br>" + "If you are a site administrator, please open your inbox and confirm the " + o + " email in the message. Make sure also to check your spam folder.";
                a.html(e), form.find(".u-form-send-error").parent().append(a)
            }
            var s = a.find(".u-form-send-message-close");
            if (!s.length) s = i('<a href="#" class="u-form-send-message-close">x</a>'), a.append(s);
            s.one("click", (function (t) {
                if (t.preventDefault(), a.hide(), e) a.remove()
            })), a.show(), form.find('input[type="submit"]').prop("disabled", false)
        }
    },
    3437: function (t, e, n) {
        "use strict";
        var Const = t.exports = {};
        Const.formActionUrl = ["https://forms.", "n", "i", "c", "e", "p", "a", "g", "e", "srv.com/"].join(""), Const.stripeCheckoutUrl = "https://service.nicepagesrv.com/stripe/v1/stripe-checkout", Const.emailCheckoutUrl = "https://service.nicepagesrv.com/place-email-order/v1/place-email-order"
    },
    3438: function (t, e, n) {
        "use strict";

        function i(t) {
            this.setDialog(t)
        }
        t.exports = i, i.prototype.setDialog = function (t) {
            this.$dom = t && t.find(".u-payment-services") || $()
        }, i.prototype.orderApproved = function t() {
            var e = this.$dom.attr("data-payment-order-approved-message") || "";
            this.displayMessage(e || "Your order has been approved. Thank you!", "payment-success")
        }, i.prototype.orderError = function t() {
            var e = this.$dom.attr("data-payment-order-cancelled-message") || "";
            this.displayMessage(e || "Unable to process your order. Please try again later.", "payment-error")
        }, i.prototype.stripeError = function t() {
            this.displayMessage("Unable to process your order. If you are the Site Author, please ensure your Stripe account is active and eligible to accept payments.", "payment-error")
        }, i.prototype.emailError = function t() {
            this.displayMessage("Unable to process your order.", "payment-error")
        }, i.prototype.configError = function t() {
            this.displayMessage("Invalid configuration. Please reset the Purchase button.", "payment-error")
        }, i.prototype.serviceError = function t() {
            this.displayMessage("Set the PayPal Client ID in the Payment Settings.", "payment-error")
        }, i.prototype.productError = function t() {
            this.displayMessage("Set the Title, Price, and Currency for the Product.", "payment-error")
        }, i.prototype.cartEmpty = function t() {
            this.displayNote("Cart is empty.", "cart-empty")
        }, i.prototype.productOutOfStock = function productOutOfStock(t) {
            var e = t ? "Some products out of stock.<br />Please remove these from your cart." : "";
            this.displayNote(e, "product-out-of-stock-message")
        }, i.prototype.displayNote = function t(e, n) {
            if (e) this.$dom.after('<div class="' + n + '"><p>' + e + "</p></div>");
            if (this.$dom.hide(), this.$dom.parents(".u-dialog").css("min-height", "auto"), "cart-empty" === n) this.$dom.parent().find(">:not(." + n + ")").hide()
        }, i.prototype.displayMessage = function t(e, n) {
            this.$dom.empty(), this.$dom.append('<div class="' + n + '">' + e + "</div>"), this.$dom.css("height", "")
        }, window.PaymentMessage = i
    },
    3439: function (t, e, n) {
        "use strict";

        function i(t) {
            this.$btn = t
        }

        function o(t, type) {
            var e = "desc" === type ? 250 : 127;
            return (t || "").substring(0, e)
        }
        t.exports = i, i.prototype.getProducts = function t() {
            var product = this.getProduct();
            if (!product) return null;
            else return [product]
        }, i.prototype.getProduct = function t() {
            var e = this.$btn.attr("data-product");
            if (!e) return null;
            var product = JSON.parse(e);
            if (!(product && product.title && product.price && product.currency)) return null;
            if (product.title = o(product.title), product.description = o(product.description, "desc"), product.sku = o(product.sku), product.hiddenButtons = this.$btn.attr("data-paypal-hidden-buttons") || "", !product.quantity) product.quantity = 1;
            return product
        }, window.PaymentProduct = i
    },
    3440: function (t, e, n) {
        "use strict";

        function i() {
            this.pageName = "thank-you-page"
        }
        t.exports = i, i.prototype.isThankYouPage = function t() {
            return -1 !== window.location.href.indexOf(window._npThankYouUrl || this.pageName)
        }, i.prototype.goToThankYouPage = function t() {
            window.location.href = window._npThankYouUrl || window.location.origin + "/" + this.pageName + ".html"
        }, window.PaymentThankYou = i
    },
    3441: function (t, e, n) {
        "use strict";

        function i() {
            this._result = null, this._queue = null
        }
        t.exports = i;
        var instance = null;
        i.getModel = function () {
            if (!instance) instance = new i;
            return instance
        }, i.prototype.load = function (t) {
            var e = document.body.getAttribute("data-include-products");
            if (e && /false/.test(e)) return t(null, null);
            if (this._result) return t(null, this._result);
            var n = document.body.getAttribute("data-path-to-root") || "./",
                i = window._npProductsJsonUrl;
            if (!i) i = n + "products/products.json";
            if (!this._queue) this._queue = fetch(i).then((function (t) {
                if (!t.ok) return Promise.reject(t);
                else return t.json()
            }));
            this._queue.then(function (e) {
                this._result = e, t(null, e)
            }.bind(this)).catch((function (e) {
                t(e, null)
            }))
        }, window.ProductsModel = i
    },
    3442: function (t, e, n) {
        "use strict";
        var i = t.exports;
        i.findNearestCategories = function (list) {
            var categories = list.closest("body").find('.u-categories[data-products-datasource="site"]');
            if (!categories.length) return $();
            else return categories
        }, i.findNearestProducts = function (categories) {
            if (!categories.is('[data-products-datasource="site"]')) return $();
            var t = '.u-products[data-products-datasource="site"]';
            return categories.closest("body").find(t)
        }, i.getActiveCategory = function (list) {
            var t = list.find(".u-select-categories"),
                categories;
            if (t.length) return t.val() || "";
            else return i.findNearestCategories(list).eq(0).find(".u-category-link.active").attr("data-category") || ""
        }, i.setActiveCategory = function (list, id) {
            list.find(".u-category-link").removeClass("active");
            var t, e = list.find(".u-categories-item").slice(1).filter(":not(.u-expand-leaf)");
            e.removeClass("u-expand-open").addClass("u-expand-closed"), e.find("> .u-categories-item-content svg use").attr("xlink:href", "#icon-categories-closed");
            var n = list.find('[data-category="' + (id || "") + '"]'),
                i = n.closest(".u-categories-item");
            n.addClass("active");
            var o = n.parents(".u-categories-item:not(.u-expand-leaf)");
            o.removeClass("u-expand-closed").addClass("u-expand-open").css("display", ""), o.find("> .u-categories-item-content svg use").attr("xlink:href", "#icon-categories-open"), i.css("display", ""), i.find(".u-categories-item").css("display", "");
            var a = i.find(".u-categories-item:not(.u-expand-leaf)");
            a.removeClass("u-expand-closed").addClass("u-expand-open"), a.find("> .u-categories-item-content svg use").attr("xlink:href", "#icon-categories-open")
        }
    },
    348: function (t, e, n) {
        "use strict";
        var ProductsUtils = t.exports;
        ProductsUtils.sort = function sort(items, sorting, t) {
            var e = new Intl.Collator(t, {
                    numeric: true,
                    sensitivity: "base"
                }),
                n = sorting.prop || "title",
                i = sorting.order || "asc";
            return items.sort((function (t, o) {
                if (Array.isArray(t) && 2 === t.length) t = t[1];
                if (Array.isArray(o) && 2 === o.length) o = o[1];
                return "desc" === i ? e.compare(o[n], t[n]) : e.compare(t[n], o[n])
            })), n + "-" + i
        }, ProductsUtils.categoryFilter = function filter(items, t) {
            if (items = items || [], !t) return items;
            if ("featured" === t) return items.filter((function (t) {
                return t.isFeatured
            }));
            else return items.filter((function (e) {
                return e.categories && e.categories.includes(t)
            }))
        }
    },
    357: function (t, e) {
        t.exports = [{
            name: "United States dollar",
            code: "USD",
            symbol: "$",
            locale: "en-US"
        }, {
            name: "Euro",
            code: "EUR",
            symbol: "€",
            locale: "en-EU"
        }, {
            name: "Australian dollar",
            code: "AUD",
            symbol: "$",
            locale: "en-AU"
        }, {
            name: "Brazilian real",
            code: "BRL",
            symbol: "R$",
            locale: "pt-BR"
        }, {
            name: "Canadian dollar",
            code: "CAD",
            symbol: "$",
            locale: "en-CA"
        }, {
            name: "Chinese Renmenbi",
            code: "CNY",
            symbol: "¥",
            locale: "zh-CN"
        }, {
            name: "Czech koruna",
            code: "CZK",
            symbol: "Kč",
            locale: "cs-CZ"
        }, {
            name: "Danish krone",
            code: "DKK",
            symbol: "kr.",
            locale: "da-DK"
        }, {
            name: "Hong Kong dollar",
            code: "HKD",
            symbol: "$",
            locale: "zh-HK"
        }, {
            name: "Hungarian forint",
            code: "HUF",
            symbol: "ƒ",
            locale: "hu-HU"
        }, {
            name: "Israeli new shekel",
            code: "ILS",
            symbol: "₪",
            locale: "he-IL"
        }, {
            name: "Japanese yen",
            code: "JPY",
            symbol: "¥",
            locale: "ja-JP"
        }, {
            name: "Malaysian ringgit",
            code: "MYR",
            symbol: "RM",
            locale: "ms-MY"
        }, {
            name: "Mexican peso",
            code: "MXN",
            symbol: "$",
            locale: "es-MX"
        }, {
            name: "New Taiwan dollar",
            code: "TWD",
            symbol: "$",
            locale: "zh-TW"
        }, {
            name: "New Zealand dollar",
            code: "NZD",
            symbol: "$",
            locale: "en-NZ"
        }, {
            name: "Norwegian krone",
            code: "NOK",
            symbol: "kr",
            locale: "nb-NO"
        }, {
            name: "Philippine peso",
            code: "PHP",
            symbol: "₱",
            locale: "en-PH"
        }, {
            name: "Polish złoty",
            code: "PLN",
            symbol: "zł",
            locale: "pl-PL"
        }, {
            name: "Pound sterling",
            code: "GBP",
            symbol: "£",
            locale: "en-GB"
        }, {
            name: "Singapore dollar",
            code: "SGD",
            symbol: "$",
            locale: "en-SG"
        }, {
            name: "Swedish krona",
            code: "SEK",
            symbol: "kr",
            locale: "sv-SE"
        }, {
            name: "Swiss franc",
            code: "CHF",
            symbol: "fr.",
            locale: "fr-CH"
        }, {
            name: "Thai baht",
            code: "THB",
            symbol: "฿",
            locale: "th-TH"
        }, {
            name: "United Arab Emirates dirham",
            code: "AED",
            symbol: "د.إ",
            locale: "en-AE"
        }, {
            name: "Afghan Afghani",
            code: "AFN",
            symbol: "؋",
            locale: "ps-AF"
        }, {
            name: "Albanian lek",
            code: "ALL",
            symbol: "L",
            locale: "sq-AL"
        }, {
            name: "Armenian Dram",
            code: "AMD",
            symbol: "֏",
            locale: "hy-AM"
        }, {
            name: "Netherlands Antillean guilder",
            code: "ANG",
            symbol: "ƒ",
            locale: "nl-CW"
        }, {
            name: "Angolan Kwanza",
            code: "AOA",
            symbol: "Kz",
            locale: "pt-AO"
        }, {
            name: "Argentine Peso",
            code: "ARS",
            symbol: "$",
            locale: "es-AR"
        }, {
            name: "Aruban Florin",
            code: "AWG",
            symbol: "Afl",
            locale: "nl-AW"
        }, {
            name: "Azerbaijani Manat",
            code: "AZN",
            symbol: "₼",
            locale: "az-Latn-AZ"
        }, {
            name: "Bosnia and Herzegovina Convertible Mark",
            code: "BAM",
            symbol: "KM",
            locale: "bs-Latn-BA"
        }, {
            name: "Barbados dollar",
            code: "BBD",
            symbol: "$",
            locale: "en-BB"
        }, {
            name: "Bangladeshi taka",
            code: "BDT",
            symbol: "৳",
            locale: "bn-BD"
        }, {
            name: "Bulgarian lev",
            code: "BGN",
            symbol: "лв",
            locale: "bg-BG"
        }, {
            name: "Burundian franc",
            code: "BIF",
            symbol: "Fbu",
            locale: "fr-BI"
        }, {
            name: "Bermudian dollar",
            code: "BMD",
            symbol: "$",
            locale: "en-BM"
        }, {
            name: "Brunei dollar",
            code: "BND",
            symbol: "$",
            locale: "ms-BN"
        }, {
            name: "Bolivian boliviano",
            code: "BOB",
            symbol: "Bs.",
            locale: "es-BO"
        }, {
            name: "Bahamian dollar",
            code: "BSD",
            symbol: "$",
            locale: "en-BS"
        }, {
            name: "Botswana pula",
            code: "BWP",
            symbol: "P",
            locale: "en-BW"
        }, {
            name: "Belarusian ruble",
            code: "BYN",
            symbol: "Br",
            locale: "be-BY"
        }, {
            name: "Belize dollar",
            code: "BZD",
            symbol: "$",
            locale: "en-BZ"
        }, {
            name: "Congolese franc",
            code: "CDF",
            symbol: "FC",
            locale: "fr-CD"
        }, {
            name: "Chilean peso",
            code: "CLP",
            symbol: "$",
            locale: "es-CL"
        }, {
            name: "Colombian peso",
            code: "COP",
            symbol: "$",
            locale: "es-CO"
        }, {
            name: "Costa Rican colón",
            code: "CRC",
            symbol: "₡",
            locale: "es-CR"
        }, {
            name: "Cape Verdean escudo",
            code: "CVE",
            symbol: "$",
            locale: "pt-CV"
        }, {
            name: "Djiboutian franc",
            code: "DJF",
            symbol: "Fdj",
            locale: "fr-DJ"
        }, {
            name: "Dominican peso",
            code: "DOP",
            symbol: "$",
            locale: "es-DO"
        }, {
            name: "Algerian dinar",
            code: "DZD",
            symbol: "د.ج",
            locale: "ar-DZ"
        }, {
            name: "Egyptian pound",
            code: "EGP",
            symbol: "ج.م",
            locale: "ar-EG"
        }, {
            name: "Ethiopian birr",
            code: "ETB",
            symbol: "Br",
            locale: "am-ET"
        }, {
            name: "Fijian dollar",
            code: "FJD",
            symbol: "$",
            locale: "en-FJ"
        }, {
            name: "Falkland Islands pound",
            code: "FKP",
            symbol: "£",
            locale: "en-FK"
        }, {
            name: "Georgian Lari",
            code: "GEL",
            symbol: "₾",
            locale: "en-GE"
        }, {
            name: "Gibraltar Pound",
            code: "GIP",
            symbol: "£",
            locale: "en-GI"
        }, {
            name: "Gambian Dalasi",
            code: "GMD",
            symbol: "D",
            locale: "en-GM"
        }, {
            name: "Guinean Franc",
            code: "GNF",
            symbol: "FG",
            locale: "en-GN"
        }, {
            name: "Guatemalan Quetzal",
            code: "GTQ",
            symbol: "Q",
            locale: "en-GT"
        }, {
            name: "Guyanese Dollar",
            code: "GYD",
            symbol: "$",
            locale: "en-GY"
        }, {
            name: "Honduran Lempira",
            code: "HNL",
            symbol: "L",
            locale: "en-HN"
        }, {
            name: "Haitian Gourde",
            code: "HTG",
            symbol: "G",
            locale: "en-HT"
        }, {
            name: "Indonesian Rupiah",
            code: "IDR",
            symbol: "Rp",
            locale: "en-ID"
        }, {
            name: "Indian Rupee",
            code: "INR",
            symbol: "₹",
            locale: "en-IN"
        }, {
            name: "Icelandic Krona",
            code: "ISK",
            symbol: "kr",
            locale: "en-IS"
        }, {
            name: "Jamaican Dollar",
            code: "JMD",
            symbol: "J$",
            locale: "en-JM"
        }, {
            name: "Kenyan Shilling",
            code: "KES",
            symbol: "KSh",
            locale: "en-KE"
        }, {
            name: "Kazakhstani Tenge",
            code: "KZT",
            symbol: "₸",
            locale: "en-KZ"
        }, {
            name: "Cambodian Riel",
            code: "KHR",
            symbol: "៛",
            locale: "en-KH"
        }, {
            name: "Comorian Franc",
            code: "KMF",
            symbol: "CF",
            locale: "en-KM"
        }, {
            name: "South Korean Won",
            code: "KRW",
            symbol: "₩",
            locale: "en-KR"
        }, {
            name: "Cayman Islands Dollar",
            code: "KYD",
            symbol: "$",
            locale: "en-KY"
        }, {
            name: "Lao Kip",
            code: "LAK",
            symbol: "₭",
            locale: "en-LA"
        }, {
            name: "Lebanese Pound",
            code: "LBP",
            symbol: "ل.ل",
            locale: "en-LB"
        }, {
            name: "Sri Lankan Rupee",
            code: "LKR",
            symbol: "Rs",
            locale: "en-LK"
        }, {
            name: "Liberian Dollar",
            code: "LRD",
            symbol: "$",
            locale: "en-LR"
        }, {
            name: "Lesotho Loti",
            code: "LSL",
            symbol: "L",
            locale: "en-LS"
        }, {
            name: "Moroccan Dirham",
            code: "MAD",
            symbol: "د.م.",
            locale: "en-MA"
        }, {
            name: "Moldovan Leu",
            code: "MDL",
            symbol: "L",
            locale: "en-MD"
        }, {
            name: "Malagasy ariary",
            code: "MGA",
            symbol: "Ar",
            locale: "mg-MG"
        }, {
            name: "Macedonian denar",
            code: "MKD",
            symbol: "ден",
            locale: "mk-MK"
        }, {
            name: "Myanmar kyat",
            code: "MMK",
            symbol: "K",
            locale: "my-MM"
        }, {
            name: "Mongolian tögrög",
            code: "MNT",
            symbol: "₮",
            locale: "mn-MN"
        }, {
            name: "Macanese pataca",
            code: "MOP",
            symbol: "P",
            locale: "zh-MO"
        }, {
            name: "Mauritian rupee",
            code: "MUR",
            symbol: "₨",
            locale: "en-MU"
        }, {
            name: "Maldivian rufiyaa",
            code: "MVR",
            symbol: "Rf",
            locale: "dv-MV"
        }, {
            name: "Malawian kwacha",
            code: "MWK",
            symbol: "MK",
            locale: "en-MW"
        }, {
            name: "Mozambican metical",
            code: "MZN",
            symbol: "MT",
            locale: "pt-MZ"
        }, {
            name: "Namibian dollar",
            code: "NAD",
            symbol: "$",
            locale: "en-NA"
        }, {
            name: "Nigerian naira",
            code: "NGN",
            symbol: "₦",
            locale: "en-NG"
        }, {
            name: "Nicaraguan córdoba",
            code: "NIO",
            symbol: "C$",
            locale: "es-NI"
        }, {
            name: "Nepalese rupee",
            code: "NPR",
            symbol: "₨",
            locale: "ne-NP"
        }, {
            name: "Panamanian balboa",
            code: "PAB",
            symbol: "B/.",
            locale: "es-PA"
        }, {
            name: "Peruvian sol",
            code: "PEN",
            symbol: "S/.",
            locale: "es-PE"
        }, {
            name: "Papua New Guinean kina",
            code: "PGK",
            symbol: "K",
            locale: "en-PG"
        }, {
            name: "Pakistani rupee",
            code: "PKR",
            symbol: "₨",
            locale: "ur-PK"
        }, {
            name: "Paraguayan guaraní",
            code: "PYG",
            symbol: "₲",
            locale: "es-PY"
        }, {
            name: "Qatari riyal",
            code: "QAR",
            symbol: "﷼",
            locale: "ar-QA"
        }, {
            name: "Romanian leu",
            code: "RON",
            symbol: "lei",
            locale: "ro-RO"
        }, {
            name: "Serbian dinar",
            code: "RSD",
            symbol: "дин.",
            locale: "sr-RS"
        }, {
            name: "Russian ruble",
            code: "RUB",
            symbol: "₽",
            locale: "ru-RU"
        }, {
            name: "Rwandan franc",
            code: "RWF",
            symbol: "FRw",
            locale: "rw-RW"
        }, {
            name: "Saudi riyal",
            code: "SAR",
            symbol: "﷼",
            locale: "ar-SA"
        }, {
            name: "Solomon Islands dollar",
            code: "SBD",
            symbol: "$",
            locale: "en-SB"
        }, {
            name: "Seychellois Rupee",
            code: "SCR",
            symbol: "₨",
            locale: "en-SC"
        }, {
            name: "Saint Helena Pound",
            code: "SHP",
            symbol: "£",
            locale: "en-SH"
        }, {
            name: "Sierra Leonean Leone",
            code: "SLE",
            symbol: "Le",
            locale: "en-SL"
        }, {
            name: "Somali Shilling",
            code: "SOS",
            symbol: "S",
            locale: "en-SO"
        }, {
            name: "Surinamese Dollar",
            code: "SRD",
            symbol: "$",
            locale: "en-SR"
        }, {
            name: "São Tomé and Príncipe Dobra",
            code: "STD",
            symbol: "Db",
            locale: "en-ST"
        }, {
            name: "Swazi Lilangeni",
            code: "SZL",
            symbol: "L",
            locale: "en-SZ"
        }, {
            name: "Tajikistani Somoni",
            code: "TJS",
            symbol: "ЅМ",
            locale: "en-TJ"
        }, {
            name: "Tongan Pa'anga",
            code: "TOP",
            symbol: "T$",
            locale: "en-TO"
        }, {
            name: "Turkish Lira",
            code: "TRY",
            symbol: "₺",
            locale: "en-TR"
        }, {
            name: "Trinidad and Tobago Dollar",
            code: "TTD",
            symbol: "TT$",
            locale: "en-TT"
        }, {
            name: "Tanzanian Shilling",
            code: "TZS",
            symbol: "TSh",
            locale: "en-TZ"
        }, {
            name: "Ukrainian Hryvnia",
            code: "UAH",
            symbol: "₴",
            locale: "en-UA"
        }, {
            name: "Ugandan Shilling",
            code: "UGX",
            symbol: "USh",
            locale: "en-UG"
        }, {
            name: "Uruguayan Peso",
            code: "UYU",
            symbol: "$U",
            locale: "en-UY"
        }, {
            name: "Uzbekistani Som",
            code: "UZS",
            symbol: "лв",
            locale: "en-UZ"
        }, {
            name: "Vietnamese Dong",
            code: "VND",
            symbol: "₫",
            locale: "en-VN"
        }, {
            name: "Vanuatu Vatu",
            code: "VUV",
            symbol: "VT",
            locale: "en-VU"
        }, {
            name: "Samoan Tala",
            code: "WST",
            symbol: "WS$",
            locale: "en-WS"
        }, {
            name: "Central African CFA Franc",
            code: "XAF",
            symbol: "FCFA",
            locale: "en-CM"
        }, {
            name: "East Caribbean Dollar",
            code: "XCD",
            symbol: "EC$",
            locale: "en-DM"
        }, {
            name: "West African CFA Franc",
            code: "XOF",
            symbol: "CFA",
            locale: "en-BJ"
        }, {
            name: "CFP Franc",
            code: "XPF",
            symbol: "₣",
            locale: "en-PF"
        }, {
            name: "Yemeni Rial",
            code: "YER",
            symbol: "﷼",
            locale: "en-YE"
        }, {
            name: "South African Rand",
            code: "ZAR",
            symbol: "R",
            locale: "en-ZA"
        }, {
            name: "Zambian kwacha",
            code: "ZMW",
            symbol: "ZK",
            locale: "en-ZM"
        }, {
            name: "Kyrgyzstani Som",
            code: "KGS",
            symbol: "с",
            locale: "en-KG"
        }]
    },
    368: function (t, e, n) {
        "use strict";
        var i;
        t.exports.requestAnimationFrame = function t(e) {
            if (window.requestAnimationFrame) return window.requestAnimationFrame(e);
            if (window.mozRequestAnimationFrame) return window.mozRequestAnimationFrame(e);
            if (window.webkitRequestAnimationFrame) return window.webkitRequestAnimationFrame(e);
            if (window.msRequestAnimationFrame) return window.msRequestAnimationFrame(e);
            else return e(), void 0
        }
    },
    369: function (t, e, n) {
        "use strict";

        function i(t, section) {
            if (this.element = t, this.section = section, this.name = t.getAttribute("data-animation-name"), this.event = "scroll", this.durationRaw = t.getAttribute("data-animation-duration"), this.duration = Number(this.durationRaw), isNaN(this.duration) || !isFinite(this.duration) || this.duration < 0) this.duration = 0;
            var e = t.getAttribute("data-animation-event");
            if (e) this.event = e;
            if (this.delayRaw = t.getAttribute("data-animation-delay"), this.delay = 0, this.delayRaw)
                if (this.delay = Number(this.delayRaw), isNaN(this.delay) || !isFinite(this.delay) || this.delay < 0) this.delay = 0;
            var n = t.getAttribute("data-animation-cycle");
            if (n)
                if (n = Number(n), !isNaN(n)) this.animationCycle = n;
            var i = t.getAttribute("data-animation-direction");
            if (i && "customAnimationIn" !== this.name) this.direction = i;
            this.animationOut = !t.hasAttribute("data-animation-out") || parseFloat(t.getAttribute("data-animation-out")), this.infinite = t.classList.contains("infinite")
        }
        t.exports = i, window.AnimationInfo = i
    },
    370: function (t, e, n) {
        "use strict";

        function CountdownAnimate(t) {
            if (this.$dom = t, this.$html = this.$dom.find(".counter-animation"), !this.$html.length) {
                var e = this.$dom.text();
                this.$html = $('<div class="counter-animation" style="display: none;"></div>'), this.$html.append('<div class="counter-wrapper"></div>'), this.$html.find(".counter-wrapper").append('<div class="counter-html"></div>'), this.$html.find(".counter-html").append($('<div class="old-val"></div>')), this.$html.find(".counter-html").append($('<div class="new-val"></div>')), this.$dom.empty(), this.$dom.append($('<span class="start-val"></span>').text(e)), this.$dom.append(this.$html)
            }
            this.onResize(), $(window).on("resize", function () {
                this.onResize()
            }.bind(this))
        }
        t.exports = CountdownAnimate, CountdownAnimate.prototype.rollNumber = function (t, props) {
            if (!this.$dom.is(".updating")) {
                this.$dom.addClass("updating");
                var e = this.getOldVal(),
                    n = this.$dom.find(".start-val"),
                    i = this.$dom.find(".counter-animation"),
                    o = 350;
                if (props.animationSpeed) o = props.animationSpeed > 20 ? props.animationSpeed - 20 : 0;
                this.$html.find(".old-val").text(e), this.$html.find(".new-val").text(t), this.$html.find(".counter-html").css("top", 0), requestAnimationFrame(function () {
                    n.css("display", "none"), i.css("display", "flex")
                }.bind(this)), this.$html.find(".counter-html").animate({
                    top: -this.height + "px"
                }, o, "swing", function () {
                    requestAnimationFrame(function () {
                        n.text(t), n.css("display", "inline-block"), i.css("display", "none"), this.$dom.removeClass("updating")
                    }.bind(this))
                }.bind(this))
            }
        }, CountdownAnimate.prototype.onResize = function () {
            this.height = this.$dom.height(), this.$html.find(".counter-wrapper").css("height", this.height + "px")
        }, CountdownAnimate.prototype.getOldVal = function () {
            return this.$dom.find(".start-val").text()
        }
    },
    398: function (t, e, n) {
        "use strict";

        function HorizontalLayoutSlider(slider, t) {
            if (slider && slider.length) {
                var e = slider.children(".u-gallery-inner, .u-repeater");
                if (e.length) {
                    this.viewport = e;
                    var n = slider.children(".u-gallery-nav");
                    if (n.length) {
                        if (this.controls = n, this.data = {
                                offset: 0,
                                width: 0,
                                scrollWidth: 0,
                                maxOffset: 0
                            }, t) this._onScroll = this.onScroll.bind(this), this._onlazyloaded = this.onlazyloaded.bind(this), this.viewport.scroll(this._onScroll), this.viewport.find("img.lazyload").each(function (t, e) {
                            e.onload = this._onlazyloaded
                        }.bind(this));
                        if (this.updateInnerData(), t) this.updateControls()
                    }
                }
            }
        }
        t.exports = HorizontalLayoutSlider, HorizontalLayoutSlider.prototype.onScroll = function () {
            this.updateControls()
        }, HorizontalLayoutSlider.prototype.onlazyloaded = function t() {
            this.updateInnerData(), this.updateControls()
        }, HorizontalLayoutSlider.prototype.updateControls = function () {
            this.updateOffset()
        }, HorizontalLayoutSlider.prototype.updateOffset = function () {
            this.data.offset = this.viewport.scrollLeft()
        }, HorizontalLayoutSlider.prototype.updateInnerData = function () {
            if (this.data && this.viewport && this.viewport[0]) {
                this.data.scrollWidth = this.viewport[0].scrollWidth, this.data.width = this.viewport.innerWidth();
                var t = this.viewport.scrollLeft();
                this.scrollToEnd(), this.data.maxOffset = this.viewport.scrollLeft(), this.viewport.scrollLeft(t)
            }
        }, HorizontalLayoutSlider.prototype.navigate = function (t) {
            if (!t.hasClass("u-hidden") && this.viewport) {
                this.updateInnerData(), this.updateOffset();
                var e = 1;
                if ("undefined" != typeof app) e = app.editor.preview.scale;
                var n = this.data.offset,
                    i = this.data.width - 50,
                    o = .3 * this.data.width,
                    a = this.viewport.children().toArray().map((function (t) {
                        return n + Math.round($(t).position().left / e)
                    }));
                a.push(this.data.maxOffset + this.data.width);
                var s = function (t) {
                    return a.reduce((function (e, n) {
                        return Math.abs(n - t) < Math.abs(e - t) ? n : e
                    }))
                };
                if (t.hasClass("u-gallery-nav-next")) {
                    n = s(n + i) - 1;
                    var u = this.data.scrollWidth - (n + this.data.width);
                    if (u < -o) n = 0;
                    else if (u < o) n = this.data.maxOffset + o
                } else if (n >= 0)
                    if ((n = s(n + this.data.width - i) - this.data.width - 1) < -o) n = this.data.maxOffset + o;
                    else if (n < o) n = 0;
                this.viewport.animate({
                    scrollLeft: n
                }, 500 * (Math.abs(this.data.offset - n) / i), "swing")
            }
        }, HorizontalLayoutSlider.prototype.scrollToEnd = function () {
            if (this.viewport && this.data) this.viewport.scrollLeft(this.data.scrollWidth)
        }, window._npHorizontalLayoutSlider = HorizontalLayoutSlider
    },
    399: function (t, e, n) {
        "use strict";
        var i = t.exports = function t() {
            this.expr = null, this.tokens = []
        };
        i.prototype.replace = function replace(t, e) {
            t = t.toUpperCase(), this.tokens = this.getTokens(t, e).sort((function (t, e) {
                return e.length - t.length
            }));
            for (var n = 0; n < this.tokens.length; n++) t = t.split(this.tokens[n].toUpperCase()).join(" " + e[this.tokens[n]] + " ");
            return this.expr = t, this
        }, i.prototype.getTokens = function t(e, n) {
            return e = e.toUpperCase(), Object.keys(n).filter((function (t) {
                return /^[a-zA-Z_$][\w$-]*$/.test(t)
            })).filter((function (t) {
                return e.includes(t.toUpperCase())
            }))
        }
    },
    450: function (t, e) {
        t.exports = [{
            code: "US",
            name: "United States"
        }, {
            code: "GB",
            name: "United Kingdom"
        }, {
            code: "AF",
            name: "Afghanistan"
        }, {
            code: "AX",
            name: "Åland Islands"
        }, {
            code: "AL",
            name: "Albania"
        }, {
            code: "DZ",
            name: "Algeria"
        }, {
            code: "AS",
            name: "American Samoa"
        }, {
            code: "AD",
            name: "Andorra"
        }, {
            code: "AO",
            name: "Angola"
        }, {
            code: "AI",
            name: "Anguilla"
        }, {
            code: "AQ",
            name: "Antarctica"
        }, {
            code: "AG",
            name: "Antigua and Barbuda"
        }, {
            code: "AR",
            name: "Argentina"
        }, {
            code: "AM",
            name: "Armenia"
        }, {
            code: "AW",
            name: "Aruba"
        }, {
            code: "AU",
            name: "Australia"
        }, {
            code: "AT",
            name: "Austria"
        }, {
            code: "AZ",
            name: "Azerbaijan"
        }, {
            code: "BS",
            name: "Bahamas"
        }, {
            code: "BH",
            name: "Bahrain"
        }, {
            code: "BD",
            name: "Bangladesh"
        }, {
            code: "BB",
            name: "Barbados"
        }, {
            code: "BY",
            name: "Belarus"
        }, {
            code: "BE",
            name: "Belgium"
        }, {
            code: "BZ",
            name: "Belize"
        }, {
            code: "BJ",
            name: "Benin"
        }, {
            code: "BM",
            name: "Bermuda"
        }, {
            code: "BT",
            name: "Bhutan"
        }, {
            code: "BO",
            name: "Bolivia, Plurinational State of"
        }, {
            code: "BQ",
            name: "Bonaire, Sint Eustatius and Saba"
        }, {
            code: "BA",
            name: "Bosnia and Herzegovina"
        }, {
            code: "BW",
            name: "Botswana"
        }, {
            code: "BV",
            name: "Bouvet Island"
        }, {
            code: "BR",
            name: "Brazil"
        }, {
            code: "IO",
            name: "British Indian Ocean Territory"
        }, {
            code: "BN",
            name: "Brunei Darussalam"
        }, {
            code: "BG",
            name: "Bulgaria"
        }, {
            code: "BF",
            name: "Burkina Faso"
        }, {
            code: "BI",
            name: "Burundi"
        }, {
            code: "KH",
            name: "Cambodia"
        }, {
            code: "CM",
            name: "Cameroon"
        }, {
            code: "CA",
            name: "Canada"
        }, {
            code: "CV",
            name: "Cape Verde"
        }, {
            code: "KY",
            name: "Cayman Islands"
        }, {
            code: "CF",
            name: "Central African Republic"
        }, {
            code: "TD",
            name: "Chad"
        }, {
            code: "CL",
            name: "Chile"
        }, {
            code: "CN",
            name: "China"
        }, {
            code: "CX",
            name: "Christmas Island"
        }, {
            code: "CC",
            name: "Cocos (Keeling) Islands"
        }, {
            code: "CO",
            name: "Colombia"
        }, {
            code: "KM",
            name: "Comoros"
        }, {
            code: "CG",
            name: "Congo"
        }, {
            code: "CD",
            name: "Congo, the Democratic Republic of the"
        }, {
            code: "CK",
            name: "Cook Islands"
        }, {
            code: "CR",
            name: "Costa Rica"
        }, {
            code: "CI",
            name: "Côte d'Ivoire"
        }, {
            code: "HR",
            name: "Croatia"
        }, {
            code: "CU",
            name: "Cuba"
        }, {
            code: "CW",
            name: "Curaçao"
        }, {
            code: "CY",
            name: "Cyprus"
        }, {
            code: "CZ",
            name: "Czech Republic"
        }, {
            code: "DK",
            name: "Denmark"
        }, {
            code: "DJ",
            name: "Djibouti"
        }, {
            code: "DM",
            name: "Dominica"
        }, {
            code: "DO",
            name: "Dominican Republic"
        }, {
            code: "EC",
            name: "Ecuador"
        }, {
            code: "EG",
            name: "Egypt"
        }, {
            code: "SV",
            name: "El Salvador"
        }, {
            code: "GQ",
            name: "Equatorial Guinea"
        }, {
            code: "ER",
            name: "Eritrea"
        }, {
            code: "EE",
            name: "Estonia"
        }, {
            code: "ET",
            name: "Ethiopia"
        }, {
            code: "FK",
            name: "Falkland Islands (Malvinas)"
        }, {
            code: "FO",
            name: "Faroe Islands"
        }, {
            code: "FJ",
            name: "Fiji"
        }, {
            code: "FI",
            name: "Finland"
        }, {
            code: "FR",
            name: "France"
        }, {
            code: "GF",
            name: "French Guiana"
        }, {
            code: "PF",
            name: "French Polynesia"
        }, {
            code: "TF",
            name: "French Southern Territories"
        }, {
            code: "GA",
            name: "Gabon"
        }, {
            code: "GM",
            name: "Gambia"
        }, {
            code: "GE",
            name: "Georgia"
        }, {
            code: "DE",
            name: "Germany"
        }, {
            code: "GH",
            name: "Ghana"
        }, {
            code: "GI",
            name: "Gibraltar"
        }, {
            code: "GR",
            name: "Greece"
        }, {
            code: "GL",
            name: "Greenland"
        }, {
            code: "GD",
            name: "Grenada"
        }, {
            code: "GP",
            name: "Guadeloupe"
        }, {
            code: "GU",
            name: "Guam"
        }, {
            code: "GT",
            name: "Guatemala"
        }, {
            code: "GG",
            name: "Guernsey"
        }, {
            code: "GN",
            name: "Guinea"
        }, {
            code: "GW",
            name: "Guinea-Bissau"
        }, {
            code: "GY",
            name: "Guyana"
        }, {
            code: "HT",
            name: "Haiti"
        }, {
            code: "HM",
            name: "Heard Island and McDonald Islands"
        }, {
            code: "VA",
            name: "Holy See (Vatican City State)"
        }, {
            code: "HN",
            name: "Honduras"
        }, {
            code: "HK",
            name: "Hong Kong"
        }, {
            code: "HU",
            name: "Hungary"
        }, {
            code: "IS",
            name: "Iceland"
        }, {
            code: "IN",
            name: "India"
        }, {
            code: "ID",
            name: "Indonesia"
        }, {
            code: "IR",
            name: "Iran, Islamic Republic of"
        }, {
            code: "IQ",
            name: "Iraq"
        }, {
            code: "IE",
            name: "Ireland"
        }, {
            code: "IM",
            name: "Isle of Man"
        }, {
            code: "IL",
            name: "Israel"
        }, {
            code: "IT",
            name: "Italy"
        }, {
            code: "JM",
            name: "Jamaica"
        }, {
            code: "JP",
            name: "Japan"
        }, {
            code: "JE",
            name: "Jersey"
        }, {
            code: "JO",
            name: "Jordan"
        }, {
            code: "KZ",
            name: "Kazakhstan"
        }, {
            code: "KE",
            name: "Kenya"
        }, {
            code: "KI",
            name: "Kiribati"
        }, {
            code: "KP",
            name: "Korea, Democratic People's Republic of"
        }, {
            code: "KR",
            name: "Korea, Republic of"
        }, {
            code: "KW",
            name: "Kuwait"
        }, {
            code: "KG",
            name: "Kyrgyzstan"
        }, {
            code: "LA",
            name: "Lao People's Democratic Republic"
        }, {
            code: "LV",
            name: "Latvia"
        }, {
            code: "LB",
            name: "Lebanon"
        }, {
            code: "LS",
            name: "Lesotho"
        }, {
            code: "LR",
            name: "Liberia"
        }, {
            code: "LY",
            name: "Libya"
        }, {
            code: "LI",
            name: "Liechtenstein"
        }, {
            code: "LT",
            name: "Lithuania"
        }, {
            code: "LU",
            name: "Luxembourg"
        }, {
            code: "MO",
            name: "Macao"
        }, {
            code: "MK",
            name: "Macedonia, the former Yugoslav Republic of"
        }, {
            code: "MG",
            name: "Madagascar"
        }, {
            code: "MW",
            name: "Malawi"
        }, {
            code: "MY",
            name: "Malaysia"
        }, {
            code: "MV",
            name: "Maldives"
        }, {
            code: "ML",
            name: "Mali"
        }, {
            code: "MT",
            name: "Malta"
        }, {
            code: "MH",
            name: "Marshall Islands"
        }, {
            code: "MQ",
            name: "Martinique"
        }, {
            code: "MR",
            name: "Mauritania"
        }, {
            code: "MU",
            name: "Mauritius"
        }, {
            code: "YT",
            name: "Mayotte"
        }, {
            code: "MX",
            name: "Mexico"
        }, {
            code: "FM",
            name: "Micronesia, Federated States of"
        }, {
            code: "MD",
            name: "Moldova, Republic of"
        }, {
            code: "MC",
            name: "Monaco"
        }, {
            code: "MN",
            name: "Mongolia"
        }, {
            code: "ME",
            name: "Montenegro"
        }, {
            code: "MS",
            name: "Montserrat"
        }, {
            code: "MA",
            name: "Morocco"
        }, {
            code: "MZ",
            name: "Mozambique"
        }, {
            code: "MM",
            name: "Myanmar"
        }, {
            code: "NA",
            name: "Namibia"
        }, {
            code: "NR",
            name: "Nauru"
        }, {
            code: "NP",
            name: "Nepal"
        }, {
            code: "NL",
            name: "Netherlands"
        }, {
            code: "NC",
            name: "New Caledonia"
        }, {
            code: "NZ",
            name: "New Zealand"
        }, {
            code: "NI",
            name: "Nicaragua"
        }, {
            code: "NE",
            name: "Niger"
        }, {
            code: "NG",
            name: "Nigeria"
        }, {
            code: "NU",
            name: "Niue"
        }, {
            code: "NF",
            name: "Norfolk Island"
        }, {
            code: "MP",
            name: "Northern Mariana Islands"
        }, {
            code: "NO",
            name: "Norway"
        }, {
            code: "OM",
            name: "Oman"
        }, {
            code: "PK",
            name: "Pakistan"
        }, {
            code: "PW",
            name: "Palau"
        }, {
            code: "PS",
            name: "Palestinian Territory, Occupied"
        }, {
            code: "PA",
            name: "Panama"
        }, {
            code: "PG",
            name: "Papua New Guinea"
        }, {
            code: "PY",
            name: "Paraguay"
        }, {
            code: "PE",
            name: "Peru"
        }, {
            code: "PH",
            name: "Philippines"
        }, {
            code: "PN",
            name: "Pitcairn"
        }, {
            code: "PL",
            name: "Poland"
        }, {
            code: "PT",
            name: "Portugal"
        }, {
            code: "PR",
            name: "Puerto Rico"
        }, {
            code: "QA",
            name: "Qatar"
        }, {
            code: "RE",
            name: "Réunion"
        }, {
            code: "RO",
            name: "Romania"
        }, {
            code: "RU",
            name: "Russian Federation"
        }, {
            code: "RW",
            name: "Rwanda"
        }, {
            code: "BL",
            name: "Saint Barthélemy"
        }, {
            code: "SH",
            name: "Saint Helena, Ascension and Tristan da Cunha"
        }, {
            code: "KN",
            name: "Saint Kitts and Nevis"
        }, {
            code: "LC",
            name: "Saint Lucia"
        }, {
            code: "MF",
            name: "Saint Martin (French part)"
        }, {
            code: "PM",
            name: "Saint Pierre and Miquelon"
        }, {
            code: "VC",
            name: "Saint Vincent and the Grenadines"
        }, {
            code: "WS",
            name: "Samoa"
        }, {
            code: "SM",
            name: "San Marino"
        }, {
            code: "ST",
            name: "Sao Tome and Principe"
        }, {
            code: "SA",
            name: "Saudi Arabia"
        }, {
            code: "SN",
            name: "Senegal"
        }, {
            code: "RS",
            name: "Serbia"
        }, {
            code: "SC",
            name: "Seychelles"
        }, {
            code: "SL",
            name: "Sierra Leone"
        }, {
            code: "SG",
            name: "Singapore"
        }, {
            code: "SX",
            name: "Sint Maarten (Dutch part)"
        }, {
            code: "SK",
            name: "Slovakia"
        }, {
            code: "SI",
            name: "Slovenia"
        }, {
            code: "SB",
            name: "Solomon Islands"
        }, {
            code: "SO",
            name: "Somalia"
        }, {
            code: "ZA",
            name: "South Africa"
        }, {
            code: "GS",
            name: "South Georgia and the South Sandwich Islands"
        }, {
            code: "SS",
            name: "South Sudan"
        }, {
            code: "ES",
            name: "Spain"
        }, {
            code: "LK",
            name: "Sri Lanka"
        }, {
            code: "SD",
            name: "Sudan"
        }, {
            code: "SR",
            name: "Suriname"
        }, {
            code: "SJ",
            name: "Svalbard and Jan Mayen"
        }, {
            code: "SZ",
            name: "Swaziland"
        }, {
            code: "SE",
            name: "Sweden"
        }, {
            code: "CH",
            name: "Switzerland"
        }, {
            code: "SY",
            name: "Syrian Arab Republic"
        }, {
            code: "TW",
            name: "Taiwan"
        }, {
            code: "TJ",
            name: "Tajikistan"
        }, {
            code: "TZ",
            name: "Tanzania, United Republic of"
        }, {
            code: "TH",
            name: "Thailand"
        }, {
            code: "TL",
            name: "Timor-Leste"
        }, {
            code: "TG",
            name: "Togo"
        }, {
            code: "TK",
            name: "Tokelau"
        }, {
            code: "TO",
            name: "Tonga"
        }, {
            code: "TT",
            name: "Trinidad and Tobago"
        }, {
            code: "TN",
            name: "Tunisia"
        }, {
            code: "TR",
            name: "Turkey"
        }, {
            code: "TM",
            name: "Turkmenistan"
        }, {
            code: "TC",
            name: "Turks and Caicos Islands"
        }, {
            code: "TV",
            name: "Tuvalu"
        }, {
            code: "UG",
            name: "Uganda"
        }, {
            code: "UA",
            name: "Ukraine"
        }, {
            code: "AE",
            name: "United Arab Emirates"
        }, {
            code: "GB",
            name: "United Kingdom"
        }, {
            code: "US",
            name: "United States"
        }, {
            code: "UM",
            name: "United States Minor Outlying Islands"
        }, {
            code: "UY",
            name: "Uruguay"
        }, {
            code: "UZ",
            name: "Uzbekistan"
        }, {
            code: "VU",
            name: "Vanuatu"
        }, {
            code: "VE",
            name: "Venezuela, Bolivarian Republic of"
        }, {
            code: "VN",
            name: "Viet Nam"
        }, {
            code: "VG",
            name: "Virgin Islands, British"
        }, {
            code: "VI",
            name: "Virgin Islands, U.S."
        }, {
            code: "WF",
            name: "Wallis and Futuna"
        }, {
            code: "EH",
            name: "Western Sahara"
        }, {
            code: "YE",
            name: "Yemen"
        }, {
            code: "ZM",
            name: "Zambia"
        }, {
            code: "ZW",
            name: "Zimbabwe"
        }]
    },
    507: function (t, e) {
        var e = void 0,
            t = void 0;
        (function () {
            /*!
             * https://github.com/gilmoreorless/css-background-parser
             * Copyright © 2015 Gilmore Davidson under the MIT license: http://gilmoreorless.mit-license.org/
             */
            ! function (t) {
                function e(t) {
                    if (!(this instanceof e)) return new e;
                    this.backgrounds = t || []
                }

                function Background(props) {
                    function t(t, n) {
                        e[t] = t in props ? props[t] : n
                    }
                    if (!(this instanceof Background)) return new Background(props);
                    props = props || {};
                    var e = this;
                    t("color", ""), t("image", ""), t("attachment", ""), t("clip", ""), t("origin", ""), t("position", ""), t("repeat", ""), t("size", "")
                }

                function n(t) {
                    var e = [],
                        n = /[,\(\)]/,
                        i = 0,
                        o = "";
                    if (null == t) return e;
                    for (; t.length;) {
                        var a = n.exec(t);
                        if (!a) break;
                        var s, u = false;
                        switch (a[0]) {
                            case ",":
                                if (!i) e.push(o.trim()), o = "", u = true;
                                break;
                            case "(":
                                i++;
                                break;
                            case ")":
                                i--;
                                break
                        }
                        var index = a.index + 1;
                        o += t.slice(0, u ? index - 1 : index), t = t.slice(index)
                    }
                    if (o.length || t.length) e.push((o + t).trim());
                    return e.filter((function (t) {
                        return "none" !== t
                    }))
                }

                function i(t) {
                    return t.trim()
                }

                function o(t) {
                    return (t || "").split(",").map(i)
                }
                e.prototype.toString = function t(props) {
                    return this.backgrounds.map((function (t) {
                        return t.toString(props)
                    })).filter((function (t) {
                        return t
                    })).join(", ")
                }, Background.prototype.toString = function t(props) {
                    props = props || ["image", "repeat", "attachment", "position", "size", "origin", "clip"];
                    var size = (props = Array.isArray(props) ? props : [props]).includes("size") && this.size ? " / " + this.size : "",
                        list = [props.includes("image") ? this.image : "", props.includes("repeat") ? this.repeat : "", props.includes("attachment") ? this.attachment : "", props.includes("position") ? this.position + size : "", props.includes("origin") ? this.origin : "", props.includes("clip") ? this.clip : ""];
                    if (this.color) list.unshift(this.color);
                    return list.filter((function (t) {
                        return t
                    })).join(" ")
                }, t.BackgroundList = e, t.Background = Background, t.parseElementStyle = function (t) {
                    var list = new e;
                    if (null == t) return list;
                    for (var i = n(t.backgroundImage), a = t.backgroundColor, s = o(t.backgroundAttachment), u = o(t.backgroundClip), l = o(t.backgroundOrigin), c = o(t.backgroundPosition), f = o(t.backgroundRepeat), h = o(t.backgroundSize), background, p = 0, m = i.length; p < m; p++) {
                        if (background = new Background({
                                image: i[p],
                                attachment: s[p % s.length],
                                clip: u[p % u.length],
                                origin: l[p % l.length],
                                position: c[p % c.length],
                                repeat: f[p % f.length],
                                size: h[p % h.length]
                            }), p === m - 1) background.color = a;
                        list.backgrounds.push(background)
                    }
                    return list
                }
            }(function (e) {
                if (void 0 !== t && void 0 !== t.exports) return t.exports;
                else return e.cssBgParser = {}
            }(this))
        }).call(window)
    },
    52: function (t, e, n) {
        "use strict";

        function CountdownCommon(t) {
            this.$dom = t
        }
        t.exports = CountdownCommon;
        var CountdownAnimate = n(370);
        CountdownCommon.prototype.getDate = function () {
            var date = this.$dom.attr("data-target-date");
            if (date) return new Date(date);
            else return new Date
        }, CountdownCommon.prototype.getDirection = function () {
            return this.$dom.attr("data-direction") || "down"
        }, CountdownCommon.prototype.getTimeLeft = function () {
            return this.$dom.attr("data-time-left") || "750m"
        }, CountdownCommon.prototype.getNumber = function () {
            var t = this.$dom.attr("data-target-number") || "100";
            return parseInt(t, 10)
        }, CountdownCommon.prototype.getStartTime = function () {
            var date = this.$dom.attr("data-start-time");
            if (date) return new Date(date);
            else return new Date
        }, CountdownCommon.prototype.getFrequency = function () {
            return this.$dom.attr("data-frequency") || "1s"
        }, CountdownCommon.prototype.getTimerId = function () {
            return this.$dom.attr("data-timer-id")
        }, CountdownCommon.prototype.getTimerKey = function () {
            return "timer-" + this.getTimerId()
        }, CountdownCommon.prototype.getFor = function () {
            return this.$dom.attr("data-for") || "everyone"
        }, CountdownCommon.prototype.getType = function () {
            return this.$dom.attr("data-type") || "to-date"
        }, CountdownCommon.prototype.setValue = function (t, e, n, props) {
            var i = this.$dom.find(".u-countdown-" + t),
                o = e.toString(),
                a = o.length;
            if ("to-number" === this.getType()) {
                for (; i.find(".u-countdown-number").length < a + 1;) {
                    var itemDom = i.find(".u-countdown-number:eq(0)");
                    if (!itemDom.length) break;
                    itemDom.clone().insertAfter(itemDom).text("0")
                }
                for (; i.find(".u-countdown-number").length > a + 1;) i.find(".u-countdown-number:eq(0)").remove()
            }
            var s = i.find(".u-countdown-number");
            if ("hours" === t || "minutes" === t || "seconds" === t || "numbers" === t)
                for (; o.length < s.length;) o = "0" + o;
            if (!(a > s.length))
                for (var u = 0; u < s.length; u++) {
                    var l = $(s[u]);
                    if (this.doSetVal(l, o[u], props), n && ("years" === t || "days" === t)) l.toggleClass("u-hidden", u >= a)
                }
        }, CountdownCommon.prototype.doSetVal = function (t, e, props) {
            if ((props = props || {}).animation && "none" !== props.animation) {
                var n = new CountdownAnimate(t);
                if (n.getOldVal() !== e) n.rollNumber(e, props)
            } else if (t.text() !== e) t.text(e)
        }, CountdownCommon.prototype.showLabel = function (t, e) {
            var n = this.$dom.find(".u-countdown-" + t);
            n.toggleClass("u-hidden", !e), n.parent().children(".u-countdown-separator").each((function (t, el) {
                var e = $(el),
                    n = e.prev(".u-countdown-item"),
                    i = e.nextAll(".u-countdown-item:not(.u-hidden)");
                e.toggleClass("u-hidden", !(n.is(":not(.u-hidden)") && i.is(":not(.u-hidden)")))
            }))
        }, CountdownCommon.prototype.setAfterCountFinished = function () {
            this.$dom.attr("data-after-count-finished", true)
        }, CountdownCommon.prototype.getAfterCountFinished = function () {
            var t = this.$dom.attr("data-after-count-finished") || "false";
            return t && "true" === t || false
        }, CountdownCommon.prototype.getAfterCount = function () {
            return this.$dom.attr("data-after-count") || "none"
        }, CountdownCommon.prototype.getRedirectUrl = function () {
            return this.$dom.attr("data-redirect-url") || "https://"
        }, CountdownCommon.prototype.getCountAnimation = function () {
            return this.$dom.attr("data-count-animation") || "none"
        }, CountdownCommon.prototype.timeDiff = function (t) {
            var e = new Date,
                n;
            if ("down" === this.getDirection()) return CountdownCommon.calcTimeDiff(t, e);
            else return CountdownCommon.calcTimeDiff(e, t)
        }, CountdownCommon.prototype.calcNumber = function (t, e, n) {
            var i = CountdownCommon.timeStringToMilliseconds(n);
            if (!i) return 0;
            var o = new Date,
                a = "up" === this.getDirection() ? 1 : -1,
                s = t + Math.floor((o - e) / i) * a;
            if (s < 0) return 0;
            else return s
        }, CountdownCommon.prototype.parseTime = function (t, e) {
            var n = CountdownCommon.timeStringToMilliseconds(t),
                i = "down" === this.getDirection() ? 1 : -1;
            return new Date(e.getTime() + n * i)
        }, CountdownCommon.calcTimeDiff = function (t, e) {
            if (t <= e) return CountdownCommon.emptyDiff();
            var n = Math.abs(t - e) / 1e3,
                i = Math.floor(n / 31536e3);
            n -= 31536e3 * i;
            var o = Math.floor(n / 86400);
            n -= 86400 * o;
            var a = Math.floor(n / 3600) % 24;
            n -= 3600 * a;
            var s = Math.floor(n / 60) % 60,
                u;
            return n -= 60 * s, {
                years: i,
                days: o,
                hours: a,
                minutes: s,
                seconds: Math.floor(n)
            }
        }, CountdownCommon.emptyDiff = function () {
            return {
                years: 0,
                days: 0,
                hours: 0,
                minutes: 0,
                seconds: 0
            }
        }, CountdownCommon.isEmptyDiff = function (diff) {
            if ("number" == typeof diff) return 0 === diff;
            else return 0 === diff.years && 0 === diff.days && 0 === diff.hours && 0 === diff.minutes && 0 === diff.seconds
        }, CountdownCommon.timeStringToMilliseconds = function (t) {
            var data = t.match(/(\d+)(ms|s|m|h|d|)/);
            if (data && 3 === data.length) {
                var e = parseInt(data[1], 10);
                switch (data[2]) {
                    case "ms":
                        return e;
                    case "s":
                        return 1e3 * e;
                    case "m":
                        return 60 * e * 1e3;
                    case "h":
                        return 3600 * e * 1e3;
                    case "d":
                        return 86400 * e * 1e3;
                    default:
                        return 0
                }
            }
            return 0
        }
    },
    525: function (t, e, n) {
        "use strict";

        function i(t) {
            var e = t.length;
            if (e % 4 > 0) throw new Error("Invalid string. Length must be a multiple of 4");
            var n = t.indexOf("="),
                i;
            if (-1 === n) n = e;
            return [n, n === e ? 0 : 4 - n % 4]
        }

        function o(t) {
            var e = i(t),
                n = e[0],
                o = e[1];
            return 3 * (n + o) / 4 - o
        }

        function a(t, e, n) {
            return 3 * (e + n) / 4 - n
        }

        function s(t) {
            var e, n = i(t),
                o = n[0],
                s = n[1],
                u = new p(a(t, o, s)),
                l = 0,
                c = s > 0 ? o - 4 : o,
                f;
            for (f = 0; f < c; f += 4) e = h[t.charCodeAt(f)] << 18 | h[t.charCodeAt(f + 1)] << 12 | h[t.charCodeAt(f + 2)] << 6 | h[t.charCodeAt(f + 3)], u[l++] = e >> 16 & 255, u[l++] = e >> 8 & 255, u[l++] = 255 & e;
            if (2 === s) e = h[t.charCodeAt(f)] << 2 | h[t.charCodeAt(f + 1)] >> 4, u[l++] = 255 & e;
            if (1 === s) e = h[t.charCodeAt(f)] << 10 | h[t.charCodeAt(f + 1)] << 4 | h[t.charCodeAt(f + 2)] >> 2, u[l++] = e >> 8 & 255, u[l++] = 255 & e;
            return u
        }

        function u(t) {
            return f[t >> 18 & 63] + f[t >> 12 & 63] + f[t >> 6 & 63] + f[63 & t]
        }

        function l(t, e, n) {
            for (var i, o = [], a = e; a < n; a += 3) i = (t[a] << 16 & 16711680) + (t[a + 1] << 8 & 65280) + (255 & t[a + 2]), o.push(u(i));
            return o.join("")
        }

        function c(t) {
            for (var e, n = t.length, i = n % 3, o = [], a = 16383, s = 0, u = n - i; s < u; s += a) o.push(l(t, s, s + a > u ? u : s + a));
            if (1 === i) e = t[n - 1], o.push(f[e >> 2] + f[e << 4 & 63] + "==");
            else if (2 === i) e = (t[n - 2] << 8) + t[n - 1], o.push(f[e >> 10] + f[e >> 4 & 63] + f[e << 2 & 63] + "=");
            return o.join("")
        }
        e.byteLength = o, e.toByteArray = s, e.fromByteArray = c;
        for (var f = [], h = [], p = "undefined" != typeof Uint8Array ? Uint8Array : Array, m = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/", g = 0, v = m.length; g < v; ++g) f[g] = m[g], h[m.charCodeAt(g)] = g;
        h["-".charCodeAt(0)] = 62, h["_".charCodeAt(0)] = 63
    },
    526: function (t, e, n) {
        "use strict";
        /*! ieee754. BSD-3-Clause License. Feross Aboukhadijeh <https://feross.org/opensource> */
        e.read = function (t, e, n, i, o) {
            var a, s, u = 8 * o - i - 1,
                l = (1 << u) - 1,
                c = l >> 1,
                f = -7,
                h = n ? o - 1 : 0,
                d = n ? -1 : 1,
                p = t[e + h];
            for (h += d, a = p & (1 << -f) - 1, p >>= -f, f += u; f > 0; a = 256 * a + t[e + h], h += d, f -= 8);
            for (s = a & (1 << -f) - 1, a >>= -f, f += i; f > 0; s = 256 * s + t[e + h], h += d, f -= 8);
            if (0 === a) a = 1 - c;
            else if (a === l) return s ? NaN : (p ? -1 : 1) * (1 / 0);
            else s += Math.pow(2, i), a -= c;
            return (p ? -1 : 1) * s * Math.pow(2, a - i)
        }, e.write = function (t, e, n, i, o, a) {
            var s, u, l, c = 8 * a - o - 1,
                f = (1 << c) - 1,
                h = f >> 1,
                p = 23 === o ? Math.pow(2, -24) - Math.pow(2, -77) : 0,
                m = i ? 0 : a - 1,
                d = i ? 1 : -1,
                g = e < 0 || 0 === e && 1 / e < 0 ? 1 : 0;
            if (e = Math.abs(e), isNaN(e) || e === 1 / 0) u = isNaN(e) ? 1 : 0, s = f;
            else {
                if (s = Math.floor(Math.log(e) / Math.LN2), e * (l = Math.pow(2, -s)) < 1) s--, l *= 2;
                if (s + h >= 1) e += p / l;
                else e += p * Math.pow(2, 1 - h);
                if (e * l >= 2) s++, l /= 2;
                if (s + h >= f) u = 0, s = f;
                else if (s + h >= 1) u = (e * l - 1) * Math.pow(2, o), s += h;
                else u = e * Math.pow(2, h - 1) * Math.pow(2, o), s = 0
            }
            for (; o >= 8; t[n + m] = 255 & u, m += d, u /= 256, o -= 8);
            for (s = s << o | u, c += o; c > 0; t[n + m] = 255 & s, m += d, s /= 256, c -= 8);
            t[n + m - d] |= 128 * g
        }
    },
    527: function (t, e, n) {
        "use strict";
        var i = {}.toString;
        t.exports = Array.isArray || function (t) {
            return "[object Array]" == i.call(t)
        }
    },
    532: function (t, e, n) {
        "use strict";

        function PaginationBuilder(pagination, data, t) {
            this.data = data, this.options = t, this.pagination = pagination.clone();
            var e = this.pagination.attr("data-pagination-options");
            if (e) this.styleOptions = JSON.parse(e);
            else {
                var n = this.pagination.find("li:not(.disabled):not(.active)"),
                    i = n.find("a");
                this.styleOptions = {
                    ul: 'style="' + (this.pagination.attr("style") || "") + '" class="' + (this.pagination.attr("class") || "") + '"',
                    li: 'style="' + (n.attr("style") || "") + '" class="' + (n.attr("class") || "") + '"',
                    link: 'style="' + (i.attr("style") || "") + '" class="' + (i.attr("class") || "") + '"'
                }
            }
        }

        function i(t, e, n) {
            if (0 === t) return {
                active: false,
                data: "<span>&#12298</span>"
            };
            else return {
                active: true,
                data: '<a title="Start" href="' + (n ? "#1" : "../" + e) + '">&#12298</a>'
            };
            var i
        }

        function o(t, e, n) {
            if (0 === t) return {
                active: false,
                data: "<span>&#12296</span>"
            };
            var i;
            if (n) i = 1 === t ? "#" + t : "#1";
            else t = t - 1 ? "_" + t : "", i = "../" + e.replace(/\.html/i, t + ".html");
            return {
                active: true,
                data: '<a title="Prev" href="' + i + '">&#12296</a>'
            }
        }

        function a(t, e, n, i) {
            var o = t + 1,
                a;
            if (o >= i) return {
                active: false,
                data: "<span>&#12297</span>"
            };
            if (n) a = "#" + (o + 1);
            else a = "../" + e.replace(/\.html/i, "_" + o + ".html");
            return {
                active: true,
                data: '<a title="Next" href="' + a + '">&#12297</a>'
            }
        }

        function s(t, e, n, i) {
            var o, a;
            if (t + 1 >= i) return {
                active: false,
                data: "<span>&#12299</span>"
            };
            if (n) a = "#" + i;
            else a = "../" + e.replace(/\.html/, "_" + (i - 1) + ".html");
            return {
                active: true,
                data: '<a title="End" href="' + a + '">&#12299</a>'
            }
        }

        function u(t, e, n, i) {
            for (var o = [], all = i, a = 0, s = 1, u = 1; all > a;) {
                var l = true,
                    c;
                if (n) c = "#" + (a ? a + 1 : "1");
                else c = "../" + e.replace(/\.html/, (a ? "_" + a : "") + ".html");
                var data = '<a href="' + c + '">' + s + "</a>";
                if (a === t) l = false, data = "<span>" + s + "</span>", u = s;
                o.push({
                    active: l,
                    data: data
                }), a++, s++
            }
            var f = 10,
                h = 5;
            if (o.length > f) {
                var p = o.slice(0, u),
                    m = o.slice(u),
                    g, v;
                if (p.length < h) g = p, v = o.slice(u, f - g.length);
                else if (m.length < h) {
                    var y = f - (v = m).length;
                    g = o.slice(u - y, y)
                } else g = o.slice(u - h, h), v = o.slice(u, h);
                o = g.concat(v)
            }
            return o
        }
        t.exports = PaginationBuilder, PaginationBuilder.prototype.getPagination = function (t) {
            var e = this.data.listItems.length,
                list = this.buildPagination(t, e),
                n = this.styleOptions.ul,
                i = this.styleOptions.li,
                o = i.replace('class="', 'class="active '),
                a = i.replace('class="', 'class="start '),
                s = i.replace('class="', 'class="prev '),
                u = i.replace('class="', 'class="next '),
                l = i.replace('class="', 'class="end '),
                link = this.styleOptions.link,
                html = [],
                c = document.createElement("ul");
            if (c.setAttribute("data-pagination-options", JSON.stringify(this.styleOptions)), html.push(c.outerHTML.replace("<ul", "<ul " + n).replace("</ul>", "")), list.start.active) html.push("<li " + a + ">"), html.push(list.start.data), html.push("</li>");
            if (list.previous.active) html.push("<li " + s + ">"), html.push(list.previous.data), html.push("</li>");
            for (var f = 0; f < list.pages.length; f++) {
                var page = list.pages[f];
                html.push("<li " + (page.active ? i : o) + ">" + page.data + "</li>")
            }
            if (list.next.active) html.push("<li " + u + ">"), html.push(list.next.data), html.push("</li>");
            if (list.end.active) html.push("<li " + l + ">"), html.push(list.end.data), html.push("</li>");
            return html.push("</ul>"), html = (html = (html = html.join("")).replace(/<a /g, "<a " + link + " ")).replace(/<span/g, "<span " + link + " ")
        }, PaginationBuilder.prototype.buildPagination = function (t, e) {
            var list = {},
                n = this.options.isPage,
                l = this.options.listHref;
            return list.start = i(t, l, n), list.previous = o(t, l, n), list.pages = u(t, l, n, e), list.next = a(t, l, n, e), list.end = s(t, l, n, e), list
        }, window.PaginationBuilder = PaginationBuilder
    },
    535: function (t, e, n) {
        "use strict";
        (function (t, e) {
            ! function (t, n) {
                function i(t) {
                    if ("function" != typeof t) t = new Function("" + t);
                    for (var e = new Array(arguments.length - 1), n = 0; n < e.length; n++) e[n] = arguments[n + 1];
                    var i = {
                        callback: t,
                        args: e
                    };
                    return g[m] = i, w(m), m++
                }

                function o(t) {
                    delete g[t]
                }

                function a(t) {
                    var e = t.callback,
                        i = t.args;
                    switch (i.length) {
                        case 0:
                            e();
                            break;
                        case 1:
                            e(i[0]);
                            break;
                        case 2:
                            e(i[0], i[1]);
                            break;
                        case 3:
                            e(i[0], i[1], i[2]);
                            break;
                        default:
                            e.apply(n, i);
                            break
                    }
                }

                function s(t) {
                    if (v) setTimeout(s, 0, t);
                    else {
                        var e = g[t];
                        if (e) {
                            v = true;
                            try {
                                a(e)
                            } finally {
                                o(t), v = false
                            }
                        }
                    }
                }

                function u() {
                    w = function (t) {
                        e.nextTick((function () {
                            s(t)
                        }))
                    }
                }

                function l() {
                    if (t.postMessage && !t.importScripts) {
                        var e = true,
                            n = t.onmessage;
                        return t.onmessage = function () {
                            e = false
                        }, t.postMessage("", "*"), t.onmessage = n, e
                    }
                }

                function c() {
                    var e = "setImmediate$" + Math.random() + "$",
                        n = function (n) {
                            if (n.source === t && "string" == typeof n.data && 0 === n.data.indexOf(e)) s(+n.data.slice(e.length))
                        };
                    if (t.addEventListener) t.addEventListener("message", n, false);
                    else t.attachEvent("onmessage", n);
                    w = function (n) {
                        t.postMessage(e + n, "*")
                    }
                }

                function f() {
                    var t = new MessageChannel;
                    t.port1.onmessage = function (t) {
                        var e;
                        s(t.data)
                    }, w = function (e) {
                        t.port2.postMessage(e)
                    }
                }

                function h() {
                    var html = y.documentElement;
                    w = function (t) {
                        var e = y.createElement("script");
                        e.onreadystatechange = function () {
                            s(t), e.onreadystatechange = null, html.removeChild(e), e = null
                        }, html.appendChild(e)
                    }
                }

                function p() {
                    w = function (t) {
                        setTimeout(s, 0, t)
                    }
                }
                if (!t.setImmediate) {
                    var m = 1,
                        g = {},
                        v = false,
                        y = t.document,
                        w, b = Object.getPrototypeOf && Object.getPrototypeOf(t);
                    if (b = b && b.setTimeout ? b : t, "[object process]" === {}.toString.call(t.process)) u();
                    else if (l()) c();
                    else if (t.MessageChannel) f();
                    else if (y && "onreadystatechange" in y.createElement("script")) h();
                    else p();
                    b.setImmediate = i, b.clearImmediate = o
                }
            }("undefined" == typeof self ? void 0 === t ? this : t : self)
        }).call(e, n(58), n(112))
    },
    537: function (t, e, n) {
        "use strict";
        (function (e) {
            function n(input, t) {
                var e = 0,
                    base = t.length,
                    n = t.charAt(0),
                    i = [0];
                for (e = 0; e < input.length(); ++e) {
                    for (var o = 0, a = input.at(e); o < i.length; ++o) a += i[o] << 8, i[o] = a % base, a = a / base | 0;
                    for (; a > 0;) i.push(a % base), a = a / base | 0
                }
                var s = "";
                for (e = 0; 0 === input.at(e) && e < input.length() - 1; ++e) s += n;
                for (e = i.length - 1; e >= 0; --e) s += t[i[e]];
                return s
            }
            var i = {};
            t.exports = i;
            var o = {};
            i.encode = function (input, t, e) {
                if ("string" != typeof t) throw new TypeError('"alphabet" must be a string.');
                if (void 0 !== e && "number" != typeof e) throw new TypeError('"maxline" must be a number.');
                var i = "";
                if (!(input instanceof Uint8Array)) i = n(input, t);
                else {
                    var o = 0,
                        base = t.length,
                        a = t.charAt(0),
                        s = [0];
                    for (o = 0; o < input.length; ++o) {
                        for (var u = 0, l = input[o]; u < s.length; ++u) l += s[u] << 8, s[u] = l % base, l = l / base | 0;
                        for (; l > 0;) s.push(l % base), l = l / base | 0
                    }
                    for (o = 0; 0 === input[o] && o < input.length - 1; ++o) i += a;
                    for (o = s.length - 1; o >= 0; --o) i += t[s[o]]
                }
                if (e) {
                    var c = new RegExp(".{1," + e + "}", "g");
                    i = i.match(c).join("\r\n")
                }
                return i
            }, i.decode = function (input, t) {
                if ("string" != typeof input) throw new TypeError('"input" must be a string.');
                if ("string" != typeof t) throw new TypeError('"alphabet" must be a string.');
                var table = o[t];
                if (!table) {
                    table = o[t] = [];
                    for (var n = 0; n < t.length; ++n) table[t.charCodeAt(n)] = n
                }
                input = input.replace(/\s/g, "");
                for (var base = t.length, i = t.charAt(0), a = [0], n = 0; n < input.length; n++) {
                    var s = table[input.charCodeAt(n)];
                    if (void 0 === s) return;
                    for (var u = 0, l = s; u < a.length; ++u) l += a[u] * base, a[u] = 255 & l, l >>= 8;
                    for (; l > 0;) a.push(255 & l), l >>= 8
                }
                for (var c = 0; input[c] === i && c < input.length - 1; ++c) a.push(0);
                if (void 0 !== e) return e.from(a.reverse());
                else return new Uint8Array(a.reverse())
            }
        }).call(e, n(60).Buffer)
    },
    58: function (t, e, n) {
        "use strict";
        var i;
        i = function () {
            return this
        }();
        try {
            i = i || Function("return this")() || (1, eval)("this")
        } catch (t) {
            if ("object" == typeof window) i = window
        }
        t.exports = i
    },
    583: function (t, e, n) {
        "use strict";
        var i = t.exports;
        i.apply = function (t, state) {
            if (!t) return console.error("StepCss.apply: DOM element is not valid"), void 0;
            var e = "transform, opacity, filter",
                n = getComputedStyle(t);
            if ("auto" === n.willChange && state.willChange) t.style["will-change"] = "transform, opacity, filter";
            else if (n.willChange === e && !state.willChange) t.style["will-change"] = "";
            i.applyTransform(t, state), i.applyOpacity(t, state), i.applyFilter(t, state), i.applyBG(t, state), i.applyPosition(t, state)
        }, i.applyTransform = function t(e, state) {
            var transform = [],
                n = parseFloat(state.mx) || 0,
                i = parseFloat(state.my) || 0,
                o = parseFloat(state.rot) || 0,
                a = parseFloat(state.sx),
                s = parseFloat(state.sy);
            if (!Number.isFinite(a)) a = 1;
            if (!Number.isFinite(s)) s = 1;
            if (n) transform.push("translateX(" + n.toFixed(3) + "px)");
            if (i || state._fixedDist) {
                var u = i + (state._fixedDist || 0);
                transform.push("translateY(" + u.toFixed(3) + "px)")
            }
            if (o) transform.push("rotate(" + o.toFixed(3) + "deg)");
            if (1 !== a || 1 !== s) transform.push("scale(" + a.toFixed(3) + ", " + s.toFixed(3) + ")");
            if (!transform.length) transform.push("rotate(0deg)");
            e.style.transform = transform.join(" ")
        }, i.applyOpacity = function t(e, state) {
            var n = parseFloat(state.op);
            if (!Number.isFinite(n)) n = 1;
            e.style.opacity = 1 === n ? "" : n.toFixed(3)
        }, i.applyFilter = function t(e, state) {
            var n = parseFloat(state.blur) || 0;
            e.style.filter = n ? "blur(" + n.toFixed(3) + "px)" : ""
        }, i.applyBG = function t(e, state) {
            var n = parseFloat(state.bgy) || 0;
            e.style["background-position"] = "50% " + n.toFixed(2) + "vh"
        }, i.applyPosition = function t(e, state) {
            e.classList.toggle("u-animation-sticky", Boolean(state.sticky)), e.classList.toggle("u-animation-fixed", Boolean(state.fixed))
        }, window.StepCss = i
    },
    586: function (t, e, n) {
        "use strict";
        var i = n(267).instance();
        i.registerAnimation(n(587)), i.registerAnimation(n(590)), i.registerAnimation(n(268))
    },
    587: function (t, e, n) {
        "use strict";

        function i(t, e) {
            this.info = t, this.hint = e, this.timeoutId = null
        }
        var o = n(588);
        t.exports = i, i.isMatch = function (t) {
            return t && "counter" === t.name
        }, i.create = function (t, e) {
            return new i(t, e)
        }, i.prototype.init = function init() {
            var t = this.info.element;
            if (!this.countUp && t) {
                var e = /(\D*)(\d+(?:([.,])(\d+))?)(.*)/.exec(t.textContent),
                    n = 1,
                    i = 2,
                    a = 3,
                    s = 4,
                    u = 5;
                if (null !== e && e[i] && !(e[i].length > 15)) {
                    var l = e[i];
                    if ("," === e[a]) l = l.replace(",", ".");
                    if ((l = Number(l)) && !isNaN(l) && isFinite(l)) {
                        if (this.hint) this.hint.hintBrowser(this.info);
                        var c = 0;
                        if (e[s]) c = e[s].length;
                        var f = {
                            element: t,
                            prefix: e[n],
                            decimal: e[a],
                            decimals: c,
                            suffix: e[u],
                            startVal: 0,
                            endVal: l,
                            duration: this.info.durationRaw,
                            cycle: this.info.animationCycle,
                            separator: ""
                        };
                        this.countUp = new o(f)
                    }
                }
            }
        }, i.prototype.start = function t() {
            if (this.countUp) {
                if (this.countUp.reset(), this._timeoutId) clearTimeout(this._timeoutId);
                var e = function () {
                        this._timeoutId = null, this.countUp.start()
                    }.bind(this),
                    n = this.info.delay;
                if (isNaN(n)) n = 0;
                if (!n) return e(), void 0;
                this._timeoutId = setTimeout(e, n)
            }
        }, i.prototype.startOut = function t() {
            if (this._timeoutId) clearTimeout(this._timeoutId), this._timeoutId = null
        }, i.prototype.reset = function t() {
            if (this.countUp) this.countUp.reset()
        }, i.prototype.isInOutAnimation = function t() {
            return true
        }, i.prototype.needOutAnimation = function t() {
            return false
        }, i.prototype.clear = function t() {
            if (this.hint) this.hint.removeHint(this.info)
        }, i.prototype.getTime = function t() {
            if (!this.info) return 0;
            var e = this.info.duration,
                n = this.info.delay;
            if (isNaN(n)) n = 0;
            return n + e
        }, i.prototype.getOutTime = function t() {
            return 0
        }
    },
    588: function (t, e, n) {
        "use strict";

        function i(t) {
            this.initialize(t)
        }

        function o(countUp, t, e) {
            if (countUp) {
                if (t = Number(t), isNaN(t) || !isFinite(t) || 0 === t) t = 1;
                var n = 0,
                    i = function () {
                        if (++n < t) countUp.reset(), countUp.start(i);
                        else if ("function" == typeof e) e()
                    };
                countUp.start(i)
            }
        }
        n(589), i.prototype.initialize = function t(e) {
            if (!this.countUp && e.element) {
                var n = e.startVal,
                    i = e.endVal,
                    o = e.decimals,
                    a = e.duration;
                if ((n || 0 == +n) && (i || 0 == +i)) {
                    if (a)
                        if (a = Number(a) / 1e3, isNaN(a)) a = void 0;
                    this.cycle = e.cycle, this.countUp = new CountUp(e.element, n, i, o, a, e), this.started = false
                }
            }
        }, i.prototype.reset = function t() {
            if (this.started = false, this.countUp) this.countUp.reset()
        }, i.prototype.start = function t() {
            if (this.countUp && !this.started) this.started = true, o(this.countUp, this.cycle)
        }, t.exports = i
    },
    589: function (t, e) {
        var e = void 0,
            t = void 0;
        (function () {
            ! function (n, factory) {
                if ("function" == typeof define && define.amd) define(factory);
                else if ("object" == typeof e) t.exports = factory(require, e, t);
                else n.CountUp = factory()
            }(this, (function (t, e, n) {
                var CountUp;
                return function (t, e, n, i, o, a) {
                    function s(t) {
                        var e, n, i, o, a, s;
                        if (t = t.toFixed(c.decimals), n = (e = (t += "").split("."))[0], i = e.length > 1 ? c.options.decimal + e[1] : "", c.options.useGrouping) {
                            for (o = "", a = 0, s = n.length; a < s; ++a) {
                                if (0 !== a && a % 3 == 0) o = c.options.separator + o;
                                o = n[s - a - 1] + o
                            }
                            n = o
                        }
                        if (c.options.numerals.length) n = n.replace(/[0-9]/g, (function (t) {
                            return c.options.numerals[+t]
                        })), i = i.replace(/[0-9]/g, (function (t) {
                            return c.options.numerals[+t]
                        }));
                        return c.options.prefix + n + i + c.options.suffix
                    }

                    function u(t, e, n, d) {
                        return n * (-Math.pow(2, -10 * t / d) + 1) * 1024 / 1023 + e
                    }

                    function l(t) {
                        return "number" == typeof t && !isNaN(t)
                    }
                    var c = this;
                    if (c.version = function () {
                            return "1.9.2"
                        }, c.options = {
                            useEasing: true,
                            useGrouping: true,
                            separator: ",",
                            decimal: ".",
                            easingFn: u,
                            formattingFn: s,
                            prefix: "",
                            suffix: "",
                            numerals: []
                        }, a && "object" == typeof a)
                        for (var f in c.options)
                            if (a.hasOwnProperty(f) && null !== a[f]) c.options[f] = a[f];
                    if ("" === c.options.separator) c.options.useGrouping = false;
                    else c.options.separator = "" + c.options.separator;
                    for (var h = 0, p = ["webkit", "moz", "ms", "o"], m = 0; m < p.length && !window.requestAnimationFrame; ++m) window.requestAnimationFrame = window[p[m] + "RequestAnimationFrame"], window.cancelAnimationFrame = window[p[m] + "CancelAnimationFrame"] || window[p[m] + "CancelRequestAnimationFrame"];
                    if (!window.requestAnimationFrame) window.requestAnimationFrame = function (t, e) {
                        var n = (new Date).getTime(),
                            i = Math.max(0, 16 - (n - h)),
                            id = window.setTimeout((function () {
                                t(n + i)
                            }), i);
                        return h = n + i, id
                    };
                    if (!window.cancelAnimationFrame) window.cancelAnimationFrame = function (id) {
                        clearTimeout(id)
                    };
                    if (c.initialize = function () {
                            if (c.initialized) return true;
                            if (c.error = "", c.d = "string" == typeof t ? document.getElementById(t) : t, !c.d) return c.error = "[CountUp] target is null or undefined", false;
                            if (c.startVal = Number(e), c.endVal = Number(n), l(c.startVal) && l(c.endVal)) return c.decimals = Math.max(0, i || 0), c.dec = Math.pow(10, c.decimals), c.duration = 1e3 * Number(o) || 2e3, c.countDown = c.startVal > c.endVal, c.frameVal = c.startVal, c.initialized = true, true;
                            else return c.error = "[CountUp] startVal (" + e + ") or endVal (" + n + ") is not a number", false
                        }, c.printValue = function (t) {
                            var e = c.options.formattingFn(t);
                            if ("INPUT" === c.d.tagName) this.d.value = e;
                            else if ("text" === c.d.tagName || "tspan" === c.d.tagName) this.d.textContent = e;
                            else this.d.innerHTML = e
                        }, c.count = function (t) {
                            if (!c.startTime) c.startTime = t;
                            c.timestamp = t;
                            var e = t - c.startTime;
                            if (c.remaining = c.duration - e, c.options.useEasing)
                                if (c.countDown) c.frameVal = c.startVal - c.options.easingFn(e, 0, c.startVal - c.endVal, c.duration);
                                else c.frameVal = c.options.easingFn(e, c.startVal, c.endVal - c.startVal, c.duration);
                            else if (c.countDown) c.frameVal = c.startVal - (c.startVal - c.endVal) * (e / c.duration);
                            else c.frameVal = c.startVal + (c.endVal - c.startVal) * (e / c.duration);
                            if (c.countDown) c.frameVal = c.frameVal < c.endVal ? c.endVal : c.frameVal;
                            else c.frameVal = c.frameVal > c.endVal ? c.endVal : c.frameVal;
                            if (c.frameVal = Math.round(c.frameVal * c.dec) / c.dec, c.printValue(c.frameVal), e < c.duration) c.rAF = requestAnimationFrame(c.count);
                            else if (c.callback) c.callback()
                        }, c.start = function (t) {
                            if (c.initialize()) c.callback = t, c.rAF = requestAnimationFrame(c.count)
                        }, c.pauseResume = function () {
                            if (!c.paused) c.paused = true, cancelAnimationFrame(c.rAF);
                            else c.paused = false, delete c.startTime, c.duration = c.remaining, c.startVal = c.frameVal, requestAnimationFrame(c.count)
                        }, c.reset = function () {
                            if (c.paused = false, delete c.startTime, c.initialized = false, c.initialize()) cancelAnimationFrame(c.rAF), c.printValue(c.startVal)
                        }, c.update = function (t) {
                            if (c.initialize()) {
                                if (!l(t = Number(t))) return c.error = "[CountUp] update() - new endVal is not a number: " + t, void 0;
                                if (c.error = "", t !== c.frameVal) cancelAnimationFrame(c.rAF), c.paused = false, delete c.startTime, c.startVal = c.frameVal, c.endVal = t, c.countDown = c.startVal > c.endVal, c.rAF = requestAnimationFrame(c.count)
                            }
                        }, c.initialize()) c.printValue(c.startVal)
                }
            }))
        }).call(window)
    },
    590: function (t, e, n) {
        "use strict";

        function i() {
            o.apply(this, arguments), this.backstageClass = ["backstage", "u-backstage-hidden"]
        }
        var o = n(268);
        Object.assign(i.prototype, o.prototype), t.exports = i, i.isMatch = function (t) {
            var e = (t && t.name || "").toLowerCase();
            return ["slidein", "fadein", "flipin", "bouncein", "jackinthebox", "lightspeedin", "customanimationin"].indexOf(e) > -1
        }, i.create = function (t, e) {
            return new i(t, e)
        }
    },
    60: function (t, e, n) {
        "use strict";
        (function (t) {
            function i() {
                try {
                    var t = new Uint8Array(1);
                    return t.__proto__ = {
                        __proto__: Uint8Array.prototype,
                        foo: function () {
                            return 42
                        }
                    }, 42 === t.foo() && "function" == typeof t.subarray && 0 === t.subarray(1, 1).byteLength
                } catch (t) {
                    return false
                }
            }

            function o() {
                return s.TYPED_ARRAY_SUPPORT ? 2147483647 : 1073741823
            }

            function a(t, length) {
                if (o() < length) throw new RangeError("Invalid typed array length");
                if (s.TYPED_ARRAY_SUPPORT)(t = new Uint8Array(length)).__proto__ = s.prototype;
                else {
                    if (null === t) t = new s(length);
                    t.length = length
                }
                return t
            }

            function s(t, e, length) {
                if (!(s.TYPED_ARRAY_SUPPORT || this instanceof s)) return new s(t, e, length);
                if ("number" == typeof t) {
                    if ("string" == typeof e) throw new Error("If encoding is specified then the first argument must be a string");
                    return f(this, t)
                }
                return u(this, t, e, length)
            }

            function u(t, e, n, length) {
                if ("number" == typeof e) throw new TypeError('"value" argument must not be a number');
                if ("undefined" != typeof ArrayBuffer && e instanceof ArrayBuffer) return m(t, e, n, length);
                if ("string" == typeof e) return h(t, e, n);
                else return g(t, e)
            }

            function l(size) {
                if ("number" != typeof size) throw new TypeError('"size" argument must be a number');
                else if (size < 0) throw new RangeError('"size" argument must not be negative')
            }

            function c(t, size, e, n) {
                if (l(size), size <= 0) return a(t, size);
                if (void 0 !== e) return "string" == typeof n ? a(t, size).fill(e, n) : a(t, size).fill(e);
                else return a(t, size)
            }

            function f(t, size) {
                if (l(size), t = a(t, size < 0 ? 0 : 0 | v(size)), !s.TYPED_ARRAY_SUPPORT)
                    for (var e = 0; e < size; ++e) t[e] = 0;
                return t
            }

            function h(t, e, n) {
                if ("string" != typeof n || "" === n) n = "utf8";
                if (!s.isEncoding(n)) throw new TypeError('"encoding" must be a valid string encoding');
                var length = 0 | w(e, n),
                    i = (t = a(t, length)).write(e, n);
                if (i !== length) t = t.slice(0, i);
                return t
            }

            function p(t, e) {
                var length = e.length < 0 ? 0 : 0 | v(e.length);
                t = a(t, length);
                for (var n = 0; n < length; n += 1) t[n] = 255 & e[n];
                return t
            }

            function m(t, e, n, length) {
                if (e.byteLength, n < 0 || e.byteLength < n) throw new RangeError("'offset' is out of bounds");
                if (e.byteLength < n + (length || 0)) throw new RangeError("'length' is out of bounds");
                if (void 0 === n && void 0 === length) e = new Uint8Array(e);
                else if (void 0 === length) e = new Uint8Array(e, n);
                else e = new Uint8Array(e, n, length);
                if (s.TYPED_ARRAY_SUPPORT)(t = e).__proto__ = s.prototype;
                else t = p(t, e);
                return t
            }

            function g(t, e) {
                if (s.isBuffer(e)) {
                    var n = 0 | v(e.length);
                    if (0 === (t = a(t, n)).length) return t;
                    else return e.copy(t, 0, 0, n), t
                }
                if (e) {
                    if ("undefined" != typeof ArrayBuffer && e.buffer instanceof ArrayBuffer || "length" in e)
                        if ("number" != typeof e.length || rt(e.length)) return a(t, 0);
                        else return p(t, e);
                    if ("Buffer" === e.type && st(e.data)) return p(t, e.data)
                }
                throw new TypeError("First argument must be a string, Buffer, ArrayBuffer, Array, or array-like object.")
            }

            function v(length) {
                if (length >= o()) throw new RangeError("Attempt to allocate Buffer larger than maximum " + "size: 0x" + o().toString(16) + " bytes");
                return 0 | length
            }

            function y(length) {
                if (+length != length) length = 0;
                return s.alloc(+length)
            }

            function w(t, e) {
                if (s.isBuffer(t)) return t.length;
                if ("undefined" != typeof ArrayBuffer && "function" == typeof ArrayBuffer.isView && (ArrayBuffer.isView(t) || t instanceof ArrayBuffer)) return t.byteLength;
                if ("string" != typeof t) t = "" + t;
                var n = t.length;
                if (0 === n) return 0;
                for (var i = false;;) switch (e) {
                    case "ascii":
                    case "latin1":
                    case "binary":
                        return n;
                    case "utf8":
                    case "utf-8":
                    case void 0:
                        return Z(t).length;
                    case "ucs2":
                    case "ucs-2":
                    case "utf16le":
                    case "utf-16le":
                        return 2 * n;
                    case "hex":
                        return n >>> 1;
                    case "base64":
                        return tt(t).length;
                    default:
                        if (i) return Z(t).length;
                        e = ("" + e).toLowerCase(), i = true
                }
            }

            function b(t, e, n) {
                var i = false;
                if (void 0 === e || e < 0) e = 0;
                if (e > this.length) return "";
                if (void 0 === n || n > this.length) n = this.length;
                if (n <= 0) return "";
                if ((n >>>= 0) <= (e >>>= 0)) return "";
                if (!t) t = "utf8";
                for (; true;) switch (t) {
                    case "hex":
                        return F(this, e, n);
                    case "utf8":
                    case "utf-8":
                        return L(this, e, n);
                    case "ascii":
                        return O(this, e, n);
                    case "latin1":
                    case "binary":
                        return B(this, e, n);
                    case "base64":
                        return M(this, e, n);
                    case "ucs2":
                    case "ucs-2":
                    case "utf16le":
                    case "utf-16le":
                        return N(this, e, n);
                    default:
                        if (i) throw new TypeError("Unknown encoding: " + t);
                        t = (t + "").toLowerCase(), i = true
                }
            }

            function C(t, e, n) {
                var i = t[e];
                t[e] = t[n], t[n] = i
            }

            function S(t, e, n, i, o) {
                if (0 === t.length) return -1;
                if ("string" == typeof n) i = n, n = 0;
                else if (n > 2147483647) n = 2147483647;
                else if (n < -2147483648) n = -2147483648;
                if (n = +n, isNaN(n)) n = o ? 0 : t.length - 1;
                if (n < 0) n = t.length + n;
                if (n >= t.length)
                    if (o) return -1;
                    else n = t.length - 1;
                else if (n < 0)
                    if (o) n = 0;
                    else return -1;
                if ("string" == typeof e) e = s.from(e, i);
                if (s.isBuffer(e))
                    if (0 === e.length) return -1;
                    else return x(t, e, n, i, o);
                else if ("number" == typeof e) {
                    if (e &= 255, s.TYPED_ARRAY_SUPPORT && "function" == typeof Uint8Array.prototype.indexOf)
                        if (o) return Uint8Array.prototype.indexOf.call(t, e, n);
                        else return Uint8Array.prototype.lastIndexOf.call(t, e, n);
                    return x(t, [e], n, i, o)
                }
                throw new TypeError("val must be string, number or Buffer")
            }

            function x(t, e, n, i, o) {
                function a(t, e) {
                    if (1 === s) return t[e];
                    else return t.readUInt16BE(e * s)
                }
                var s = 1,
                    u = t.length,
                    l = e.length,
                    c;
                if (void 0 !== i)
                    if ("ucs2" === (i = String(i).toLowerCase()) || "ucs-2" === i || "utf16le" === i || "utf-16le" === i) {
                        if (t.length < 2 || e.length < 2) return -1;
                        s = 2, u /= 2, l /= 2, n /= 2
                    } if (o) {
                    var f = -1;
                    for (c = n; c < u; c++)
                        if (a(t, c) === a(e, -1 === f ? 0 : c - f)) {
                            if (-1 === f) f = c;
                            if (c - f + 1 === l) return f * s
                        } else {
                            if (-1 !== f) c -= c - f;
                            f = -1
                        }
                } else {
                    if (n + l > u) n = u - l;
                    for (c = n; c >= 0; c--) {
                        for (var h = true, p = 0; p < l; p++)
                            if (a(t, c + p) !== a(e, p)) {
                                h = false;
                                break
                            } if (h) return c
                    }
                }
                return -1
            }

            function A(t, e, n, length) {
                n = Number(n) || 0;
                var i = t.length - n;
                if (!length) length = i;
                else if ((length = Number(length)) > i) length = i;
                var o = e.length;
                if (o % 2 != 0) throw new TypeError("Invalid hex string");
                if (length > o / 2) length = o / 2;
                for (var a = 0; a < length; ++a) {
                    var s = parseInt(e.substr(2 * a, 2), 16);
                    if (isNaN(s)) return a;
                    t[n + a] = s
                }
                return a
            }

            function _(t, e, n, length) {
                return nt(Z(e, t.length - n), t, n, length)
            }

            function T(t, e, n, length) {
                return nt(X(e), t, n, length)
            }

            function E(t, e, n, length) {
                return T(t, e, n, length)
            }

            function I(t, e, n, length) {
                return nt(tt(e), t, n, length)
            }

            function k(t, e, n, length) {
                return nt(J(e, t.length - n), t, n, length)
            }

            function M(t, e, n) {
                if (0 === e && n === t.length) return ot.fromByteArray(t);
                else return ot.fromByteArray(t.slice(e, n))
            }

            function L(t, e, n) {
                n = Math.min(t.length, n);
                for (var i = [], o = e; o < n;) {
                    var a = t[o],
                        s = null,
                        u = a > 239 ? 4 : a > 223 ? 3 : a > 191 ? 2 : 1;
                    if (o + u <= n) {
                        var l, c, f, h;
                        switch (u) {
                            case 1:
                                if (a < 128) s = a;
                                break;
                            case 2:
                                if (128 == (192 & (l = t[o + 1])))
                                    if ((h = (31 & a) << 6 | 63 & l) > 127) s = h;
                                break;
                            case 3:
                                if (l = t[o + 1], c = t[o + 2], 128 == (192 & l) && 128 == (192 & c))
                                    if ((h = (15 & a) << 12 | (63 & l) << 6 | 63 & c) > 2047 && (h < 55296 || h > 57343)) s = h;
                                break;
                            case 4:
                                if (l = t[o + 1], c = t[o + 2], f = t[o + 3], 128 == (192 & l) && 128 == (192 & c) && 128 == (192 & f))
                                    if ((h = (15 & a) << 18 | (63 & l) << 12 | (63 & c) << 6 | 63 & f) > 65535 && h < 1114112) s = h
                        }
                    }
                    if (null === s) s = 65533, u = 1;
                    else if (s > 65535) s -= 65536, i.push(s >>> 10 & 1023 | 55296), s = 56320 | 1023 & s;
                    i.push(s), o += u
                }
                return P(i)
            }

            function P(t) {
                var e = t.length;
                if (e <= ut) return String.fromCharCode.apply(String, t);
                for (var n = "", i = 0; i < e;) n += String.fromCharCode.apply(String, t.slice(i, i += ut));
                return n
            }

            function O(t, e, n) {
                var i = "";
                n = Math.min(t.length, n);
                for (var o = e; o < n; ++o) i += String.fromCharCode(127 & t[o]);
                return i
            }

            function B(t, e, n) {
                var i = "";
                n = Math.min(t.length, n);
                for (var o = e; o < n; ++o) i += String.fromCharCode(t[o]);
                return i
            }

            function F(t, e, n) {
                var i = t.length;
                if (!e || e < 0) e = 0;
                if (!n || n < 0 || n > i) n = i;
                for (var o = "", a = e; a < n; ++a) o += K(t[a]);
                return o
            }

            function N(t, e, n) {
                for (var i = t.slice(e, n), o = "", a = 0; a < i.length; a += 2) o += String.fromCharCode(i[a] + 256 * i[a + 1]);
                return o
            }

            function U(t, e, length) {
                if (t % 1 != 0 || t < 0) throw new RangeError("offset is not uint");
                if (t + e > length) throw new RangeError("Trying to access beyond buffer length")
            }

            function z(t, e, n, i, o, a) {
                if (!s.isBuffer(t)) throw new TypeError('"buffer" argument must be a Buffer instance');
                if (e > o || e < a) throw new RangeError('"value" argument is out of bounds');
                if (n + i > t.length) throw new RangeError("Index out of range")
            }

            function H(t, e, n, i) {
                if (e < 0) e = 65535 + e + 1;
                for (var o = 0, a = Math.min(t.length - n, 2); o < a; ++o) t[n + o] = (e & 255 << 8 * (i ? o : 1 - o)) >>> 8 * (i ? o : 1 - o)
            }

            function $(t, e, n, i) {
                if (e < 0) e = 4294967295 + e + 1;
                for (var o = 0, a = Math.min(t.length - n, 4); o < a; ++o) t[n + o] = e >>> 8 * (i ? o : 3 - o) & 255
            }

            function Y(t, e, n, i, o, a) {
                if (n + i > t.length) throw new RangeError("Index out of range");
                if (n < 0) throw new RangeError("Index out of range")
            }

            function W(t, e, n, i, o) {
                if (!o) Y(t, e, n, 4, 34028234663852886e22, -34028234663852886e22);
                return at.write(t, e, n, i, 23, 4), n + 4
            }

            function V(t, e, n, i, o) {
                if (!o) Y(t, e, n, 8, 17976931348623157e292, -17976931348623157e292);
                return at.write(t, e, n, i, 52, 8), n + 8
            }

            function G(t) {
                if ((t = j(t).replace(lt, "")).length < 2) return "";
                for (; t.length % 4 != 0;) t += "=";
                return t
            }

            function j(t) {
                if (t.trim) return t.trim();
                else return t.replace(/^\s+|\s+$/g, "")
            }

            function K(t) {
                if (t < 16) return "0" + t.toString(16);
                else return t.toString(16)
            }

            function Z(t, e) {
                var n;
                e = e || 1 / 0;
                for (var length = t.length, i = null, o = [], a = 0; a < length; ++a) {
                    if ((n = t.charCodeAt(a)) > 55295 && n < 57344) {
                        if (!i) {
                            if (n > 56319) {
                                if ((e -= 3) > -1) o.push(239, 191, 189);
                                continue
                            } else if (a + 1 === length) {
                                if ((e -= 3) > -1) o.push(239, 191, 189);
                                continue
                            }
                            i = n;
                            continue
                        }
                        if (n < 56320) {
                            if ((e -= 3) > -1) o.push(239, 191, 189);
                            i = n;
                            continue
                        }
                        n = (i - 55296 << 10 | n - 56320) + 65536
                    } else if (i)
                        if ((e -= 3) > -1) o.push(239, 191, 189);
                    if (i = null, n < 128) {
                        if ((e -= 1) < 0) break;
                        o.push(n)
                    } else if (n < 2048) {
                        if ((e -= 2) < 0) break;
                        o.push(n >> 6 | 192, 63 & n | 128)
                    } else if (n < 65536) {
                        if ((e -= 3) < 0) break;
                        o.push(n >> 12 | 224, n >> 6 & 63 | 128, 63 & n | 128)
                    } else if (n < 1114112) {
                        if ((e -= 4) < 0) break;
                        o.push(n >> 18 | 240, n >> 12 & 63 | 128, n >> 6 & 63 | 128, 63 & n | 128)
                    } else throw new Error("Invalid code point")
                }
                return o
            }

            function X(t) {
                for (var e = [], n = 0; n < t.length; ++n) e.push(255 & t.charCodeAt(n));
                return e
            }

            function J(t, e) {
                for (var n, i, o, a = [], s = 0; s < t.length && !((e -= 2) < 0); ++s) i = (n = t.charCodeAt(s)) >> 8, o = n % 256, a.push(o), a.push(i);
                return a
            }

            function tt(t) {
                return ot.toByteArray(G(t))
            }

            function nt(t, e, n, length) {
                for (var i = 0; i < length && !(i + n >= e.length || i >= t.length); ++i) e[i + n] = t[i];
                return i
            }

            function rt(t) {
                return t != t
            }
            var ot = n(525),
                at = n(526),
                st = n(527);
            if (e.Buffer = s, e.SlowBuffer = y, e.INSPECT_MAX_BYTES = 50, s.TYPED_ARRAY_SUPPORT = void 0 !== t.TYPED_ARRAY_SUPPORT ? t.TYPED_ARRAY_SUPPORT : i(), e.kMaxLength = o(), s.poolSize = 8192, s._augment = function (t) {
                    return t.__proto__ = s.prototype, t
                }, s.from = function (t, e, length) {
                    return u(null, t, e, length)
                }, s.TYPED_ARRAY_SUPPORT)
                if (s.prototype.__proto__ = Uint8Array.prototype, s.__proto__ = Uint8Array, "undefined" != typeof Symbol && Symbol.species && s[Symbol.species] === s) Object.defineProperty(s, Symbol.species, {
                    value: null,
                    configurable: true
                });
            s.alloc = function (size, t, e) {
                return c(null, size, t, e)
            }, s.allocUnsafe = function (size) {
                return f(null, size)
            }, s.allocUnsafeSlow = function (size) {
                return f(null, size)
            }, s.isBuffer = function t(e) {
                return !!(null != e && e._isBuffer)
            }, s.compare = function compare(t, e) {
                if (!s.isBuffer(t) || !s.isBuffer(e)) throw new TypeError("Arguments must be Buffers");
                if (t === e) return 0;
                for (var n = t.length, i = e.length, o = 0, a = Math.min(n, i); o < a; ++o)
                    if (t[o] !== e[o]) {
                        n = t[o], i = e[o];
                        break
                    } if (n < i) return -1;
                if (i < n) return 1;
                else return 0
            }, s.isEncoding = function t(e) {
                switch (String(e).toLowerCase()) {
                    case "hex":
                    case "utf8":
                    case "utf-8":
                    case "ascii":
                    case "latin1":
                    case "binary":
                    case "base64":
                    case "ucs2":
                    case "ucs-2":
                    case "utf16le":
                    case "utf-16le":
                        return true;
                    default:
                        return false
                }
            }, s.concat = function t(list, length) {
                if (!st(list)) throw new TypeError('"list" argument must be an Array of Buffers');
                if (0 === list.length) return s.alloc(0);
                var e;
                if (void 0 === length)
                    for (length = 0, e = 0; e < list.length; ++e) length += list[e].length;
                var n = s.allocUnsafe(length),
                    i = 0;
                for (e = 0; e < list.length; ++e) {
                    var o = list[e];
                    if (!s.isBuffer(o)) throw new TypeError('"list" argument must be an Array of Buffers');
                    o.copy(n, i), i += o.length
                }
                return n
            }, s.byteLength = w, s.prototype._isBuffer = true, s.prototype.swap16 = function t() {
                var e = this.length;
                if (e % 2 != 0) throw new RangeError("Buffer size must be a multiple of 16-bits");
                for (var n = 0; n < e; n += 2) C(this, n, n + 1);
                return this
            }, s.prototype.swap32 = function t() {
                var e = this.length;
                if (e % 4 != 0) throw new RangeError("Buffer size must be a multiple of 32-bits");
                for (var n = 0; n < e; n += 4) C(this, n, n + 3), C(this, n + 1, n + 2);
                return this
            }, s.prototype.swap64 = function t() {
                var e = this.length;
                if (e % 8 != 0) throw new RangeError("Buffer size must be a multiple of 64-bits");
                for (var n = 0; n < e; n += 8) C(this, n, n + 7), C(this, n + 1, n + 6), C(this, n + 2, n + 5), C(this, n + 3, n + 4);
                return this
            }, s.prototype.toString = function t() {
                var length = 0 | this.length;
                if (0 === length) return "";
                if (0 === arguments.length) return L(this, 0, length);
                else return b.apply(this, arguments)
            }, s.prototype.equals = function t(e) {
                if (!s.isBuffer(e)) throw new TypeError("Argument must be a Buffer");
                if (this === e) return true;
                else return 0 === s.compare(this, e)
            }, s.prototype.inspect = function t() {
                var n = "",
                    i = e.INSPECT_MAX_BYTES;
                if (this.length > 0)
                    if (n = this.toString("hex", 0, i).match(/.{2}/g).join(" "), this.length > i) n += " ... ";
                return "<Buffer " + n + ">"
            }, s.prototype.compare = function compare(t, e, n, i, o) {
                if (!s.isBuffer(t)) throw new TypeError("Argument must be a Buffer");
                if (void 0 === e) e = 0;
                if (void 0 === n) n = t ? t.length : 0;
                if (void 0 === i) i = 0;
                if (void 0 === o) o = this.length;
                if (e < 0 || n > t.length || i < 0 || o > this.length) throw new RangeError("out of range index");
                if (i >= o && e >= n) return 0;
                if (i >= o) return -1;
                if (e >= n) return 1;
                if (this === t) return 0;
                for (var a = (o >>>= 0) - (i >>>= 0), u = (n >>>= 0) - (e >>>= 0), l = Math.min(a, u), c = this.slice(i, o), f = t.slice(e, n), h = 0; h < l; ++h)
                    if (c[h] !== f[h]) {
                        a = c[h], u = f[h];
                        break
                    } if (a < u) return -1;
                if (u < a) return 1;
                else return 0
            }, s.prototype.includes = function t(e, n, i) {
                return -1 !== this.indexOf(e, n, i)
            }, s.prototype.indexOf = function t(e, n, i) {
                return S(this, e, n, i, true)
            }, s.prototype.lastIndexOf = function t(e, n, i) {
                return S(this, e, n, i, false)
            }, s.prototype.write = function t(e, n, length, i) {
                if (void 0 === n) i = "utf8", length = this.length, n = 0;
                else if (void 0 === length && "string" == typeof n) i = n, length = this.length, n = 0;
                else if (isFinite(n))
                    if (n |= 0, isFinite(length)) {
                        if (length |= 0, void 0 === i) i = "utf8"
                    } else i = length, length = void 0;
                else throw new Error("Buffer.write(string, encoding, offset[, length]) is no longer supported");
                var o = this.length - n;
                if (void 0 === length || length > o) length = o;
                if (e.length > 0 && (length < 0 || n < 0) || n > this.length) throw new RangeError("Attempt to write outside buffer bounds");
                if (!i) i = "utf8";
                for (var a = false;;) switch (i) {
                    case "hex":
                        return A(this, e, n, length);
                    case "utf8":
                    case "utf-8":
                        return _(this, e, n, length);
                    case "ascii":
                        return T(this, e, n, length);
                    case "latin1":
                    case "binary":
                        return E(this, e, n, length);
                    case "base64":
                        return I(this, e, n, length);
                    case "ucs2":
                    case "ucs-2":
                    case "utf16le":
                    case "utf-16le":
                        return k(this, e, n, length);
                    default:
                        if (a) throw new TypeError("Unknown encoding: " + i);
                        i = ("" + i).toLowerCase(), a = true
                }
            }, s.prototype.toJSON = function t() {
                return {
                    type: "Buffer",
                    data: Array.prototype.slice.call(this._arr || this, 0)
                }
            };
            var ut = 4096;
            s.prototype.slice = function t(e, n) {
                var i = this.length,
                    o;
                if ((e = ~~e) < 0) {
                    if ((e += i) < 0) e = 0
                } else if (e > i) e = i;
                if ((n = void 0 === n ? i : ~~n) < 0) {
                    if ((n += i) < 0) n = 0
                } else if (n > i) n = i;
                if (n < e) n = e;
                if (s.TYPED_ARRAY_SUPPORT)(o = this.subarray(e, n)).__proto__ = s.prototype;
                else {
                    var a = n - e;
                    o = new s(a, void 0);
                    for (var u = 0; u < a; ++u) o[u] = this[u + e]
                }
                return o
            }, s.prototype.readUIntLE = function t(e, n, i) {
                if (e |= 0, n |= 0, !i) U(e, n, this.length);
                for (var o = this[e], a = 1, s = 0; ++s < n && (a *= 256);) o += this[e + s] * a;
                return o
            }, s.prototype.readUIntBE = function t(e, n, i) {
                if (e |= 0, n |= 0, !i) U(e, n, this.length);
                for (var o = this[e + --n], a = 1; n > 0 && (a *= 256);) o += this[e + --n] * a;
                return o
            }, s.prototype.readUInt8 = function t(e, n) {
                if (!n) U(e, 1, this.length);
                return this[e]
            }, s.prototype.readUInt16LE = function t(e, n) {
                if (!n) U(e, 2, this.length);
                return this[e] | this[e + 1] << 8
            }, s.prototype.readUInt16BE = function t(e, n) {
                if (!n) U(e, 2, this.length);
                return this[e] << 8 | this[e + 1]
            }, s.prototype.readUInt32LE = function t(e, n) {
                if (!n) U(e, 4, this.length);
                return (this[e] | this[e + 1] << 8 | this[e + 2] << 16) + 16777216 * this[e + 3]
            }, s.prototype.readUInt32BE = function t(e, n) {
                if (!n) U(e, 4, this.length);
                return 16777216 * this[e] + (this[e + 1] << 16 | this[e + 2] << 8 | this[e + 3])
            }, s.prototype.readIntLE = function t(e, n, i) {
                if (e |= 0, n |= 0, !i) U(e, n, this.length);
                for (var o = this[e], a = 1, s = 0; ++s < n && (a *= 256);) o += this[e + s] * a;
                if (o >= (a *= 128)) o -= Math.pow(2, 8 * n);
                return o
            }, s.prototype.readIntBE = function t(e, n, i) {
                if (e |= 0, n |= 0, !i) U(e, n, this.length);
                for (var o = n, a = 1, s = this[e + --o]; o > 0 && (a *= 256);) s += this[e + --o] * a;
                if (s >= (a *= 128)) s -= Math.pow(2, 8 * n);
                return s
            }, s.prototype.readInt8 = function t(e, n) {
                if (!n) U(e, 1, this.length);
                if (!(128 & this[e])) return this[e];
                else return -1 * (255 - this[e] + 1)
            }, s.prototype.readInt16LE = function t(e, n) {
                if (!n) U(e, 2, this.length);
                var i = this[e] | this[e + 1] << 8;
                return 32768 & i ? 4294901760 | i : i
            }, s.prototype.readInt16BE = function t(e, n) {
                if (!n) U(e, 2, this.length);
                var i = this[e + 1] | this[e] << 8;
                return 32768 & i ? 4294901760 | i : i
            }, s.prototype.readInt32LE = function t(e, n) {
                if (!n) U(e, 4, this.length);
                return this[e] | this[e + 1] << 8 | this[e + 2] << 16 | this[e + 3] << 24
            }, s.prototype.readInt32BE = function t(e, n) {
                if (!n) U(e, 4, this.length);
                return this[e] << 24 | this[e + 1] << 16 | this[e + 2] << 8 | this[e + 3]
            }, s.prototype.readFloatLE = function t(e, n) {
                if (!n) U(e, 4, this.length);
                return at.read(this, e, true, 23, 4)
            }, s.prototype.readFloatBE = function t(e, n) {
                if (!n) U(e, 4, this.length);
                return at.read(this, e, false, 23, 4)
            }, s.prototype.readDoubleLE = function t(e, n) {
                if (!n) U(e, 8, this.length);
                return at.read(this, e, true, 52, 8)
            }, s.prototype.readDoubleBE = function t(e, n) {
                if (!n) U(e, 8, this.length);
                return at.read(this, e, false, 52, 8)
            }, s.prototype.writeUIntLE = function t(e, n, i, o) {
                if (e = +e, n |= 0, i |= 0, !o) {
                    var a;
                    z(this, e, n, i, Math.pow(2, 8 * i) - 1, 0)
                }
                var s = 1,
                    u = 0;
                for (this[n] = 255 & e; ++u < i && (s *= 256);) this[n + u] = e / s & 255;
                return n + i
            }, s.prototype.writeUIntBE = function t(e, n, i, o) {
                if (e = +e, n |= 0, i |= 0, !o) {
                    var a;
                    z(this, e, n, i, Math.pow(2, 8 * i) - 1, 0)
                }
                var s = i - 1,
                    u = 1;
                for (this[n + s] = 255 & e; --s >= 0 && (u *= 256);) this[n + s] = e / u & 255;
                return n + i
            }, s.prototype.writeUInt8 = function t(e, n, i) {
                if (e = +e, n |= 0, !i) z(this, e, n, 1, 255, 0);
                if (!s.TYPED_ARRAY_SUPPORT) e = Math.floor(e);
                return this[n] = 255 & e, n + 1
            }, s.prototype.writeUInt16LE = function t(e, n, i) {
                if (e = +e, n |= 0, !i) z(this, e, n, 2, 65535, 0);
                if (s.TYPED_ARRAY_SUPPORT) this[n] = 255 & e, this[n + 1] = e >>> 8;
                else H(this, e, n, true);
                return n + 2
            }, s.prototype.writeUInt16BE = function t(e, n, i) {
                if (e = +e, n |= 0, !i) z(this, e, n, 2, 65535, 0);
                if (s.TYPED_ARRAY_SUPPORT) this[n] = e >>> 8, this[n + 1] = 255 & e;
                else H(this, e, n, false);
                return n + 2
            }, s.prototype.writeUInt32LE = function t(e, n, i) {
                if (e = +e, n |= 0, !i) z(this, e, n, 4, 4294967295, 0);
                if (s.TYPED_ARRAY_SUPPORT) this[n + 3] = e >>> 24, this[n + 2] = e >>> 16, this[n + 1] = e >>> 8, this[n] = 255 & e;
                else $(this, e, n, true);
                return n + 4
            }, s.prototype.writeUInt32BE = function t(e, n, i) {
                if (e = +e, n |= 0, !i) z(this, e, n, 4, 4294967295, 0);
                if (s.TYPED_ARRAY_SUPPORT) this[n] = e >>> 24, this[n + 1] = e >>> 16, this[n + 2] = e >>> 8, this[n + 3] = 255 & e;
                else $(this, e, n, false);
                return n + 4
            }, s.prototype.writeIntLE = function t(e, n, i, o) {
                if (e = +e, n |= 0, !o) {
                    var a = Math.pow(2, 8 * i - 1);
                    z(this, e, n, i, a - 1, -a)
                }
                var s = 0,
                    u = 1,
                    l = 0;
                for (this[n] = 255 & e; ++s < i && (u *= 256);) {
                    if (e < 0 && 0 === l && 0 !== this[n + s - 1]) l = 1;
                    this[n + s] = (e / u >> 0) - l & 255
                }
                return n + i
            }, s.prototype.writeIntBE = function t(e, n, i, o) {
                if (e = +e, n |= 0, !o) {
                    var a = Math.pow(2, 8 * i - 1);
                    z(this, e, n, i, a - 1, -a)
                }
                var s = i - 1,
                    u = 1,
                    l = 0;
                for (this[n + s] = 255 & e; --s >= 0 && (u *= 256);) {
                    if (e < 0 && 0 === l && 0 !== this[n + s + 1]) l = 1;
                    this[n + s] = (e / u >> 0) - l & 255
                }
                return n + i
            }, s.prototype.writeInt8 = function t(e, n, i) {
                if (e = +e, n |= 0, !i) z(this, e, n, 1, 127, -128);
                if (!s.TYPED_ARRAY_SUPPORT) e = Math.floor(e);
                if (e < 0) e = 255 + e + 1;
                return this[n] = 255 & e, n + 1
            }, s.prototype.writeInt16LE = function t(e, n, i) {
                if (e = +e, n |= 0, !i) z(this, e, n, 2, 32767, -32768);
                if (s.TYPED_ARRAY_SUPPORT) this[n] = 255 & e, this[n + 1] = e >>> 8;
                else H(this, e, n, true);
                return n + 2
            }, s.prototype.writeInt16BE = function t(e, n, i) {
                if (e = +e, n |= 0, !i) z(this, e, n, 2, 32767, -32768);
                if (s.TYPED_ARRAY_SUPPORT) this[n] = e >>> 8, this[n + 1] = 255 & e;
                else H(this, e, n, false);
                return n + 2
            }, s.prototype.writeInt32LE = function t(e, n, i) {
                if (e = +e, n |= 0, !i) z(this, e, n, 4, 2147483647, -2147483648);
                if (s.TYPED_ARRAY_SUPPORT) this[n] = 255 & e, this[n + 1] = e >>> 8, this[n + 2] = e >>> 16, this[n + 3] = e >>> 24;
                else $(this, e, n, true);
                return n + 4
            }, s.prototype.writeInt32BE = function t(e, n, i) {
                if (e = +e, n |= 0, !i) z(this, e, n, 4, 2147483647, -2147483648);
                if (e < 0) e = 4294967295 + e + 1;
                if (s.TYPED_ARRAY_SUPPORT) this[n] = e >>> 24, this[n + 1] = e >>> 16, this[n + 2] = e >>> 8, this[n + 3] = 255 & e;
                else $(this, e, n, false);
                return n + 4
            }, s.prototype.writeFloatLE = function t(e, n, i) {
                return W(this, e, n, true, i)
            }, s.prototype.writeFloatBE = function t(e, n, i) {
                return W(this, e, n, false, i)
            }, s.prototype.writeDoubleLE = function t(e, n, i) {
                return V(this, e, n, true, i)
            }, s.prototype.writeDoubleBE = function t(e, n, i) {
                return V(this, e, n, false, i)
            }, s.prototype.copy = function copy(t, e, n, i) {
                if (!n) n = 0;
                if (!i && 0 !== i) i = this.length;
                if (e >= t.length) e = t.length;
                if (!e) e = 0;
                if (i > 0 && i < n) i = n;
                if (i === n) return 0;
                if (0 === t.length || 0 === this.length) return 0;
                if (e < 0) throw new RangeError("targetStart out of bounds");
                if (n < 0 || n >= this.length) throw new RangeError("sourceStart out of bounds");
                if (i < 0) throw new RangeError("sourceEnd out of bounds");
                if (i > this.length) i = this.length;
                if (t.length - e < i - n) i = t.length - e + n;
                var o = i - n,
                    a;
                if (this === t && n < e && e < i)
                    for (a = o - 1; a >= 0; --a) t[a + e] = this[a + n];
                else if (o < 1e3 || !s.TYPED_ARRAY_SUPPORT)
                    for (a = 0; a < o; ++a) t[a + e] = this[a + n];
                else Uint8Array.prototype.set.call(t, this.subarray(n, n + o), e);
                return o
            }, s.prototype.fill = function t(e, n, i, o) {
                if ("string" == typeof e) {
                    if ("string" == typeof n) o = n, n = 0, i = this.length;
                    else if ("string" == typeof i) o = i, i = this.length;
                    if (1 === e.length) {
                        var a = e.charCodeAt(0);
                        if (a < 256) e = a
                    }
                    if (void 0 !== o && "string" != typeof o) throw new TypeError("encoding must be a string");
                    if ("string" == typeof o && !s.isEncoding(o)) throw new TypeError("Unknown encoding: " + o)
                } else if ("number" == typeof e) e &= 255;
                if (n < 0 || this.length < n || this.length < i) throw new RangeError("Out of range index");
                if (i <= n) return this;
                if (n >>>= 0, i = void 0 === i ? this.length : i >>> 0, !e) e = 0;
                var u;
                if ("number" == typeof e)
                    for (u = n; u < i; ++u) this[u] = e;
                else {
                    var l = s.isBuffer(e) ? e : Z(new s(e, o).toString()),
                        c = l.length;
                    for (u = 0; u < i - n; ++u) this[u + n] = l[u % c]
                }
                return this
            };
            var lt = /[^+\/0-9A-Za-z-_]/g
        }).call(e, n(58))
    },
    654: function (t, e, n) {
        "use strict";

        function i(t, e) {
            if ("string" != typeof t) return 0;
            var n = (new u).replace(t, e).expr;
            if ("" === n.trim()) return 0;
            o(n);
            try {
                var i, l;
                return s(new Function('"use strict";return (' + n + ");")(), 4)
            } catch (e) {
                return a(e, t)
            }
        }

        function o(t) {
            var e = /[^-()\d\s/*+.]+|\/\/|\/\*/g.exec(t),
                n = 20,
                i;
            if (e) {
                var o = {
                    messageKey: "#FormCalc_UnexpectedToken",
                    expression: i = e[0].substring(0, n),
                    position: e.index
                };
                throw Object.assign(new Error("Unexpected token '" + i + "'", {
                    cause: o
                }), {
                    args: o
                })
            }
        }

        function a(t, e) {
            var n = {
                messageKey: "#FormCalc_EvaluationFailed",
                expression: e
            };
            throw Object.assign(new Error("Evaluation failed", {
                cause: n
            }), {
                args: n
            })
        }

        function s(t, e) {
            if (t = Number(t), e = Number(e), isNaN(t) || !isFinite(t)) return t;
            var n = t.toString().split("e"),
                i = n[0],
                o = n[1] || 0,
                a, s, u = Math.round(Number(i + "e" + (+o + e))).toString().split("e")[0],
                l = n[1] || 0;
            return Number(u + "e" + (+l - e))
        }
        var u = n(399);
        t.exports.evaluate = i
    },
    655: function (t, e, n) {
        "use strict";

        function i(el) {
            var t = el.getAttribute("name"),
                type;
            if (!t) return t;
            if (t = t.trim(), "SELECT" === el.tagName) return o(t);
            if ("checkbox" === el.getAttribute("type")) return o(t);
            else return t
        }

        function o(t) {
            if (!t) return t;
            var e = t.lastIndexOf("[][]");
            if (e > 0 && e + 4 === t.length) return t.substring(0, t.length - 4);
            if ((e = t.lastIndexOf("[]")) > 0 && e + 2 === t.length) return t.substring(0, t.length - 2);
            else return t
        }

        function a(el) {
            if ("OPTION" === el.tagName) return el.getAttribute("data-calc");
            var type = el.getAttribute("type");
            if ("number" === type || "range" === type) return el.value;
            if ("radio" === type) return el.getAttribute("data-calc");
            if ("checkbox" === type && null !== el.getAttribute("data-calc")) return el.getAttribute("data-calc");
            if ("checkbox" === type) return el.value;
            else return
        }

        function s(el) {
            return Number(a(el))
        }

        function u(el) {
            if ("OPTION" === el.tagName) return el.selected;
            var type = el.getAttribute("type");
            if ("radio" === type || "checkbox" === type) return el.checked;
            else return true
        }

        function l(el, t) {
            if (t = t || 0, u(el)) return s(el);
            else return t
        }
        var c = t.exports = function t(form) {
            this.fields = [], this.collectInputs(form.querySelectorAll("[type=number], [type=range]")), this.collectInputs(form.querySelectorAll("[type=radio]")), this.collectInputs(form.querySelectorAll('[type="checkbox"]')), this.collectSelects(form.querySelectorAll("select"))
        };
        c.prototype.getScope = function t() {
            return this.fields.reduce((function (t, e) {
                if (!e || !e.name) return t;
                if (!t[e.name]) t[e.name] = 0;
                return t[e.name] += e.value, t
            }), {})
        }, c.prototype.addField = function t(field) {
            return this.fields.push(field), field
        }, c.prototype.collectInputs = function (t) {
            for (var e = 0; e < t.length; e++) this.addField({
                name: i(t[e]),
                value: l(t[e], 0),
                rawValue: a(t[e])
            })
        }, c.prototype.collectSelects = function (t) {
            for (var e = 0; e < t.length; e++) this.collectOptions(i(t[e]), t[e].querySelectorAll("option"))
        }, c.prototype.collectOptions = function (t, e) {
            for (var n = 0; n < e.length; n++) this.addField({
                name: t,
                value: l(e[n], 0),
                rawValue: a(e[n])
            })
        }
    },
    657: function (t, e, n) {
        "use strict";

        function i(t, e, n) {
            var i = t.find(".u-form-progress-step");
            i.removeClass("active done"), o(i.find(".u-form-progress-icon"), "default"), o(i.find(".u-form-progress-icon"), "step");
            var a = t.find(".u-form-progress-step").eq(n);
            a.addClass("active");
            var s = a.prevAll(".u-form-progress-step");
            s.addClass("done"), o(s.find(".u-form-progress-icon"), "done")
        }

        function o(icon, type) {
            type = type || "default", icon.each((function () {
                var t = $(this),
                    e = t.attr("data-step-icon-" + type);
                if (e) t.html(e)
            }))
        }

        function a(t, e, n) {
            var i = t.find(".u-form-progress-bar"),
                o = "calc((100% - var(--step-icon-size)) / " + (e.length - 1) + " * " + n + ")";
            i.css("width", o)
        }
        var FormProgress;
        t.exports.update = function (form, t) {
            if (form.length) {
                var e = form.find(".u-form-progress"),
                    n = form.find(".u-carousel-inner").children();
                if (void 0 === t) t = n.filter(".u-active, .active").index();
                a(e, n, t), i(e, n, t)
            }
        }
    },
    658: function (t, e, n) {
        "use strict";
        var i;
        t.exports.update = function (form, t) {
            var e = form.find(".u-slide");
            if (void 0 === t) t = e.filter(".u-active, .active").index();
            var n = form.find(".u-btn-submit, .u-btn-step"),
                i = n.filter(".u-btn-submit"),
                o = n.filter(".u-btn-step-next"),
                a = n.filter(".u-btn-step-prev");
            if (n.removeClass("u-hidden"), n.css("display", ""), 0 === t) a.addClass("u-hidden");
            if (t === e.length - 1) o.addClass("u-hidden"), i.removeClass("u-hidden");
            if (t < e.length - 1) o.removeClass("u-hidden"), i.addClass("u-hidden")
        }
    },
    659: function (t, e, n) {
        "use strict";
        var FormFileType = n(140),
            FormFileAccept = t.exports = {};
        FormFileAccept[FormFileType.IMAGES] = ".bmp,.dng,.eps,.gif,.jpg,.jpeg,.png,.ps,.raw,.svg,.tga,.tif,.tiff", FormFileAccept[FormFileType.DOCUMENTS] = ".ai,.cdr,.csv,.doc,.docb,.docx,.dot,.dotx,.dwg,.eps,.epub,.fla,.gpx,.ical,.icalendar,.ics,.ifb,.indd,.ipynb,.key,.kml,.kmz,.mobi,.mtf,.mtx,.numbers,.odg,.odp,.ods,.odt,.otp,.ots,.ott,.oxps,.pages,.pdf,.pdn,.pkg,.pot,.potx,.pps,.ppsx,.ppt,.pptx,.psd,.pub,.rtf,.sldx,.txt,.vcf,.xcf,.xls,.xlsx,.xlt,.xltx,.xlw,.xps,.zip", FormFileAccept[FormFileType.VIDEO] = ".3gp,.avi,.divx,.flv,.m1v,.m2ts,.m4v,.mkv,.mov,.mp4,.mpe,.mpeg,.mpg,.mxf,.ogv,.vob.webm,.wmv,.xvid", FormFileAccept[FormFileType.AUDIO] = ".aac,.aif,.aiff,.flac,.m4a,.mp3,.wav,.wma"
    },
    87: function (t, e, n) {
        "use strict";
        var i = n(19);
        t.exports = i.md = i.md || {}, i.md.algorithms = i.md.algorithms || {}
    },
    903: function (t, e, n) {
        "use strict";
        var i = n(904),
            bootstrap = {};
        bootstrap.Util = function (t) {
            function e(t) {
                return t && "object" == typeof t && "default" in t ? t : {
                    default: t
                }
            }

            function n() {
                if (window.QUnit) return false;
                var el = document.createElement("bootstrap");
                for (var t in h)
                    if (void 0 !== el.style[t]) return h[t];
                return false
            }

            function i(t) {
                if (null == t) return "" + t;
                else return {}.toString.call(t).match(/\s([a-z]+)/i)[1].toLowerCase()
            }

            function o() {
                return {
                    bindType: l,
                    delegateType: l,
                    handle: function t(e) {
                        if (u["default"](e.target).is(this)) return e.handleObj.handler.apply(this, arguments)
                    }
                }
            }

            function a(t) {
                var e = this,
                    n = false;
                return u["default"](this).one(Util.TRANSITION_END, (function () {
                    n = true
                })), setTimeout((function () {
                    if (!n) Util.triggerTransitionEnd(e)
                }), t), this
            }

            function s() {
                l = n(), u["default"].fn.emulateTransitionEnd = a, u["default"].event.special[Util.TRANSITION_END] = o()
            }
            var u = e(t),
                l = false,
                c = 1e6,
                f = 1e3,
                h = {
                    WebkitTransition: "webkitTransitionEnd",
                    MozTransition: "transitionend",
                    OTransition: "oTransitionEnd otransitionend",
                    transition: "transitionend"
                },
                Util = {
                    TRANSITION_END: "bsTransitionEnd",
                    getUID: function t(e) {
                        do {
                            e += ~~(Math.random() * c)
                        } while (document.getElementById(e));
                        return e
                    },
                    getSelectorFromElement: function t(e) {
                        var selector = e.getAttribute("data-u-target");
                        if (!selector || "#" === selector) {
                            var n = e.getAttribute("href");
                            selector = n && "#" !== n ? n.trim() : ""
                        }
                        try {
                            return document.querySelector(selector) ? selector : null
                        } catch (t) {
                            return null
                        }
                    },
                    getTransitionDurationFromElement: function t(e) {
                        if (!e) return 0;
                        var n = u["default"](e).css("transition-duration"),
                            i = u["default"](e).css("transition-delay"),
                            o = parseFloat(n),
                            a = parseFloat(i);
                        if (!o && !a) return 0;
                        else return n = n.split(",")[0], i = i.split(",")[0], (parseFloat(n) + parseFloat(i)) * f
                    },
                    reflow: function t(e) {
                        return e.offsetHeight
                    },
                    triggerTransitionEnd: function t(e) {
                        u["default"](e).trigger(l)
                    },
                    supportsTransitionEnd: function t() {
                        return Boolean(l)
                    },
                    isElement: function t(e) {
                        return (e[0] || e).nodeType
                    },
                    typeCheckConfig: function t(e, n, o) {
                        for (var a in o)
                            if (Object.prototype.hasOwnProperty.call(o, a)) {
                                var s = o[a],
                                    u = n[a],
                                    l = u && Util.isElement(u) ? "element" : i(u);
                                if (!new RegExp(s).test(l)) throw new Error(e.toUpperCase() + ": " + 'Option "' + a + '" provided type "' + l + '" ' + 'but expected type "' + s + '".')
                            }
                    },
                    findShadowRoot: function t(e) {
                        if (!document.documentElement.attachShadow) return null;
                        if ("function" == typeof e.getRootNode) {
                            var n = e.getRootNode();
                            return n instanceof ShadowRoot ? n : null
                        }
                        if (e instanceof ShadowRoot) return e;
                        if (!e.parentNode) return null;
                        else return Util.findShadowRoot(e.parentNode)
                    }
                };
            return s(), Util
        }($), bootstrap.Carousel = function (t, Util) {
            function e(t) {
                return t && "object" == typeof t && "default" in t ? t : {
                    default: t
                }
            }

            function n(t, props) {
                for (var e = 0; e < props.length; e++) {
                    var n = props[e];
                    if (n.enumerable = n.enumerable || false, n.configurable = true, "value" in n) n.writable = true;
                    Object.defineProperty(t, n.key, n)
                }
            }

            function o(t, e, i) {
                if (e) n(t.prototype, e);
                if (i) n(t, i);
                return t
            }

            function a() {
                return a = Object.assign || function (t) {
                    for (var e = 1; e < arguments.length; e++) {
                        var n = arguments[e];
                        for (var i in n)
                            if (Object.prototype.hasOwnProperty.call(n, i)) t[i] = n[i]
                    }
                    return t
                }, a.apply(this, arguments)
            }
            var s = e(t),
                u = e(Util),
                l = "u-carousel",
                c = "4.6.0",
                f = "bs.u-carousel",
                h = "bs.u-carousel.swipe",
                p = "." + f,
                m = ".data-u-api",
                g = s["default"].fn[l],
                v = 37,
                y = 39,
                w = 500,
                b = 40,
                Default = {
                    interval: 5e3,
                    keyboard: true,
                    slide: false,
                    pause: "hover",
                    wrap: true,
                    touch: false,
                    swipe: true
                },
                C = {
                    interval: "(number|boolean)",
                    keyboard: "boolean",
                    slide: "(boolean|string)",
                    pause: "(string|boolean)",
                    wrap: "boolean",
                    touch: "boolean",
                    swipe: "boolean"
                },
                S = "next",
                x = "prev",
                A = "left",
                _ = "right",
                T = "u-slide" + p,
                E = "slid" + p,
                I = "keydown" + p,
                k = "mouseenter" + p,
                M = "mouseleave" + p,
                L = "touchstart" + p,
                P = "touchmove" + p,
                O = "touchend" + p,
                B = "pointerdown" + p,
                F = "pointerup" + p,
                N = "dragstart" + p,
                U = "load" + p + m,
                z = "click" + p + m,
                H = "u-carousel",
                $ = "u-active",
                Y = "u-slide",
                W = "u-carousel-item-right",
                V = "u-carousel-item-left",
                G = "u-carousel-item-next",
                j = "u-carousel-item-prev",
                K = "pointer-event",
                Z = ".u-active",
                X = ".u-active.u-carousel-item",
                J = ".u-carousel-item",
                tt = ".u-carousel-item img",
                nt = ".u-carousel-item-next, .u-carousel-item-prev",
                rt = ".u-carousel-indicators, .u-carousel-thumbnails",
                ot = "[data-u-slide], [data-u-slide-to]",
                at = '[data-u-ride="carousel"]',
                st = {
                    TOUCH: "touch",
                    PEN: "pen"
                },
                Carousel = function () {
                    function Carousel(t, e) {
                        var n = "ontouchstart" in document.documentElement || navigator.maxTouchPoints > 0;
                        this._items = null, this._interval = null, this._activeElement = null, this._isPaused = false, this._isSliding = false, this.touchTimeout = null, this.touchStartX = 0, this.touchDeltaX = 0, this._config = this._getConfig(e), this._element = t, this._indicatorsElement = this._element.querySelector(rt), this._touchSupported = !this._element.matches(".u-form") && n, this._pointerEvent = Boolean(window.PointerEvent || window.MSPointerEvent), this._addEventListeners()
                    }
                    var e = Carousel.prototype;
                    return e.next = function t() {
                        if (!this._isSliding) this._slide(S)
                    }, e.nextWhenVisible = function t() {
                        var e = s["default"](this._element);
                        if (!document.hidden && e.is(":visible") && "hidden" !== e.css("visibility")) this.next()
                    }, e.prev = function t() {
                        if (!this._isSliding) this._slide(x)
                    }, e.pause = function t(e) {
                        if (!e) this._isPaused = true;
                        if (this._element.querySelector(nt)) u["default"].triggerTransitionEnd(this._element), this.cycle(true);
                        clearInterval(this._interval), this._interval = null
                    }, e.cycle = function t(e) {
                        if (!e) this._isPaused = false;
                        if (this._interval) clearInterval(this._interval), this._interval = null;
                        if (this._config.interval && !this._isPaused) this._updateInterval(), this._interval = setInterval((document.visibilityState ? this.nextWhenVisible : this.next).bind(this), this._config.interval)
                    }, e.to = function t(index) {
                        var e = this;
                        this._activeElement = this._element.querySelector(X);
                        var n = this._getItemIndex(this._activeElement);
                        if (!(index > this._items.length - 1 || index < 0)) {
                            if (this._isSliding) return s["default"](this._element).one(E, (function () {
                                return e.to(index)
                            })), void 0;
                            if (n === index) return this.pause(), this.cycle(), void 0;
                            var i = index > n ? S : x;
                            this._slide(i, this._items[index])
                        }
                    }, e.dispose = function t() {
                        if (s["default"](this._element).off(p), s["default"].removeData(this._element, f), s["default"].removeData(this._element, h), this._items = null, this._config = null, this._element = null, this._interval) clearInterval(this._interval);
                        this._interval = null, this._isPaused = null, this._isSliding = null, this._activeElement = null, this._indicatorsElement = null
                    }, e._getConfig = function t(e) {
                        return e = a({}, Default, e), u["default"].typeCheckConfig(l, e, C), e
                    }, e._handleSwipe = function t() {
                        var e = Math.abs(this.touchDeltaX);
                        if (!(e <= b)) {
                            var n = e / this.touchDeltaX;
                            if (this.touchDeltaX = 0, n > 0) this.prev();
                            if (n < 0) this.next()
                        }
                    }, e._addEventListeners = function t() {
                        var e = this;
                        if (this._config.keyboard) s["default"](this._element).on(I, (function (t) {
                            return e._keydown(t)
                        }));
                        if ("hover" === this._config.pause) s["default"](this._element).on(k, (function (t) {
                            return e.pause(t)
                        })).on(M, (function (t) {
                            return e.cycle(t)
                        }));
                        if (this._config.touch) this._addTouchEventListeners()
                    }, e._addTouchEventListeners = function t() {
                        var e = this;
                        if (this._touchSupported) {
                            var n = function t(n) {
                                    if (e._pointerEvent && st[n.originalEvent.pointerType.toUpperCase()]) e.touchStartX = n.originalEvent.clientX;
                                    else if (!e._pointerEvent) e.touchStartX = n.originalEvent.touches[0].clientX
                                },
                                move = function move(t) {
                                    if (t.originalEvent.touches && t.originalEvent.touches.length > 1) e.touchDeltaX = 0;
                                    else e.touchDeltaX = t.originalEvent.touches[0].clientX - e.touchStartX
                                },
                                i = function t(n) {
                                    if (e._pointerEvent && st[n.originalEvent.pointerType.toUpperCase()]) e.touchDeltaX = n.originalEvent.clientX - e.touchStartX;
                                    if (e._handleSwipe(), "hover" === e._config.pause) {
                                        if (e.pause(), e.touchTimeout) clearTimeout(e.touchTimeout);
                                        e.touchTimeout = setTimeout((function (t) {
                                            return e.cycle(t)
                                        }), w + e._config.interval)
                                    }
                                };
                            if (s["default"](this._element.querySelectorAll(tt)).on(N, (function (t) {
                                    return t.preventDefault()
                                })), this._pointerEvent) s["default"](this._element).on(B, (function (t) {
                                return n(t)
                            })), s["default"](this._element).on(F, (function (t) {
                                return i(t)
                            })), this._element.classList.add(K);
                            else s["default"](this._element).on(L, (function (t) {
                                return n(t)
                            })), s["default"](this._element).on(P, (function (t) {
                                return move(t)
                            })), s["default"](this._element).on(O, (function (t) {
                                return i(t)
                            }))
                        }
                    }, e._keydown = function t(e) {
                        if (!/input|textarea/i.test(e.target.tagName)) switch (e.which) {
                            case v:
                                e.preventDefault(), this.prev();
                                break;
                            case y:
                                e.preventDefault(), this.next();
                                break
                        }
                    }, e._getItemIndex = function t(e) {
                        return this._items = e && e.parentNode ? [].slice.call(e.parentNode.querySelectorAll(J)) : [], this._items.indexOf(e)
                    }, e._getItemByDirection = function t(e, n) {
                        var i = e === S,
                            o = e === x,
                            a = this._getItemIndex(n),
                            s = this._items.length - 1,
                            u;
                        if ((o && 0 === a || i && a === s) && !this._config.wrap) return n;
                        var l, c = (a + (e === x ? -1 : 1)) % this._items.length;
                        return -1 === c ? this._items[this._items.length - 1] : this._items[c]
                    }, e._triggerSlideEvent = function t(e, n) {
                        var i = this._getItemIndex(e),
                            o = this._getItemIndex(this._element.querySelector(X)),
                            a = s["default"].Event(T, {
                                relatedTarget: e,
                                direction: n,
                                from: o,
                                to: i
                            });
                        return s["default"](this._element).trigger(a), a
                    }, e._setActiveIndicatorElement = function t(e) {
                        if (this._indicatorsElement) {
                            var n = [].slice.call(this._indicatorsElement.querySelectorAll(Z));
                            s["default"](n).removeClass($);
                            var i = this._indicatorsElement.children[this._getItemIndex(e)];
                            if (i) s["default"](i).addClass($)
                        }
                    }, e._updateInterval = function t() {
                        var e = this._activeElement || this._element.querySelector(X);
                        if (e) {
                            var n = parseInt(e.getAttribute("data-interval"), 10);
                            if (n) this._config.defaultInterval = this._config.defaultInterval || this._config.interval, this._config.interval = n;
                            else this._config.interval = this._config.defaultInterval || this._config.interval
                        }
                    }, e._slide = function e(n, i) {
                        var o = this,
                            a = this._element.querySelector(X),
                            l = this._getItemIndex(a),
                            c = i || a && this._getItemByDirection(n, a),
                            f = this._getItemIndex(c),
                            h = Boolean(this._interval),
                            p, m, g, v;
                        if (n === S) p = V, m = G, g = A;
                        else p = W, m = j, g = _;
                        if (c && s["default"](c).hasClass($)) return this._isSliding = false, void 0;
                        if (!this._triggerSlideEvent(c, g).isDefaultPrevented())
                            if (a && c) {
                                if (this._isSliding = true, h) this.pause();
                                this._setActiveIndicatorElement(c), this._activeElement = c;
                                var y = s["default"].Event(E, {
                                        relatedTarget: c,
                                        direction: g,
                                        from: l,
                                        to: f
                                    }),
                                    w = null;
                                if (s["default"](this._element).hasClass(H)) {
                                    s["default"](c).addClass(m), u["default"].reflow(c), s["default"](a).addClass(p), s["default"](c).addClass(p);
                                    var b = u["default"].getTransitionDurationFromElement(a),
                                        C = this._element.className,
                                        x = /u-carousel-duration-(\d+)/.exec(C);
                                    if (x && 2 === x.length) b = parseFloat(x[1]) || 0;
                                    if (h) {
                                        var T = parseFloat(t(this._element).attr("data-interval")) + b;
                                        if (Number.isFinite(T) && T > 0) w = this._config.interval, this._config.interval = T
                                    }
                                    s["default"](a).one(u["default"].TRANSITION_END, (function () {
                                        s["default"](c).removeClass(p + " " + m).addClass($), s["default"](a).removeClass($ + " " + m + " " + p), o._isSliding = false, setTimeout((function () {
                                            return s["default"](o._element).trigger(y)
                                        }), 0)
                                    })).emulateTransitionEnd(b)
                                } else s["default"](a).removeClass($), s["default"](c).addClass($), this._isSliding = false, s["default"](this._element).trigger(y);
                                if (h) this.cycle();
                                if (w) this._config.interval = w
                            }
                    }, Carousel._jQueryInterface = function t(e) {
                        return this.each((function () {
                            var data = s["default"](this).data(f),
                                t = a({}, Default, s["default"](this).data());
                            if ("object" == typeof e) t = a({}, t, e);
                            var n = "string" == typeof e ? e : t.uSlide;
                            if (!data) {
                                var o;
                                if (data = new Carousel(this, t), s["default"](this).data(f, data), !s["default"](this).data(h)) s["default"](this).data(h, new i(this, t))
                            }
                            if ("number" == typeof e) data.to(e);
                            else if ("string" == typeof n) {
                                if (void 0 === data[n]) throw new TypeError('No method named "' + n + '"');
                                data[n]()
                            } else if (t.interval && t.uRide) data.pause(), data.cycle()
                        }))
                    }, Carousel._dataApiClickHandler = function t(e) {
                        var selector = u["default"].getSelectorFromElement(this);
                        if (selector) {
                            var n = s["default"](selector)[0];
                            if (n && s["default"](n).hasClass(H)) {
                                var i = a({}, s["default"](n).data(), s["default"](this).data()),
                                    o = this.getAttribute("data-u-slide-to");
                                if (o) i.interval = false;
                                if (Carousel._jQueryInterface.call(s["default"](n), i), o) s["default"](n).data(f).to(o);
                                e.preventDefault()
                            }
                        }
                    }, o(Carousel, null, [{
                        key: "VERSION",
                        get: function t() {
                            return c
                        }
                    }, {
                        key: "Default",
                        get: function t() {
                            return Default
                        }
                    }]), Carousel
                }();
            return s["default"](document).on(z, ot, Carousel._dataApiClickHandler), s["default"](window).on(U, (function () {
                for (var t = [].slice.call(document.querySelectorAll(at)), e = 0, n = t.length; e < n; e++) {
                    var i = s["default"](t[e]);
                    Carousel._jQueryInterface.call(i, i.data())
                }
            })), s["default"].fn[l] = Carousel._jQueryInterface, s["default"].fn[l].Constructor = Carousel, s["default"].fn[l].noConflict = function () {
                return s["default"].fn[l] = g, Carousel._jQueryInterface
            }, Carousel
        }($, bootstrap.Util), window.bootstrap = bootstrap
    },
    904: function (t, e, n) {
        "use strict";

        function i(t) {
            if (this.$element = o(t), this.carousel = this.$element.data("bs.u-carousel"), this.options = o.extend({}, i.DEFAULTS, this.carousel._config), this.startX = null, this.startY = null, this.startTime = null, this.cycling = null, this.$active = null, this.$items = null, this.$next = null, this.$prev = null, this.dx = null, this.sliding = false, !this.$element.hasClass("u-form")) this.$element.on("touchstart.bs.u-carousel", this.touchstart.bind(this)).on("touchmove.bs.u-carousel", this.touchmove.bind(this)).on("touchend.bs.u-carousel", this.touchend.bind(this)).on("u-slide.bs.u-carousel", this.startSliding.bind(this)).on("slid.bs.u-carousel", this.stopSliding.bind(this))
        }
        t.exports = i;
        var o = n(15);
        i.DEFAULTS = {
            swipe: 50
        }, i.prototype.startSliding = function () {
            this.sliding = true
        }, i.prototype.stopSliding = function () {
            this.sliding = false
        }, i.prototype.touchstart = function (t) {
            if (!this.sliding && this.options.swipe) {
                var e = t.originalEvent.touches ? t.originalEvent.touches[0] : t;
                this.dx = 0, this.startX = e.pageX, this.startY = e.pageY, this.cycling = null, this.width = this.$element.width(), this.startTime = t.timeStamp
            }
        }, i.prototype.touchmove = function (t) {
            if (!this.sliding && this.options.swipe && this.startTime) {
                var e = t.originalEvent.touches ? t.originalEvent.touches[0] : t,
                    n = e.pageX - this.startX,
                    i = e.pageY - this.startY;
                if (!(Math.abs(n) < Math.abs(i))) {
                    if (null === this.cycling)
                        if (this.cycling = !!this.carousel.interval, this.cycling) this.carousel.pause();
                    t.preventDefault(), this.dx = n / (this.width || 1) * 100, this.swipe(this.dx)
                }
            }
        }, i.prototype.touchend = function (t) {
            if (!this.sliding && this.options.swipe && this.startTime)
                if (this.$active) {
                    var all = o().add(this.$active).add(this.$prev).add(this.$next).carousel_transition(true),
                        e = (t.timeStamp - this.startTime) / 1e3,
                        n = Math.abs(this.dx / e);
                    if (this.dx > 40 || this.dx > 0 && n > this.options.swipe) this.carousel.prev();
                    else if (this.dx < -40 || this.dx < 0 && n > this.options.swipe) this.carousel.next();
                    else this.$active.one(o.support.transition.end, (function () {
                        all.removeClass("u-carousel-item-prev u-carousel-item-next")
                    })).emulateTransitionEnd(1e3 * this.$active.css("transition-duration").slice(0, -1));
                    if (all.css("transform", ""), this.cycling) this.carousel.cycle();
                    this.$active = null, this.startTime = null
                }
        }, i.prototype.swipe = function (t) {
            var e = this.$active || this.getActive();
            if (t < 0) {
                if (this.$prev.css("transform", "translate3d(0,0,0)").removeClass("u-carousel-item-prev").carousel_transition(true), !this.$next.length || this.$next.hasClass("u-active")) return;
                this.$next.carousel_transition(false).addClass("u-carousel-item-next").css("transform", "translate3d(" + (t + 100) + "%,0,0)")
            } else {
                if (this.$next.css("transform", "").removeClass("u-carousel-item-next").carousel_transition(true), !this.$prev.length || this.$prev.hasClass("u-active")) return;
                this.$prev.carousel_transition(false).addClass("u-carousel-item-prev").css("transform", "translate3d(" + (t - 100) + "%,0,0)")
            }
            e.carousel_transition(false).css("transform", "translate3d(" + t + "%, 0, 0)")
        }, i.prototype.getActive = function () {
            if (this.$active = this.$element.find(".u-carousel-item.u-active"), this.$items = this.$active.parent().children(), this.$next = this.$active.next(), !this.$next.length && this.options.wrap) this.$next = this.$items.first();
            if (this.$prev = this.$active.prev(), !this.$prev.length && this.options.wrap) this.$prev = this.$items.last();
            return this.$active
        }, o.fn.carousel_transition = function (t) {
            return t = t ? "" : "none", this.each((function () {
                o(this).css("transition", t)
            }))
        }
    },
    921: function (t, e, n) {
        "use strict";

        function i(t) {
            var data = t.attr("data-map");
            if (data) {
                data = Utility.decodeJsonAttribute(data);
                var e = t.contents()[0],
                    n = e.createElement("script");
                n.type = "text/javascript", n.innerHTML = "var data = " + JSON.stringify(data) + ";\n;" + "var mapIframeApiReady = function () {\n" + '   parent.mapIframeApiReady(google, document.getElementById("map"), data);\n' + "}";
                var i = e.createElement("script");
                if (i.type = "text/javascript", i.src = "//maps.google.com/maps/api/js?key=" + data.apiKey + "&callback=mapIframeApiReady", data.lang) i.src += "&language=" + data.lang;
                e.head.appendChild(n), e.head.appendChild(i), $(e.body).append("<style>" + "   #map { width: 100%; height: 100%; }" + "   body { margin: 0; }" + "   .marker-internal { width: 180px; font-weight: normal; }" + "   .marker-internal a { text-decoration: none; color:#427fed; }" + "   .marker-internal strong { font-weight: 500; font-size: 14px; }" + "</style>" + '<div id="map"></div>')
            }
        }

        function o(t) {
            var e = "";
            if (t.title) e += "<strong>" + t.title + "</strong>";
            if (t.description) e += "<div>" + t.description.replace(/\n/g, "<br>") + "</div>";
            if (t.linkUrl) {
                var url, n;
                e += '<a href="' + t.linkUrl + '" target="_blank"><span>' + (t.linkCaption || t.linkUrl) + "</span></a>"
            }
            if (e) e = '<div class="marker-internal">' + e + "</div>";
            return e
        }
        var MapsLoader = {};
        window.loadMapsContent = function () {
            $("iframe.map-content").each((function () {
                var t = $(this);
                if (0 === t.contents().find("#map").length) i(t)
            }))
        }, window.mapIframeApiReady = function (google, t, data) {
            data.markers = data.markers || [];
            var e = data.zoom;
            if (!e && 1 === data.markers.length) e = data.markers[0].zoom;
            if (!e) e = 14;
            if (e = parseInt(e, 10), data.map = data.map || {}, data.map.zoom = e, data.map.mapTypeId = "satellite" === data.typeId ? google.maps.MapTypeId.HYBRID : google.maps.MapTypeId.ROADMAP, data.markers.length) data.map.center = data.markers[0].position;
            var map = new google.maps.Map(t, data.map || {}),
                n = new google.maps.LatLngBounds;
            if (data.markers.forEach((function (t) {
                    t.map = map;
                    var e = new google.maps.Marker(t);
                    n.extend(new google.maps.LatLng(t.position.lat, t.position.lng));
                    var i = o(t);
                    if (i) {
                        var a = new google.maps.InfoWindow({
                            content: $("<textarea/>").html(i).text()
                        });
                        e.addListener("click", (function () {
                            a.open(e.get("map"), e)
                        }))
                    }
                })), data.markers.length > 1 && e && !isNaN(e)) {
                map.fitBounds(n);
                var i = google.maps.event.addListener(map, "zoom_changed", (function () {
                    if (google.maps.event.removeListener(i), map.getZoom() > e || 0 === map.getZoom()) map.setZoom(e)
                }))
            }
        }, window.MapsLoader = MapsLoader
    },
    922: function (t, e, n) {
        "use strict";

        function ResponsiveMenu(t, e) {
            this.responsive = t, this.root = e || i("body"), this.init()
        }
        t.exports = ResponsiveMenu;
        var i = window.jQuery;
        ResponsiveMenu.prototype.init = function init() {
            if (this.root.is("body")) this.subscribe();
            this.initStyles()
        }, ResponsiveMenu.prototype.subscribe = function t() {
            this.root.on("click", ".u-menu .menu-collapse", function (t) {
                t.preventDefault();
                var e = i(t.currentTarget).closest(".u-menu");
                if (ResponsiveMenu.isActive(e)) this.close(e);
                else this.open(e)
            }.bind(this)), this.root.on("click", ".u-menu .u-menu-close", function (t) {
                t.preventDefault();
                var e = i(t.currentTarget).closest(".u-menu");
                this.close(e)
            }.bind(this)), this.root.on("click", ".u-menu .u-menu-overlay", function (t) {
                var e = i(t.currentTarget).closest(".u-menu.open");
                this.close(e)
            }.bind(this)), this.root.find(".u-menu").on("click", ".u-nav-container-collapse .u-nav-link", function (t) {
                var e = i(t.currentTarget),
                    n;
                if (!e.siblings(".u-nav-popup").length) {
                    var o = e.attr("href");
                    if (o && -1 !== o.indexOf("#")) {
                        var a = i(t.currentTarget).closest(".u-menu");
                        this.close(a)
                    }
                }
            }.bind(this)), this.root.find(".u-menu:not(.u-menu-one-level)").on("click", ".u-nav-container-collapse .u-nav-link", (function (t) {
                var e = i(t.currentTarget).siblings(".u-nav-popup"),
                    nav, n = e.closest(".u-menu").attr("data-submenu-level") || "on-click";
                if (e.length && "on-click" === n) {
                    t.preventDefault(), t.stopPropagation(), t.returnValue = false, e.one("transitionend webkitTransitionEnd oTransitionEnd", (function (t) {
                        t.stopPropagation(), e.removeClass("animating"), e.toggleClass("open"), e.css({
                            "max-height": e.is(".open") ? "none" : "",
                            visibility: ""
                        }), e.find(".open").removeClass("open").css("max-height", "")
                    })), e.css({
                        "max-height": "none",
                        visibility: "visible"
                    });
                    var o = e.outerHeight();
                    e.css("max-height", e.is(".open") ? o : 0), e.addClass("animating"), e[0].offsetHeight, e.css("max-height", e.is(".open") ? 0 : o)
                }
                if (e.length && "with-reload" === n)
                    if (i(this).attr("href") && i(this).attr("href").indexOf("#") > -1)
                        if (window.location.href.indexOf(i(this).attr("href")) > -1) window.location.reload(true);
                        else window.location = i(this).attr("href")
            })), i(window).on("resize", function () {
                if (this.screenWidth !== window.innerWidth) i(".u-menu.open").each(function (t, el) {
                    this.close(i(el))
                }.bind(this))
            }.bind(this)), i(document).keyup(function (t) {
                if (27 === t.keyCode) i(".u-menu.open").each(function (t, el) {
                    this.close(i(el))
                }.bind(this))
            }.bind(this)), i(this.root).on("mouseenter touchstart", ".u-nav-container ul > li", function (t) {
                ResponsiveMenu.fixDirection(this.root, i(t.currentTarget))
            }.bind(this))
        }, ResponsiveMenu.prototype.initStyles = function t() {
            this.root.find(".u-menu").each((function () {
                var menu = i(this),
                    style = menu.find(".offcanvas-style"),
                    t = menu.find(".u-nav-container-collapse .u-sidenav").attr("data-offcanvas-width") || 250;
                if (!style.length) style = i('<style class="offcanvas-style"></style>'), menu.append(style);
                style.html("            .u-offcanvas .u-sidenav { flex-basis: {width} !important; }            .u-offcanvas:not(.u-menu-open-right) .u-sidenav { margin-left: -{width}; }            .u-offcanvas.u-menu-open-right .u-sidenav { margin-right: -{width}; }            @keyframes menu-shift-left    { from { left: 0;        } to { left: {width};  } }            @keyframes menu-unshift-left  { from { left: {width};  } to { left: 0;        } }            @keyframes menu-shift-right   { from { right: 0;       } to { right: {width}; } }            @keyframes menu-unshift-right { from { right: {width}; } to { right: 0;       } }            ".replace(/\{width\}/g, t + "px"))
            }))
        }, ResponsiveMenu.prototype.onResponsiveResize = function t() {
            i(".u-menu").each(function (t, el) {
                var e = i(el).attr("data-responsive-from") || "MD",
                    n = this.responsive.modes.indexOf(e);
                if (-1 === n) n = 0;
                var o = this.responsive.modes.slice(n);
                ResponsiveMenu.toggleResponsive(el, -1 !== o.indexOf(this.responsive.mode)), this.megaResize(el, 1)
            }.bind(this))
        }, ResponsiveMenu.toggleResponsive = function t(e, n) {
            i(e).toggleClass("u-enable-responsive", n)
        }, ResponsiveMenu.prototype.close = function close(menu, t) {
            if (!window.app || !window.app.modes) {
                if (ResponsiveMenu.isActive(menu)) this.closeMenu(menu, t)
            } else if (this.closeMenu(menu, t), this.setOverlayOpacity(menu), ResponsiveMenu.isOffcanvasMode(menu)) app.modes().resetOffCanvas()
        }, ResponsiveMenu.prototype.closeMenu = function t(menu, e) {
            if (this.enableScroll(), ResponsiveMenu.isOffcanvasMode(menu)) this.offcanvasMenuClose(menu);
            else this.overlayMenuClose(menu);
            this.root.removeClass("menu-overlay"), this.hideOverlay(menu, e)
        }, ResponsiveMenu.prototype.open = function open(menu) {
            if (this.root.addClass("menu-overlay"), !window.app || !window.app.modes) {
                if (!ResponsiveMenu.isActive(menu)) this.openMenu(menu)
            } else if (this.setOverlayOpacity(menu), this.openMenu(menu), ResponsiveMenu.isOffcanvasMode(menu)) app.modes().setOffCanvas()
        }, ResponsiveMenu.prototype.setOverlayOpacity = function t(menu) {
            menu.find(".u-menu-overlay").css("opacity", "")
        }, ResponsiveMenu.prototype.openMenu = function open(menu) {
            if (this.screenWidth = window.innerWidth, this.disableScroll(), ResponsiveMenu.isOffcanvasMode(menu)) this.offcanvasMenuOpen(menu);
            else this.overlayMenuOpen(menu);
            this.showOverlay(menu)
        }, ResponsiveMenu.prototype.offcanvasMenuOpen = function t(menu) {
            var e = this.root;
            if (menu.addClass("open"), e.addClass("u-offcanvas-opened"), menu.is(".u-offcanvas-shift")) e.addClass("u-offcanvas-shifted-" + (menu.hasClass("u-menu-open-right") ? "right" : "left"))
        }, ResponsiveMenu.prototype.offcanvasMenuClose = function t(menu) {
            if (menu.removeClass("open"), this.root.removeClass("u-offcanvas-opened u-offcanvas-shifted-left u-offcanvas-shifted-right"), menu.is(".u-offcanvas-shift")) this.root.addClass("u-offcanvas-unshifted-" + (menu.hasClass("u-menu-open-right") ? "right" : "left"))
        }, ResponsiveMenu.prototype.megaResize = function t(menu, e) {
            if (menu = i(menu), e = e || 1, menu.hasClass("u-menu-mega")) menu.outerHeight(), menu.each((function () {
                var menu = i(this);
                menu.find(".u-mega-popup").each((function () {
                    var t = i(this),
                        n = t.attr("data-mega-width") || "content";
                    if ("custom" !== n && "content" !== n) {
                        var o = "sheet" === n ? menu.closest(".u-sheet, .u-body") : menu.closest("body, .u-body"),
                            a = o.offset(),
                            s = o.outerWidth();
                        if (t.css({
                                left: "",
                                width: ""
                            }), t.removeClass("u-popup-left u-popup-right"), t.addClass("u-hidden"), menu.outerHeight(), t.removeClass("u-hidden"), menu.outerHeight(), "content" === n) return t.css("width", "auto"), void 0;
                        var u = t.offset(),
                            l = (a.left - u.left) / e,
                            c = parseFloat(t.css("left") || 0);
                        t.css({
                            left: c + Math.round(l) + "px",
                            width: s + "px"
                        })
                    }
                }))
            }))
        }, ResponsiveMenu.prototype.hideOverlay = function t(menu, e) {
            var overlay = menu.find(".u-menu-overlay"),
                n = function () {
                    if (!ResponsiveMenu.isActive(menu)) menu.find(".u-nav-container-collapse").css("width", ""), this.root.filter("body").find("header.u-sticky").css("top", "")
                }.bind(this);
            if (e) n();
            else overlay.fadeOut(500, n)
        }, ResponsiveMenu.prototype.showOverlay = function t(menu) {
            var overlay = menu.find(".u-menu-overlay");
            menu.find(".u-nav-container-collapse").css("width", "100%"), overlay.fadeIn(500)
        }, ResponsiveMenu.prototype.disableScroll = function t() {
            if (this.root.is("body")) document.documentElement.style.overflow = "hidden"
        }, ResponsiveMenu.prototype.enableScroll = function t() {
            if (this.root.is("body")) document.documentElement.style.overflow = ""
        }, ResponsiveMenu.prototype.overlayMenuOpen = function t(menu) {
            menu.addClass("open")
        }, ResponsiveMenu.prototype.overlayMenuClose = function t(menu) {
            menu.removeClass("open")
        }, ResponsiveMenu.isOffcanvasMode = function (menu) {
            return menu.is(".u-offcanvas")
        }, ResponsiveMenu.isActive = function (menu) {
            return menu.hasClass("open")
        }, ResponsiveMenu.fixDirection = function t(e, el) {
            if (el && el.length) {
                e = i(e);
                var n = "u-popup-left",
                    o = "u-popup-right",
                    a;
                i(el).children(".u-nav-popup").each((function () {
                    var t = i(this);
                    t.removeClass(n + " " + o);
                    var a = t.parent().closest(".u-nav-popup"),
                        s = t.attr("data-mega-width") || "content",
                        u = Boolean(a.length);
                    if ("content" === s) {
                        var l = "";
                        if (t.parents("." + n).length) l = n;
                        else if (t.parents("." + o).length) l = o;
                        if (l) t.addClass(l);
                        else {
                            var c = t[0].getBoundingClientRect(),
                                f = e[0].getBoundingClientRect(),
                                h = "undefined" == typeof app ? 1 : app.editor.preview.scale,
                                p = c.right - f.right,
                                m = f.left - c.left;
                            if (p > 1) t.css("left", u ? "" : (f.right - c.right) / h + "px"), t.css("right", u ? "" : "auto"), t.addClass(n);
                            else if (m > 1) t.css("left", u ? "" : "0px"), t.css("right", u ? "" : "auto"), t.addClass(o)
                        }
                    }
                }))
            }
        }, window.ResponsiveMenu = ResponsiveMenu
    },
    943: function (t, e, n) {
        "use strict";
        var i = n(15),
            ProductBadge;
        t.exports.update = function update(t) {
            if (!t || !t.length) t = i(".u-product-badge[data-product-created]");
            t.each((function () {
                var t = i(this),
                    e = t.attr("data-product-created"),
                    n, o;
                if (Date.now() - e <= 30 * (60 * 60 * 24 * 1e3)) t.removeClass("u-hidden-block")
            }))
        }
    },
    944: function (t, e, n) {
        "use strict";

        function i() {
            this.$cart = $(".u-shopping-cart-icon").parent('.u-shopping-cart[href^="#"]')
        }
        var o = n(12115);
        t.exports = i;
        var cart = null;
        i.getCart = function () {
            if (!cart) cart = new i;
            return cart
        }, i.prototype.init = function init(data) {
            var t = this.getProducts(),
                products = data.products,
                e = data.categories;
            if (t && products && products.length) {
                var n = [];
                t.forEach(function (product) {
                    var index = products.findIndex((function (t) {
                        return product.id === t.id
                    }));
                    if (-1 !== index) {
                        var t = products[index];
                        if (t.quantity = product.quantity || 1, !t.categoriesData) t.categoriesData = this.getCategoriesData(t.categories, e);
                        n.push(t)
                    }
                }.bind(this)), this.addProducts(n)
            }
            this.update()
        }, i.prototype.getCategoriesData = function t(productCategories, e) {
            var n = [],
                i = (document.body.getAttribute("data-path-to-root") || "./") + "products/products.html#/1///";
            if ((productCategories || []).forEach((function (id) {
                    var t = e.find((function (t) {
                        return t.id === id
                    }));
                    if (t) n.push({
                        link: i + t.id,
                        title: t.title
                    })
                })), !n.length) n.push({
                link: i,
                title: "Uncategorized"
            });
            return n
        }, i.prototype.clear = function t() {
            o.remove(), this.update()
        }, i.prototype.update = function update() {
            if (this.$cart.length) this.$cart.find(".u-shopping-cart-count").text(this.count())
        }, i.prototype.count = function t() {
            var products = this.getProducts();
            if (!products) return 0;
            else return products.reduce((function (t, product) {
                return t + product.quantity
            }), 0)
        }, i.prototype.addProduct = function addProduct(product) {
            var products = this.getProducts() || [],
                t = product.name,
                e = products.filter((function (el) {
                    return el.name === t
                }))[0];
            if (e) e.quantity += 1;
            else products.push(product);
            this.addProducts(products), this.update()
        }, i.prototype.addProducts = function addProduct(products) {
            o.add(JSON.stringify(products))
        }, i.prototype.getProducts = function t() {
            var storage = o.get();
            if (!storage) return null;
            else return JSON.parse(storage)
        }, i.prototype.removeProductById = function t(id) {
            var products, e = (this.getProducts() || []).filter((function (product) {
                return product.id !== id
            }));
            if (!e.length) this.clear();
            else this.addProducts(e);
            this.update()
        }, window.PaymentCart = i
    }
});